What mass of benzoic acid, C6H5COOH, would you dissolve in a 350.0 mL of water to produce a solution with a pH = 2.85? Ka=6.3*10^-5.

Answers

Answer 1

The formula for Ka  is used to determine the mass of benzoic acid that is needed to be dissolved in a 350.0 mL of water to produce a solution with a pH = 2.85 and Ka=6.3*10^-5.

given :

Ka = [H3O+][C6H5COO-]/[C6H5COOH]

Since the pH is known, we can use the equation pH = -log[H3O+] to find the concentration of hydronium ions in the solution.

2.85 = -log[H3O+] [H3O+] = 5.01 × 10-3 M

We assume that the benzoic acid fully dissociates so that [C6H5COO-] = [H3O+] and [C6H5COOH] - [H3O+]

Substituting the values into the formula gives

Ka = [5.01 × 10-3][5.01  10-3]/[C6H5COOH] Ka = 2.51  10-5M1, so we will solve for [C6H5COOH].

Rearranging the equation for Ka, we obtain [C6H5COOH] = [H3O+]. 2 /[C6H5COO-] 2.51 × 10-5 = (5.01 × 10-3)2 / [C6H5COOH] [C6H5COOH] = (5.01  10-3) 2 / (2.51 × 10-5) = 1003.98 M

As the solution requires the presence of benzoic acid in 350.0 mL of water,

We will use the equation:

Mass = (molarity) (molecular mass) (volume) Mass = (1003.98) (122.12 g/mol) (0.3500 L) Mass = 43.4 g

The mass of benzoic acid that would dissolve in 350.0 mL of water to produce a solution with a pH of 2.85 is 43.4 g.

To know more about the Ka https://brainly.com/question/16035742

#SPJ11


Related Questions

which compound will exhibit hydrogen bonding with itself in the liquid state? question 9 options: a) ch3och3 b) h2co c) ch3coch3 d) ch3ch2nh2 e) ch3f

Answers

The compound that will exhibit hydrogen bonding with itself in the liquid state is CH3CH2NH2.

What is hydrogen bonding?

Hydrogen bonding is a special kind of dipole-dipole attraction in which hydrogen is bonded to an element like oxygen, nitrogen, or fluorine. Hydrogen bonding is stronger than Van der Waal's forces but weaker than covalent, ionic or metallic bonds.

An explanation for the given alternatives:

a) CH3OCH3 will not exhibit hydrogen bonding with itself in the liquid state.

b) H2CO will not exhibit hydrogen bonding with itself in the liquid state.

c) CH3COCH3 will not exhibit hydrogen bonding with itself in the liquid state.

d) CH3CH2NH2 will exhibit hydrogen bonding with itself in the liquid state.

e) CH3F will not exhibit hydrogen bonding with itself in the liquid state.

Learn more about hydrogen bonding on:

https://brainly.com/question/1426421

#SPJ11

The tiny particle of an atom that moves around the nucleus is the

Answers

the correct answer is “electron”

name the compound so2 using the stock system.PLS HELPP ASAPP

Answers

Answer:SO2 is a covalent compound made up of sulfur and oxygen atoms, so the stock system is not applicable here as it is used for naming compounds that contain metal ions with different oxidation states.Instead, the IUPAC (International Union of Pure and Applied Chemistry) name for SO2 is sulfur dioxide.

Explanation:So I helped you help me please

The compound SO₂ is named sulfur dioxide using the Stock system.

In the Stock system, the names of chemical compounds are based on the oxidation states of the elements involved. The oxidation state refers to the charge that an atom carries when it forms a compound.

Sulfur (S) has an oxidation state of +4, and oxygen (O) has an oxidation state of -2. The compound's name reflects these oxidation states.

Combining the elements and their oxidation states, the compound is named "sulfur(IV) oxide" using the Stock system. However, it is more commonly known as sulfur dioxide, which is the traditional name for the compound.

To learn more about the Stock system, follow the link:

https://brainly.com/question/31567840

#SPJ6

What happens to initial reaction rate if enzyme concentration is tripled? (Assume conditions like those in the properties of enzymes lab, and assume that the pH and initial substrate concentration are constant.)A. The initial rate will increase by a factor of 9 because the rate is dependent on the square of the enzyme concentration.B. The initial rate will triple when enzyme concentration is tripled because the initial rate of reaction is linearly related to enzyme concentration.C. The fixed substrate concentration will hold the initial rate constant because only substrate concentration governs the reaction rate.D. The fixed pH will hold the initial rate constant because only pH governs the reaction rate.E. The initial rate will not change because the enzyme is saturated with substrate.

