The roots of $7x^2 + x - 5 = 0$ are $a$ and $b.$ Compute $(a - 4)(b - 4).$[tex]The roots of $7x^2 + x - 5 = 0$ are $a$ and $b.$ Compute $(a - 4)(b - 4).$[/tex]

Answers

Answer 1

Using the factor theorem, we have

[tex]7x^2+x-5=7(x-a)(x-b)[/tex]

and expanding gives us

[tex]7x^2+x-5=7(x^2-(a+b)x+ab)\implies\begin{cases}ab=-5\\a+b=-1\end{cases}[/tex]

So we have

[tex](a-4)(b-4)=ab-4(a+b)+16=-5-4(-1)+16=\boxed{15}[/tex]


Related Questions

224,112,56,28 what are the two next answers?

Answers

Answer:

14,7

Step-by-step explanation: if it is being divided by 2 it is 14 and 7

You give me answer=BRAINLIEST

Answers

Answer:

A. 2

Step-by-step explanation:

Well let’s first graph the following,

[tex]x^2 + y = 8[/tex]

[tex]x=y[/tex]

So on the graph the system of equations only have 2 real solutions which are

(-3.272, -3.272) (2.372,2.372)

if cos 0=2/3, what are the values of sin 0 and tan 0?

Answers

Answer:

Below

Step-by-step explanation:

● cos O = 2/3

We khow that:

● cos^2(O) + sin^2(O) =1

So : sin^2 (O)= 1-cos^2(O)

● sin^2(O) = 1 -(2/3)^2 = 1-4/9 = 9/9-4/9 = 5/9

● sin O = √(5)/3 or sin O = -√(5)/3

So we deduce that tan O will have two values since we don't khow the size of O.

■■■■■■■■■■■■■■■■■■■■■■■■■

●Tan (O) = sin(O)/cos(O)

● tan (O) = (√(5)/3)÷(2/3) or tan(O) = (-√(5)/3)÷(2/3)

● tan (O) = √(5)/2 or tan(O) = -√(5)/2

Determine the parent function.

Answers

Answer:

y= [tex]\sqrt{x}[/tex]

Step-by-step explanation:

IF U DO THIS FOR ME I WILL GIVE U TONS OF POINTS PLSSSS HELP AND DO THE WHOLE THING :)

Instructions
Search your home for a rectangular prism. Some examples are a cereal box, a CD case, or a coffee table.
Measure your prism using appropriate units, such as inches, centimeters, or feet.
Complete the following.
Show all work for calculations. List the dimensions of your box. Be sure to include the units (in, cm, ft, etc.). Describe the shape of the cross section when the box is cut parallel to the base.
What is the surface area of the box? What is the surface area of the box if it is scaled up by a factor of 10?
What is the volume of the box?
What is the volume of the box if it is scaled down by a factor of 1 over 10?

Answers

Answer:

Some examples are a cereal box, a CD case, or a coffee table. Measure your prism using appropriate units, such as inches, centimeters, or feet. ... If you are using a ruler with a centimeter (cm) scale, then your units are going to be in cm, and if you ... We have to do the same thing to volume like we did with the surface area.

:)

Answer:

Rectangular prism

I chose a box of cereal.

Part 1)List the dimensions of your box. Be sure to include the units (in, cm, ft, etc.).

Length: 20 cm

Width: 8 cm

Height: 32 cm

Part 2).

 Describe the shape of the cross-section when the box is cut parallel to the base.

The shape of the cross-section would be a rectangle in dimensions.

