Yesterday, a factory used (2)/(3) of a tub of peanut butter. They use 16 of a tub of peanut butter for each batch of peanut butter cookies. How many batches of peanut butter cookies did the factory make yesterday? help!

Answers

Answer 1

Answer:

4 batches

Step-by-step explanation:

1/3=2/6, 2/3=4/6


Related Questions

help again plz.......​

Answers

The answer is B I think

Adult humans have approximately 2.6 red blood cells and 3.92 white blood cells. About how many times greater is the number of red blood cells than white blood cells?

Answers

Answer:

1.5 rounded to the nearest tenth

Step-by-step explanation:

To find how much greater WBC are from RBC we do,

3.92 ÷ 2.6

= 1.50769230769

Which is 1.5 rounded to the nearest tenth.

Thus,

there are approximately 1.5 times WBC than RBC.

Hope this helps :)

The 1.5 times greater is the number of red blood cells than white blood cells

What is division?

The division in mathematics is one kind of operation. In this process, we split the expressions or numbers into the same number of parts.

Given:

Adult humans have approximately 2.6 red blood cells and 3.92 white blood cells.

To find the number of times greater is the number of red blood cells than white blood cells:

Use division operation,

3.92 / 2.6

= 1.5076

≈ 1.5 rounded to the nearest tenth.

Therefore, the required number is 1.5 times.

To learn more about the division;

https://brainly.com/question/13263114

#SPJ5

What happens to the value of the expression 80-2r80−2r80, minus, 2, r as rrr decreases? Choose 1 answer: Choose 1 answer: (Choice A) A It increases. (Choice B) B It decreases. (Choice C) C It stays the same. Stuck?Watch a video or use a hint.

Answers

Answer:

(Choice B) B It decreases.

Step-by-step explanation:

According to the situation, the solution of the value of the expression is as follows

Let us assume

r         80 -2r

5        80 - 10 = 70

4        80 - 8 = 72

3        80 - 6 = 74

2        80 - 4 = 76

1         80 - 2 = 78

As we can from the above calculation that expression value risen if r value decreased

Therefore the correct option is B.

Answer:

It increases

Step-by-step explanation:

In65 - lnX = 39
What does X=?

Answers

Answer:

The answer is 7.47

Step-by-step explanation:

In this problem we are going find the natural logarithmic of the numbers involved and solve for x

[tex]ln65-Ln x= 39\\[/tex]

from tables

ln 65= 4.17

[tex]4.17-ln x= 39\4.17-39= lnx\\-34.83=lnx\\[/tex]

taking the exponents of both sides we have

[tex]e^-^3^4^.^8^3= x\\x= 7.47[/tex]

If c cars can be parked in each of the four main rows of the parking lot, what is the expression gor the maximum number of cars that can be parked in the parking lot?

Answers

Answer:

4c

Step-by-step explanation:

We can say that the maximum number of cars can be represented as:

Maximum number of cars = Total of rows × Number of cars per row

In this particular case, we have 4 rows and the number of cars per row is c, thus, the expression above becomes:

Maximum number of cars = 4c

Rationalize the denominator of $\frac{2}{3\sqrt{5} + 2\sqrt{11}}$ and write your answer in the form $\displaystyle \frac{A\sqrt{B} + C\sqrt{D}}{E}$, where $B < D$, the fraction is in lowest terms and all radicals are in simplest radical form. What is $A+B+C+D+E$? PLEASE HELP ME I WILL DO ANYTHING

Answers

Answer:

19

Step-by-step explanation:

Given the surdic expression [tex]\frac{2}{3\sqrt{5} + 2\sqrt{11}}\\[/tex], to rationalize the expression, we will have to multiply the numerator and denominator of the expression by the conjugate of the denominator as shown;

[tex]= \frac{2}{3\sqrt{5} + 2\sqrt{11}} * \frac{3\sqrt{5} - 2\sqrt{11}}{3\sqrt{5} - 2\sqrt{11}}\\\\= \frac{2(3\sqrt{5} - 2\sqrt{11})}{(3\sqrt{5} + 2\sqrt{11})(3\sqrt{5} - 2\sqrt{11})}\\\\= \frac{6\sqrt{5} - 4\sqrt{11} }{9\sqrt{25}+6\sqrt{55}- 6\sqrt{55}-4\sqrt{121} } \\\\= \frac{6\sqrt{5} - 4\sqrt{11} }{9(5)-4(11) }\\\\= \frac{6\sqrt{5} - 4\sqrt{11} }{45-44 }\\\\= \frac{6\sqrt{5} - 4\sqrt{11} }{1}[/tex]

