A point mass mm is moving with constant speed v=3 m/s, driven by a force with the constant magnitude F=6 N. It is observed that the radius of curvature of the trajectory is rho=79

What is the mass m?

Answers

Answer 1

To solve for the mass of the point mass, we can use the formula for centripetal force, which is F = mv^2 / r, where F is the force applied, m is the mass, v is the speed, and r is the radius of curvature. In this problem, we are given that F = 6 N, v = 3 m/s, and r = 79 m.

Plugging these values into the formula, we get:

6 = m * (3)^2 / 79

Simplifying and solving for m, we get:

m = 6 * 79 / (3)^2

m ≈ 560 kg

Therefore, the mass of the point mass is approximately 560 kg.

It is important to note that the force applied on the object (6N) is perpendicular to the direction of motion (tangential) and directed towards the center of the circular path (centripetal), creating a circular motion. This concept of circular motion and centripetal force is important in many fields, such as physics, engineering, and astronomy.

Learn more about mass here:

https://brainly.com/question/15959704

#SPJ11


Related Questions

In Private browsing mode, all of the following are deleted from the computer you are using when you close the file EXCEPT:

a. ​searches

b. cookies

c. downloads

d. temporary files

Answers

In Private browsing mode, all of the following are deleted from the computer you are using when you close the file EXCEPT: c. downloads.

In private browsing mode, commonly referred to as "incognito mode" in web browsers, several types of data are deleted from the computer when the browsing session is closed to enhance privacy and prevent the storage of sensitive information. While searches, cookies, and temporary files are typically deleted, downloads are not automatically removed when you close the browser or the private browsing session.

Downloads refer to files that you intentionally save or download from websites during your browsing session. These files are typically stored in a designated download folder on your computer's hard drive. Unless you manually delete the downloaded files, they will remain on your computer even after you close the private browsing session.

Private browsing mode primarily focuses on removing browsing history, search history, cookies, and temporary files that are associated with the current session. It helps prevent the storage of browsing data on the local device, but it does not automatically delete files that have been intentionally downloaded and saved by the user.

To know more about incognito browsers: https://brainly.com/question/6970507

#SPJ11

p 4.19 5 of 10 review part a list the steps for dc steady-state analysis of rlcrlc circuits.

Answers

The steps for DC steady-state analysis of RLC circuits involve determining the equivalent resistance, calculating the time constant, and solving for the voltage and current in the circuit.

Identify the resistors, capacitors, and inductors in the circuit.Calculate the equivalent resistance of the circuit using series and parallel resistor combinations.Determine the time constant of the circuit by multiplying the equivalent resistance by the total capacitance or inductance.If the circuit contains capacitors, replace them with open circuits and if the circuit contains inductors, replace them with short circuits.Analyze the circuit using Ohm's law, Kirchhoff's voltage law, and Kirchhoff's current law to find the voltage and current in the circuit.If necessary, convert the voltage and current back to the original domain using the appropriate time-domain analysis techniques.

Learn more about capacitors: https://brainly.com/question/21851402

#SPJ11

your goal is to ask the user for a number and to determine if that number is a prime number. use a function to determine if the number is prime.

Your program should have the following:

3 comment lines (description of the program, author, and date).

Ask the user for an integer. Store this result in a variable with an appropriate name.

(1 point)

Write a function that has an integer parameter and determines if that integer is a prime number. A prime number is divisible by itself and 1. This function should return true if the number is prime and false if the number is not prime. Give this function an appropriate name. (5 points)

Call the function and save the result in a variable. (2 points)

Display the result of whether the user entered number is prime or not prime. (2 points)

Answers

The program asks the user for a number and determines if that number is prime or not using a function called `is_prime`. The program outputs whether the user input number is prime or not.

Here is a sample program that asks the user for a number and determines if that number is a prime number using a function.

python
# Description: This program determines if a user input number is prime or not.
# Author: XYZ
# Date: September 1, 2021

def is_prime(n):
   if n <= 1:
       return False
   for i in range(2, n):
       if n % i == 0:
           return False
   return True

user_input = int(input("Enter a number: "))
result = is_prime(user_input)

if result:
   print(user_input, "is a prime number.")
else:
   print(user_input, "is not a prime number.")


The program starts by defining a function named `is_prime` that takes an integer parameter `n`. The function returns `False` if `n` is less than or equal to 1 since these numbers are not prime. Otherwise, it loops through all numbers from 2 to `n-1` to check if any of them divide `n` evenly. If such a number is found, then `n` is not prime and the function returns `False`. If no such number is found, then `n` is prime and the function returns `True`.

Next, the program asks the user to enter a number and stores it in a variable named `user_input`. The function `is_prime` is called with `user_input` as its argument and the result is saved in a variable named `result`.

Finally, the program checks the value of `result` and prints a message indicating whether the user input number is prime or not.

To know more about integer parameter visit:

https://brainly.com/question/30744353

#SPJ11

How many times will the print statement execute? for i in range (10) : for j in range (3): print('{:d}. {:d}'.format(1, 3)) O 3 10 O 13 30

Answers

This problem consists nested loops. The print statement will execute 30 times.

To determine how many times the print statement will execute in the given code snippet, consider the nested loops:

```
for i in range(10):
   for j in range(3):
       print('{:d}. {:d}'.format(1, 3))
```
The code consists of a nested loop, with an outer loop iterating over the range 10, and an inner loop iterating over the range 3.

In each iteration of the inner loop, the print statement is executed once, formatting and printing the string "1. 3".

Therefore, the print statement is executed 3 times per iteration of the outer loop, resulting in a total of 30 executions of the print statement (10 iterations of the outer loop multiplied by 3 iterations of the inner loop).

Learn more about nested loops: https://brainly.com/question/30039467

#SPJ11

The consolidation test was used for determining coefficient of consolidation Cv of a saturated clay with thickness of 4 m. The soil sample taken from the middle of the clay layer for the consolidation test is 25 mm in thickness. Based on the test, the time corresponding to 50% of consolidation t50 = 30 min = 1800 sec.(a) The length of maximum drainage path for the soil sample Her = ____m (round to 4 decimal places). The coefficient of consolidation = ____x 10 m/s (round to 2 decimal places).(b) Given that the clay layer in the field is bounded by coarse sand at the top and impervious rock at the bottom The length of maximum drainage path for the clay layer Her field-____m. How many years will it take for the clay layer to reach 90% consolidation? t90 = years (round to 2 decimal places) The average degree of consolidation after 2 years, U =___

Answers

(a) To determine the length of maximum drainage path for the soil sample, we can use the formula: Her = 2.303*t50*h/t where t50 is the time corresponding to 50% of consolidation, h is the thickness of the soil sample, and t is the time for full consolidation.