20 cm x 8 cm

Part 3)

What is the surface area of the box? 

surface area=2*area of the base + perimeter of the base*height

area of the base=20*8=160 cm²

perimeter of the base=2*[20+8]-----> 56 cm

height=32 cm

surface area=2*160+56*32------> 2,112 cm²

the answer part 3) is

2,112 cm²

Part 4)

What is the surface area of the box if it is scaled up by a factor of 10?

we know that

surface area of the larger box =[scale factor]²*surface area original box

scale factor=10

surface area original box=2,112 cm²

so

surface area of the larger box=10²*2,112-----> 211,200 cm²

the answer part 4) is

211,200 cm²

Part 5) 

What is the volume of the box?

volume of the box = L*W*H 20*8*32-5,120 cm³

the answer Part 5) is

5,120 cm³

Part 6) 

What is the volume of the box if it is scaled down by a factor of 1/10?

we know that

the volume of the smaller box =[scale factor]³volume original box

scale factor=1/10

volume original box=5,120 cm³

so

volume of the smaller box =[1/10]³*5,120 5.12 cm³

the answer part 6) is

5.12 cm³

The length is 6 in., the width is 2 in., and the height is 16 in.

Instructions: Find the measure of the indicated angle to the
nearest degree

Answers

Answer:

See below.

Step-by-step explanation:

We want to find the unknown angle and we know the sides opposite to it and the hypotenuse. Therefore, we can use sine.

Recall that sine is the ratio of the opposite to the hypotenuse:

[tex]\sin(\theta)=opp/hyp[/tex]

Plug in the numbers. The opposite is 20 and the hypotenuse is 55.

[tex]\sin(\theta)=20/55[/tex]

Solve for theta (use a calculator):

[tex]\sin(\theta)=20/55\\\theta=\arcsin(4/11)\\\theta\approx21.23\approx21\textdegree[/tex]

y=6x 2x+3y=20 solving equation using substitution

Answers

Answer:

x = 1, y = 6

Step-by-step explanation:

y = 6x

2x + 3y = 20

Plug y as 6x in the second equation and solve for x.

2x + 3(6x) = 20

2x + 18x = 20

20x = 20

[tex]\frac{20x}{20}= \frac{20}{20}[/tex]

x = 1

Plug x as 1 in the first equation and solve for y.

y = 6(1)

y = 6

Answer:

y=6 , x=1

Step-by-step explanation:

y=6x

2x+3y=20

Substitute 6x into y because y=6x.

2x+3(6x)=20

2x+18x=20

20x=20

x=1

Then subsitiute 1 into the first equation in x value

y=6(1)

y=6


The surface area of this rectangular prism is_____square centimeters.​

Answers

I think the answer is 69

Answer:

Find the area of all the shapes

Length x width = area

10 x 3 = 30

6 x 3 = 18

6 x 3 = 18

6 x 10 = 60

3 x 10 = 30

6 x 10 = 60

Add them all up

30 + 18 + 18 + 60 + 30 + 60 = 216 cm^2

Hope this helps

Step-by-step explanation:

The makers of Mini-Oats cereal have an automated packaging machine that is set to fill boxes with 24.3 ounces of cereal (as labeled on the box). At various times in the packaging process, we select a random sample of 100 boxes to see if the machine is (on average) filling the boxes as labeled. On Tuesday morning, at 7:45 a.m., a random sample of 100 boxes produced an average amount of 23.6 ounces. Which of the following is an appropriate statement of the null hypothesis?
A) The machine fills the boxes with the proper amount of cereal.
B) The average is 24.3 ounces (H0: μ = 24.3)
C) The machine is not filling the boxes with the proper amount of cereal (H0: μ ≠ 24.3 ounces).
D) The machine is not putting enough cereal in the boxes.
E) The average is less than 24.3 ounces (H0: μ < 24.3).
F) The machine fills the boxes with an average of 23.6 ounces (H0: μ = 23.6).

Answers

Answer:

B.

Step-by-step explanation:

The null hypothesis will say that the mean is equal to what it is supposed to be. In this case, each box is supposed to have 24.3 ounces of cereal.

So, your null hypothesis would be that the average is equal to 24.3, or H₀ = 24.3. B.

Hope this helps!

