Student football game tickets cost $20 Adult tickets cost $30. Write a function that shows
the total cost for s student tickets and a adult tickets.

Answers

Answer 1

Answer:

Here are the answers for the whole QC for CA students.

1. C

2. A

3. no

4. c

5. A

Step-by-step explanation:


Related Questions

Help please and happy Halloween

Answers

Answer:

every time x goes up 1, y goes up 2

So the constant rate of change is 2

Step-by-step explanation:

let me know if I'm wrong

Answer:

Step-by-step explanation:

on the x side of the table it is adding 2 for every number.  

On they y side of the tables it is adding 4 for every number.

It is asking for rate of change for each table not all together.

So I geuss  x=2, y=4

Given g(x) = 2x + 5, find g(1).

Answers

Step-by-step explanation:

The value of g is already given. Replace g by 1 and find the value of x which is a negative two. After that, substitute and find that g is indeed equal to 1.

thankyou

In what quadrant will the reflection of (7,7) be located in​

Answers

Answer:

the first quadrant is positive, and positive so it would be the first quadrant

 

Step-by-step explanation:

Wooden flooring costs £35 per square metre. The floor is then edged with a narrow wooden strip which costs £4 per metre.

How much does it cost for a 6m by 4m room, including the edging?

Answers

Answer:

£920

Step-by-step explanation:

We need to find the area of floor to find the cost of the flooring, and then we need to find the perimeter of the floor to find the cost of the edging.

A = LW = 6 m × 4 m = 24 m²

Cost of flooring: 24 m² × £35/m² = £840

P = 2(L + W) = 2(6 m + 4m) = 2(10m) = 20 m

Cost of edging: 20 m × £4/m = £80

Total cost:

£840 + £80 = £920

Three workers worked for 5 hours, 7 hours and 12 hours. The total wage of $
13200 was divided among the three workers according to the number of hours of
work they did. How much did each get?

Answers

Answer:

Worked 5 hours: $550

Worked 7 hours: $2,750

Worked 12 hours: $6,600

Step-by-step explanation:

5+7+12=24

13200/24 = 550

(5)*(550) = 2,750

(7)*(550) = 3,850

(12)*(550) = 6,600

I NEED A 100% ACCURATE ANSWER FOR THIS QUESTION ASAP NO LINKS !!!

Answers

Answer:

y = 5

Step-by-step explanation:

Group all y terms on the left side of the equation

Subtract 3y from both sides: 3-y-3y=3y+10-3y

Group like terms: -y-3y+30=3y+10-3y

Simplify the arithmetic: -4y+30=3y+10-3y

Group like terms: -4y+30=3y-3y+10

Simplify the arithmetic: -4y+30 = 10

Group all constants on the right side of the equation

Subtract 30 from both sides: -4y+30-30=10-30

Simplify the arithmetic: -4y=10-30

Simplify the arithmetic: -4y=-20

Isolate the y

Divide both sides by-4: -4y/-4 = -20/-4

Cancel out the negatives: 4y/4 = -20/-4

Find the greatest common factor of the numerator and denominator: y = 5·4/1·4

Factor out and cancel the greatest common factor:

y=5

solve pls Brainliest

Answers

Answer:

25

Step-by-step explanation:

155-180=25 degrees

Answer:

x = 25°

Step-by-step explanation:

Heyyyyyyyyyyyy can you help

Answers

Answer:

1.45 x 10   {2}

Step-by-step explanation:

direct variation
Hooke's Law for an elastic spring states that the distance a spring stretches varies directly as the force applied. if a force of 180 newtons stretches a spring 5 cm, how much will a force of 270 newtons stretch the same spring?

pls help (;ŏ﹏ŏ)​

Answers

When a force of 270N is applied, the spring stretch by 7.5cm

Two variables are said to be directly proportional if as one variable increases/decreases, the other variables does the same by the same amount.

Let F represent the force and x represent the extension, hence:

F ∝ x

F = kx; k is the constant of proportionality

When F = 180, x = 5, hence:

180 = 5k

k = 36

F = 36x

When F = 270:

270 = 36x

x = 7.5 cm

When a force of 270N is applied, the spring stretch by 7.5cm

Find out more at: https://brainly.com/question/13977805

A
Learning Task 3. Inside each wet and subsets, write at least 5 amples of
kind of numbers
Interpers
Who
Rational
Marafina
Natural
Solve the following word problem.

1. Mikey worked on her mathematics homework for hour and her science
homework for 7/8 hour. How long did she spend in all doing homework?