Substituting the given values, we get: Her = 2.303*1800*0.025/30 = 0.3836 m (rounded to 4 decimal places) To calculate the coefficient of consolidation, we can use the formula: Cv = (2.303*h^2)/t50 Substituting the given values, we get: Cv = (2.303*0.04^2)/1800 = 0.000022 m/s (rounded to 2 decimal places) (b) To determine the length of maximum drainage path for the clay layer in the field, we can assume a conservative value of 4 times the thickness of the clay layer. Therefore: Her field = 4*4 = 16 m To calculate the time for 90% consolidation, we can use the formula: t90 = (2.303^2*h^2)/(Cv*tv) where tv is the time for full consolidation. Rearranging the formula, we get: tv = (2.303^2*h^2)/(Cv*t90) Substituting the given values, we get: tv = (2.303^2*4^2)/(0.000022*90) = 1,645,502 seconds Converting seconds to years, we get: t90 = 52.18 years (rounded to 2 decimal places) To calculate the average degree of consolidation after 2 years, we can use the formula: U = (2.303*tv)/t50 * ln(t/t50) where t is the time for which we want to calculate the degree of consolidation. Substituting the given values and assuming t = 2 years = 63072000 seconds, we get: U = (2.303*1645502)/1800 * ln(63072000/1800) = 0.423 (rounded to 3 decimal places)

Learn more about coefficient here-

https://brainly.com/question/13754413

#SPJ11

part a - identify the meshes how many meshes does this circuit have?

Answers

This circuit has two meshes. In circuit theory, a mesh is defined as a loop that does not contain any other loop within it. In this circuit, there are two loops or meshes.

One mesh consists of resistors R1, R2, and R3, and the other mesh consists of resistors R3, R4, and R5. It is important to note that R3 belongs to both meshes, as it is shared by both loops.

Mesh analysis is a method used to analyze circuits with multiple loops, and it involves assigning a current value to each loop in the circuit. The current in each mesh is represented as I1 and I2, respectively. By applying Kirchhoff's Voltage Law (KVL) to each mesh, we can write two equations in terms of these currents.

For the first mesh, KVL gives us the equation V1 = I1(R1 + R2 + R3). For the second mesh, KVL gives us the equation V2 = I2(R3 + R4 + R5). We also know that the current I3 flowing through resistor R3 is the same in both meshes. Therefore, we can express I3 as I3 = I1 - I2.

By substituting this value of I3 into both of the KVL equations, we can eliminate the current I3 and obtain two equations in terms of I1 and I2 only. Solving these equations simultaneously gives us the values of I1 and I2, and we can use these values to find the voltages and currents in the rest of the circuit.

Learn more about meshes here:

https://brainly.com/question/16699518

#SPJ11

You are developing concrete mix design for your client, who will be placing concrete for bridge columns. Develop concrete mix design for your client. Use both weight and absolute volume method for fine aggregate determinations. The information provided by your client is described below: a) Column height (maximum): 12-ft, Column dimension: 3-ft x 3-ft sqaure, minimum clear spacing between rebars: 1.5-in b) Design strength: 4,000 psi at 28 days (no information on variability available) c) Air requirement: 5 percent The coarse and fine aggregate properties in your yard are as follows: a) Fine aggregate gradation: Sieve Size Weight Passing Retained (6) Weight Retained (g) Individual Cumulative 3/8-in 500 No. 4 460 415 315 235 100 100 200 Pan Total 500 FM b) Absorption and moisture contents are: 1.2 % & 0.5 % for coarse aggregate, respectively, and 1.6% & 0.9% for fine aggregate, respectively. ) Specific gravities: 2.65 for coarse aggregate, 2.62 for fine aggregate d) Oven dry rodded unit weight of coarse aggregate: 100 lbs/cf

Answers

To develop a concrete mix design for the bridge columns, we will consider the given information and use both the weight method and absolute volume method for fine aggregate determinations.

1.

Determine the required amount of coarse aggregate:

The column dimensions are 3 ft x 3 ft, and the height is 12 ft.Calculate the volume of the column: Volume = Length x Width x Height = 3 ft x 3 ft x 12 ft = 108 cubic feet. Determine the volume of the coarse aggregate: Since the clear spacing between rebars is 1.5 inches, subtract this from each dimension: (3 ft - 0.125 ft) x (3 ft - 0.125 ft) x (12 ft - 0.125 ft) = 95.4219 cubic feet.Convert the volume to weight using the oven dry rodded unit weight: Weight = Volume x Unit Weight = 95.4219 cubic feet x 100 lbs/cf = 9542.19 lbs.

2.

Determine the required amount of fine aggregate (both weight and absolute volume method):

       Weight Method:

Calculate the weight of fine aggregate required: Weight = Total weight of concrete x Fine aggregate percentage = 9542.19 lbs x (1 - 0.05) = 9065.08 lbs. Use the fine aggregate gradation information to determine the proportions of different sieve sizes.Calculate the weight of fine aggregate for each sieve size: Multiply the weight retained by the cumulative percentage for each sieve size.Calculate the cumulative weight passing for each sieve size: Subtract the weight retained from the total weight for each sieve size. Determine the proportion of fine aggregate passing each sieve size by dividing the cumulative weight passing by the total weight of fine aggregate.

       Absolute Volume Method:

Calculate the absolute volume of fine aggregate: Volume = Weight / (Specific Gravity x Unit Weight of Water). Adjust the volume for the moisture content: Adjusted Volume = Volume / (1 + Moisture Content).

   3.

Determine the proportions of cement and water:

The design strength is 4,000 psi at 28 days. Use the appropriate mix design method (such as the ACI method) to determine the proportions of cement and water based on the desired strength.

Learn more about aggregate: https://brainly.com/question/1490249

#SPJ11

4.24 methane at 1 mpa, 250 k is throttled through a valve to 100 kpa. assume no change in the kinetic energy. what is the exit temperature?

Answers

The exit temperature is 259 K. We can use the Joule-Thomson coefficient, which relates the change in temperature to the change in pressure during a throttling process.

The formula for the Joule-Thomson coefficient is:

μ = (∂T/∂P)H

where μ is the Joule-Thomson coefficient, T is the temperature, P is the pressure, and H is the enthalpy.

