why are some substances such as magnesium and fluoride allowed in drinking water?

Answers

Answer 1

Answer:Pure water does not contain fluoride, but much drinking water does contain fluoride that is deliberately added to reduce tooth decay of children who drink the water. Some drinking water supplies also contain fluoride naturally.

Explanation:

in small doses not harmful

Answer 2

Fluoride is a chemical that is intentionally added to drinking water in order to prevent tooth decay in children. Pure water does not naturally contain fluoride. Some sources of drinking water naturally contain fluoride as well.

Why magnesium and fluoride allowed in drinking water?

Fluoride is a chemical that is intentionally added to drinking water in order to prevent tooth decay in children. Pure water does not naturally contain fluoride. Some sources of drinking water naturally contain fluoride as well.

Compared to magnesium found in food, magnesium in water is present as hydrated ions, which are more easily absorbed. Thus, the role played by water magnesium in the prevention of magnesium insufficiency may be quite important for people who drink water with high magnesium levels.

To learn more about magnesium and fluoride refer to:

https://brainly.com/question/20217768

#SPJ2


Related Questions

Assume that wave B has a wavelength of 415 nm. Calculate the frequency of the wave. The value for c is 3.00 x 10 8 m/s. The wavelength of wave A is [__________]Hz.

Answers

The wave B has wavelength of 415 nm. The value for c is 3.00 x 10 8 m/s. The frequency is 7.22 x 10¹¹ Hz.

What is frequency?

Frequency is defined as the number of waves passing through a fixed point in a given amount of time.

The frequency can also be defined as a repeated event is the number of occurrences per unit of time.

Frequency can be expressed as

f = c / ∧

Where c = 3.00 x 10⁸ m/s

           ∧ = 415 nm

So, f = 3.00 x 10⁸ m/s x 415 nm

      f = 7.22 x 10¹¹ Hz.

Thus, the wave B has wavelength of 415 nm. The value for c is 3.00 x 10 8 m/s. The frequency is 7.22 x 10¹¹ Hz.

To learn more about frequency, refer to the link below:

https://brainly.com/question/5102661

#SPJ1

Contrast the cause of the attraction in ionic bonds
and metallic bonds.

Answers

Ionic bonds are held together by the electrostatic force of attraction between ions, whereas a metallic bond is due to the attraction of metallic cations for delocalized electrons.

Please I will mark brainliest !!! I need both answered

Answers

7 Protons and 7 Neutrons

What does the graph show about the rate of temperature change over time?

Answers

Answer:

The temperature is the same overtime.

Explanation:

Since the line on the graph is straight the temperature will be constant.

which physical quantity is not used when determining the stoichiometry in this experiment?

Answers

The physical quantity that is not used when determining the stoichiometry in this experiment is temperature.

Stoichiometry offers a way in which we can calculate the amount of reactants and products using mass - mole relationship. The mass of reactants, number of moles of reactant, mass of product and mass of precipitate can all be used to determine the stoichiometry.

However, the temperature of a reaction is not used to determine the stoichiometry of the reaction.

Learn more: https://brainly.com/question/17320375

Which physical quantity is NOT used when determining the stoichiometry in this experiment?

mass of precipitate mass of product moles of reactant temperature

If 84.5 mol of an ideal gas occupies 21.5 L at 305 K, what is the pressure of the gas? pressure: atm​

Answers

Answer:

98.367 atm

Explanation:

For this, you must use the equation PV=nRT. Since you are looking for P, rearrange the equation so that P= nRT/V.

Now collect the information you have:

n (mol) = 84.5

R (ideal gas constant to find atm not every case) = .08206

T (temperature) = 305 K (always convert to kelvin)

V (volume in liters) = 21.5

Now Use P= (85.5 mol)×(.08206)×(305 K)/(21.5) to get your answer in atm

I have nothing to say hear look at picture sorry

Answers

Answer:

D

Explanation:

Hope it helps :p

weight is a flawed measure of mass because it....​ PLEASE ANSWER BY 10/30/21 or a. s. a. p.

Answers

Answer:

I believe it's because it's based on gravity

Explanation:

mass is like your true weight while weight is your mass and some equation with gravity. it's been a few years

what are homologous series

Answers

Answer :


A homologous series is a family of hydrocarbons with similar chemical properties who share the same general formula. We will look at three hydrocarbon series: alkanes, alkenes and the cycloalkanes. Hydrocarbons are compounds that contain only hydrogen and carbon.



