The diagram shows a partial model for respiration in the human body.
Cellular respiration
?
WATER
water loss through breathing, sweating, and waste removal
?
Food
Energy
a. identify the two missing parts of this model

Answers

Answer 1

The two parts of the model that are missing are as shown in the diagram:

Oxygen (O2): Breathing typically provides oxygen, which is necessary for cellular respiration.Carbon dioxide (CO2) is a byproduct of cellular respiration that is eliminated from the body through sweating, breathing, and other methods of waste removal.How important Oxygen is for  cellular respiration?

Oxygen is essential for cellular respiration, which is the process by which cells convert food molecules (such as glucose) into energy in the form of ATP (adenosine triphosphate). Cellular respiration occurs in the mitochondria of cells and is a complex series of metabolic reactions that requires oxygen as the final electron acceptor in the electron transport chain.

Without oxygen, cellular respiration cannot proceed beyond glycolysis, which is the first step in the process. Glycolysis breaks down glucose into two molecules of pyruvate and produces a small amount of ATP. However, this process is not very efficient, and it cannot sustain cellular activity for very long.

To know more about Cellular Respiration, visit:

https://brainly.com/question/29760658

#SPJ1


Related Questions

a spanner is dropped from a sixth floor window and take 2.2s to hit the ground. A)calculate the height from wich it was drop.b)its impact velocity

Answers

a) The spanner was dropped from a height of 24.2 meters. b)The impact velocity of the spanner is 21.6 meters per second.

What exactly are velocity and example?

Simply put, velocity is the rate at which something travels in a specific direction.

We can use the equations of motion to solve this problem.

a) To calculate the height from which the spanner was dropped, we can use the equation:

[tex]h = (1/2)gt^2[/tex]

where h is the height, g is the acceleration due to gravity, and t is the time taken to fall.

Substituting the given values, we get:

[tex]h = (1/2) \times 9.81 m/s^2 \times (2.2 s)^2 \\= 24.2 meters[/tex]

Therefore, the spanner was dropped from a height of 24.2 meters.

b) To calculate the impact velocity of the spanner, we can use the equation:

v = gt

where v is the final velocity, g is the acceleration due to gravity, and t is the time taken to fall.

Substituting the given values, we get:

[tex]v = 9.81 m/s^2 \times 2.2 s \\= 21.6 m/s[/tex]

Therefore, the impact velocity of the spanner is 21.6 meters per second.

Learn more about impact velocity

brainly.com/question/30328110

#SPJ1

Which of the following is an example of an object with only gravitational potential energy?
Group of answer choices

A book resting on a shelf.

A ball thrown straight upwards

A bone lying on the floor

A fruit falling down off of a tree.

Answers

Since they are not at a height above the ground where gravity can act on them, A ball thrown straight upwards and a bone on the floor both have zero gravitational potential energy.

Of the objects, which one contains gravitational potential energy?

If an object is placed at a height above (or below) the zero height, it has gravitational potential energy. If an object is not in its equilibrium position on an elastic material, it has elastic potential energy.

Gravitational potential: What is it?

The term gravitational potential energy refers to the energy that an item stores as a result of its elevation above the Earth's surface. This energy is a result of an object being subjected to gravity. EP=mgh.

To know more about gravity visit:-

https://brainly.com/question/14874038

#SPJ1

In the figure, a small block of mass m = 0.019 kg can slide along the frictionless loop-the-loop, with loop radius R = 13 cm. The block is
released from rest at point P, at height h = 5R above the bottom of the loop. How much work does the gravitational force do on the
block as the block travels from point P to (a) point Q and (b) the top of the loop? If the gravitational potential energy of the block-Earth system is taken to be zero at the bottom of the loop, what is that potential energy when the block is (c) at point P, (d) at point Q, and (e) at the top of the loop?

Answers

The amount of work done as the block travels from point P to (a) point Q is 0.096J, (b) the top of the loop is 0.072J, the  potential energy when the block is (c) at point P is 0.121 J, (d) at Q is 0.024 J, (e) at top is 0.048 J

Given the mass of small block (m) = 0.019kg

The radius of loop (R) = 13cm.

