.
Simplify: -8(13 – 5c + 12d)
a -104 – 5c + 12d
b -104 - 40c - 96d
c -104 -13c + 4d
d -104 + 40c – 96d

Answers

Answer 1

[tex]▪▪▪▪▪▪▪▪▪▪▪▪▪  {\huge\mathfrak{Answer}}▪▪▪▪▪▪▪▪▪▪▪▪▪▪[/tex]

Simplification ~

[tex] - 8(13 - 5c + 12d)[/tex]

[tex]( - 8 \times 13) + ( - 5c \times - 8) + ( - 8 \times 12d)[/tex]

[tex] - 104 + 40c - 96d[/tex]

Correct choice is D

Answer 2

Simplify: -8(13 – 5c + 12d)

= −8 (13−5c+12d)

= (−8×13) + (−5c×−8) + (−8×12d)

= - 104 + 40c - 96d

Correct option is D

▪▪▪▪▪▪▪▪▪▪▪▪▪▪▪▪▪▪

Answered by:-Cutest Ghost (・◡・)

▪▪▪▪▪▪▪▪▪▪▪▪▪▪▪▪▪▪


Related Questions

Which expression is equivalent to -0.25(16m + 12)?

PLEASE HELP

Answers

Answer:

-4m-3

Step-by-step explanation:

Step-by-step explanation:

-0.25(16m+12)

(-0.25×16m)+(-0.25×12)

(-4m)+(-3)

-4m-3. Answer

What is the first whole number greater than 11?

Answers

Answer:

4

Step-by-step explanation:

The √11 is ≈ 3.3166....

So the first whole number GREATER than 3.3166 is 4

-Chetan K

Answer:

√11 = 3.3166

The first whole number greater than 3.3166 is 4

Hope This Helps!

how to convert 111101 from base 2 to base 10​

Answers

Answer:

61

Step-by-step explanation:

So basically you separate the numbers like 1 1 1 1 0 1, and time 2 while having the number of numbers as the exponent decreasing. Like this, 1x2^5+1x2^4+1x2^3+1x2^2+0x2^1+1x2^0. Then figure it out and it would be 32+16+8+4+0+1=61. If don't understand, look at the picture below

At the grocery store, 6 pints of ice cream cost $12.54. How much would 40 pints of ice cream cost?

Answers

Answer:

$83.60

Step-by-step explanation:

to find the answer you need to know the price of one pint (unit rate) so we divide 12.54 by 6.

12.54 ÷ 6 = 2.09

then we multiply that by 40

2.09 x 40 = 83.60

What is the value of 5 in 102,587?

Answers

Answer:

Value of 5 is 500

From right to left ones, tens, hundreds, thousands, ten thousands, hundred thousands

5 is in the hundredth place

HOPE THIS IS WORTH IT :)

Logan and his father each have a sandwich and a drink for lunch at a restaurant. A sandwich costs $5.25 and a drink costs $1.75. Logan's father leaves a 20% tip. What is the amount of the tip?

Answers

Answer:

$1.4

Step-by-step explanation:

$5.25 + $1.75 = $7

20/100 × $7

= 20× 7 /100

= 140/100

= $1.4

WILL GIVE BRAINLIEST!... whats the unit rate of the equation(HAVE TO SHOW HOW YOU GOT ANSWER)
y=-4x​

Answers

Answer:

-4

Step-by-step explanation:

The form of a liner equation is y=mx+b.  b is 0 in this example.  So we are left with y=-4x

-4 is the m, the slope.  It is also called the unit rate of change.  It tells us how much y changes for each 1x unit.  

y     x

0    0

-4    1   One unit changes y by -4 :  The unit rate of change.

-8    2

can anyone heelp me pls

Answers

Answer:

I think it's b.

Step-by-step explanation:

b. ,. ....

2.Pleas can someone answer!

Answers

Answer: A, A, C

Step-by-step explanation:

Educated Guess because none of them are going to be zero so it's either A or C but the point has a negative y so to plug it all in all of them have to be negative ex. -1 + -1 + -1 =-3

the x is -1 so both have to be negative in order to get -3

Write the answer to 6 2/5 × 4 in improper fraction form AND mixed number form.

Improper fraction:
-------------------------

Mixed number: -------------------------
(whole number + fraction number

Answers

Answer:

6 2/5 as an improper fraction is 32/5 and if we turn 4 into a fraction (4/1) we can multiply them.

32/5 * 4/1 = 128/5

128/5 is the improper fraction

and the mixed number is 25 3/5

Step-by-step explanation:

6 2/5 as an improper fraction is 32/5 and if we turn 4 into a fraction (4/1) we can multiply them.

32/5 * 4/1 = 128/5

for his
Noah decides to change the design of the tabletop so that it is a rectangle with the same
area as his original tabletop design. How can Noah change his design to a rectangle but
keep the same area?
Choose one option from each drop-down menu to answer the question.
To change his design, Noah can make one vertical cut through the parallelogram to form
Choose...
Then, to make a rectangle, he can match up
Choose..
Noah's original tabletop design
has the same area as a rectangle with a base of Choose...ft and a height of
Choose... v ft.