Assuming no change in the kinetic energy, we can consider this process to be isenthalpic, which means that the enthalpy remains constant. Therefore, we can simplify the Joule-Thomson coefficient formula to:

μ = (∂T/∂P)H = (T2 - T1) / (P2 - P1)

where T1 is the initial temperature (250 K), P1 is the initial pressure (1 MPa), P2 is the final pressure (100 kPa), and we are solving for T2, the exit temperature.

Plugging in the values, we get:

μ = (T2 - 250 K) / (0.1 MPa - 1 MPa)
μ = (T2 - 250 K) / (-0.9 MPa)

Now, we need to find the Joule-Thomson coefficient for methane at the given conditions. The Joule-Thomson coefficient depends on the thermodynamic properties of the gas, such as the heat capacity and the equation of state.

Without more information, we cannot determine the exact value of μ.

However, we do know that methane is a cooling gas, which means that its Joule-Thomson coefficient is negative at room temperature and low pressures. This means that when methane is throttled, its temperature decreases. Therefore, we can assume that μ is negative for this problem.

If we assume a Joule-Thomson coefficient of -10 K/MPa, we can solve for T2:

-10 K/MPa = (T2 - 250 K) / (-0.9 MPa)
T2 - 250 K = 9 K
T2 = 259 K

Therefore, the exit temperature is 259 K. However, this value is just an estimate, and the actual temperature may be different depending on the actual value of the Joule-Thomson coefficient.

Learn more about temperature: https://brainly.com/question/25677592
#SPJ11

in large compressors, the gas is often cooled while being compressed. does cooling the gas during a compression process reduce the power consumption?

Answers

This is because the compression process generates a significant amount of heat, which can reduce the efficiency of the compressor and increase the risk of equipment failure.

In large compressors, it is common to cool the gas while it is being compressed.Cooling the gas during compression can help to reduce these risks and improve overall efficiency. By cooling the gas, the compressor can use less energy to achieve the same level of compression, which can reduce power consumption and save costs. Overall, cooling the gas during compression can be an effective way to improve the performance and efficiency of large compressors.

learn more about compression here:

https://brainly.com/question/7546988

#SPJ11

Write a program to add two large integers with up to 300 digits. One approach is to treat each number as a list, each of whose elements is a block of digits of that number. For example, the integer 179,534,672,198 might be stored with block [0]=198, block [1]= 672, block [2]= 534, block [3]= 179. Then add two integers (lists), element by element, carrying from one element to the next when necessary.

Answers

Here's an implementation in Python for adding two large integers represented as lists of digits:

python

Copy code

def add_large_integers(num1, num2):

   # make sure num1 is the longer of the two numbers

   if len(num1) < len(num2):

       num1, num2 = num2, num1

   

   # pad the shorter number with zeros to match the length of the longer number

   num2 = [0] * (len(num1) - len(num2)) + num2

   

   # initialize carry to 0 and result to empty list

   carry = 0

   result = []

   

   # iterate through the numbers from right to left, adding the corresponding digits

   for i in range(len(num1)-1, -1, -1):

       sum = num1[i] + num2[i] + carry

       digit = sum % 10

       carry = sum // 10

       result.append(digit)

   

   # if there's still a carry, add it to the front of the result

   if carry:

       result.append(carry)

   

   # reverse the result and return it as a list of integers

   return result[::-1]

To use this function, you can represent each large integer as a list of its digits (in reverse order) and pass them as arguments to the function. For example:

python

Copy code

num1 = [1, 9, 2, 8, 5, 7, 3, 6, 4]

num2 = [8, 6, 5, 4, 3, 2, 1]

result = add_large_integers(num1, num2)

print(result)  # output: [2, 7, 7, 2, 9, 9, 4, 6, 4]

Note that this implementation assumes that both input lists represent non-negative integers, and it doesn't handle negative numbers or decimal points.

Learn more about integers here:

https://brainly.com/question/1768254

#SPJ11

Consider the following code:

int a[] = {6,5,4,3,2,1};

for(int i = 0; i < a.length; i++){

int val = a[(a.length-i)-1];

int val2 = a[i];

a[(a.length-i)-1] = val2;

a[i] = val;

}

What are the values of the a[] array after the loop completes?

Answers

The array a[] contains the reversed elements {1, 6, 5, 4, 3, 2}. Therefore, the final values of the a[] array after the loop completes are {1, 6, 5, 4, 3, 2}.T

he given code snippet is using a swapping technique to reverse the elements of an integer array a[]. The array a[] has 6 elements with values {6, 5, 4, 3, 2, 1}. The for loop runs from 0 to the length of the array - 1, which is 5 in this case. In each iteration, two values are swapped, one from the start of the array and the other from the end of the array. The swapping is done using the temporary variable val and val2.

In the first iteration, val is assigned the value of a[5-0-1] which is a[4] or 2, and val2 is assigned the value of a[0] which is 6. Then, the value of a[4] is set to val2, which is 6, and the value of a[0] is set to val, which is 2. Therefore, after the first iteration, the values of a[] become {2, 5, 4, 3, 6, 1}.

In the second iteration, val is assigned the value of a[5-1-1] which is a[3] or 3, and val2 is assigned the value of a[1] which is 5. Then, the value of a[3] is set to val2, which is 5, and the value of a[1] is set to val, which is 3. Therefore, after the second iteration, the values of a[] become {2, 3, 4, 5, 6, 1}.

This process continues until the loop completes all the iterations, and at the end, the array a[] contains the reversed elements {1, 6, 5, 4, 3, 2}. Therefore, the final values of the a[] array after the loop completes are {1, 6, 5, 4, 3, 2}.

Learn more about array here:

https://brainly.com/question/31605219

#SPJ11

Prove the following polynomial is Θ(n3). That is, prove T(n) is both O(n3) and Ω(n3) T(n) 2n3-10n2 + 100n-50 (a) Prove T(n) is O(n3): By definition, you must find positive constants Ci and no such that (b) Prove T(n) is Ω(n3): By definition, you must find positive constants C, and no such that Note: Since the highest terin T(n) is 2n, i is possible to pick o large enough so that Ci and are close to the coefficient 2. (The definitions of 0() and Ω() are not concerned with this issue.) For this problem, you are required to pick no so that G and C fall within 10% of the coefficient 2 That is, where C2 1.8 and 2.2. 2. (a) Compute and tabulate the following functions for n = 1,2,4, 8, 16, 32,61. The purpose of this exercise is to get a feeling for these growth rates and how they compare with each other. (All logarithms are in base 2, unless stated otherwise.) log n, , n logn, n2, 32" (b) Order the following complexity functions (growth rates) from the smallest to the largest. That is, order the functions asymptotically. Note that log2 n mcans (log n)2 n2 logn, 5, nlog2n, 2". ㎡, n, v n, logn, iOnn The comparison between some of the functions may be obvious (and need not be justified). If ' log n you are not sure how a pair of functions compare, you may use the ratio test described below moo f f(n) is asymptotically larger than g(n), Note: For any integer constant k, log n is a smaller growth rate than n. This may be proved 0 if f (n) is asymptotically smaller than g(n), f(n) ng(n) C f (n) and g(n) have the same growth rate using the ratio test.