Comparing the result [tex]\frac{6\sqrt{5} - 4\sqrt{11} }{1}[/tex] with the expression [tex]\frac{A\sqrt{B} + C\sqrt{D}}{E}[/tex], it can be seen that A = 6, B = 5, C = -4, D = 11 and E = 1

A+B+C+D+E = 6+5+(-4)+11+1

A+B+C+D+E = 11-4+12

A+B+C+D+E = 19

Hence the value of A+B+C+D+E is 19

What’s a possible value of an integer that is less than 14 units from 29 but no more than or equal to 18

Answers

Answer:

15, 16, 17, 18

Step-by-step explanation:

29-14=15

15, 16, 17, 18 are less than or equal to 18

the three-dimensional shape that this net represents is _______. The surface area of the figure is _____ square centimeters.

Answers

Answer:

Shape - Cube

Area= 864

Step-by-step explanation:

The shape folds to become a cube and all the edges are the same size.

Area of a cube is Length * Width * Height = Area

12*12*12= 864

Answer:

Shape - Cube

Area= 864

Step-by-step explanation:

The shape folds to become a cube and all the edges are the same size.

Area of a cube is Length * Width * Height = Area

12*12*12= 864

can someone answer the underlined question? (number 9)

Answers

Answer:

Slope = -6/7

Step-by-step explanation:

You need to use the formula m = y2 - y1 ÷ x2 - x1

The formula means: slope = the y coordinate of point 2 subtract the y coordinate of point 1, divided by the x coordinate of point 2 subtract the x coordinate of point 1

So,

m = 2 - 5 ÷ 3/2 - (-2)

m = -3 ÷ 7/2

m = -6/7

Hope this helps :)

what is the first step in writing f(x)=6x^2+5-42x in vertex form? a) factor 6 out of each term. b) factor 6 out of the first two terms. c) write the function in standard form. d) write the trinomial as a binomial squared.

Answers

Answer:

Answer c): write the function in standard form

Step-by-step explanation:

To start with, it is important to write the polynomial in standard form, so as to have the two terms with the dependence in x together:

[tex]6x^2-42\,x+5[/tex]

then you extract 6 as a common factor of just the terms with the variable x:

[tex]6(x^2-7x)+5[/tex]

Then proceed to complete the square in the expression inside the parenthesis:

[tex]6(x^2-7x+\frac{49}{4} -\frac{49}{4})+5[/tex]

[tex]6\,((x-\frac{7}{2} )^2-\frac{49}{4} )+5\\6\,(x-\frac{7}{2} )^2-\frac{147}{2}+5\\6\,(x-\frac{7}{2} )^2-\frac{137}{2}[/tex]

Then, the function can be finally be written as:

[tex]f(x)=6\,(x-\frac{7}{2} )^2-\frac{137}{2}[/tex]

in vertex form

Answer:

C.) Write the function in standard form

Step-by-step explanation:

The factory quality control department discovers that the conditional probability of making a manufacturing mistake in its precision ball bearing production is 4 % 4\% 4% on Tuesday, 4 % 4\% 4% on Wednesday, 4 % 4\% 4% on Thursday, 8 % 8\% 8% on Monday, and 12 % 12\% 12% on Friday. The Company manufactures an equal amount of ball bearings ( 20 % 20\% 20%) on each weekday. What is the probability that a defective ball bearing was manufactured on a Friday?

Answers

Answer:

The probability that a defective ball bearing was manufactured on a Friday is 0.375.

Step-by-step explanation:

The conditional probability of an events X given that another event A has already occurred is:

[tex]P(X|A)=\frac{P(A|X)P(X)}{P(A)}[/tex]

The information provided is as follows:

P (D|M) = 0.08

P (D|Tu) = 0.04

P (D|W) = 0.04

P (D|Th) = 0.04

P (D|F) = 0.12

It is provided that the Company manufactures an equal amount of ball bearings, 20% on each weekday, i.e.

P (M) = P (Tu) = P (W) = P (Th) = P (F) = 0.20

Compute the probability of manufacturing a defective ball bearing on any given day as follows:

[tex]P(D)=P(D|M)P(M)+P(D|Tu)P(Tu)+P(D|W)P(W)\\+P(D|Th)P(Th)+P(D|F)P(F)[/tex]

      [tex]=(0.08\times 0.20)+(0.04\times 0.20)+(0.04\times 0.20)+(0.04\times 0.20)+(0.12\times 0.20)\\\\=0.064[/tex]

Compute the probability that a defective ball bearing was manufactured on a Friday as follows:

[tex]P(F|D)=\frac{(D|F)P(F)}{P(D)}[/tex]

             [tex]=\frac{0.12\times 0.20}{0.064}\\\\=0.375[/tex]

Thus, the probability that a defective ball bearing was manufactured on a Friday is 0.375.