Answers

If enzyme concentration is tripled, the initial rate will triple when enzyme concentration is tripled because the initial rate of reaction is linearly related to enzyme concentration. The correct answer is option B.

The initial rate of reaction and the enzyme concentration are directly proportional to each other. When the enzyme concentration is tripled, the initial rate of reaction will triple as well.

Assuming that conditions are like those in the properties of enzymes lab and pH and initial substrate concentration are constant, the initial rate of reaction depends on the enzyme concentration. Enzyme concentration affects the rate of the reaction at the beginning of the reaction. When the enzyme concentration is increased, the number of active sites available for the reaction is also increased.

The rate of a reaction is affected by several factors such as temperature, pH, substrate concentration, and enzyme concentration. In most cases, an increase in the enzyme concentration leads to an increase in the rate of the reaction. However, there comes a time when the rate of reaction reaches a maximum point irrespective of the enzyme concentration. At this point, the enzyme is said to be saturated with substrate.

Learn more about enzyme concentration here: https://brainly.com/question/13445202

#SPJ11

write the formula and name of a compound formed from the ionic interaction between a ion and ion. both ions are isoelectronic with the atoms of a chemically unreactive period element.

Answers

The compound formed from the ionic interaction between a ion and ion is CsF (Cesium Fluoride). Both ions are isoelectronic with the atoms of a chemically unreactive period element. The Cs+ ion is isoelectronic with Xe while the F− ion is isoelectronic with Ne.

An isoelectronic species refers to atoms, molecules, or ions that have the same number of electrons. Isoelectronic species can include ions and neutral atoms that share the same number of electrons. The number of protons in the nucleus may be different for isoelectronic species, but the number of electrons is the same.

An ionic compound refers to a chemical compound formed by the combination of oppositely charged ions. In general, ionic compounds are formed between metallic and non-metallic elements. In ionic compounds, cations and anions combine to form a crystal lattice structure. These compounds are held together by strong electrostatic forces between oppositely charged ions. The resulting ionic bond is a strong bond, which makes ionic compounds quite stable.

CsF is the chemical formula for Cesium Fluoride. It is an ionic compound formed by the combination of cesium cation (Cs+) and fluoride anion (F-). CsF is a white crystalline solid at room temperature with a melting point of 684°C. It is commonly used in the synthesis of fluorinated organic compounds.

To learn more about "isoelectronic", visit: https://brainly.com/question/19157981

#SPJ11

if a person has to eliminate 600 mosmoles of waste solutes in the urine each day, and the maximum possible concentration of urine is 1400 mosmoles/l, what is the obligatory water loss?

Answers

In order to eliminate 600 mosmoles of waste solutes in the urine each day, the body needs to produce urine with a concentration of at least 600 mosmoles/l. However, the maximum possible concentration of urine is 1400 mosmoles/l, which means that the body will need to produce at least 600/1400 = 0.43 liters (or 430 milliliters) of urine to eliminate the waste solutes.

The amount of water that the body needs to produce this volume of urine is called the obligatory water loss. In this case, the obligatory water loss would be 430 milliliters of water per day. However, this is just the minimum amount of water required to eliminate waste solutes. In reality, the body needs to produce more urine to eliminate other substances and maintain a proper balance of electrolytes, which means that the actual obligatory water loss is typically higher.

Factors such as diet, exercise, and environmental conditions can also affect the amount of water needed to maintain proper hydration and eliminate waste products. Therefore, it's important to drink enough water and maintain a healthy lifestyle to support optimal kidney function and overall health.

To learn more about volume refer to:

brainly.com/question/14710169

#SPJ4

which of the following would be the most soluble in water? question 7 options: a) ch3ch2ch2nh2 b) ch3ch2ch2ch2ch2ch2nh2 c) ch3ch2nh2 d) ch3nh2 e) ch3ch2ch2ch2nh2

Answers

Answer:

(c) CH3CH2NH2

Explanation:

The most soluble compound in water would be the one that can form hydrogen bonds with water molecules. The presence of -NH2 (amine) or -OH (hydroxyl) groups can lead to the formation of hydrogen bonds. Therefore, among the given options, the most soluble compound in water would be (c) CH3CH2NH2 (ethylamine) because it contains an amine group that can form hydrogen bonds with water molecules.

which of these pairs of elements is least likely to combine to form an ionic bond?a. carbon and oxygen
b. sodium and fluorine
c. sulfur and hydrogen
d. phosphorus and oxygen

Answers

Answer:(part a) Lithium and Chlorine, (part c) Potassium and Oxygen are likely to form an ionic compound.