Answers

Answer:

two triangles, the top of one figure with the bottom of the other figure, 8 and 4

Step-by-step explanation:

I am not sure if it's right but I hope it is!

You are shipping a box that weighs 13 pounds. Shipping charges are listed by ounces at the local mail center. How many ounces does the box weigh?

Answers

Answer:

208 ounces in 13 pounds

Step-by-step explanation:

The total temperature measured by 3 thermometers was −15 degrees Fahrenheit.

What was the average temperature measured by the 3 thermometers?

Answers

-5 degrees Fahrenheit

hi, can you help me here pls?






...


...​

Answers

1. Money
2. Weight
3. Length
Time
Height
Distance
Weight
Money

PLEASE HELP ME SO I CAN GRADUATE!!!!!
What is the y-intercept of the line passing through the point (4,-5) with a
-2
slope of ?
A.
41
9
O
B.
O
O
D.
49
9

Answers

Answer:

A: -41/9

Step-by-step explanation:

Substitute the point (4, -5) and slope -1/9 into the equation y = mx + b.

-5 = -1/9(4) + b

-5 = -4/9 + b

Solve for b:

b = -41/9

Our equation: y = -1/9(x) - 41/9

a class has 28 students. The ratio of girls to boys is 4:3. How many girls

Answers

Answer:

let

no of girls be 4x & boys be 3x

or, 3x+4x=28

or, 7x=28

x=28/7=4

hence no of girls = 4x=4*4= 16

I when I'm 10, my brother is half of my age. How old is my brother if I am 44 now

Answers

Answer:

Step-by-step explanation:

A-B = 4–2 = 2 (age difference between A and B). IF A = 44,. B = A - 2 = 44 - 2 = 42 years old.

Answer:

39 years old

It could be;

10 ÷ 1/2 = 5

Age difference= 10 - 5= 5 years

So, 44 - 5 = 39 years old

draw a square and its diagonals how many angles are formed by the intersection of the diagonals?

Answers

A square has 2 diagnals. imagine 2 lines connecting every opposite angle of the square. that leaves 2 intersecting lines. Sinse the two lines are intersecting, they form angles. Because there are only 2 lines, there are 4 angles. The answer is 4.

A square is a four-equal-sided figure with the diagonals of the square cut perpendicular to each other as shown below and the number of angles formed by diagonals is 4.

What is a square?

A square is a geometrical figure in which we have four sides each side must be equal and the angle between two adjacent sides must be 90 degrees.

Area of square = Side²

The perimeter of the square = 4× side

A square is a geometrical figure in which we have four sides each side must be equal and the angle between two adjacent sides must be 90 degrees.

There are two diagonals in every square.

The angle of intersection between both diagonals is 90 degrees.

The number of angles formed by diagonals = 4

Hence "A square is a four-equal-sided figure with the diagonals of the square cut perpendicular to each other as shown below and the number of angles formed by diagonals is 4".

For more about a square,

https://brainly.com/question/2189895

#SPJ2


Suppose two trains leave a certain station, at the same time, traveling in opposite directions. One train travels 30 mph faster than the other. In 2.5 hours, the trains are 205 miles apart. Find the speed of each train


Answers

9514 1404 393

Answer:

  56 mph, 26 mph

Step-by-step explanation:

The trains are separating at the rate of (205 mi)/(2.5 h) = 82 mi/h. If we let s represent the speed of the slower train, then that sum of their speeds is ...

  s + (s+30) = 82

  2s = 52 . . . . . . . . . . subtract 30

  s = 26 . . . . . . . . . divide by 2

  s +30 = 56 . . . the speed of the other train

The speeds of the two trains are 56 mph and 26 mph.

Order the expressions by choosing >,<, or =

Answers

Answer:

1. <

2. <

3. >

Step-by-step explanation:

Remember in order to solve exponents you need to multiply the whole number by itself as many times as it's exponent so if you have 3^4 you need to multiply three by itself four times.

1. [tex]2^5 = 2\times2\times2\times2\times2[/tex]

[tex]2\times2\times2\times2\times2=32[/tex]

[tex]=32[/tex]

[tex]2^2 = 2\times2[/tex]

[tex]2\times2=4[/tex]

[tex]32\times4=128[/tex]

[tex]2^{10} = 2\times2\times2\times2\times2\times2\times2\times2\2\times2\times2[/tex]

[tex]2\times2\times2\times2\times2\times2\times2\times2\2\times2\times2=1024[/tex]

128 < 1024

2. [tex]2^2=2\times2=4[/tex]

[tex]5^2=5\times5=25[/tex]

[tex]4\times25=100[/tex]

[tex]=100[/tex]

[tex]2^{10} = 1024[/tex]

100 < 1024

3. [tex]2^5 = 32[/tex]

[tex]5^2=25[/tex]

[tex]32\times25=800[/tex]

[tex]10^2 = 10\times10 = 100[/tex]

800 > 100

Hope this helps.