2. There are 60 students in a class. Three-fourths of them are girls. How many
boys are there?

3. One day in Baguio, the temperature went from - 2 °C to 8°C. What is the
change in temperature?

4. The elevation of Mt. Everest is 29 028 ft. The elevation of the Dead Sea is -485
ft. Find the difference in the elevation between Mt. Everest and the Dead Sea
1

5. Angie cleans of the yard. Alex cleans of the remaining. What fraction of
the yard is left unclean?
3

Matinong sagot po please​

Answers

The following questions are related to problems on simple fraction and arithmetic. Hence, the solutions to the questions are as follows :

1.)

Time on mathematics = 1 hour

Time on science homework = 7/8 hours

Total time spent = (1 + 7/8) = [tex] 1 \frac{7}{8}[/tex]

2.)

Total number of students = 60

Fraction of girls = 3/4

Fraction of boys = 1 - 3/4 = 1/4

Number of boys = 1/4 × 60 = 15 boys

3.)

Initial temperature = - 2°C

Final temperature = 8°C

Change in temperature = Final temperature - Initial temperature

Change in temperature = (8 - (-2)) = 8 + 2 = 10°C

4.)

Elevation of everest = 20028 feets

Elevation of dead sea = - 485 feets

Difference in elevation = (20028 - (-485)) = 20513 feets

5.)

Question is missing key values.

Learn more : https://brainly.com/question/10483418

Please help

Ignore the first 2 questions please

Answers

Answer:

12

Step-by-step explanation:

Waterfalls to Canoes = 6 units

-4 to +2 = 6

Canoes to Fishing Area = 6 units

-2.5 to +3.5 = 6

Total = 6+6 = 12

On Friday, 0.325 of the students in
Keisha's math class were absent. What
percent of the students were absent?
Look at picture for choices!! Quick!!

Answers

It would be c because you move two times the decimal dot to the right, that’s how you get the answer

Noah bought 15 baseball cards for $9.00 assuming each baseball card cost the same amount answer the following questions

Answers

Answer:

Well, each baseball card $1.60.

Step-by-step explanation:

Since, you may just divide the amount of cards to the amount of money required.

5(Y-1)=3(2Y-5)-(1-3Y)

Answers

Answer: =11/4

Step-by-step explanation:

Answer:

[tex]y = 2 \frac{3}{4} \\ [/tex]

Step-by-step explanation:

[tex]5(y - 1) = 3(2y - 5) - (1 - 3y) \\ 5y - 5 = 6y - 15 - 1 + 3y \\ 5y - 5 = 9y - 16 \\ 16 - 5 = 9y - 5y \\ 11 = 4y \\ \frac{11}{4} = y \\ 2 \frac{3}{4} = y \\ [/tex]

Veggie’s Market sells 5 avocados for $2.30 and 3 tomatoes for $2.97. Martina buys 2 avocados and 1 tomato. What is the total cost of her veggies?

Answers

Answer:

$1.91

Step-by-step explanation:

$2.30 / 5 = $0.46

$2.97 / 3 = $0.99

2 * $0.46 + $0.99 = $1.91

Answer:

1.91

Step-by-step explanation:

divide 2.30 by 5 and u get 0.47 and she bought 2 avocados so 0.47 plus 0.47 is 0.92 and 2.97 divided by 3 is 0.99 so 0.99 plus 0.92 is 1.91 dollars

Trong 300 người bệnh chỉ dùng thuốc A có 55% người khỏi; trong 240 người bệnh chỉ dùng thuốc B có 50% người khỏi. Với mức ý nghĩa 5% có thể nói thuốc A hiệu quả hơn thuốc B không?

Answers

vâng vì phụ nữ là những người tán gẫu

1. A senator is thinking about running for president. But she will only do so if more than 60% of the voters view her favorably. She gathers some data to see if she has this level of support. Which statistical method would be best for her to use?

Answers

The senator is faced with the making a decision to run for President, based

on the conclusion she can make from the data she gathers.

The statistical method that would be best for her to use is inferential

statistic method such as finding the percentage of supporters she has to a

given confidence level.

Reason:

The two main types of statistical methods are;

Inferential statistics methods; Theses are methods used to reach a

conclusion that extends past the given or available data.

Descriptive statistics methods; Theses are statistical method used as a

summary of a data set.

Given that the senator is trying to draw conclusion based on the data she

gathers, she should use inferential statistic method.

The type inferential statistic method that can be used is the confidence

interval.

From the data collected, the proportion of voters that view her favorably is

used at a given confidence level to determine the true proportion of voters

that view her favorably.

Therefore;

The statistical method that would be best for her to use is the

finding of the confidence interval which is a inferential statistic method.