What is the weight (in grams) of a liquid that exactly fills a 202 milliliter container if the density of the liquid is 0.685g/mL? Round to the nearest hundredth

Answers

Answer:

138.37 gram

Step-by-step explanation:

Formula of density

density = mass/ volume

given

volume = 202 mL

density = 0.685g/mL

using these values in Formula of density

0.685g/mL = mass/ 202 mL

mass = 0.685g/mL * 202 mL = 138.37 gram

Thus, weight of liquid is  138.37 gram to the nearest hundredth.

Answer:

138.37 grams

Step-by-step explanation:

I'm taking the exam. Good luck on yours!

In a school 3/5are boys. In a day 1/6 were absent and 250 boys were present. How many girls are in that school

Answers

Answer:

There are 200 girls in that school

Step-by-step explanation:

The correct and complete question is as folly;

In a school 3/5 pupils are boys. One day 1/6 of the boys were absent when 250 boys were present. How many girls are in the school?

SOLUTION

Let the total number of students in the school be x students

Since 3/5 are boys , then the number of girls in the school would be 1-3/5 = 2/5

The number of boys are 3/5 * x = 3x/5

The number of girls are 2/5 * x = 2x/5

Now on a particular day, 1/6 of the boys were absent and 250 boys were present.

What this means is that the fraction of boys present is 1-1/6 = 5/6

Now, 5/6 of the total boys population were present.

Mathematically;

5/6 * 3x/5 = 250

3x/6 = 250

x/2 = 250

x = 2 * 250 = 500

So there are 590 students in the school.

The number of girls in the school is ;

2x/5 = 2/5 * 500 = 200 girls

Use multiplication to solve the proportion
w/4 = 42/24

Answers

Answer: w=5

Step-by-step explanation:

Determine the perimeter and area of the red portion of the 2 dimensional figure below, given the circle diameter of 7 cm and the perimeter of the entire figure is 42 cm. Round if necessary

Answers

Answer:

Perimeter = 20cm ; area = 59.5cm

Step-by-step explanation:

Given the following :

Perimeter of entire figure = 42cm

Diameter of circle (d) = 7cm

Find the perimeter of the circle :

The perimeter (p) of a circle equals :

2πr

Where r = radius of circle

r = diameter /2 = 7/2 = 3.5cm

Therefore,

P = 2 * (22/7) * 3.5

P = 22 cm

Looking at the figure, we only take the semicircle :

Therefore perimeter of each semicircle =

22cm / 2 = 11cm

Therefore, perimeter of the red shaded region =

(42 - 22)cm = 20cm

Area of Circle = πr^2

(22/7) * 3.5^2 = 38.5 cm

Area of each semicircle = 38.5/2 = 19.25cm

Total area of semicircle = (19.25 +19.25) = 38.50cm

To find sides of rectangle :

Perimeter of the rectangle :

width = diameter of circle = 7cm

2(l + w) = 42

2(l + 7) = 42

2l + 14 = 42

2l = 42 - 14

2l = 28

l = 28/2

length (l) = 14cm

Therefore, area of rectangle :

Length * width

14 * 7 = 98cm

Area of red portion:

Area of rectangle - (area of the 2 semicircles)

98cm - 38.50cm

= 59.50cm

EF is a median of trapezoid ABCD. What is the value of x?

Answers

Answer:

x = 4

Step-by-step explanation:

The midsegment ( median is equal to half the sum of the parallel bases, that is

[tex]\frac{AB+CD}{2}[/tex] = EF, substitute values

[tex]\frac{4x-10+3x+8}{2}[/tex] = 13 ( multiply both sides by 2

7x - 2 = 26 ( add 2 to both sides )

7x = 28 ( divide both sides by 7 )

x = 4

plzzz hellpppppp...........​

Answers

Answer:

Bearing of R from S = S 45° E or 135°

The bearing of R from Q

= S 66.42° w or 246.42°

Step-by-step explanation:

Distance between R and S

RS²= RP²+PS²

RS²= 15²+15²

RS²=225+225

RS= √450

RS= 21.21

Angle at S

21.21= 15/sins

Sin s= 15/21.21

S= sin^-1 15/21.21.