A rectangular solid measures 150cm by 100cm by 200cm calculate the volume

Answers

Answer:

3000000cm³

Step-by-step explanation:

150cm x 100cm x 200cm = 3000000cm³

What is the value of x in the diagram below? If necessary, round your answer
to the nearest tenth of a unit.
14
х
B
L
D
с
30
O A. 30.1
B. 6.5
C. 14
O D. 16

Answers

Answer:

D. 16

Step-by-step explanation:

Homework help!!!!!!!

Answers

Answer:

r = -9

Step-by-step explanation:

the less the negative number is the more it is .

I need help with this question. Thank you!

Answers

Answer:

gradient is the same as slope The gradient or slope of line A = 3/1 or 3

The gradient of line B is -4/1 or -4

gradient or slope = rise over run = y/x.

if the line goes up from the left to the right, The slope is positive.

if the line goes down from the left to the right, The slope is negative

By visual inspection alone, which one of the following pairs of variables has a stronger relationship between them?
1. Community violence exposure and Bullying by peers have a strong relationship at -0.24.
2. Community violence exposure and Bullying by peers have a strong relationship at 0.20.
3. Community violence exposure and SAT-9 Mathematics have a stronger relationship at -0.24.
4. Community violence exposure and SAT-9 Mathematics have a stronger relationship at 0.20.

Answers

Boiii. Job. Look. Jkjk. Bbh. Bbhhh yes I did
but yuyyyyyyyy

Two more than the quotient of a number and 4 equals 7.

Answers

Answer:

20

Step-by-step explanation:

we can set up the equation like this:

n/4 + 2 = 7

subtract 2 from both sides

n/4 = 5

multiply 4 to both sides and you get...

n = 20

Can someone please help me with this problem

Answers

Answer:

A is the right one

Step-by-step explanation:

if not I'm sorry I'm here to help

Joe's employer will reimburse him $0.17 per miles driven. If Joe drives 104.43 miles on a business trip, what is his mileage reimbursement?

Answers

Answer:

17.75

Step-by-step explanation:

You can rewrite the sentence as

$0.17*104.43=

Which is  17.7531

Round it money which is 17.75

Therefore 17.75 is your answer

Hope this helps!

find the value of 3x^3y-2xy^2 when x=3 and y=-2​

Answers

Answer:

sorry I don't remember bye I will try to remember

It’s -30
3^3^3^-2-2^3^-2^2 = -30

A biased coin has a probability of 0.4 of coming up heads. What is the probability that when flipped one hundred times it comes up heads half of the trials or more. Give answer to at least three decimal points.

Answers

Using the binomial probability relation ; the probability that an head is obtained at least 50 times is 0.0271

Using the binomial probability relation :

P(x = x) = nCx * p^x * q^(n-x) p = probability of success = 0.4q = 1 - p = 0.6n = number of trials = 100

P(x ≥ 50) = p(x = 50) + p(x = 51) + ...+ p(x = 100)

Using a binomial probability calculator :

P(x ≥ 100) = 0.0271

Therefore, the probability that atleast 50 heads are obtained in the trial is 0.0271

Learn more :https://brainly.com/question/12474772

Other Questions
I HAVE MORE PLS HELP ITS DUE TOMORROW At a movie theater, there were 7 kidsfor every 2 adults. If kids tickets cost $5and adult tickets cost $8, how muchmoney did the theater make if therewere 54 people in the theater? how does chromatid cohesion as maintained by cohesin proteins differ in mitosis and meiosis? can someone help me solve this Y= q-k/n for q classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2 g(x) = 3x-1f(x) = x + 5.find g (f (4) What one accomplishment do you consider to be the greatest of the ancient Mesopotamian civilizations? help plz 20 points What is the equation of the line that passes through the point (-6, -7) and has a slope of 0 what dreams do you have?please write 44 words (Someone help asap! I searched this question but some people are saying true and others are saying its false so im not sure what to do cause the test im doing is a huge part of my grade.)Is this statement true or false?One of the reasons for the lack of Indian unity in fighting Europeans was, that the Indians were descended from different peoples who came in different waves of immigration.truefalse tortoise A walks 32 feet per hour and Tortoise B walks 8 inches per minute. who travels faster A family wants to be able to give their child $5,000 per year for 4 years of college. The child will leave for college in 8 years, at which point the family will stop contributing to the college fund. How much money should be set aside each year on the child's birthday in order to follow through with this plan Part A and Part C the same? Why or why not? Find the elapsed time of 8:45AM to 1:10 PM Similar to el Zcalo, what public spaces in the United States play host to major celebrations and protests? And in other parts of the world? 1. Rice, beans tortillas, and plantains are common foods in Central American countries. Where does the comma belong in this sentence? hello and good morning, todays question is..name the most popular thing today. vs the most popular item in the 90s a serious neck injury may leave a person paralyzed from the neck down. explain why. $200 is divided in the ratio 6: 4, What is the smaller part? What is the molecule in this image?Nucleic acid A protein A lipidA carbohydrate