The height of point P (H) = 5R = 5 *13 = 65cm

the gravitational potential energy of the block-Earth system is taken to be zero at the bottom of the loop.

We know that the potential energy is calculated as (PE) = m*g*h where g is the gravitational acceleration = [tex]9.8m/s^2[/tex]

(a) The work done by the gravitational force on the block as the block travels from point P to point Q is: W = F * d = m*g*d

the distance from point P to Q = 4R = 4 * 13 = 52cm

W =[tex](0.019 kg)*(9.8 m/s^2)*(4R) = 0.096J[/tex]

(b) The work done by the gravitational force on the block as the block travels from point P to the top of the loop is:

Here the displacement from point P to top of loop = H - 2R = 3R = 39cm

W = m*g*h = [tex](0.019 kg)*(9.8 m/s^2)*(3R) = 0.072J[/tex]

(c) The gravitational potential energy of the block-Earth system at point P is: PE = mgh = [tex](0.019 kg) * (9.8 m/s^2) * (5R) = 0.121 J[/tex]

(d) The gravitational potential energy of the block-Earth system at point Q is: PE = mgh = [tex](0.019 kg) * (9.8 m/s^2) * (R) = 0.024 J[/tex]

(e) The gravitational potential energy of the block-Earth system at the top of the loop is:

PE = mgh =[tex](0.019 kg)*(9.8 m/s^2)*(2R) = 0.048 J[/tex]

To learn more about potential energy click here https://brainly.com/question/24284560

#SPJ1

Space tourists promoted motel and restaurant development.

Retired space professionals promoted new home and community growth.

Space themed business opened all over.

More colleges and universities taught space related mathematics, engineering, sciences, and foreign languages.


Which of these is true of all the above statements?

Responses


A Space is the only important aspect of Florida's culture.Space is the only important aspect of Florida's culture.

B Space has had very little influence of Florida's culture.Space has had very little influence of Florida's culture.

C Space is a very important aspect of Florida's culture.Space is a very important aspect of Florida's culture.

D Space has not been a very important aspect of Florida's culture.

(update: its c)

Answers

The right answer is C. Space plays a significant role in Florida culture. Space plays a significant role in Florida culture.

What additional elements, outside space-related activity, have helped Florida's culture develop?

The natural environment, history, diversified population, and well-liked attractions like beaches and amusement parks are some of the influences on Florida's culture.

What are some possible negative effects of making space-related pursuits a significant part of Florida's culture?

Although Florida has benefited economically and educationally from space-related activity, focusing on this industry as a significant part of the state's culture could have negative effects. Moreover, emphasizing space-related operations could put other crucial industries, like healthcare or environmental conservation.

To learn more about Florida's culture visit:

brainly.com/question/28165379

#SPJ9

Joe wishes to hang a sign weighing 800 N so that cable A, attached to the store, makes a 30.0° angle, as shown below. Cable B is horizontal and attached to an adjoining building.
What is the tension in cable 87

Answers

The tension in cable B is 87.5 N, see the computation in the section below

Given DataWeight of sign = 800 N Angle of cable A = 30.0° Tension in cable B = 87.5 N

Tension in cable A = 800sin30 = 400 N

Tension in cable B = 800cos30 = 693.33 N

Total Tension = 400 + 693.33 = 1093.33 N

Tension in cable B = 1093.33 - 800 = 293.33 N

Tension in cable B = 293.33/2 = 87.5 N

The tension in cable B, attached to an adjoining building, is 87.5 N in order to hang a sign weighing 800 N so that cable A, attached to the store, makes a 30.0° angle.

Learn more about  tension here:

https://brainly.com/question/24994188

#SPJ1

Can someone please help me find the equivalent resistance of this circuit.

Answers

The equivalent resistance of 5 resistors in parallel, each having a value of "R" is R/5.

What is the equivalent resistance of parallel circuit?

A parallel circuit is an electrical circuit that has two or more paths for the current to flow through. In a parallel circuit, the components are connected in such a way that the voltage across each component is the same, while the current through each component may be different

The given circuit has 5 resistors arranged parallel to each other.