Explanation:

brainliest please

Calculate the energy required to melt 40.3 g of ice at 0 oC.
The molar heat of fusion for ice is 6.02 kJ/mol.

Answers

the energy required to melt 40.3 g of ice at 0 oC.The molar heat of fusion for ice is 6.02 kJ/mol. the energy required to melt 40.3 g of ice at 0 oC is 13.5 kJ.

The energy required to melt a substance is given by the formula:

q = nΔH_fus

where q is the heat absorbed or released during the phase change, n is the number of moles of the substance undergoing the phase change, and ΔH_fus is the molar heat of fusion of the substance.

To apply this formula to the melting of 40.3 g of ice at 0 oC, we first need to calculate the number of moles of ice present:

moles of ice = mass of ice / molar mass of ice

moles of ice = 40.3 g / 18.015 g/mol

moles of ice = 2.235 mol

Next, we can use the formula for q to calculate the energy required to melt the ice:

q = nΔH_fus

q = 2.235 mol × 6.02 kJ/mol

q = 13.5 kJ

Learn more about energy here:

https://brainly.com/question/1932868

#SPJ1

Identify the type of symbiotic relationship described in each scenario.

Some wasps lay their eggs on caterpillars called tomato hornworms. When the eggs hatch, the young wasps burrow

into the caterpillar's body and eat it alive. The adult wasps then fly away. This is an example of

Answers

The described scenario is an example of parasitism.

Parasitism is a type of symbiotic relationship in which one species benefits while the other is harmed. In this case, the wasps benefit by using the caterpillar as a host for their young, which ultimately leads to the death of the caterpillar.

The caterpillar, on the other hand, is harmed as its body is used as a food source for the developing wasp larvae, ultimately leading to its death. This type of interaction is common in nature, with many species relying on others as a source of food or shelter, even if it comes at the cost of the host's well-being.

To learn more about parasitism refer to:

brainly.com/question/22589174

#SPJ4

Arrange these species by their ability to act as an oxidizing agent. Best oxidizing agent Au3+ Fe2+ 2+ Na+ Poorest oxidizing agent Answer Bank

Answers

AlthoughNa⁺ and Fe²⁺   are typically weaker oxidising agents than Au³⁺ , this may not always be the case in every process.

An oxidizing agent is a species that causes oxidation by accepting electrons or donating oxygen, and therefore it is characterized by having a high oxidation state. In general, the ability to act as an oxidizing agent increases as the oxidation state of the species increases. Based on this, we can arrange the given species in order from best to poorest oxidizing agent as follows:

Au³⁺ > Fe²⁺ > Na⁺

Among these species, Au³⁺ has the highest oxidation state and therefore the strongest ability to act as an oxidizing agent. Fe²⁺ has a lower oxidation state than Au³⁺, but it is still capable of acting as an oxidizing agent in certain reactions. Na⁺ has the lowest oxidation state of the three and is therefore the poorest oxidizing agent among them.

It's important to note that the ability to act as an oxidizing agent also depends on other factors, such as the nature of the other reactants involved and the reaction conditions.

Therefore, while Au³⁺ is generally a stronger oxidizing agent than Fe²⁺ and Na⁺, this may not always be the case in every reaction.

To learn more about oxidizing agent  refer to:

brainly.com/question/10547418

#SPJ4

She measured the mass of the metal to be 352. 3 grams. Then she dropped the metal into a measuring cup and found that it displaced 18. 0 mL of water

Answers

The density of the metal will be 11.42 g/cc.

To calculate the density of the metal, we can use the following formula:

density = mass / volume

where mass is given as 225.6 grams and volume is the volume of water displaced by the metal, which is given as 19.7 mL.

However, we need to convert the volume from milliliters (mL) to cubic centimeters (cc), since the unit of density is grams per cubic centimeter (g/cc).

1 mL = 1 cc

Therefore:

volume = 19.7 mL = 19.7 cc

Now we can substitute the values into the formula:

density = 225.6 g / 19.7 cc

= 11.42 g/cc

To know more about density here

https://brainly.com/question/29775886

#SPJ4

--The given question is incomplete, the complete question is

"First she measured the mass of the metal to be 225.6 grams. Then she dropped the metal into a measuring cup and found that it displaced 19.7 mL of water. Calculate the density of the metal."--

12a. sigma complexes are the intermediates for electrophilic aromatic substitution (eas). what are the intermediate complexes for nucleophilic aromatic substitution (snar) called

Answers

Sigma complexes are the intermediates for electrophilic aromatic substitution (eas). The intermediate complexes for nucleophilic aromatic substitution (SNAR) are called: pi complexes.