S= 45°

90+45= 135°

Bearing of R from S = S 45° E or 135°

Distance between R and Q

RQ²= PQ²+PR²

RQ²= 35²+15²

RQ²=1225+225

RQ= √1450

RQ= 38.08

RQ= 15/sinQ

SinQ= 15/38.08

SinQ= 0.40

Q=23.58°

90-23.58 = 66.42°

66.42+180= 246.42°

The bearing of R from Q

= S 66.42° w or 246.42°

Pls answer the image given

Answers

Answer:

[tex]4 \frac{1}{4} [/tex] hours

Step-by-step explanation:

Given,

Time spent in studies : [tex]1 \frac{3}{4} [/tex] hours

Time spent in playing cricket : [tex]2 \frac{1}{2} [/tex] hours

Now, let's find the time that he spent in all:

[tex]1 \frac{3}{4} + 2 \frac{1}{2} [/tex]

Add the whole number and fractional parts of the mixed numbers separately

[tex](1 + 2)( \frac{3}{4} + \frac{1}{2} )[/tex]

Add the numbers

[tex]3 +( \frac{3}{4} + \frac{1}{2} )[/tex]

Add the fractions

[tex]3 + ( \frac{3 + 1 \times 2}{4} )[/tex]

[tex]3 + ( \frac{3 + 2}{4} )[/tex]

[tex]3 + \frac{5}{4} [/tex]

Convert the improper fraction into mixed number

[tex] 3 + 1\frac{1}{4} [/tex]

Write the mixed number as a sum of the whole number and the fractional part

[tex]3 + 1 + \frac{1}{4} [/tex]

Add the numbers

[tex]4 + \frac{1}{4} [/tex]

Write the sum of whole number and the fraction as a mixed number

[tex]4 \frac{1}{4} [/tex] hours

Hope this helps..

Best regards!!

Answer:

4 1/4 hours.

Step-by-step explanation:

1 3/4 + 2 1/2

= 1 + 2 + 3/4 + 1/2

= 3 + 3/4 + 1/2   The LCM of 2 and 4 is 4 so 1/2 = 2/4. and so we have:

3 + 3/4 + 2/4

= 3 + 5/4

= 3 + 1 1/4

= 4 1/4 hours.

5t - 3 = 3t - 5 : solve

Answers

Answer: -1

Step-by-step explanation:

[tex]5t-3=3t-5[/tex]

Add 3 to both sides.

[tex]5t=3t-2[/tex]

Subtract 3t from both sides.

[tex]2t=-2[/tex]

[tex]t=-1[/tex]

Hope this helps!

Answer: t=-1

Step-by-step explanation:

1) add 3 to both sides

2) subtract 3t from both sides

3) Divide both sides by 2

Please help me!! I am struggling... I will not accept nonsense answers!

Answers

Answer:

y = 110°

Step-by-step explanation:

The inscribed angle CHF is half the measure of its intercepted arc CDF

The 3 arcs in the circle = 360°, thus

arc CDF = 360° - 160° - 60° = 140°, so

∠ CHF = 0.5 × 140° = 70°

∠ CHF and ∠ y are adjacent angles and supplementary, thus

y = 180° - 70° = 110°

a quadrilateral has angles measuring 56 degrees, 78 degrees, and 90 degrees. how large is the missing angle?

Answers

Answer:

Hey there!

Angles in a quadrilateral add to 360 degrees, so we have 56+78+90+x=360

Solving, we see that the missing angle, x, is 136 degrees.

Hope this helps :)

Answer:

Hey.... Ans is 154°

The mate who ans before me HAVE TO FIND x TOO

Step-by-step explanation:

For example take a quadrilateral ABCD (refer to the pic)

Then solution is...

In quadrilateral ABCD

            Sum of all sides of a quadrilateral= 360°

           =angle A + angle B+ angle C+ angle D=

Given,

          Angle A= 56° + angle B=78° + angle C=90° + angle D=x

        =56° + 78° + 90° + x.            (add all the numbers)

         x+226=360°                           (56+78+90=226)

         x=360° - 226°

         x=154°

Therefore the largest angle = x = 154°

Hope it helped u!!