Please answer this in two minutes


Answers

Answer:

x = 5.7 units

Step-by-step explanation:

By applying Sine rule is the triangle XYZ,

[tex]\frac{\text{SinX}}{\text{WY}}=\frac{\text{SinY}}{\text{WX}}=\frac{\text{SinW}}{\text{XY}}[/tex]

[tex]\frac{\text{SinX}}{\text{x}}=\frac{\text{SinY}}{\text{y}}=\frac{\text{SinW}}{\text{10}}[/tex]

[tex]\frac{\text{Sin33}}{\text{x}}=\frac{\text{SinY}}{\text{y}}=\frac{\text{Sin107}}{\text{10}}[/tex]

[tex]\frac{\text{Sin33}}{\text{x}}=\frac{\text{Sin107}}{\text{10}}[/tex]

[tex]x=\frac{10\times(\text{Sin33})}{\text{(Sin107)}}[/tex]

x = 5.69

x ≈ 5.7 units

Suppose you are designing a cardboard box that must have a volume of cubic feet. The cost of the cardboard is ​$ per square foot. What is the most economical design for the box​ (one that minimizes the​ cost), and how much will the material in each box​ cost?

Answers

Answer:

hello your question lacks some information below is the complete question

Suppose you are designing a cardboard box that must have a volume of  27 cubic feet. The cost of the cardboard is ​$0.15 per square foot. What is the most economical design for the box​ (one that minimizes the​ cost), and how much will the material in each box​ cost?

Answer : Box design , $8.1 ( cost of material in each box)

Step-by-step explanation:

Volume of cardboard box = 27 cubic feet

cost of cardboard = $0.15 square feet

i) The most economical design for the box would be Designing a square box because the dimensions of the box would be [tex]\sqrt[3]{27}[/tex] = 3 ft

ii) The cost of the material for each box can be calculated as

= surfaces * surface area * cost per square foot

= 6 * 3^2 * $0.15

= $8.1

factor completely

1 + 12x + 36x^2 =_____

Answers

Answer:

(6x + 1)^2.

Step-by-step explanation:

1 + 12x + 36x^2

= 36x^2 + 12x + 1

= (6x + 1)(6x + 1)

= (6x + 1)^2.

Hope this helps!

Answer:

[tex](6x+1)^2[/tex]

Step-by-step explanation:

How can 2182 be written as the sum of four consecutive whole numbers?

Answers

Answer:

544 + 545 + 546 + 547

explanation: if the numbers are consecutive whole numbers then it would be near the ¼ of the given number

The following is the student's grades for a certain class
(left : grades, right : frequency)

determine :
a.) how many students have grades that are above than 73,5

b) how many students have grades that are below 75


Answers

Answer:

a) 20 students

b) 20 students

Step-by-step explanation:

a) From the given frequency table, we have to check the number of students that scored above 73.5 and add them up.

Therefore, the number of students that have grades above 73.5 are:

14 + 4 + 2 = 20 students

b) 75 falls in between 74 - 76 and we do not have the individual frequencies of the grades (74, 75, 76).

However, we can use the data we have from the table to make an assumption.

The number of students that have grades below 75 will be:

13 + 5 + 2 = 20 students

Karen has $600. She spent $240 on clothes. What percentage of money did she have left?

Answers

Answer: She had 60% of the money left

Step-by-step explanation:

240/600=0.4

0.4 = 40%

100%-40%=60%

Answer:

60%

Step-by-step explanation:

LETS MAKE IT INTO A FRACTION

FIRST LETS CALCULATE HOW MUCH SHE SPENT

=240/600

WE CAN SIMPLIFY BY DIVIDING THE EQUATION BY 10

=24/60

LETS DIVIDE BY 6

=4/10

DIVIDE BY 2

=2/5

NOW LETS CALCULATE HOW MUCH SHE HAS LEFT

THE EASIEST WAY IS TO SUBTRACT

5/5-2/5=3/5

3/5 IS ALSO EQUAL TO 60/100

SO KAREN HAS 60% OF HER MONEY LEFT

HOPE I HELPED

PLS MARK BRAINLIST

(DESPERATELY TRYING TO LEVEL UP)

        ✌

Elvia is job shadowing for an internship. She is required to complete at least 48 hours of shadowing in her chosen career. Elvia can shadow for 2 hours on weekdays and 6 hours on weekends. Which graph represents the number of weekdays and weekends that Elvia can shadow to meet her requirements?