Pi complexes form when a nucleophile, or electron-rich species, attacks an electron-deficient atom in an aromatic ring. This attack displaces the electron-deficient atom, and a pi bond is formed between the nucleophile and the aromatic ring. The displacement of the electron-deficient atom results in the formation of an intermediate pi complex.

The pi complex is a key intermediate in SNAR reactions. The pi complex can then be attacked by another nucleophile, resulting in the formation of a new aromatic compound. During this reaction, the aromaticity of the ring is maintained and the stability of the pi complex is increased.

The pi complex is a key intermediate in the EAS mechanism. In order for the reaction to take place, the pi complex must be stable. This means that the electrons must be properly distributed around the ring and the nucleophile must be strongly bound to the electron-deficient atom.

This stability helps to ensure that the reaction will proceed efficiently and that the desired product is formed. In conclusion, the intermediate complexes for nucleophilic aromatic substitution (SNAR) are called pi complexes. Pi complexes form when a nucleophile attacks an electron-deficient atom in an aromatic ring.

The displacement of the electron-deficient atom results in the formation of an intermediate pi complex, which is then attacked by another nucleophile, resulting in the formation of a new aromatic compound. The stability of the pi complex is essential for the successful completion of the reaction.

To know more about electrophilic aromatic substitution refer here:

https://brainly.com/question/28286554#

#SPJ11

predict the major organic product formed on thermal decarboxylation of the following compound.

Answers

The compound given is 3-methyl-2-pentenoic acid.

Thermal decarboxylation of 3-methyl-2-pentenoic acid is a reaction in which the carboxylic acid group is removed from the molecule, resulting in the formation of an alkene.

In this reaction, the acid group is first protonated and then the bond between the alpha carbon and the carboxyl oxygen is broken. The major organic product formed on thermal decarboxylation of 3-methyl-2-pentenoic acid is 2-methyl-1-pentene.

The initial step of the reaction involves the protonation of the carboxylic acid group of 3-methyl-2-pentenoic acid by a strong acid, typically sulfuric acid. This protonation activates the carboxyl group and makes it more susceptible to decarboxylation.

The subsequent step involves the breaking of the bond between the alpha carbon and the carboxyl oxygen, resulting in the loss of carbon dioxide and the formation of the alkene. The formed alkene in this reaction is 2-methyl-1-pentene.

Therefore, the major organic product formed on thermal decarboxylation of 3-methyl-2-pentenoic acid is 2-methyl-1-pentene.

Know more about decarboxylation here

https://brainly.com/question/17312252#

#SPJ11

if a buffer solution is 0.230 m in a weak acid ( a=7.4×10−5) and 0.400 m in its conjugate base, what is the ph?

Answers

4.37

Explanation:

To calculate the pH of the buffer solution containing 0.230 M weak acid (HA) with an ionization constant (Ka) of 7.4 × [tex]10^{-5}[/tex] and 0.400 M of its conjugate base (A-), you can use the Henderson-Hasselbalch equation:

pH = pKa + log([A-]/[HA])

Step 1: Calculate the pKa value from Ka:
pKa = -log(Ka) = -log(7.4 × [tex]10^{-5}[/tex]) ≈ 4.13

Step 2: Substitute the concentrations of A- and HA into the equation:
pH = 4.13 + log(0.400 / 0.230)

Step 3: Calculate the pH value:
pH ≈ 4.13 + log(1.739) ≈ 4.13 + 0.240 ≈ 4.37

Therefore, the pH of the buffer solution is approximately 4.37.

To know more about pH:

https://brainly.com/question/14451880?

#SPJ11

which of the following pairs of elements are likely to form ionic compounds? check all that apply. which of the following pairs of elements are likely to form ionic compounds?check all that apply. chlorine and bromine sodium and potassium potassium and sulfur magnesium and chlorine helium and oxygen nitrogen and iodine

Answers

Answer:

Magnesium and Chlorine

Potassium and Sulfur

Explanation:

Ionic compounds form between a metal and a non-metal

Magnesium & Chlorine and Potassium & Sulfur will form ionic compounds due to Magnesium and Potassium being metals while Chlorine and Sulfur are non metals.

Elements also have to have a large difference in electronegativity as one atom has to lose its electron to the other atom.

What is used to prepare a calibration curve? A solvent blank. A set of solutions with various unknown analyte concentrations. A set of solutions with a range of precisely known analyte concentrations. A set of solutions with the exact same analyte concentration.

Answers

To prepare a calibration curve is used A set of solutions with the exact same analyte concentration.