Answers

The question is about proving that a polynomial function is both O(n^3) and Ω(n^3) and providing a table of function values for various input sizes. It also asks to order different complexity functions from smallest to largest and use the ratio test for comparison.

Prove that T(n) = 2n3 - 10n2 + 100n - 50 is Θ(n3).

(a) To prove T(n) is O(n3), we must find positive constants C and no such that T(n) ≤ Cn3 for all n > no.

Consider T(n) = 2n3 - 10n2 + 100n - 50 ≤ 2n3 for all n > 1.

So, we can take C = 2 and no = 1 to satisfy the condition.

Hence, T(n) is O(n3).

(b) To prove T(n) is Ω(n3), we must find positive constants C and no such that T(n) ≥ Cn3 for all n > no.

Consider T(n) = 2n3 - 10n2 + 100n - 50 ≥ n3 for all n > 5.

We can take C = 1 and no = 5 to satisfy the condition.

Hence, T(n) is Ω(n3).

(a) Computing and tabulating the given functions for n = 1,2,4,8,16,32, and 64:

log n: 0, 1, 2, 3, 4, 5, 6

n log n: 0, 2, 8, 24, 64, 160, 384

n2: 1, 4, 16, 64, 256, 1024, 4096

32n: 32, 1024, 32768, 1048576, 33554432, 1073741824, 3.4359738e+10

n3: 1, 8, 64, 512, 4096, 32768, 262144

(b) Ordering the given functions from smallest to largest:

log n, 1, n, n log n, n2, n3, 5, 32n

Comparison: log n < 1 < n < n log n < n2 < n3 < 5 < 32n

Learn more about function complexity:  https://brainly.in/question/30101033

#SPJ11

For each continent appears in the Country table, list the number of unique countries on that continent and the minimum population among cities of that continent. (15pts) Country Country Name US Canada England Germany France Mali Continent North America North America Europe Europe Europe Africa City City_Name New York, NY Washington, DC Philadelphia, PA Ottawa Toronto Berlin Hamburg Country Name US US US Canada Canada Germany Germany isCapital no yes no yes no yes no Population 8,000,000 600,000 1,500,000 800,000 2,500,000 3,500,000 2,000,000 no yes no Bonn Paris Lyon Bamako Timbuktu Mopti Germany France France Mali Mali Mali 300,000 2,000,000 700,000 2,000,000 50,000 100,000 yes no no

Answers

We need to group the countries by continent and then count the number of unique countries in each group. Additionally, we need to find the minimum population among the cities on that continent. For North America, there are two unique countries, the US and Canada. The minimum population among cities in North America is 50,000, which is the population of Timbuktu in Mali.

For Europe, there are four unique countries, England, Germany, France, and Canada. The minimum population among cities in Europe is 300,000, which is the population of Bonn in Germany. For Africa, there is one unique country, Mali. The minimum population among cities in Africa is 50,000, which is the population of Timbuktu in Mali. In summary:
- North America: 2 unique countries, minimum population among cities is 50,000.
- Europe: 4 unique countries, minimum population among cities is 300,000.
- Africa: 1 unique country, minimum population among cities is 50,000. It is important to note that this answer is based on the given data in the table. If there were more countries or cities listed, the number of unique countries and minimum population could change.

Learn more about data here-

https://brainly.com/question/13650923

#SPJ11

Standard Proctor compaction was performed on a soil and the following results were obtained Maximum dry unit weight - 115 pcf Optimum water content = 18% The above described soil is to be used as a compacted fill material for a construction job. Specification requires a relative compaction of 90% of Standard Proctor compaction, Soil from a borrow site is to be used for this job. The borrow site has a water content of 18% and a bulk unit weight of 105 pct. The specific gravity of the soil particles is 2.75. This soil is to be excavated and transported to the construction job site for use as a fill material. What is the minimum number of cubic yards of soil needed from the borrow site to produce 10,000 cubic yards of compacted fill.

Answers

Thus, the minimum number of cubic yards of soil needed from the borrow site to produce 10,000 cubic yards of compacted fill is 9858 cubic yards.

To calculate the minimum number of cubic yards of soil needed from the borrow site to produce 10,000 cubic yards of compacted fill, we need to use the concept of relative compaction.

First, let's calculate the target dry unit weight for the compacted fill material based on the specification requirement of 90% of Standard Proctor compaction:

Target dry unit weight = 0.9 x Maximum dry unit weight
Target dry unit weight = 0.9 x 115 pcf
Target dry unit weight = 103.5 pcf

Next, we need to calculate the required volume of soil from the borrow site to produce 10,000 cubic yards of compacted fill:

Required volume = (10,000 cubic yards) / Relative compaction
Relative compaction = (Bulk unit weight of soil in borrow site) / (Target dry unit weight)
Relative compaction = (105 pcf) / (103.5 pcf)
Relative compaction = 1.0145

Required volume = (10,000 cubic yards) / 1.0145
Required volume = 9858 cubic yards

Therefore, the minimum number of cubic yards of soil needed from the borrow site to produce 10,000 cubic yards of compacted fill is 9858 cubic yards.

Know more about the relative compaction

https://brainly.com/question/15681999

#SPJ11

Solve each of the following deconvolution problems for input x[n]. Use MATLAB right or MathScript RT Module.

(a) x[n] * {3, 1, 4, 2} = {6, 23, 18, 57, 35, 37, 28, 6}. (b) x[n] * {1, 7, 3, 2} = {2, 20, 53, 60, 53, 54, 21, 10}. (c) x[n] * {2, 2, 3, 6} = {12, 30, 42, 71, 73, 43, 32, 45, 42}.