A.) Picture 1
B.) Picture 2
C.) Picture 3
D.) Picture 4

Answers

The Answer is A.)

A picture of my answer

I need help with the image below ASAP

Answers

Answer:

a

Step-by-step explanation:

The standard form of the equation of a circle is

(x - h)² + (y - k)² = r²

where (h, k) are the coordinates of the centre and r is the radius

Here (h, k) = (0, 0), thus

(x - 0)² + (y - 0)² = r², that is

x² + y² = r² → a

1. The total area within any continuous probability distribution is equal to 1.00.
A. True
B. False
2. For any continuous probability distribution, the probability, P(x), of any value of the random variable, X, can be computed.
A. True
B. False
3. For any discrete probability distribution, the probability, P(x), of any value of the random variable, X, can be computed.
A. True
B. False

Answers

Answer:

1. True

2. False.

3. True.

Step-by-step explanation:

1. The total area within any continuous probability distribution is equal to 1.00: it is true because the maximum probability (value) is one (1), therefore, the total (maximum) area is also one (1).

Hence, for continuous probability distribution: probability = area.

2. For any continuous probability distribution, the probability, P(x), of any value of the random variable, X, can be computed: False because it has an infinite number of possible values, which can not be counted or uncountable.

Hence, it cannot be computed.

3. For any discrete probability distribution, the probability, P(x), of any value of the random variable, X, can be computed: True because it has a finite number of possible values, which are countable or can be counted.

Hence, it can be computed.

What is the measure of each intercepted arc for each inscribed angle of a square inscribed in a circle?

Answers

Answer:

The measure of the angle of each of the intercepted arc is 180°

Step-by-step explanation:

An intercepted arc is an encased (between chords) portion of the circumference of the circle. The chords that form the intercepted arc meet at a point

An inscribed angle is the angle is an angle formed between two chords that meet at a point called the end point

For the inscribed square, the symmetry has it that the diagonal is the same as the diameter of the circle as the diagonals bisect each other having equal distances on either side to the circumference of the circle.

Given that the angles in the vertices of the square are 90° and the point of intersection of the two chords forming the vertex are at the ends of the diameter of the circle, which passes through the center of the circle, the angle 90° at the vertex is half the angle at the center which is the angle of the intercepted arc

∴ The measure of the angle of each of the intercepted arc = 2× 90 = 180°.

Triangle DEF is the image of triangle ABC after a sequence of transformations. After you reflect ABC in the y-axis, what must you do? Describe a sequence of transformations that proves the triangles congruent.

Answers

Answer:

Step-by-step explanation:

After reflection about y-axis, A'B'C' must be translated down 6 units to create image DEF.

ABC and DEF are congruent due to the following common properties of reflections and translations.

1. does not change the nature of geometric elements, i.e. maps a line to a line,  a segment to a segment, etc.

2. preserve lenths of segments.

3. preserves angles

By the congruent theorem of SSS, the two triangles are congruent.

The sequence of transformations that proves the triangles congruent is explained in the solution below.

What is transformation?

The geometric transformation is a bijection of a set that has a geometric structure by itself or another set. If a shape is transformed, its appearance is changed.

After reflection about y-axis, A'B'C' must be translated down 6 units to create image DEF.

ABC and DEF are congruent due to the following common properties of reflections and translations.

It does not change the nature of geometric elements, i.e. maps a line to a line, a segment to a segment, etc., preserve lengths of segments, and preserves angles.

By the congruent theorem of SSS, the two triangles are congruent.

Learn more about transformation, click;

https://brainly.com/question/11709244

#SPJ3

Solve the equation and show the solution set on a number line: |x+5|=x+5

Answers

Answer: x ≥  -5

Step-by-step explanation:

First, let's see how the function f(x) = IxI works:

if x ≥ 0, IxI = x

if x ≤ 0, IxI = -x

Notice that for 0, I0I = 0.

