classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2

Answers

Answer 1

The reaction Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq) is a precipitation reaction.

A chemical reaction is said to occur when two or more substances are combined to produce new substances. Chemical reactions are classified based on the kind of change taking place in the reaction.

In the reaction;

Pb(NO3)2(aq) + NiCl2(aq)---------> PbCl2(s) + Ni(NO3)2(aq)

We can see that a solid is formed when lead II nitrate reacts with nickel II chloride. This is a precipitation reaction.

Learn more: https://brainly.com/question/5624100


Related Questions

Alex mixed soy sauce and vinegar and created mixture that has a uniform appearance all throughout. he also noticed that the components are not recognizable and are evenly mixed.Which type of mixture was he able to create

a.heterogeneous
b.homogeneous
c.solid in liquid
d.solid in liquid​

Answers

Answer:

b.homogeneous

Can I have a Brainliest please?

Explanation:

In all the examples in the simulation, are atoms conserved?

Answers

Atoms are conversed in a Chemical reaction.

What is a Chemical reaction ?

A chemical reaction is a process in which chemical bonds between atoms to break and reorganize, to form other new substances. In chemical reaction matter cannot be created or destroyed.  It is called the law of conservation of mass.

Thus from the above conclusion we can say that Atoms are conversed in a Chemical reaction.

Learn more about the Chemical reaction here:

https://brainly.com/question/11231920

#SPJ2

Why is mining for coal a long-term concern?

A. It is being replenished faster than it can be mined.
B. The supply will eventually be exhausted.
C. New methods of mining need to be developed.
D. The demand for coal is diminishing.

Answers

Answer: Is B: the supply will eventually be exhausted.

Explanation:

there is only so much coal in the world as in many other elements. That is why we are looking for more appropriate and resourceful way of supplying energy and it is a lot safer for the workers involved

As coal is a nonrenewable source of energy so its supply will eventually be exhausted. Therefore, option (B) is correct.

What are nonrenewable sources of energy?

Non-renewable energy can be described as energy that comes from fossil fuels such as coal, natural gas, crude oil, and uranium. Non-renewable energy requires human intervention to create it suitable for consumption. Fossil fuels are generally made up of Carbon. Fossil fuels were produced over 300 million years ago.

Non-renewable energy is generally fossil fuels such as coal, oil, natural gas, etc. Fossil Fuels are produced from the remains of animals and plants and can be is divided into three categories.

To produce natural gas from fossil fuels, the decomposition process is longer and conducted with high amounts of pressure and heat. Coal takes millions of years under the crust of the earth to produce through the decomposition of trees, plants, and ferns.

Learn more about nonrenewable sources of energy, here:

https://brainly.com/question/10402348

#SPJ2

3. Compare What is the
difference between a
chromosome and a
chromatid?
(Please answer in a simple sentence)

Answers

Answer:

A chromosome is a thread-like structure present in the nucleus  that is made up of a single molecule of DNA and proteins, carrying some or all genetic materials of an organism. A chromatid is an identical half of a duplicated chromosome

Explanation:

what type of energy is the sum of kinetic and potetinal energy in an object that is used to do work

Answers

Answer:

mechanical energy

Explanation:

A chemical reaction takes place in a closed system. The mass of the reactants before the reaction was grams. What must the mass of the products of the reaction be, according to the law of conservation of mass?

A. 35 grams B. 30 grams C. 70 grams D. 25 grams

Answers

Answer:

D. 25 grams

Explanation:

I think that's what the answer is

Multiple choice (ASAP!)

Answers

Answer:

c

Explanation:

oxygen is lost electrons are added in oxidation state is decreased

Answer:

the correct answer is C

hope this helps <3

Pure iron, Fe , can be produced from an ore called hematite, Fe2O3 , by reaction with carbon at high temperatures. 2Fe2O3+3C⟶4Fe+3CO2 How many tons of hematite must react with carbon if an iron company needs to make 49 tons of iron?

Answers

70 tons of hematite (Fe₂O₃) is needed to produce 49 tons of iron (Fe).