                             

Which of the following shows the true solution to the logarithmic equation 3 log Subscript 2 Baseline (2 x) = 3 x = negative 1 x = 1 x = negative 1 and x = 1 x = 0, x = negative 1, and x = 1

Answers

Answer:

x = 1

Step-by-step explanation:

Using the rules of logarithms

log [tex]x^{n}[/tex] ⇔ n log x

[tex]log_{b}[/tex] x = n ⇔ x = [tex]b^{n}[/tex]

Given

3[tex]log_{2}[/tex] (2x) = 3

[tex]log_{2}[/tex] (2x)³ = 3

(2x)³ = 2³

8x³ = 8 ( divide both sides by 8 )

x³ = 1 ( take the cube root of both sides )

x = 1

Answer:

x=1 is the correct answer

Step-by-step explanation:

got it right on edge!!!!

John has 14 boxes of apples. Each box holds 12 apples. If 6 of the boxes are full, and 8 of the boxes are half full, how many apples does John have?

Answers

Answer:

120

Step-by-step explanation:

12 x 6 = 72

8x(12/2)=48

72+48 =120

SOMEONE PLSSSS HELPPPP. When under equal tension, the frequency of a vibrating string in a piano varies inversely with the string length. If a string that is 410 millimeters in length vibrates at a frequency of 515 cycles a second, at about what frequency will a 705-millimeter string vibrate?

Answers

Answer: 299.5 cycles per second.

Step-by-step explanation:

An inverse variation can be written as:

y = k/x

Where, in this case:

y = frequency

x = length of the string

k = constant.

We know that 410 mm correspond to 515 cps.

then:

515cps = k/410mm

k = 515cps*410mm = 211,150 cps*mm

now, if we use x = 705mm we can find the frequency as:

y = ( 211,150 cps*mm)/705mm = 299.5 cycles per second.

what is the midpoint of the segment shown below (2 2) (3 5) a. (5/2, 7/2) b. (5, 7) c. (5/2, 7) d. (5, 7/2)

Answers

Answer:

[tex]( \frac{5}{2} \: , \frac{7}{2} )[/tex]

Option A is the correct option.

Step-by-step explanation:

Let the points be A and B

A ( 2 , 2 ) ------> ( x1 , y1 )

B ( 3 , 5 ) -------> ( x2 , y2)

Now, let's find the mid-point :

Midpoint = [tex] (\frac{x1 + x2}{2} \:, \frac{y1 + y2}{2} )[/tex]

plug the values

[tex] = ( \frac{2 + 3}{2} \: , \frac{2 + 5}{2} )[/tex]

Calculate the sum

[tex] = \: ( \frac{5}{2} \:, \frac{7}{2} )[/tex]

Hope this helps..

Best regards!!

1. Find the cube root of the following through
estimation a) 300763 b) 704969 c)
( - 226981)
in which are perfect cube

Answers

Answer:

A).300763=+ 67

b) 704969= +87

c)( - 226981)= -61

Step-by-step explanation:

The values of the cube root iyf the given numbers above will be looked up in a calculator and the estimated value will be returned back.

Going through the numbers

A).for 300763

The value of the cube root = +67

B). For 704969

The value of the cube root = +89

C). For ( - 226981)

The value of the cube root= -61

-2x-3=-9. What does x equal?

Answers

Answer:

x=3

Step-by-step explanation:

-2x-3=-9

Add 3 to each side

-2x-3+3=-9+3

-2x = -6

Divide by -2

-2x/-2 = -6/-2

x = 3

Answer:

x =3

Step-by-step explanation:

[tex]-2x-3=-9. \\ - 2x = - 9 + 3 \\ - 2x - 6 \\ \frac{ - 2x}{ - 2} = \frac{ - 6}{ - 2} [/tex]

[tex]x = 3[/tex]

On March 20, Soren kierkegaard deposited $1000 into his savings account that pays 5.5% interest compounded daily. How much interest will the money earn by April 20?

Answers

Hey there! I'm happy to help!

There are 31 days in March, so there are 11 days left in March. We add this to the 20 days in April, giving us 31 total days this interest is compounded.

We could calculate the amount compounded each day for 31 total days, but that would take a long time. Instead, there is a formula we can use to calculate compound interest instead.

[tex]Total= P(1+i)^n\\\\P=Principal Amount\\i=interest rate\\\\n=number of times compounded[/tex]

So, let's plug in those numbers! Remember to convert the percent to a decimal so it works in the equation!

[tex]Total=1000(1+0.055)^3^1\\Total=1000(5.258068609)\\Total=5258.068609[/tex]

Now, we subtract the initial amount just to see how much interest was earned.

5258.068609-1000=4258.07 (rounded to nearest cent).

Therefore, the money will have earned $4,258.07 by April 20.

Have a wonderful day!

What is the slope of the line?