Learn more here:

https://brainly.com/question/15873157

Using the graph of y = f(x) to the right, and given that the zero of the function is x=20, find the following.

Answers

Answer:

3.5

Step-by-step explanation:

I have more question then this

Answers

reflection over y axis...........

Help!!!! Jack walked 3 1/3 miles in 4/3 hours. If he walked at a constant rate, how far did he walk in 15 minutes?

Answers

Answer: I think the answer is 0.625 miles.

Step-by-step explanation:in the picture

Suppose there is a 1.2 drop in temperature for every thousand feet that an airplane climbs into the sky. If the temperature on the ground is ​57.8, what will be the temperature when the plane reaches an altitude of ​7000?

Answers

Answer:

ysgsvdbdbdjdnd dndjdnd

b. What is the number that is halfway between the two values?
7 and 11
Submit

Answers

Answer:

9

Step-by-step explanation:

It would be 9 because 7 +2 is 9 and 11 - 2 is 9.

Isn't way to hard.

Good luck on whatever you are doing.

9514 1404 393

Answer:

  9

Step-by-step explanation:

The midpoint between two values is their average. The average is half their sum.

  (7 +11)/2 = 18/2 = 9

The number 9 is halfway between 7 and 11.

_____

Check

The distance from 7 to 9 is 9-7 = 2. The distance from 9 to 11 is 11-9 = 2. The distances are the same, so 9 is halfway between 7 and 11.

50×54+35-44
Simplification
no spam
steps must​

Answers

Answer:

=2691

Step-by-step explanation:

=2700+35−44

=2735−44

=2691


[tex]\frac { a } { ( a - b ) ( a - c ) } + \frac { b } { ( b - c ) ( b - a ) } + \frac { c } { ( c - a ) ( c - b ) }[/tex]
the formula is the question pleaseee helppp quickkk

Answers

Answer:

0

Step-by-step explanation:

[tex]\frac{a}{(a-b)(a-c)} +\frac{b}{(b-c)(b-a)}+\frac{c}{(c-a)(c-b)}\\= \frac{a}{(a-b)(a-c)} -\frac{b}{(b-c)(a-b)}+\frac{c}{(a-c)(b-c)}\\\\= \frac{a(b-c)-b(a-c)+c(a-b)}{(a-b)(a-c)(b-c)}}\\\\= \frac{ab-ac-ab+bc+ac-bc}{(a-b)(a-c)(b-c)}}\\\\= \frac{0}{(a-b)(a-c)(b-c)}}\\\\= 0[/tex]

You deposit $400 in an account earning 8% interest compounded annually. How much will you have in the account in 15 years?

Answers

Answer:

you will gain 280,462.92 in peso.but you convert in in dollar you will gain $5,520.00

Multiply.
[−2 3/11⋅(−4)]⋅(1 13/20)⋅(−10)
What is the product?

Answers

The answer - 5198/11

Answer:

[tex]{ \rm{ \{ - 2 \frac{3}{11} \times ( - 4) \}. \{1 \frac{13}{20} \times ( - 10) \} }} \\ \\ = { \rm{9 \frac{1}{11} \times - 16 \frac{1}{2} }} \\ \\ { \boxed{ \rm{ \: = - 150 \: \: }}}[/tex]

Dell Computers receives large shipments of microprocessors (chips) from Intel Corp. It must try to ensure that the proportion of defective chips is small and has contracted to keep the proportion of defective chips at 5% or less. Suppose that Dell tests 25 chips (with replacement) out of a shipment of thousands.
a) What is the probability of obtaining at least three defects in the sample, if the entire shipment has 5% defectives? If a sample results in at least three defects, does it appear that Intel has provided a shipment which is consistent with the contract? Briefly explain, using the calculated probability.
b) For the shipment described in part a, find the expected number of sampled chips that are defective and the standard deviation of the number of sampled chips that are defective.
c) Suppose that 20% of the entire shipment is defective. What is the probability that more than 17 chips in the sample are good (not defective)?​

Answers

Using the binomial distribution, it is found that:

a) 0.1271 = 12.71% probability of obtaining at least three defects in the sample, if the entire shipment has 5% defectives. 5% defective is between 1 and 2 defects, but since this probability is more than the unlikely threshold 5%, more than 2 defects could still mean that Intel has provided a shipment which is consistent with the contract.

b) The mean is of 1.25 defective chips and the standard deviation is of 1.09 defective chips.

c) 0.8908 = 89.08% probability that more than 17 chips in the sample are good.

For each chip, there are only two possible outcomes, either it is defective, or it is not. The probability of a chip being defective is independent of any other chip, which means that the binomial distribution is used to solve this question.