We'll begin by calculating the tons of hematite (Fe₂O₃) that reacted and the tons of Fe produced from the balanced equation. This is illustrated below:

2Fe₂O₃ + 3C —> 4Fe + 3CO₂

Molar mass of Fe₂O₃ = (56×2) + (16×3) = 160 g/mol

Mass of Fe₂O₃ from the balanced equation = 2 × 160 = 320 g

Divide by 907185 to express in ton

320 / 907185 = 0.000353 ton

Molar mass of Fe = 56 g/mol

Mass of Fe from the balanced equation = 56 × 4 = 224 g

Divide by 907185 to express in ton

224 / 907185 = 0.000247 ton

SUMMARY

From the balanced equation above,

0.000353 ton of Fe₂O₃ reacted to produce 0.000247 ton of Fe.

Finally, we shall determine the tons of hematite (Fe₂O₃) needed to produce 49 tons of Fe. This can be obtained as follow:

From the balanced equation above,

0.000353 ton of Fe₂O₃ reacted to produce 0.000247 ton of Fe.

Therefore,

X ton of Fe₂O₃ will react to produce 49 tons of Fe i.e

X ton of Fe₂O₃ = [tex]\frac{0.000353 * 49}{0.000247} \\\\[/tex]

X ton of Fe₂O₃ = 70 tons

Thus, 70 tons of hematite (Fe₂O₃) is needed to produce 49 tons of Fe.

Learn more: https://brainly.com/question/15343472

which is more likely HON or HNO

Answers

NO- (isoelectronic or same as O2) is hard base

H+ is hard acid

bonding depends which pi* has more electron density and calc shows more on N...hence HNO is more likely (bent) molecule

whatever....


Which temperatures originally represented the fixed points
Celsius temperature scale?

Answers

Answer:Since 1743 the Celsius scale has been based on 0 °C for the freezing point of water and 100 °C for the boiling point of water at 1 atm pressure. Prior to 1743 the values were reversed (i.e. the boiling point was 0 degrees and the freezing point was 100 degrees).

Explanation: i no it

with examples of amino acids, explain the type of isomerism that exists in amino acids.​

Answers

Answer:

All amino acids are stereoisomers with the exception of glycine (because it has no chiral centers) and the two types are enantiomers and diastereomers

Explanation:

Not sure how in depth you need but the most fundamental categories are:

Enantiomers: non superimposable images which means that they cannot be placed on top of one another and look perfectly identical and instead are structurally the same but flipped in the opposite direction. An example being D-alanine and L-alanine.

Diastereomers: The molecules are superimposable which means they have an identical structure that will look the same placed on top of one another however, the compounds attached to the structure are placed in different orders an example being, L-isoleucine and D-allo-isoleucine (compounds in same place but isoleucine has two hydrogens positioned forward while allo-iso have one positioned forward and one positioned in the back)

The common type of isomerism among amino acids is the optical isomerism.

Isomerism refers to a situation in which there are two or more compounds that have the same molecular formula but different structural formulas. When two compounds have the same molecular formula but different atom to atom connectivity, they are called stereoisomers. Stereoisomers that are mirror images of each other are called enantiomers.

The common type of isomerism among amino acids is the optical isomerism. The optical isomers of alanine are shown in the image attached.

Learn more: https://brainly.com/question/8592296

what city building could represent the cytoplasm

Answers

Answer:

the ground of the building or supports

Explanation:

because that's what holds the building in place

What is the name of the ion with 4 neutrons and 4 electrons with a 1- charge?

A: Hydrogen
B: Berrylium
C: Lithium
D: Helium

Answers

Answer:

C.

Explanation:

I search it on Gøogle

What scientific term is a well-tested explanation for a set of observations or experimental results?

law
theory
method
conclusion

Answers

Answer:

b) theory

Explanation:

Answer:

theory or, conclusion is the answer

what is the importance of hydrogenation​

Answers

Answer:

It improves the oxidative stability of the oil.

The hydrogenation process increases the melting point of the fat, which changes liquid oil into solid shortening.