O slope = 1/3
O slope = -3
O slope = 3​

Answers

Answer:

Slope = 3

Step-by-step explanation:

Slope is rise (vertical distance) over run (horizontal distance).

Our rise is equal to 3

Our run is equal to 1

So, slope = 3/1 = 3

can someone please help ​

Answers

Answer:

The expression is equal to 3,120 when x = -5 and y = 25.

Step-by-step explanation:

In order to obtain the output of the expression when x = -5 and y = 25, we need to apply these numbers in its correct places as shown below. We need to pay close attention to [tex]|x|[/tex] which is the absolute value of "x", this means that if x is positive, then [tex]|x|[/tex] will also be positive, but if x is negative then the result will still be positive.

[tex]\frac{5|x| - y^3}{x}[/tex]

[tex]\frac{5*|-5| - (25)^3}{-5}\\\frac{5*5 - 15625}{-5}\\\frac{25 - 15625}{-5}\\\frac{-15600}{-5} = 3,120[/tex]

The expression is equal to 3,120 when x = -5 and y = 25.

Other Questions
In May direct labor was 35% of conversion cost. If the manufacturing overhead for the month was $116,350 and the direct materials cost was $20,200, the direct labor cost was: Describe the importance of peoples participation. You invest a single amount of $14,800 for 7 years at 15 percent. At the end of 7 years you take the proceeds and invest them for 14 years at 17 percent. How much will you have after 21 years Yesterday at 1:00 P.M., Marias train was 42 miles north of Gulls Beach, traveling north at an average speed of 90 mph. At the same time on the adjacent track, Elenas train was 6 miles north of Gulls Beach, traveling north at an average speed of 101 mph. To the nearest hundredth of an hour, after how much time will the trains meet up? 0.23 hours 0.31 hours 3.27 hours 4.36 hours * *4.8.21Question HelpAfter the release of radioactive material into the atmosphere from a nuclear power plant in a country in 1982, the hay in that country was contaminated by a radioactiveisotope (half-life 5 days). If it is safe to feed the hay to cows when 9% of the radioactive isotope remains, how long did the farmers need to wait to use this hay?The farmers needed to wait approximately(Round to one decimal place as needed.)days for it to be safe to feed the hay to the cows.Vo1.(1,1)MoreEnter your answer in the answer box and then click Check Answer.All parts showingClear AllCheck Answernere to searchO8a which numbers are the extremes of the proption shown below. 3/4 = 6/8 f(x) = 3x + 21; solve for f(3) and f(7) Select the error-free sentence. A. The speakers reliance on notes made the question-and-answer session dull. B. The speaker's reliance on notes made the question-and-answer session dull. C. The speakeres reliance on notes made the question-and-answer session dull. D. The speakers' reliance on notes made the question-and-answer session dull. Determine whether each of the following salts will form a solution that is acidic, basic, or pH-neutral. Drag the appropriate items to their respective bins.Al(NO3)3C2H5NH3NO3NaClORbICH3NH3CN Please help urgently "Tina withdraws $20,000 from her money market account to start up her own house cleaning business. Over that time, the account would have earned 3 percent interest. In order to properly account for all costs of her business, Tina must not forget:" Please help ASAP! Ill give brainliest:)) A June sales forecast projects that 5,000 units are going to be sold at a price of $11.00 per unit. The desired ending inventory of units is 15% higher than the beginning inventory of 600 units. Merchandise purchases for June are projected to include how many units please help :) What is 96,989,200 written in scientific notation? A. 96.9892 10 to the 5 power B. 9.69892 10 to the 7 power C. 9.69892 10 to the 6 power D. 9.69892 10 to the 8 power Which characteristic describes the whale but not its food source, the phytoplankton? The whale is heterotrophic. The whale has cell walls. The whale is unicellular. The whale is a prokaryote. Sort the characteristic of new as objectivie In Appellia, it takes 10 units of resources to increase its output of sugar from 12 tons to 13 tons, but 11 units of resources to increase output from 13 tons to 14 tons, and 12 units of resources to increase output from 14 tons and 15 tons, and so on. The need for increasing resources is an example of True or False, Geometric lines are uncertain and unpredictable. Which energy profile best shows that the enthalpy of formation of CS2 is 89.4 KJ/mol? intext:"ABC Co. purchased merchandise on August 5 at a $1,000 invoice price with terms of 2/10,n/30 and paid for the merchandise on August 14. Determine its entry to record this purchase and the subsequent payment under both the gross method and the net method by matching the action on the left with the method on the right."