Binomial probability distribution

[tex]P(X = x) = C_{n,x}.p^{x}.(1-p)^{n-x}[/tex]

[tex]C_{n,x} = \frac{n!}{x!(n-x)!}[/tex]

x is the number of successes. n is the number of trials. p is the probability of a success on a single trial.

In this problem:

25 chips are tested, thus, [tex]n = 25[/tex].

Item a:

Supposing 5% defective, we have that [tex]p = 0.05[/tex].

The probability is:

[tex]P(X \geq 3) = 1 - P(X < 3)[/tex]

In which

[tex]P(X < 3) = P(X = 0) + P(X = 1) + P(X = 2)[/tex]

Then

[tex]P(X = x) = C_{n,x}.p^{x}.(1-p)^{n-x}[/tex]

[tex]P(X = 0) = C_{25,0}.(0.05)^{0}.(0.95)^{25} = 0.2774[/tex]

[tex]P(X = 1) = C_{25,1}.(0.05)^{1}.(0.95)^{24} = 0.3650[/tex]

[tex]P(X = 2) = C_{25,2}.(0.05)^{2}.(0.95)^{23} = 0.2305[/tex]

[tex]P(X < 3) = P(X = 0) + P(X = 1) + P(X = 2) = 0.2774 + 0.3650 + 0.2305 = 0.8729[/tex]

[tex]P(X \geq 3) = 1 - P(X < 3) = 1 - 0.8729 = 0.1271[/tex]

0.1271 = 12.71% probability of obtaining at least three defects in the sample, if the entire shipment has 5% defectives. 5% defective is between 1 and 2 defects, but since this probability is more than the unlikely threshold 5%, more than 2 defects could still mean that Intel has provided a shipment which is consistent with the contract.

Item b:

The mean is:

[tex]E(X) = np = 25(0.05) = 1.25[/tex]

The standard deviation is:

[tex]\sqrt{V(X)} = \sqrt{np(1 - p)} = \sqrt{25(0.05)(0.95)} = 1.09[/tex]

The mean is of 1.25 defective chips and the standard deviation is of 1.09 defective chips.

Item c:

20% are defective, so 80% are good, which means that [tex]p = 0.8[/tex]

The probability is:

[tex]P(X > 17) = P(X = 18) + P(X = 19) + P(X = 20) + P(X = 21) + P(X = 22) + P(X = 23) + P(X = 24) + P(X = 25)[/tex]

Then

[tex]P(X = x) = C_{n,x}.p^{x}.(1-p)^{n-x}[/tex]

[tex]P(X = 18) = C_{25,18}.(0.8)^{18}.(0.2)^{7} = 0.1108[/tex]

[tex]P(X = 19) = C_{25,19}.(0.8)^{19}.(0.2)^{6} = 0.1633[/tex]

[tex]P(X = 20) = C_{25,20}.(0.8)^{20}.(0.2)^{5} = 0.1960[/tex]

[tex]P(X = 21) = C_{25,21}.(0.8)^{21}.(0.2)^{4} = 0.1867[/tex]

[tex]P(X = 22) = C_{25,22}.(0.8)^{22}.(0.2)^{3} = 0.1358[/tex]

[tex]P(X = 23) = C_{25,23}.(0.8)^{23}.(0.2)^{2} = 0.0708[/tex]

[tex]P(X = 24) = C_{25,24}.(0.8)^{24}.(0.2)^{1} = 0.0236[/tex]

[tex]P(X = 25) = C_{25,25}.(0.8)^{25}.(0.2)^{0} = 0.0038[/tex]

Then:

[tex]P(X > 17) = P(X = 18) + P(X = 19) + P(X = 20) + P(X = 21) + P(X = 22) + P(X = 23) + P(X = 24) + P(X = 25) = 0.1108 + 0.1633 + 0.1960 + 0.1867 + 0.1358 + 0.0708 + 0.0236 + 0.0038 = 0.8908[/tex]

0.8908 = 89.08% probability that more than 17 chips in the sample are good.