Explanation:

<
Time's Up!
Submit
Balance the following chemical equation (if necessary):
Rb(s) + RbNO3(s) → Rb2O(s) + N2(g)
3C,
2-
Reset
OS
< >
1
3
4
2.
5
07
6
7
8.
9
o

Answers

Answer:

im sorry but what is it post to be

Explanation:

Multiple Choice Question
What do molecules in a bowl of hot soup do?
A. Disperse
B. Evaporate
C. Vibrate
D. Sublimate
Submit

Answers

Answer:

Explanation:

i would say not d im not fully sure but id say c

When molecules present in a bowl of hot soup then they do vibration due to high kinetic energy.

What are molecules?

Molecules are the example of chain substance, which can be prepared by the addition of two or more than 2 atoms of same or different nature.

In a hot soup bowl, kinetic energy of the molecules present in that soup increases due to which they move with higher velocity and also shows vibration in their mean position.

Hence, option (C) is correct i.e. vibrate.

To know more about kinetic energy, visit the below link:
https://brainly.com/question/19555619

If gas is truly to be classified as a form of matter this means it can be measured. What form of gas can be measured?

Answers

Answer:

Gas is sometimes measured in cubic feet at a temperature of 60 degrees Fahrenheit and an atmospheric pressure of 14.7 pounds per square inch. Gas production from wells is discussed in terms of thousands or millions of cubic feet (Mcf and MMcf). Resources and reserves are calculated in trillions of cubic feet (Tcf).

Answer:

A dry gas, that is a natural gas, is the form in which gas can be measured.

And gas is measured in cubic meter, that is, it's volume is measured and the size of gas can be determined.

All the best!

Please help me. I can’t give too much points bc I don’t have too much.

QUANTUM=
The relationship between energy and frequency=
E = hy
EN
h=
V=
Albert Einstein: PHOTONS

Answers

Answer is photons hope this helps

How many molecules are present in 40g of c02

Answers

Answer:

2.258x 10 above 24 molecules

Explanation:

We use Avogadro's number of 6.022×1023 molecules per mole to calculate the number of molecules from the number of moles represented by 165 g of carbon dioxide.

The gram-molecular weight of carbon dioxide can be calculated from the atomic weights for carbon and oxygen (two of them in CO2) given in a Periodic Table of the Elements.

165 g CO244.01 g/mol×6.022×1023moleculesmol

=2.258×1024molecules

Is this equation balanced and in the lowest form?

4NH3 → 2N2 + 6H2

Answers

Answer:

It's balanced but not in the lowest form

Explanation:

The actual equation is given by

[tex]\\ \sf\longmapsto 2NH_3\longrightarrow N_2+3H_2[/tex]


Where is groundwater stored?


Answers

Answer:

Answer Below! : )

Explanation:

Groundwater is stored in the tiny open spaces between rock and sand, soil, and gravel. How well loosely arranged rock (such as sand and gravel) holds water depends on the size of the rock particles.

Hope this helps! : )

Answer:

Underground  brainliest plz

Explanation:

Three rocks are rolling down a hill at the same speed. Rock 1 has a mass of 1 kg1 kg; rock 2 has a mass of 1.5 kg1.5 kg, and rock 3 has a mass of 3 kg3 kg. Which rock has the most kinetic energy?

Answers

Answer: The first one has the most kinetic energy. Why? traveling with the slowest speed comes with the faster stop withholding more energy in the stone

Explanation:

What is extrapolation?
A. Predicting data that fall beyond a known data point
B. Estimating data that fall between two known data points
C. Finding a line that follows closely to all the points
O D. A close relationship between two events

Answers

Answer:

A. Predicting data that fall beyond a known data point

Explanation:

Extrapolating is unreliable because you are predicting data outside of the data range - anything could happen for the data to stop following the trend or pattern

Butanoic acid + 2 propanol

Answers

Answer:

propyl butanoate

Explanation:

does xef4 have resonance structure?​

Answers

Answer:

Yes

Explanation:The structure of XeF4 is square planar.

Define physical and chemical properties, provide three examples of each, discuss their reversibility, and
explain the fundamental differences between them.