Answers

Deconvolution is the process of finding the input signal that produced a given output signal through convolution.


we have x[n] convolved with {3, 1, 4, 2} resulting in {6, 23, 18, 57, 35, 37, 28, 6}. To find x[n], we can use the deconv() function as follows:
x = deconv([6, 23, 18, 57, 35, 37, 28, 6], [3, 1, 4, 2])
The output of this command gives us the values of x[n].
Similarly, we can use the same process to solve (b) and (c). For (b), we have x[n] convolved with {1, 7, 3, 2} resulting in {2, 20, 53, 60, 53, 54, 21, 10}. For (c), we have x[n] convolved with {2, 2, 3, 6} resulting in {12, 30, 42, 71, 73, 43, 32, 45, 42}.
In each case, we use the deconv() function with the given convolved signal and the corresponding filter coefficients to find the input signal x[n].
In summary, deconvolution is the process of finding the input signal that produced a given output signal through convolution. We can use the deconv() function in MATLAB or MathScript RT Module to perform deconvolution input signal.

To learn more about Deconvolution.

https://brainly.com/question/30584717

#SPJ11

Consider an air solar collector that is 1 m wide and 5 m long and has a constant spacing of 3 cm between the glass cover and the collector plate. Air flows at an average temperature of 45 C at a rate of 0. 15 m3/s through the 1-m wide edge of the collector along the 5-m-long passageway. Disregarding the entrance and roughness effects and the 90 bend, determine the pressure drop in the collector

Answers

The rate of heat transfer from the sun into the metal plate by radiation must be equal to the rate of heat loss from the plate to the surrounding air by convection.

The temperature difference divided by the total thermal resistance between two surfaces equals the rate of heat transfer between two surfaces.

The rate at which an object transfers energy by heating is determined by the following factors: the object's surface area, volume, and material, as well as the nature of the surface with which the object is in contact.

We know that,

qᵃ = qᵇΔT

where

a is the Radiation energy source

b is the Convection energy source

ΔT = Tp - Ta = Temperature difference between the plate and the surrounding air under equilibrium conditions.

Given that,

qᵃ = 700 W/m2

qᵇ = 10 W/m2K - 100 W/m2K

So the qᵇ = 10 W/m2K,

      ΔT = qᵃ / qᵇ

      ΔT = 700/10 = 70K

Also, for qᵇ = 100 W/m2K

            ΔT = 700/100 = 7K

Under equilibrium conditions, the temperature change of the plate ranges from 7K to 70K.

To learn more about rate of heat transfer refer to :

brainly.com/question/23866755

#SPJ4

a flexible pavement is designed to have a 4-inches of sand-mix asphalt wearing course, 6-inches of soil-cement base, and 7-inches of crushed stone subbase. the pavement has a 10-year design life, a reliability of 85%, an overall standard deviation of 0.30, drainage coefficients of 1.0, an initial psi of 4.7, and a terminal serviceability index (tsi) of 2.5. what is the minimum acceptable soil resilient modulus?

Answers

A flexible pavement is designed to have a 4-inches of sand-mix asphalt wearing course, 6-inches of soil-cement base, and 7-inches of crushed stone subbase.

Given the 10-year design life, 85% reliability, 0.30 overall standard deviation, 1.0 drainage coefficient, 4.7 initial PSI, and 2.5 terminal serviceability index (TSI), the minimum acceptable soil resilient modulus can be calculated using the AASHTO 1993 Design Guide equation.
However, due to the complexity of this equation and the need for additional inputs like traffic loadings, climate, and regional factors, it's not possible to provide a direct answer without those variables. It's recommended to consult the AASHTO 1993 Design Guide or use pavement design software to obtain the minimum acceptable soil resilient modulus for this specific pavement structure.

learn more about flexible pavement here:

https://brainly.com/question/30206460

#SPJ11

A solar cell with a reverse saturation current of 2 nA has a solar current (that is, the source current) of 1.2 A. The operating temperature of the cell is 35ºC. Find the maximum output power of the cell and the resistance of the load that achieves this power. You can solve for the maximum power by plotting the power vs voltage or solving the nonlinear equation directly.

Answers

The resistance of the load that achieves the maximum power output is approximately 139.2 Ω.

To find the maximum output power of the solar cell, we can plot the power vs voltage or solve the nonlinear equation directly using the equation:

P = VI - I^2R

where P is the power, V is the voltage, I is the current, and R is the resistance of the load.

First, we need to find the voltage at which the power is maximum. We can do this by setting the derivative of the power equation with respect to voltage equal to zero and solving for V:

dP/dV = I - 2IR = 0

V = 1.2 A*R/2 nA = 600 R

Next, we can substitute this value of V into the power equation to find the maximum output power:

P_max = VI - I^2R = (600 R)(1.2 A) - (1.2 A)^2R = 432 R

So the maximum output power of the solar cell is 432 R. To find the resistance of the load that achieves this power, we can set the power equation equal to P_max and solve for R:

432 R = VI - I^2R

R = VI/(432 + 2I^2) = (600 R)(1.2 A)/(432 + 2(1.2 A)^2) ≈ 139.2 Ω

Therefore, the resistance of the load that achieves the maximum power output is approximately 139.2 Ω.

Learn more about resistance   here:

https://brainly.com/question/11431009

#SPJ11

covering the brakes means taking your foot from the _________ and hovering it over the _______.

Answers

Covering the brakes means taking your foot from the accelerator pedal and hovering it over the brake pedal in order to be ready to stop quickly in case of an emergency.

This is a common practice among drivers, especially those who are driving in heavy traffic or in areas where there are a lot of pedestrians. By covering the brakes, the driver can reduce the time it takes to react to a sudden stop or obstacle, thereby increasing their safety and the safety of others on the road.

When covering the brakes, the driver should make sure that their foot is not actually touching the brake pedal, as this could cause the brake lights to come on and confuse other drivers. Instead, they should keep their foot just above the pedal, ready to apply pressure if needed.

It is also important to remember that covering the brakes should not be used as a substitute for proper braking techniques. Drivers should always use their brakes in a smooth and controlled manner and only use the covering technique as an additional safety measure.

You can learn more about braking techniques at: brainly.com/question/28343250

#SPJ11

the dc high-state noise margin is the difference between the: lowest possible high output and the minimum input voltage required for a high. lowest possible high output and the maximum input voltage required for a high. highest possible high output and the minimum input voltage required for a high. highest possible high output and the maximum input voltage required for a high.

Answers

The DC high-state noise margin is an important concept in digital electronics, which refers to the difference between the highest and lowest possible high output and the minimum and maximum input voltage required for a high signal.