Answer:

A homologous series is a series of compounds with the same general formula, usually varying by a single parameter such as the length of a carbon chain. Compounds within a homologous series typically have a fixed set of functional groups that gives them similar chemical and physical properties.

in structural isomers atoms and functional groups join together in different ways. which of the following statements is not correct with respect to structural isomers

Answers

Structural isomerism is based on the existence of different molecular

structures formed by the same elements.

The statement that is not correct with respect to structural isomers is; All

structural isomers show hydrogen bonding.

Reason:

Structural isomers are isomers that have different molecular structures but

the same molecular formula. They are referred to as constitutional isomers

Therefore;

The empirical formula which is obtainable from the molecular formula is the same for structural isomers.The structural formula of structural isomers are differentStructural isomers that are functional isomers have different chemical properties.

However;

Structural isomers that are linkage isomers may not have hydrogen bonding.

Therefore, the statement that is not correct with respect to structural isomers is; All structural isomers show hydrogen bonding.

 

Learn more here:

https://brainly.com/question/12796779

The question options are;

The same empirical formula among structural isomers.

Different physical and chemical properties can be possessed by structural isomers.

Structural isomers have different structural formulas.

Hydrogen bonding is shown in all structural isomers.

All the above statements are correct.

what type of mixture is formed when black iron filings and yellow sulfur powder black iron filing is formed
Homogeneous
Heterogeneous
Compound ​

Answers

A compound, is the right answer

Answer:

when you heat the blend, you form iron sulfide, a compound

Depending on the ratio, you could form Fe4S3 or fool's gold

Explanation:When iron filings and sulphur powder are mixed and heated they undergo a chemical reaction and form ferrous sulphide (FeS). It is a new substance which has properties entirely different from Fe and S. Therefore, heating of mixture of iron and sulphur powder is a chemical change forming a compoundf

can you make hydroxychloroquine from grapefruit and lemon rinds

Answers

Hydroxychloroquine cannot be made from grapefruit and lemon rinds.

Hydroxychloroquine is not a natural compound, rather it can only be synthesized from quinoline molecule in the laboratories.

During the synthesis of hydroxychloroquine, several sequential chemical reactions and purifications are done.

Hydroxychloroquine is used in the treatment of:

malariasystemic lupus erythematosus, rheumatoid arthritis

But when grapefruit and lemon rinds are boiled in water, a natural chemical compound known as limonene is obtained.

Therefore, hydroxychloroquine cannot be made from grapefruit and lemon rinds,

Learn more here:

https://brainly.com/question/20113211

what is the name of an interaction that would form between two ions?

Answers

Answer:

Intermolecular forces: are the forces of attraction or repulsion which act between neighboring particles (atoms, molecules, or ions ).

The interaction that would form between the ions (opposite charged) is called the ion-ion interaction.

What is the ion-ion interaction?

Ion-ion interactions are attraction forces between ions that are oppositely charged. They are also known as ionic bonds and are the forces that held together ionic compounds.

The oppositely charged ions floating around in a vacuum will be attracted toward each other, and the attraction will become stronger as they move closer. When they finally stay together and take a considerable amount of energy to separate them.

They produce an ion-pair, a new particle that has a positively and negatively charged surface. The clusters tend to develop because these ion pairs and free ions have strong connections and finally fall out of the gas state as a liquid or solid.

The attraction forces of ions with opposite charges are called ion-ion interactions. The ions with similar charges repel each other, whereas ions with opposite charges attract.

Learn more about ion-ion interaction, here:

https://brainly.com/question/7988007

#SPJ2

where do the electrons that are excited by the energy in sunlight first come from?

Answers

Answer:

Pigments in the light-harvesting complex pass light energy to two special chlorophyll a molecules in the reaction center. The light excites an electron from the chlorophyll a pair, which passes to the primary electron acceptor. The excited electron must then be replaced.

Explanation:

During photosynthesis,the electrons that are excited by the energy in sunlight first come from chlorophyll pigment present in the leaves.

What is photosynthesis?

It is defined as a process by which plants and other photosynthetic organisms convert the light energy in to chemical energy  through the process of cellular respiration.