Answers

Physical properties are defined as the properties
which can be observed without changing its
chemical composition.
For example: color, volume, and molecular
weight.
Chemical properties are defined as the
properties which can be observed only after
changing chemical identity of the substance.
For example: reactivity, toxicity, and
flammability.
The fundamental differences between physical
and chemical properties are as follows:
Chemical properties are related to
chemical bonds of the substance while physical
properties are not.
In chemical properties, chemical identity of
substance changes while physical properties do
not have any change.
Chemical properties predict the reaction of
substance while physical properties only describe
the appearance of the substance.


1. How many MOLECULES are contained in 80.0 grams of sodium hydroxide?

Answers

Answer:

2 molecules

Explanation:

In 80 grams there will be 2 molecules of NaOH, so mass of Sodium would be 23 x 2 = 46g.

Looking at the above diagram, which side would be considered an acid AND explain how do you know this?

Answers

Answer:

The side with lots of H+ and low pH

Explanation:

Because one of the feature of an acid is the ability to dissociate to H+.

And it has lower pH because the concentration of H+ is more than OH-

Select the correct answer. Which statement best describes how chemical equations demonstrate conservation of mass? O A. The number of reactants is the same as the number of products. O B. The compounds are the same on each side of the reaction. O c. The number of atoms of each element is the same on each side of the equation. OD. The state of matter is the same on each side of the equation.
Note:
No need to explain.​

Answers

Answer:

Option C )The number of atoms of each element is the same on each side of the equation.

Answer:

Option D

Hope it helps you

Other Questions
what is the process called when a glacier deposits rocks in oceans and lakes? Do you believe they technology has had a positive or a negative impact on society ? Give me three example please PLEASE HELP ME !!!!!!!!! WILL GIVE YOU THE BRAINLIEST!!!!Fill in the blanks in the dialogue below using the following words.(assez, plus, grand, trs, beaucoup, petit) Olivier: Bonjour La! Dis-donc il est super _________ ton sac dos!La: Ben oui, j'ai ____________ de livres et ils sont _____________ lourds (heavy). Toi, ton sac, il est beaucoup plus __________ que le mien.Olivier: Oui, mais il est _______________ grand pour mes livres et mes crayons. Hi I just need an answer btw its science not physics suppose 48 out of every 120 people like baseball. of the people who like baseball 3 out of 5 play base ball if you ask 500 people how many would play baseball Why people living in bhutan celebrate blessed raining day in autumn and people in Australia celebrate in spring 1) Jen spends $5.98 on ribbon. Ribbon costs $0.92 per meter. How manymeters of ribbon does Jen buy? Which equation represents a proportional relationship?A) y=5B) x=3C) y=2x+3D) y=1/4x Deshaun is estimating the weight of his mountain bike. The actual weight of his mountain bike is 11.3 kg. Deshaun's estimate is 12 kg.Find the absolute error and the percent error of Deshaun's estimate. If necessary, round your answers to the nearest tenth. Select the correct picture for the following wordAmrica del NorteOOVIEW GRADE DETAILSSubmissionSign outlaMO Ang mga sumusunod na pang yayari Ang nagingdahilan ng Sigaw sa Pugad -Lawin maliban sa Isa . During the age of Imperialism and Colonization what percentage of the world was dominated by Great Britain? Evan drives a golf ball with an initial velocity of 49 meters per second at an angle of 16 degrees own a flat driving range. How far will the golf ball land? May I please receive help? What is another name the Russian character is referred to as? Why is this name used? What does the reference to this name symbolize? The heart of darkness Answer HereWhy is 0.0123 x 107not in the correct ScientificNotation format? 9. Aaron has a lemonade business. If he sells each glass of lemonade for $2.75, and he sold 11glasses of lemonade today, how much money did Aaron make? Help me please this is due answer the question please Help pleaseeeeeeeeeeee biblioteca porque (because) me gusta leer.2. Choose the correct definite article: Voy aa. elb. lalasd. losroo oo What system did colonial courts (and modern ones) use as guidelines for trials?