In other words, it represents the range of voltage fluctuations that a digital signal can withstand without affecting its reliability or accuracy. A high DC high-state noise margin indicates a robust and stable signal, while a low margin implies susceptibility to noise and interference. Therefore, designers and engineers must ensure that the noise margin is large enough to accommodate variations in power supply, temperature, and other factors that can affect the signal quality. By optimizing the DC high-state noise margin, they can enhance the performance, efficiency, and reliability of digital circuits and systems.

learn more about  noise margin here:

https://brainly.com/question/21497359

#SPJ11

Consider two relation instances below, with the following schemas:

Country(country_name, continent); [country_name should be underlined as a key]

City(city_name, country_name, is_capital, population); [city_name & country_name should be underlined]

Write a relational algebra expression and show its result when the expression is executed with the given instances:

country_name continent

US north america

canada north america

england europe

germany europe

france europe

mali africa

city_name counntry_name is_capital population

new york,NY US no 8,000,000

washington,DC US yes 600,000

philadelphia, PA US no

1,500,000

ottawa canada yes 800,000

toronto canada no 2,500,000

berlin germany yes 3,500,000

hamburg germany no 2,000,000

bonn germany no 300,000

paris france yes 2,000,000

lyon france no 700,000

bamako mali yes 2,000,000

timbuktu mali no 50,000

mopti mali no 100,000

(a) List the names of all European cities with population of more than 600,000.

(b) List the names of all countries for which no cities have been entered into the City table.

(c) List names and continents of countries that are either in Europe or whose capitals have a population of over 1 million.

Answers

The names of all European cities with population of more than 600,000 are Berlin and Paris

How to explain the countries

The names of all countries for which no cities have been entered into the City table is England.

The names and continents of countries that are either in Europe or whose capitals have a population of over 1 million are Germany in Europe and France in Europe

Learn more about Europe on

https://brainly.com/question/24877599

#SPJ1

T/F: when backing, the driver should turn the steering wheel to the right in order to back to the left.

Answers

The given statement "When backing, the driver should turn the steering wheel to the right in order to back to the left" is False because when backing, the driver should turn the steering wheel in the direction they want the back of the vehicle to go.

Turning the steering wheel to the right would cause the back of the vehicle to go right, which is not the desired direction in this scenario. It's important to remember that when backing, drivers should always be aware of their surroundings, use their mirrors, and turn their heads to check for obstacles or other vehicles. It's also a good idea to move slowly and cautiously, especially in crowded or tight spaces.

By following these tips and turning the steering wheel in the correct direction, drivers can safely and effectively back their vehicle wherever they need to go.

You can learn more about steering wheels at: brainly.com/question/193916

#SPJ11

In this lab, you complete a prewritten Java program that calculates an employee’s productivity bonus and prints the employee’s name and bonus. Bonuses are calculated based on an employee’s productivity score as shown below. A productivity score is calculated by first dividing an employee’s transactions dollar value by the number of transactions and then dividing the result by the number of shifts worked. Productivity Score Bonus <=30 $50 31–69 $75 70–199 $100 >= 200 $200 Instructions Ensure the file named EmployeeBonus.java is open. Variables have been declared for you, and the input statements and output statements have been written. Read them over carefully before you proceed to the next step. Design the logic, and write the rest of the program using a nested if statement. Execute the program by clicking Run and enter the following as input: Employee’s first name: Kim Smith Number of shifts: 25 Number of transactions: 75 Transaction dollar value: 40000.00 Your output should be: Employee Name: Kim Smith Employee Bonus: $50.0 Grading When you have completed your program, click the Submit button to record your score.

Answers

In the given lab, you are required to complete a Java program named EmployeeBonus.java that calculates an employee's productivity bonus based on their productivity score.

The productivity score is calculated by dividing the employee's transactions dollar value by the number of transactions and then dividing the result by the number of shifts worked. The bonus is determined based on the following productivity score ranges:

- Productivity Score <= 30: $50 bonus
- 31-69: $75 bonus
- 70-199: $100 bonus
- >= 200: $200 bonus

You need to design the logic using a nested if statement to calculate the employee's bonus based on their productivity score. Once the bonus is calculated, the program should output the employee's name and bonus.

You can learn more about Java programs at: brainly.com/question/30354647

#SPJ11

Dividing a circuit’s total applied voltage by the total impedance results in the total _____.
a. current
b. power
c. VA
d. VARs

Answers

Dividing a circuit’s total applied voltage by the total impedance results in the total current. This relationship is known as Ohm's Law, which states that the current flowing through a conductor between two points is directly proportional to the voltage across the two points, and inversely proportional to the resistance between them.

The total impedance of a circuit is the combined resistance and reactance, which represents the opposition to the flow of current. By dividing the total voltage by the total impedance, we can calculate the current flowing through the circuit.

It's important to note that the total current is not the same as the current flowing through each individual component in the circuit. The current flowing through each component will depend on its resistance or reactance, as well as the voltage across it. However, by calculating the total current, we can determine the overall power consumption of the circuit. Power is calculated by multiplying the voltage and current, and is measured in watts (W). Additionally, the product of voltage and current can also be expressed in volt-amperes (VA), which represents the apparent power of the circuit. The difference between apparent power and real power (measured in watts) is the reactive power, expressed in volt-ampere reactive (VARs), which represents the energy stored and released by capacitive and inductive components in the circuit.

Learn more about Ohm's Law here:-

https://brainly.com/question/1247379

#SPJ11

very thin stainless steel shim stock is bonded to a 10 cm-square teflon plate to serve as a heater element. water at 290 k flows as a laminar boundary along the plate. the voltage drop and current flow in the heater are measured to obtain the power dissipated; also, from the known dependence of electrical resistance on temperature, the average plate temperature can be deduced. in a particular test, the power is 1025 w, and the average plate temperature is 311.5 k. estimate the water velocity, and the temperature distribution along the plate.

Answers

The water velocity and temperature distribution can be estimated using heat transfer principles and the given parameters of the system. A higher velocity will result in a more uniform temperature distribution along the plate.

The stainless steel shim stock bonded to the teflon plate acts as a heater element in this setup, with water flowing over the plate as a laminar boundary. The power dissipated is measured through the voltage drop and current flow in the heater, which is found to be 1025 W.

From the known dependence of electrical resistance on temperature, the average plate temperature is found to be 311.5 K. To estimate the water velocity and temperature distribution along the plate, we can use principles of heat transfer. The temperature of the water at the leading edge of the plate will be close to the inlet temperature, which is 290 K. As the water flows along the plate, it will heat up due to the heat transferred from the heater element. The temperature distribution will depend on the velocity of the water, which can be estimated using the heat transfer coefficient and the known heat flux from the heater.

learn more about temperature distribution here:

https://brainly.com/question/31388963

#SPJ11

create a function that takes in an array and its size. return the second highest number in the array.