Some of the energy which is converted  is stored in molecules of carbohydrates like sugar and starches  which are made up of from carbon dioxide and water . Photosynthetic organisms which can perform photosynthesis  are algae and cyanobacteria. Photosynthesis is largely responsible for producing and maintaining the content of oxygen in earth's atmosphere.

The process begins with proteins absorbing light energy  which are called reaction centers and contain a green pigment which is called chlorophyll . In plants ,these pigments are present inside organelles called chloroplasts while in bacteria they are present in plasma membrane.

Learn more about photosynthesis,here:

https://brainly.com/question/29775046

#SPJ5

How much heat is needed to raise the temperature of 100g of an iron from 25°C to
110°C?
(The specific heat of iron is 0.45 J/g∙°C).

Answers

Answer:

382.5J

Explanation:

Use the formula:

E = mcΔθ or Q = mcΔT

m = 100g

c = 0.45 J/g°C

ΔT or Δθ = 110 - 25 = 85°

Sub in the values:

E = 100 × 0.45 × 85

= 382.5J

true or False
sound needs a medium to travel​

Answers

Answer:

True or T

Explanation:

Is the correct answer please make me brainliest

Số amin bậc một có cùng công thức phân tử C3H9N là

A. 3. B. 1. C. 2. D. 4

Answers

Answer:

A.3

Three primary amines

Ba amin chính

Which of the following are products of combustion?



liquid and solid water


newly discovered elements


additional atoms


heat and light

Answers

The answer option which are products of combustion is: D. Heat and light.

In Chemistry, there are five (5) main types of chemical reaction and these include;

Combination reaction.Double-replacement reaction.Decomposition reaction.Single-replacement reaction.Combustion reaction.

A combustion reaction can be defined as an exothermic chemical reaction between physical substances, usually in the presence of oxygen and hydrocarbons to produce heat, light and carbon.

An example of a combustion reaction is the burning of forest trees and plants.

In conclusion, the products of combustion are heat and light.

Read more: https://brainly.com/question/21453409

Answer:

heat and light

Explanation:

Calcium carbonate decomposes into calcium oxide and carbon dioxide when heated. Calculate the mass of carbon dioxide released when 300 g of calcium carbonate is heated.

Answers

Answer: 131.9 g

Explanation:

Write a Balanced Equation for the decomposition

CaCO₃     →     CaO    +    CO₂

Find Moles of CO₂ Produced

Since the mole ratio of  CaCO₃  to CO₂ is 1 to 1,

the moles of CaCO₃ = moles of CO₂

moles of CaCO₃   = mass ÷ molar mass

                             = 300 g ÷ 100.087 g/mol

                             = 2.997 moles

∴ moles of CO₂ = 2.997 moles

Determine Mass of CO₂

Mass = moles × molar mass

         = 2.997 mol × 44.01 g/mol

         = 131.9 g

∴ when 300 g of calcium carbonate is decomposed, it produces 131.9 g of carbon dioxide.

what family is hydrogen in? explain

Answers

Explanation:

Hydrogen is a very special element of the periodic table and doesn't belong to any family. While hydrogen sits in Group I, it is NOT an alkali metal.

Find the number of protons, neutrons, and electrons for hydrogen-1, hydrogen-2, and hydrogen-3 respectively.

Answers

Answer:

Protons Neutron Electrons

hydrogen-1 1 0 1

hydrogen-2 1 1 1

hydrogen-3 1 2 1

Explanation:

hydrogen-1, hydrogen-2, and hydrogen-3 are all isotopes.

Isotopes have the same number of protons but a varying number of neutrons. Protons = Electrons.

Hi! I could use some help, I need to turn this in today

Each of these Ionic Compounds are named INCORRECTLY.

1. Find and describe the mistake
2. Correctly name the compound.

CaCl2 - Calcium Chlorine

CuS - Copper Sulfide

Li3P - Trilithium Phosphide

CuBr - Copper(II) Bromide

NaOH - Sodium Hydrogen Oxide

Answers

Explanation:

The nomenclature of ionic compounds is given by:

1. Positive is written first.  And if the metal atom has various oxidation states then its oxidation state is to be mentioned in brackets with help of roman numbers

2. The negative ion is written next and a suffix is added at the end of the negative ion. The suffix written is '-ide'.

1.)  : Calcium chloride  (Correct)

In the given compound, calcium has oxidation state of +2 and chlorine has oxidation state of -1.The name is correct.