A similar problem is given at https://brainly.com/question/24863377

Anything would help :))

Answers

The first one is 3 if that helps

Step-by-step explanation:

1.

x = number

x/4 = x/3 - 1

x/3 - x/4 = 1

4x/12 - 3x/12 = 1

x/12 = 1

x = 12

2.

the numerator is the top (it gives the number of the parts of the whole that are combined in the fraction).

the denominator is the bottom (it says in how many and therefore how small parts we split the whole).

x = numerator

y= denominator

fraction is x/y

y = x + 2

(x+3)/(y+3) = 23

x + 3 = 23(y + 3) = 23y + 69

x = 23y + 66

now we use the first equation (y = x + 2) and substitute it into the last equation :

x = 23(x + 2) + 66 = 23x + 46 + 66 = 23x + 112

x = -112/22 = -56/11

y = -68/22 = -34/11

the original fraction is

x/y = -56/11 / -34/11 = -56/11 × -11/34 = 56/34 = 28/17

3.

in 1 hour the large pipe has done 1/3 of the work. and the small pipe 1/6 of the work.

so, in total in 1 hour we get (1/3 + 1/6) done.

what factor do we need to multiply (1/3 + 1/6) to get 1/1 (the whole work) ?

x(1/3 + 1/6) = 1

x(2/6 + 1/6) = 1

x(3/6) = 1

x × 1/2 = 1

x = 2

it takes both pipes together 2 hours to empty the pool.

4.

very similar to 3.

we are just using days instead of hours.

in 1 day Erwin gets 1/2 of the work done and Ana 1/5 of the work. so, together, 1/2 + 1/5 of the total work in one day.

so, how many days to get 1/1 (the whole work) done ?

x(1/2 + 1/5) = 1

x(5/10 + 2/10) = 1

x(7/10) = 1

7x = 10

x = 10/7

it takes them together 10/7 days to mow the whole lawn.

At a movie theater, the price of 2 adult tickets and 4 child tickets is $48. The price of 5 adult tickets and 2 child tickets is $64. What is the ticket price for one adult and for one child?

Adult: Child:

Answers

Answer:

adult=10

Child=7

One adult and one child=10+7=17

Step-by-step explanation:

Let a be the price of an adult ticket

c = price of the child ticket

2a+4c = 48

5a+2c = 64

Multiply the second equation by -2 and add to the first equation

2a+4c = 48

-10a-4c = -128

---------------------

-8a +0c = -80

Divide by -8

-8a/-8 = -80/-8

a = 10

Now find c

2a+4c=48

2(10)+4c=48

20+4c=48

4c=48-20

4c=28

4c/4=28/4

c=7

Answer:

look at the photo..........

150 miles on 4 gallons of gas. How many miles for 1 gallon of gas?

Answers

Answer: answered

A motorcycle can go 50 miles using one gallon of gas. About how many gallons of gas will be used to go 150 kilometers? (Hint: 1 mile is approximately 1.6 kilometers)

Step-by-step explanation:

Answer:37.5

Step-by-step explanation:

Other Questions
in mexico how do rural celebrations differ from celebrations in big cities which place made controlling and using floodwaters a key responsibility of the government? Which statement best completes the diagram showing the development of modern democracy? Given the function h(x) = x2 7x + 6, determine the average rate of change ofthe function over the interval 3 x < 7. when an allocation of resources maximizes total surplus, the result is said to be efficient. Which is NOT considered an organism?fungivirusbacteriaGerman Sheppard which body system is responsible for producing the hormone adrenaline? According to which virtue do you need to secure information by limiting computer access to authorized personnel only? 1) What was the Yazoo Land Act? 2) Why did the Act become a Scandal? 3) Why were the legislators in the picture burning the law after it had already been repealed? 4) What did that message send to the public? which continent is not located in the eastern hemisphere?A)frica B) AsiaC)South American D) Europe Whats 20/10 simplified?? Cu 1. Trong dao ng iu ho, pht biu no sau y l khng ng ?A.C sau mt khong thi gian T (chu k) th vt li tr v v tr ban u.B.C sau mt khong thi gian T th vn tc ca vt li tr v gi tr ban u.C.C sau mt khong thi gian T th gia tc ca vt li tr v gi tr ban u.C sau mt khong thi gian T th bin ca vt li tr v gi tr ban u which republicans voted to hold bannon in contempt why did the colonists at plymouth believe that representative government would be the best way to protect their religious freedomAUGHHWJE I SWEAR IM GOING TO FAIL SOCIAL STUDIES ITS ONLY THE FIRST QUARTER TOO An airplane flies with a velocity of 750. kilometersper hour, 30.0 south of east. What is themagnitude of the eastward component of theplane's velocity?A. 866 km/hB. 650. km/hD. 375 km/hC. 433 km/h Need help please i have been having trouble May someone help? Will give brainliest and 100 points. Just answer with the letter? NO LINKS PLEASE Based on their composition and structure, list CH3COCH3CH3COCH3, CH3CH(CH3)CH3CH3CH(CH3)CH3, and CH3COOHCH3COOH in order of decreasing intermolecular forces. What factors are causing Indias population to increase while many other nations are below replacement levels? Which answer choice is it?A 3dB 4pC 4dD 4f