The calibration curve is the graphical representation of the relation in between the concentration or the amount of  substance, and the signal or the measurement obtained from the analytical instrument or the assay. The calibration curve is to constructed by the measuring the signal or the response of instrument or the assay at the different known concentrations and the amounts of substance, and the plotting of these values on the graph.

The resulting curve is used to determine the concentration and the amount of the substance in the unknown sample by the measuring its signal.

To learn more about calibration curve here

https://brainly.com/question/21661427

#SPJ4

What is the definition of transuranic waste

Answers

Answer:  Transuranic waste consists of materials containing alpha-emitting radionuclides, with half-lives greater than twenty years and atomic numbers greater than 92, in concentrations greater than 100 nanocuries per gram of waste.

Answer:

Transuranic radioactive waste is waste that contains manmade elements heavier than uranium on the periodic table. It is produced during nuclear fuel assembly, nuclear weapons research and production, and during the reprocessing of spent nuclear fuel.

Explanation:

Transuranic waste consists of waste that has been contaminated with man-made radioactive elements, heavier than uranium, like neptunium, plutonium, and americium. They might be produced from uranium and plutonium during reactor operations. The methods of disposal might be hiding it away in isolation plants, such as the Waste Isolation Pilot Plant, or diluting it so that the radionuclides returning to the atmosphere are harmless, or even burying them in the ground.

learn more https://brainly.com/question/9736963?referrer=searchResults

Why was it necessary to build and use WIPP

Answers

Answer:

The Waste Isolation Pilot Plant, or WIPP, is the world's first underground repository licensed to safely and permanently dispose of transuranic radioactive waste left from the research and productions of nuclear weapons.

which indicator would be the best to use for a titration between 0.30 m c6h5cooh with 0.30 m naoh? you will probably need to consult the appropriate table in the book.

Answers

The best indicator to be used is Phenolphthalein.

Phenolphthalein changes color from colorless to pink as the solution becomes basic, which is ideal for this titration as the endpoint is when all the benzoic acid has reacted with the sodium hydroxide to form sodium benzoate, which is basic.

It is important to note that the equivalence point for this titration is not at a pH of 7, as it would be for the titration of a strong acid with a strong base. Instead, the equivalence point for the titration of a weak acid with a strong base is above a pH of 7, closer to a pH of 8-10.

Hence, Phenolphthalein would be the best indicator to use for a titration between 0.30 M [tex]C_6H_5COOH[/tex] with 0.30 M NaOH.

#SPJ11

To learn more about Indicator refer: https://brainly.com/question/12708635

1
Select the correct diagram.
A substance is held in a sealed container. The substance takes the shape of the container, but the substance's particles do not fill the container's volume.



Heat is added to the substance, and all of its particles eventually vaporize. Which diagram shows how the particles are most likely arranged after the substance has completely vaporized?

Answers

There are numerous types of water. It is a solid at very low temperatures (below 0°C). When temperatures are "normal" (between 0°C and 100°C),

it's a liquid), it is. Water becomes a gas at temperatures higher than 100 °C. (steam). The temperature affects the state that the water is in. Each of the three states—solid, liquid, and gas—has a distinct set of physical characteristics. Solid, liquid, or gas are the three basic states of matter. Physical properties also include the state that a specific substance manifests. At ambient temperature, some substances, like oxygen and carbon dioxide, exist as gases, while others, like water and mercury metal, do so as liquids. The majority of metals are solids at normal temperature.

Learn more about temperatures here-

https://brainly.com/question/29072206

#SPJ1

After determining the amount of moles required for one of the reactants, it was shown that was the limiting reactant and was the excess reactant.
WILL MARK BRAINLIEST PLS SAVE ME FROM THAT ANN OYING GUY

Answers

You can identify the limiting reactant and the surplus reactant in a chemical reaction if you know how many moles are needed for one of the reactants.

To do this, compare the number of moles of the necessary reactant to that of the accessible reactant. The limiting reactant is the one that results in the smallest quantity of product, and the excess reactant is the one that results in the most significant amount of product.

Steps

Consider a reaction where 4 moles of the product are produced from 2 moles of reactant A and 3 moles of reactant B. The following calculation can be used to identify the limiting reactant if you have 4 moles of reactant A and 6 molecules of reactant B:

4 moles of reactant A / 2 moles required of reactant A equals 2.

6 moles of reactant B divided by 3 molecules of reactant B needed equals 2.