Ok, we want that:

|x+5| = x+5

Notice that this is equivalent to:

IxI = x

This means that  |x+5| = x+5 is only true when:

(x + 5) ≥ 0

from this we can find the possible values of x:

we can subtract 5 to both sides and get:

(x + 5) -5 ≥ 0 - 5

x ≥  -5

So the graph in the number line will be a black dot in x = -5, and all the right region shaded.

something like:

-7__-6__-5__-4__-3__-2__-1__0__1__2__3__4__ ...

Find the surface area of the right rectangular prism shown below. units²

Answers

Answer:

67 units^2

Step-by-step explanation:

The surface area of the prism is found by

SA = 2 ( lw+lh + wh)

     = 2 ( 5*1.5+ 4*1.5 + 5*4)

     = 2 ( 7.5+6+20)

     = 2 (33.5)

    = 67

Answer:

67units²

Step-by-step explanation:

Dave, Kurt, and Chris buy 3 different shirts. In how many selections can they distribute the shirts equally among themselves?

Answers

Answer:

Hence the number of ways they can distribute the shirt among themselves is 6 ways

Step-by-step explanation:

This problem can be solved by applying the permutation strategy since it has to do with the number of ways of selection

Given

Number of items= 3

Therefore 3!= 3*2*1= 6

Hence the number of ways they can distribute the shirt among themselves is 6 ways

the legnth of rectangular sheet decreases by 34.5 cm its width decreases proportionally that is by the same percentage. if the sheets original width was half of the legnth and the new (smaller) area was 1.2 m^2 what was original sheet's width

Answers

Answer:

The original width was 94.71 cm

Step-by-step explanation:

Given:

new smaller area = 1.2m^2

Decrease in length of the rectangular sheet = 34.5cm

Therefore:

1. the final width of the sheet is given as

2X^2 = 1.2 m^2

X^2 - 0.6 m^2

X^2 = 10000 * 0.6 cm

X = 77.46 cm (this is the width)

2. The length of the sheet

= 2 * 77.46

= 154.92 cm.

3. Initial length of the sheet

= 154.92 + 34.5

= 189.42 cm.

4. Initial width of the sheet ( original ).

= 189.42 / 2

= 94.71 cm.

5. Initial area of the sheet

= 94.71 * 189.92

= 17939.9 cm^2

New area of the sheet

= 79.46 * 154.92

= 12000.1 cm^2

Difference between the initial and new area

= 17939.9 - 12000.1

= 5939.86 cm^2

Percentage of area decrease

= 5939.86 ' 17939.9

= 33.1%

What are the measures of angles M and N?
mM = 61° and mN = 113
mM = 67 and mN= 119
mM = 113 and mN = 61
mM = 119 and mN = 67

Answers

Answer:

mM = 113 and mN = 61

Step-by-step explanation:

In a Cyclic quadrilateral, the rule states that:

The sum opposite interior angles is equal to 180°

In the above diagram, we have cyclic quadrilateral KLMN

According to the rule stated above:

Angle K is Opposite to Angle M

So, Angle K + Angle M = 180°

Angle K = 67°

67° + Angle M = 180°

Angle M = 180° - 67°

Angle M = 113°

Angle L is Opposite to Angle N

so Angle L + Angle N = 180°

Angle L is given as = 119°

119° + Angle N = 180°

Angle N = 180° - 119°

Angle N = 61°

Therefore, Angle M = 113° and Angle N = 61°

My initial deposit is $100. Every year my account total increases by 5% What is the total percent increase after 5 years?

Answers

Each year, your account is multiplied by 1.05 (5% increase). Thus, after 5 years, your account would have been multiplied by that value 5 times.

[tex](1.05)^5=1.27628...[/tex]

Thus, the total percent increase would have been 27.6% (rounded to the nearest tenths).