2.)  : Copper (II) oxide   (Incorrect)

In the given compound,copper has the oxidation state of +1 and oxygen has oxidation state of -2.So ,the correct name will be Copper (I) oxide.

3.)  : Lead (II) sulfide   (Incorrect)

In the given compound, lead has the oxidation state of +4 and sulfur has oxidation state of -2. So ,the correct name will be Lead (IV) sulfide.

I will make you brainless answer this 1 question pleaaeeee!b​

Answers

The answer is point 3

What are the factors affecting chemical reaction??? 4 points. ​

Answers

Answer:

Surface areaTemperature Concentration Amount of catalyst used

what are 5 different bases for birds

Answers

Answer:

adenine, guanine, cytosine, thymine, and uracil

The specific heat of wood is 2.03 J/g.°C. How much
heat is needed to convert 225 g of wood at -15.0°C to
10.0°C?

Answers

Answer:

11419 J/g/ 11.419 KJ/g

Explanation:

H=MCQ

H=225×2.03×(-15-10)

H=225×2.03(25) Note; negative sign is of no use

H=11419J/g

Someone pls help me I will make you brain

Answers

Answer:

Thanks but I already have a brain LOL.

Your answer is D cooler temperatures.

Melting permisfrost actualy is a source of greenhouse gas because it realeses water which could in turn be vaporized eventualy.

Equation between Mg and H2O

Answers

Answer:

Mg + 2H2O → Mg(OH)2 + H2, is normally sluggish, but it becomes reasonably rapid when a milled composite of powdered magnesium metal and powdered iron (1−10 mol %) is used with sodium chloride solutions.

The electronic configuration of an element is given below.

Element 1: 1s22s22p4

Which statement about the reactivity of the element is true?

It is reactive because it has to gain an electron to have a full outermost energy level.
It is unreactive because it has to lose an electron to have a full outermost energy level.
It is reactive because it has to gain two electrons to have a full outermost energy level.
It is unreactive because it has to gain two electrons to have a full outermost energy level.

Answers

Answer:

It is reactive because it has to gain an electron to have a full outermost energy level.

Explanation:

Answer:

A

Explanation:

Plants are able to produce special chemicals at the right time and place.
A: True
B: False
help fast my test is almost due

Answers

Answer:

true

Explanation:

Other Questions
how does chromatid cohesion as maintained by cohesin proteins differ in mitosis and meiosis? can someone help me solve this Y= q-k/n for q classify each of these reactions pb(no3)2+nicl2=pbcl2+ni(no3)2 g(x) = 3x-1f(x) = x + 5.find g (f (4) What one accomplishment do you consider to be the greatest of the ancient Mesopotamian civilizations? help plz 20 points What is the equation of the line that passes through the point (-6, -7) and has a slope of 0 what dreams do you have?please write 44 words (Someone help asap! I searched this question but some people are saying true and others are saying its false so im not sure what to do cause the test im doing is a huge part of my grade.)Is this statement true or false?One of the reasons for the lack of Indian unity in fighting Europeans was, that the Indians were descended from different peoples who came in different waves of immigration.truefalse tortoise A walks 32 feet per hour and Tortoise B walks 8 inches per minute. who travels faster A family wants to be able to give their child $5,000 per year for 4 years of college. The child will leave for college in 8 years, at which point the family will stop contributing to the college fund. How much money should be set aside each year on the child's birthday in order to follow through with this plan Part A and Part C the same? Why or why not? Find the elapsed time of 8:45AM to 1:10 PM Similar to el Zcalo, what public spaces in the United States play host to major celebrations and protests? And in other parts of the world? 1. Rice, beans tortillas, and plantains are common foods in Central American countries. Where does the comma belong in this sentence? hello and good morning, todays question is..name the most popular thing today. vs the most popular item in the 90s a serious neck injury may leave a person paralyzed from the neck down. explain why. $200 is divided in the ratio 6: 4, What is the smaller part? What is the molecule in this image?Nucleic acid A protein A lipidA carbohydrate Given the following functions, find the indicated values,f(x)= 1 - 5x(a) f(-4) (b) f(0) (C) f(5)(a) f( 4)=0 Is coup detat means overthrow?