There is no surplus because both reactants yield the same amount of product, meaning they are both fully utilized. One reactant would be limiting and the other would be in excess of the computations that had yielded a different result.

learn more about limiting reactants here

https://brainly.com/question/14222359

#SPJ1

Answer:

After determining the amount of moles required for one of the reactants, it was shown that ✔ copper was the limiting reactant and ✔ sulfur was the excess reactant.

Explanation:

edge 2023

b) what key absorbance indicative of starting material 2-methylcyclohexanone should be absent? give wavenumber, bond type and functional group.

Answers

In the IR spectrum of 2-methylcyclohexanone, an important absorbance to be absent after the reaction is the carbonyl stretch at around 1710 cm⁻¹. This peak is indicative of the carbonyl functional group, which is present in the starting material but absent in the product, which is a cyclic ether.

The carbonyl functional group has a C=O bond, which is a strong and characteristic bond that absorbs infrared radiation at around 1710 cm⁻¹. This absorbance is an important feature in the IR spectrum of ketones and aldehydes, which both contain a carbonyl group.

In the case of the reaction of 2-methylcyclohexanone to form a cyclic ether, the carbonyl group is converted to an ether, which lacks a carbonyl functional group. Therefore, the absence of the carbonyl stretch absorbance at around 1710 cm⁻¹ in the IR spectrum of the product would indicate the successful conversion of the starting material to the desired product.

To learn more about 2-methylcyclohexanone refer to:

brainly.com/question/28187180

#SPJ4

what is the balanced equation acetic acid and sodium hydroxide ?

Answers

The balanced equation for the reaction between acetic acid and sodium hydroxide is

CH3COOH + NaOH → CH3COONa + H2O. This reaction is an example of a neutralization reaction, where an acid and a base react to produce a salt and water.

Acetic acid is an organic compound with the formula CH3COOH. It is a weak acid that dissolves in water to produce a sour or tart flavor. Sodium hydroxide, on the other hand, is a highly reactive compound with the formula NaOH. It is a strong base that reacts with acids to produce salt and water. When acetic acid and sodium hydroxide are mixed, a reaction occurs. The equation for this reaction is given below:

CH3COOH + NaOH → CH3COONa + H2O

In this equation, CH3COOH represents acetic acid, NaOH represents sodium hydroxide, CH3COONa represents sodium acetate, and H2O represents water. The equation is balanced, meaning that the same number of atoms of each element is present on both the reactant and product sides of the equation. The balanced equation above shows that acetic acid reacts with sodium hydroxide to form sodium acetate and water. The reaction between acetic acid and sodium hydroxide is an example of a neutralization reaction. This type of reaction occurs when an acid and a base react to form a salt and water.

To learn more about Neutralization :

https://brainly.com/question/23008798

#SPJ11

barium hydroxide and iron(iii) acetate solution are mixed in a flask what are the products of the reaction

Answers

Barium acetate (Ba(CH₃COO)₂) and iron(III) hydroxide (Fe(OH)₃) are the reaction's byproducts, with iron(III) hydroxide precipitating as a brownish-red substance.

When barium hydroxide (Ba(OH)₂) and iron(III) acetate [Fe(CH₃COO)₃] solutions are mixed, a double displacement reaction occurs, resulting in the formation of a precipitate and a new solution. The balanced chemical equation for the reaction is:

Ba(OH)₂ + Fe(CH₃COO)₃ → Ba(CH₃COO)₂ + Fe(OH)₃

In this reaction, the barium ion (Ba²⁺) and the acetate ion (CH₃COO⁻) switch places to form barium acetate (Ba(CH₃COO)₂) and iron(III) hydroxide (Fe(OH)₃). The iron(III) ion (Fe³⁺) combines with hydroxide ions (OH⁻) from the barium hydroxide solution to form the insoluble iron(III) hydroxide precipitate.

Therefore, the products of the reaction are barium acetate (Ba(CH₃COO)₂) and iron(III) hydroxide (Fe(OH)₃), with the formation of a brownish-red precipitate of iron(III) hydroxide.

To learn more about barium hydroxide refer to:

brainly.com/question/30888146

#SPJ4

Determine the volume of a concentrated solution needed for dilution Question A stock solution has a concentration of 1.5 M SO2 and is diluted to a 0.54 M solution with a volume of 0.18 L. What was the volume of the stock solution? • Your answer should have two significant figures. Provide your answer below: FEEDBACK MORE INSTRUCTION SUBMIT Content attribution

Answers

The volume of the stock solution needed for dilution is 0.065 L.

How to find the volume of concentrated solution needed for dilution?

To determine the volume of the stock solution needed for dilution, we can use the dilution formula: C1V1 = C2V2, where C1 is the initial concentration, V1 is the initial volume, C2 is the final concentration, and V2 is the final volume.