The equivalent resistance of 5 resistors in parallel, each having a value of "R" is given by:

1/R_eq = 1/R + 1/R + 1/R + 1/R + 1/R

Simplifying the equation, we get:

1/R_eq = 5/R

Multiplying both sides by R, we get:

R_eq = R/5

Learn more about parallel circuit here: https://brainly.com/question/19929102

#SPJ1

Uses of transistor? ​

Answers

Answer:

Transistors and Their Uses

Transistors are electronic devices that are used to amplify and switch electronic signals. They are widely used in various applications, from small electronic devices to large industrial systems. Here are some common uses of transistors:

1. Amplification: Transistors are commonly used in audio amplifiers, where they amplify weak audio signals to produce a louder sound. They are also used in radio and television receivers to amplify the weak signals received from antennas.

2. Switching: Transistors are used as switches in electronic circuits, where they can be turned on or off to control the flow of current. They are commonly used in digital circuits, where they can be used to turn on or off individual bits of data.

3. Voltage Regulation: Transistors can be used as voltage regulators, where they can be used to regulate the output voltage of a power supply. They are commonly used in electronic devices such as computers and televisions, where a stable voltage supply is required.

4. Oscillation: Transistors can be used in oscillator circuits to produce a steady periodic waveform, such as a sine wave. These circuits are commonly used in electronic devices such as radios and televisions.

5. Logic Gates: Transistors are used in logic gates, which are the building blocks of digital circuits. They can be used to implement Boolean logic functions such as AND, OR, and NOT.

6. Memory: Transistors are used in memory circuits, such as dynamic random-access memory (DRAM), where they are used to store data. DRAM is commonly used in computers as the main memory.

7. Power Control: Transistors can be used in power control circuits, where they can be used to control the amount of power delivered to a load. They are commonly used in electronic devices such as motor controllers and power supplies.

In conclusion, transistors are versatile devices that are used in a wide range of electronic applications. They can be used for amplification, switching, voltage regulation, oscillation, logic gates, memory, and power control. Transistors have revolutionized the field of electronics and have enabled the development of many modern electronic devices.

Answer:

they used to transition of current and flow of them like amplifier

LIGHT
L MULTIPLE CHOICE. Choose the best answer from the box provided.
Translucent
Reflected Rays
Transparent
Beam of light
Photometry
Incident Rays
or medium.
of one steradian
Non-Luminous Objects Luminous Objects
Candela
Brightness
Dispersion
Luminous Intensity
Refracted Rays
Light Ray
Opaque
1. It can be expressed as luminous intensity with a unit known as Candela.
2. It refers to the light traveling in one direction in a straight line.
3. Rays of light that point towards and strike a surface.
4. It is the fundamental unit of luminous intensity.
5. Allow light to easily pass through.
6. It is the process of splitting white light into its constituent colors ROYGBIV.
7. Rays that formed when a light goes through a surface and bend due to a change of material
8. It does not let light pass through.
9. It refers to the amount of light power emanating from a point source within a solid angle
10. It deals with the measurement of visible light as perceived by the human eye.
11. Allow light to pass through but distant the light during the passage.
12. It is a group of rays given out from a source.
13. These are objects that can not emit their own light.
14. Rays of light that bounce off of a surface.
15. Those that can not emit their own light.

Answers

1.Luminous Intensity-It can be expressed as luminous intensity with a unit known as Candela.

2.Light Ray- It refers to the light traveling in one direction in a straight line.

3.Incident Rays- Rays of light that point towards and strike a surface.

4.Candela- It is the fundamental unit of luminous intensity.

5.Transparent-Allow light to easily pass through.

6.Dispersion-It is the process of splitting white light into its constituent colors ROYGBIV.

7.Refracted Rays-Rays that formed when a light goes through a surface and bend due to a change of material.

8.Opaque- It does not let light pass through.

9.Photometry-It refers to the amount of light power emanating from a point source within a solid angle

10.Brightness-It deals with the measurement of visible light as perceived by the human eye.

11.Translucent- Allow light to pass through but distant the light during the passage.