PLEASE HELP! Thank you!!!

Answers

Answer is D. 7
A+b is equal to 2.438 and 6.562
2.438x6.562= 15.99 which rounds up to the nearest whole number 16
16-9=7
So answer is D. 7

(Please help!) Find the horizontal asymptote of f(x)=-2x^2+3x+6/x^2+1

Answers

Answer:

[tex]\large \boxed{\sf \ \ y=-2 \ \ }[/tex]

Step-by-step explanation:

Hello,

To guess the end behaviours when x tends to [tex]\infty[/tex] you only take into account the highest terms of polynomial expressions.

So the expression will be equivalent to

[tex]\dfrac{-2x^2}{x^2}=-2[/tex]

In other words we can say

[tex]\displaystyle \lim_{x\rightarrow+\infty} \dfrac{-2x^2+3x+6}{x^2+1}=\lim_{x\rightarrow+\infty} \dfrac{-2x^2}{x^2}=-2\\\\\displaystyle \lim_{x\rightarrow-\infty} \dfrac{-2x^2+3x+6}{x^2+1}=\lim_{x\rightarrow-\infty} \dfrac{-2x^2}{x^2}=-2\\\\[/tex]

So, the correct answer is y = -2

Hope this helps.

Do not hesitate if you need further explanation.

Thank you

If a line crosses the x-axis at (4,0), what is the x-intercept?

Answers

Answer:

x = 4

Step-by-step explanation:

The y- intercept is the value of the x- coordinate where the line crosses the x- axis.

Given the line crosses the x- axis at (4, 0 ), then

the x- intercept is x = 4

A percent measures a rate

Answers

answer = no it does not measure a rate

Answer:

NO

Step-by-step explanation:

Percent is just a number out of 100

Other Questions
A block with a mass of 0.28 kg is attached to a horizontal spring. The block is pulled back from its equilibrium position until the spring exerts a force of 1.0 N on the block. When the block is released, it oscillates with a frequency of 1.2 Hz. How far was the block pulled back before being released? Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3 As a result of education and law enforcement, negative attitudes toward the disabled are rare in society today. Please select the best answer from the choices provided. T F URGENT!!! PLEASE help me with this question! Indicate the direction of heat flow in each scenario. Scenario A: Scenario B: Scenario C: Scenario D: Compute the value of each expression 717 distinguish between deliquescence and efflorescence. *HELP WITH THIS QUESTION* When might you use the AP Stylebook to establish the correct format? a.) when writing a business letter b.) when writing a persuasive essay for school c.) when writing a news article for an online magazine d.) when writing a historical essay for school What most likely happens if two people groups meet? Each group preserves their own culture. The American culture is created. Their cultures mix together, creating something new. The groups vote on which culture will be recognized. The moons rotational period and revolution period are equal. What is the result of this? Enter your answer in the space provided. Write an equation of a line that has a y-intercept at (0, -6) what is civil service Describe the crystallization process as applied in salt preparation The Carnegie model and the incremental model disagree with each other on how decisions are made--the former claiming that they are made through a political process and the latter claiming that they emerge over time following careful objective analysis.a) trueb) false suppose you are the Selfish Giant describe what brought a change in you and how you felt If while playing Blackjack if you receive the 6 of hearts and the 8 of diamonds, what are the odds that you will bust if you hit? (If you receive another card what are the odds that their sum will add to 22 or higher with Aces counting as 1 and royal cards counting as 10?) The Clayton Act: Group of answer choices a. was declared illegal. b. closed loopholes in the Sherman Antitrust Act. c. prevents anticompetitive practices. d. prohibits all mergers and acquisitions. The increase in Hollywood revenues outside North America reflects which business trend? Multiple Choice strategic alliance globalization cost reduction cultural distance local responsiveness Please help!! Geometry is my weakness!! A client comes to the clinic for an ophthalmologic screening, which will include measurement of intraocular pressure (IOP) with a tonometer. Which statement about this procedure is true?