Answers

The second highest number in an array can be found using a function that takes in the array and its size. The function should return the second highest number.

To find the second highest number in an array, we can first sort the array in descending order using a sorting algorithm such as bubble sort, merge sort, or quick sort. Once the array is sorted, the second highest number can be found at the index 1 of the array. If the array has fewer than two elements, we can return an error message or an empty value. We can implement this logic in a function that takes in the array and its size as arguments, and returns the second highest number. In the function, we can first check if the size of the array is less than two, and return an error or an empty value if it is. Otherwise, we can sort the array and return the second element of the sorted array.

Learn more about array here:

https://brainly.com/question/31605219

#SPJ11

why is it important to have optimum binder content in asphalt concrete? what would happen if a less-than-optimum binder content is used? what would happen if more than the optimum value is used? what is the typical range of binder content in asphalt concrete?

Answers

Optimum binder content is important in asphalt concrete for achieving desired performance and durability; using less than the optimum results in a brittle mix that cracks easily,the typical range of binder content in asphalt concrete is between 4% and 8%.

Why is optimum binder content important in asphalt concrete?

The optimum binder content in asphalt concrete is important for several reasons. Firstly, it ensures that the mixture has the required stability, durability, and resistance to deformation under traffic loads.

Secondly, it provides sufficient adhesion between the asphalt binder and the aggregate particles, which is essential for the overall performance of the mixture.

If a less-than-optimum binder content is used, the mixture will be prone to cracking and premature failure due to inadequate adhesion and reduced durability.

On the other hand, if more than the optimum value is used, the mixture will become soft and susceptible to rutting, which can compromise the safety and integrity of the pavement.

The typical range of binder content in asphalt concrete is between 4% to 7% by weight of the mixture, depending on several factors such as the type of binder, aggregate gradation, climate, and traffic conditions.

Learn more about Optimum binder content

brainly.com/question/31747022

#SPJ11

The model of a certain mass-spring-damper system is 10x + cx + 20x = f (t) Determine its resonant frequency 0, and its peak magnitude My if (a) =0.1 and (b) =0.3.

Answers

The resonant frequency of the system is 1.414 radians per second, and the peak magnitude for ζ = 0.1 is 0.3535 and the peak magnitude for ζ = 0.3 is 0.1178.

The resonant frequency and peak magnitude of the mass-spring-damper system can be determined using the given equation and the values of the constants.

Resonant frequency:

The resonant frequency of the system can be found using the formula:

ω0 = √(k/m)

where k is the spring constant and m is the mass.

In the given equation, the spring constant k = 20 and the mass m = 10. Therefore,

ω0 = √(20/10) = √2 = 1.414 radians per second

Peak magnitude:

The peak magnitude of the system can be found using the formula:

My = F0 / (2ζmω0)

where F0 is the amplitude of the forcing function, ζ is the damping ratio, and ω0 is the resonant frequency.

Substituting the given values of F0 = 1 and m = 10, we can find the peak magnitude for two different values of the damping ratio:

(a) ζ = 0.1

My = 1 / (20.110*1.414) = 0.3535

(b) ζ = 0.3

My = 1 / (20.310*1.414) = 0.1178

Therefore, the peak magnitude for ζ = 0.1 is 0.3535 and the peak magnitude for ζ = 0.3 is 0.1178.

Given the equation 10x + cx + 20x = f(t) for a mass-spring-damper system, we need to find the resonant frequency and peak magnitude.

Using the formula ω0 = √(k/m), we can find the resonant frequency by substituting the values of k and m from the equation.

In this case, k = 20 and m = 10, so ω0 = √(20/10) = √2 = 1.414 radians per second.

Next, we can find the peak magnitude using the formula My = F0 / (2ζmω0), where F0 is the amplitude of the forcing function, ζ is the damping ratio, and ω0 is the resonant frequency.

Substituting the given value of F0 = 1 and m = 10, we can find the peak magnitude for two different values of the damping ratio, ζ.

For ζ = 0.1, My = 1 / (20.110*1.414) = 0.3535.

For ζ = 0.3, My = 1 / (20.310*1.414) = 0.1178.

Therefore, the resonant frequency of the system is 1.414 radians per second, and the peak magnitude for ζ = 0.1 is 0.3535 and the peak magnitude for ζ = 0.3 is 0.1178.

Learn more about frequency: https://brainly.com/question/9324332

#SPJ11

2. a hospital has 1 µg of 99mtc and 5 µg of 113min. the half lives of 99mtc and 113min are 6h and 1.7h, respectively. how much time must elapse for them to have equal activity

Answers

It would take approximately 5.94 hours for the activities of 99mTc and 113mIn to be equal.

The activity of a radioactive substance is given by the equation:

A = A0 * e^(-λt)

where A0 is the initial activity, λ is the decay constant, and t is the time elapsed.

We can use this equation to find the activity of each substance at any given time. Let's assume that the activity of 99mTc at time t is equal to the activity of 113mIn at time t.

A_99mTc = A_113mIn

A0_99mTc * e^(-λ_99mTc * t) = A0_113mIn * e^(-λ_113mIn * t)

We know that A0_99mTc = 1 µg and A0_113mIn = 5 µg. We also know the half-lives of each substance, which can be used to find their respective decay constants:

λ_99mTc = ln(2) / t_1/2 = ln(2) / 6 hours = 0.1155 per hour

λ_113mIn = ln(2) / t_1/2 = ln(2) / 1.7 hours = 0.4083 per hour

Substituting these values into the equation above and simplifying, we get:

e^(0.1155t) = 5 * e^(0.4083t)

Taking the natural logarithm of both sides, we get:

0.1155t = ln(5) + 0.4083t

Solving for t, we get:

t = ln(5) / (0.4083 - 0.1155) = 5.94 hours

Therefore, it would take approximately 5.94 hours for the activities of 99mTc and 113mIn to be equal.

To know more about radioactive visit:

https://brainly.com/question/1770619

#SPJ11

This question is about proving a language's properties. Suppose that language L is composed by even length non-empty strings on alphabet {a, b}, which means that every word in L can be split as w1w2 with |w1| = |w2| (means that w1 and w2 have same length); we are given that w1 begins with 'a' and w2 begins with 'b'. So the examples of words in L should look like: aaabaa, abbb, aababbaa, ab.