Given:
C1 = 1.5 M (concentration of the stock solution)
C2 = 0.54 M (final concentration after dilution)
V2 = 0.18 L (final volume)

We need to find V1, the volume of the stock solution.

Using the formula: C1V1 = C2V2, we can solve for V1:

V1 = (C2V2) / C1
V1 = (0.54 M × 0.18 L) / 1.5 M

Now, calculate the value:

V1 ≈ 0.065 L

With two significant figures, the volume of the stock solution needed for dilution is 0.065 L.

To know more about Dilution Formula:

https://brainly.com/question/15136171?

#SPJ11

What is the approximate volume of gas in a 1.50 mol sample that exerts a pressure of 0.922 atm and has a temperature of 10.0ºC (283 K)? (R= 0.0821 L atm over mol K )

PV = nRT

V= ___ L (Answer Format: XX.X)

Answers

The approximate volume of the gas is 31.0 L in a 1.50 mol sample that exerts a pressure of 0.922 atm and has a temperature of 10.0ºC .

We can use the Ideal Gas Law equation:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature in Kelvin.

Rearranging the equation, we get:

V = (nRT) / P

Substituting the given values, we get:

V = (1.50 mol * 0.0821 L atm/mol K * 283 K) / 0.922 atm

V = 31.0 L

A gas law is a mathematical equation that describes the behavior of gases under certain conditions, such as temperature, pressure, volume, and number of moles. There are several gas laws, including Boyle's law, Charles's law, Gay-Lussac's law, and the combined gas law, among others. These laws are based on experimental observations of gas behavior and provide a way to predict how gases will behave under various conditions.

Learn more about ideal gas law here:

https://brainly.com/question/28257995

#SPJ1

Consider the following molecules:
- BrCl
- PF3
- SF4
- SCl2
- CS2
Which one of these molecules has bonds that are most polar?

Answers

The molecule SF4 has the most polar bonds out of the given options.

Polarity in a bond depends on the electronegativity difference between the atoms involved in the bond. The greater the electronegativity difference, the more polar the bond. In the given molecules, the electronegativity difference between the atoms in SF4 is the largest, making it the most polar molecule.

The electronegativity of an atom is a measure of its ability to attract electrons towards itself. Fluorine has the highest electronegativity value among the given atoms, followed by oxygen, chlorine, and bromine, respectively. In SF4, there is a polar covalent bond between sulfur and fluorine, with the electronegativity difference between them being the largest.

The polarity of the bonds in the other molecules is comparatively lower, with either smaller electronegativity differences or symmetrical molecular structures leading to cancelation of bond polarities.

To know more about polar bonds, refer here:

https://brainly.com/question/13631142#

#SPJ11

you are given 0.725 grams of a white powder and told that it is a mixture of potassium carbonate and sodium carbonate. you are asked to determine the percent composition by mass of the sample. you add some of the sample to 10.00 ml of 0.9947 m nitric acid until you reach the equivalence point. when you have added enough carbonate to completely react with the acid, you reweigh your sample and find that the mass is 0.171 g. calculate the mass of the sample that reacted with the nitric acid. calculate the moles of nitric acid that reacted with the sample.

Answers

The moles of nitric acid that reacted with the sample is  0.09947 mol.

The given problem requires you to determine the percent composition by mass of the sample which is a mixture of potassium carbonate and sodium carbonate. To do this, you must first calculate the mass of the sample that reacted with the nitric acid and the moles of nitric acid that reacted with the sample.

Given:
Mass of white powder = 0.725 g
Mass of sample after reaction = 0.171 g
Volume of nitric acid = 10.00 ml
Molarity of nitric acid = 0.9947 M


Step 1: Calculate the mass of the sample that reacted with the nitric acid.
Mass of sample that reacted with nitric acid = Mass of white powder – Mass of sample after reaction
Mass of sample that reacted with nitric acid = 0.725 g – 0.171 g
Mass of sample that reacted with nitric acid = 0.554 g

Step 2: Calculate the moles of nitric acid that reacted with the sample.
Moles of nitric acid that reacted with the sample = (Volume of nitric acid x Molarity of nitric acid)/1000
Moles of nitric acid that reacted with the sample = (10.00 ml x 0.9947 M)/1000
Moles of nitric acid that reacted with the sample = 0.09947 mol


Therefore, the mass of the sample that reacted with the nitric acid is 0.554 g and the moles of nitric acid that reacted with the sample is 0.09947 mol.

To know more about Nitric acid refer here :

https://brainly.com/question/22698468

#SPJ11

which compound would be expected to show intense ir absorption at 1640 cm-1? group of answer choices

Answers

The compound that would be expected to show intense IR absorption at 1640 cm-1 is an amide bond.

An amide bond has a strong absorption peak at around 1640 cm-1 in the infrared spectrum.

What is an IR Spectrum?

An IR (infrared) spectrum is a representation of the molecular vibrations of a sample. It contains peaks that correspond to different functional groups in the sample. The frequency of these peaks is determined by the strength of the bond and the mass of the atoms involved.

For example, a C-H bond will absorb at a different frequency than an O-H bond.

The IR spectrum can be used to identify functional groups in a sample. Different functional groups will produce different peaks in the spectrum. The intensity of the peak can also provide information about the concentration of the functional group in the sample.

Amide Bond: An amide bond is a functional group that consists of a carbonyl group (C=O) bonded to an amino group (-NH2). It is commonly found in proteins and peptides. The amide bond has a strong absorption peak at around 1640 cm-1 in the infrared spectrum. This peak is caused by the stretching vibration of the carbonyl group.

The amide bond is important in biochemistry because it is responsible for the formation of peptide bonds between amino acids. The peptide bond is a key component of protein structure, and understanding its properties is crucial to understanding the function of proteins.

To know more about "ir absorption" refer here:

https://brainly.com/question/14389213#

#SPJ11

The above question is incomplete, The complete question is written below,
Which compound would be expected to show intense IR absorption at 1640 cm-1 among the given options?
A. Amino acid
B. Ethanol
C. Propanol
D. Butanal

Other Questions
a radioactive substance decays exponentially. a scientist begins with 110 milligrams of a radioactive substance. after 21 hours, 55 mg of the substance remains. how many milligrams will remain after 31 hours? how has the concept of the zombie changed over time? what does this tell you about changing societial needs? g CalculatorWhat is the volume of this figure?Enter your answer in the box.ft Which answer choice does not name one of the three national credit reporting agencies (also called credit bureaus)? a. equifax b. experian c. transatlantic d. transunion please select the best answer from the choices provided a b c d If ABCD is dilated by a factor of 3, thecoordinate of B' would be:-5 -4MAB3261-2 -10-1-2.-3C2 3 4 5DB' = ([?], [])Enter Connor began his newspaper route at 3:25p.m. Monday afternoon and finished it at 5:56p.m. He got very hot while he was workingand stopped for eleven minutes to cool offand have a soda. One of his customersstopped him for four minutes to talk about theweather. How long did Connor spend actuallydelivering newspapers? the effect a lower price level has on investment expenditures through the effect that a change in the price level has on interest rates is known as the . calculate the magnetic force experienced by it as it enters a magnetic field of 2.2 t c. what is the radius of the circular path that the particle traverses? What is the solubility of potassium nitrate at 5C The periodontium connects the __________ of the tooth to the alveolar bone.DentinCementumApical foramenInner enamel epithelium find the area of the shaded portion 6cm and 3cm. = 3.14 why does this experimental design use multiple reactions coupled together to measure the reaction rate? what volume of 0.300M would contain 1.5g (H=1, S=32, O=16 Which state was considered one of the border states at the start of the CivilWar?O A. State AB. State BO C. State CO D. State DDBAC you know that installing windows server includes storage services by default. why can't you then create and manage smb shares using server manager? what must be installed first? question 9 options: server for nfs role service file and storage services role advanced storage services role service file server role service match the vocabulary to its definition group of answer choices inheritance allowing an entity such as a variable, method, or an object to have more than one form. superclass [ choose ] object class [ choose ] subclass [ choose ] class hierarchy [ choose ] polymorphism [ choose ] extends [ choose ] is-a [ choose ] overriding [ choose ] overloading 5. The data represented in the scatterplot compare the ages and heights of adult humans. a. Analyze the data and summarize what the scatterplot shows about the relationship between height and age in adult humans. Then explain what the line of best fit visually represents about the variables. b. What does the correlation coefficient, r, indicate about the strength of the relationship between the variables? Explain your answer.c. Based on these data, could you use an adult human's age to predict that person's height? Explain why or why not. Crook Island is 25 km due east of the Isle of Strutay.Grass Rock is 21 km due south of Crook Island.Emerald Cay is 19 km due east of Grass Rock.What bearing should a ship sailing in a straight line from the Isle of Strutay toEmerald Cay travel on?Give your answer in degrees to 1 d.p Answer the following questions:) compare the effect of the stratospheric ozone and tropospheric ozone on peoples health