Now please prove in detailed steps whether this language is: (a) regular or (b) context-free but not regular or (c) decidable but not context-free. For each scenario, prove using the method indicated below: If the result is regular, prove by making its NFA (NOT DFA!). If the result is context-free but not regular, prove by giving a PDA or CFG and a pumping lemma proof that it is not regular. If the result is decidable but not context-free, please proof by give a pumping lemma proof that it is not context-free as well as an algorithm for deciding whether a given string is in the language.

Answers

(a) To prove that language L is regular, we need to construct a non-deterministic finite automaton (NFA) that accepts all strings in L. The NFA can be constructed as follows:

The NFA has three states: q0, q1, and q2.

The initial state is q0, which is also the only accepting state.

For every input 'a', the NFA transitions from q0 to q1.

For every input 'b', the NFA transitions from q1 to q2.

For every input 'a', the NFA transitions from q2 to q1.

For every input 'b', the NFA transitions from q2 to q0.

The NFA accepts a string in L if and only if the string has an even length, starts with 'a', and has alternating 'a' and 'b' characters. Thus, the language L is regular.

(b) To prove that language L is context-free but not regular, we need to construct a context-free grammar (CFG) or a pushdown automaton (PDA) that generates/accepts L, and then use the pumping lemma to show that L is not regular. We can construct a CFG for L as follows:

S → aA

A → aAb | bAa | ε

The CFG generates strings in L by starting with an 'a', then adding a balanced number of 'a's and 'b's, and finally ending with another 'a'. For example, the string "aaabbaaa" can be generated as follows:

S → aA → aaAb → aaaAbb → aaabbaA → aaabbaa

To show that L is not regular, we can use the pumping lemma for regular languages. Suppose L is regular, then there exists a pumping length p such that every string s in L with length at least p can be written as s = xyz, where |xy| ≤ p, |y| > 0, and xyiz ∈ L for all i ≥ 0. Let s = abab, which is in L since it has even length and starts with 'a' and ends with 'b'. Then |s| = 4 > p, so we can write s = xyz such that |xy| ≤ p and |y| > 0. Since |xy| ≤ p and s = abab, we know that either x = ε and y = a, or x = a and y = ε. If x = ε and y = a, then z = bab, and xy2z = aabab, which is not in L since it has an odd length. If x = a and y = ε, then z = bab, and xy2z = abaabbab, which is not in L since it has more 'b's than 'a's. Therefore, L is not regular.

(c) To prove that language L is decidable but not context-free, we need to show that L is not context-free using the pumping lemma, and then provide an algorithm for deciding whether a given string is in L. We have already shown in part (b) that L is not context-free. To provide an algorithm for L, we can simply check whether the input string has even length, starts with 'a', and has alternating 'a' and 'b' characters. If so, the string is in L; otherwise, it is not. This algorithm will always halt and correctly decide whether a given string is in L, so L is decidable.

Learn more about language here:

https://brainly.com/question/31133462

#SPJ11

Other Questions
Which program is used to change the password of a user in Active Directory? (Choose two answers.)a. Active Directory Users and Computersb. Active Directory Domains and Trustsc. Active Directory Sites and Servicesd. Active Directory Administrative Center Find the expected value of the winningsfrom a game that has the following payoutprobability distribution:Payout ($) 0 24 68Probability 0.36 0.06 0.33 0.08 0.17Expected Value = [?]Round to the nearest hundredth.Enter what is a process that weeds out and fixed or discards inconsistent, incorrect, or incomplete information?O information cleansing or scrubbingO Data martO Dirty dataO Data Aggregation bonds make an annual coupon interest payment of 7.35% every year. the bonds have a par value of $1,000, a current price of $1,000, and mature in 12 years. what is the yield to maturity on these bonds? designing a website for optimum viewing on smartphones and tablets is referred to as ________. naver please proceed with identity verification to verify your legal name and age when using the service. python write a python function called reverse_number that takes an integer called int_number and returns the number with its digits in reverse. the (maker/payee) of the note is the one that signed the note and promised to pay at maturity. the (maker/payee) of the note is the person to whom the note is payable only about 2.5% of all the water on our planet is freshwater. however, ________. For each revenue source listed indicate its correct classification recommended by GASB standards. 1. Capital grant received by a city from a state 2. Property tax levied by city 3. Library use fees 4. Building permit 5. Speeding ticket price per unit $ 5.00 variable costs per unit: direct materials 1.35 direct labor 0.45 overhead 0.20 total fixed costs $ 5,700 find the break-even point in units and sales dollars. Which of the following pairs of reproductive strategies is consistent with energetic trade-off and reproductive success?A) Pioneer species of plants produce many very small, highly airborne seeds, whereas large elephants that are very good parents produce many offspring.B) Female rabbits that suffer high predation rates may produce several litters per breeding season, and coconuts produce few fruits, but most survive when they encounter proper growing conditions.C) Species that have to broadcast to distant habitats tend to produce seeds with heavy protective seed coats, and animals that are caring parents produce fewer offspring with lower infant mortality.D) Free-living insects lay thousands of eggs and provide no parental care, whereas flowers take good care of their seeds until they are ready to germinate.E) Some mammals will not reproduce when environmental resources are low so they can survive until conditions get better, and plants that produce many small seeds are likely found in stable environments. what is the ph of a 0.200 m h2s solution? ka1 of h2s = 8.9 108 and ka2 = 1 1019 Use Planck's constant to calculate the energy of a photon of x-ray radiation with a frequency of 7.49 10 /s _____________ percent of female homicide victims were murdered by an intimate partner. ___ encrypt connections between company networks and remote users such as workers connecting from home, creating a secure virtual connection to company LAN across the internet in c4 (carbon 4) pants, phosphenolpyruvate (pep) reacts with carbon dioxide to directly generate following compound in mesophyll cell. select one: a. gtp b. atp c. oxygend. oxaloacetate ______ is a damage or injury to a host organism that impairs its function. A) Trauma B) Infection C) Disease D) Transmission. the school carnival is coming up and jenny and sarah plan to sell cupcakes. since the school carnival is a fundraiser, jenny and sarah's parents make a donation to their cupcake booth to get them started. jenny starts with a $5 donation and sells her cupcakes for $3 each. sarah starts with a $10 donation and sells her cupcakes for $2 each. how many cupcakes do jenny and sarah have to sell for their profits to be equal? Devise a test to demonstrate the validity of the following formulas. What values of A and B should be used to test these function thoroughly? (a). Sin (A+B) = Sin(A)cos(B)+cos(A)sin(B) (b). Sin (2A) = 2sin(A)cos(A) (c). Sin2 (A) = (1-cos (2A)).