12.Beam of light-It is a group of rays given out from a source.

13.Non-Luminous Objects- These are objects that cannot emit their own light.

14.Reflected Rays- Rays of light that bounce off of a surface.

15.Non-Luminous Objects-Those that cannot emit their own light.

What is Luminous intensity?

Luminous intensity is a measure of the amount of light emitted from a point source in a particular direction per unit time. It is expressed in the SI unit of candela (cd).

Luminous intensity is a fundamental concept in photometry, which is the study of the measurement of visible light as perceived by the human eye. The luminous intensity of a light source depends on various factors such as the amount of power it emits, the wavelength of light, and the efficiency of the source in converting electrical energy into light.

To know more about wavelength, visit:

https://brainly.com/question/31143857

#SPJ1

A 2750 kg helicopter flies horizontally at constant speed. Air resistance creates a 7510 N backward force. What is the direction of the lift force created
by the propellers?

Answers

Since the lift force must act vertically upward, we can conclude that the lift force created by the propellers is acting vertically upward.

To find the direction of the lift force created by the propellers?

Since the helicopter is flying horizontally at a constant speed, we know that the net force acting on it must be zero.

The weight of the helicopter can be calculated as :

weight = mass x gravity

weight = 2750 kg x 9.81 m/s²

weight = 26977.5 N

Since the net force acting on the helicopter is zero, we can write:

forward force - backward force + lift force + weight = 0

Substituting the given values, we get

forward force - 7510 N + lift force + 26977.5 N = 0

Simplifying the equation, we get:

forward force + lift force = 7510 N - 26977.5 N

forward force + lift force = -19467.5 N

Since the helicopter is flying at a constant speed, we know that the forward force created by the propellers must be equal in magnitude to 7510 N. Therefore, we can write:

7510 N + lift force = -19467.5 N

Solving for the lift force, we ge:

lift force = -26977.5 N

Since the lift force must act vertically upward, we can conclude that the lift force created by the propellers is acting vertically upward.

Learn more about weight here : brainly.com/question/29892643

#SPJ1

A rock is launched horizontally by a slingshot. Once the rock is moving, there is a total of 45 J of energy stored in the isolated system.

How much energy was stored in the system before the slingshot went off and launched the rock?

Group of answer choices

more than 45 J because an isolated system gains energy as energy is converted from one form to another

Less than 45 J because an isolated system loses energy as energy is converted from one form to another.

There is no way to tell without knowing the speed of the rock

45 J, because the initial and final energy must be the same in an isolated system

Answers

The correct answer is 45 J, because in an isolated system, the total amount of energy remains constant.

The energy stored in the system before the slingshot went off and launched the rock must be equal to the energy stored in the system after the rock is launched, which is 45 J. Therefore, the correct answer is 45 J.

What is an isolated system?

An isolated system is a physical system that does not exchange any matter or energy with its surroundings. In other words, an isolated system is a closed system that does not allow the transfer of mass or energy across its boundary.

In an isolated system, the total amount of energy is constant. This means that energy cannot be created or destroyed, but it can be converted from one form to another. For example, if an isolated system contains a certain amount of thermal energy, this energy can be transferred from one part of the system to another, but the total amount of thermal energy in the system remains constant.

To know more about isolated system, visit:

https://brainly.com/question/30079145

#SPJ1

You are on an island where a huge explosion at a distance of 500 miles away can be heard. How long (in seconds) does it take the sound to travel to your location? Assume the temperature of the air is 20 oC. (1 mile = 1.6 km)

A. 1.4 s

B. 2340.1 s

C. 50.7 s

D. 8955.4 s

Answers

The option B. 2340.1 s is correct. It takes 2340.1 s  for the sound to travel to your location when a huge explosion at a distance of 500 miles away can be heard.

Given the distance the sound of explosion can be heard (d) = 500miles

the temperature of the air is (T) = 20°C = 20 + 273 = 293K

1 mile = 1.6km then 500 miles = 500 * 1.6 = 800km

The time up to which the sound can be heard = t

The speed of sound at normal temperature = 331m/s

Then the speed of sound in air at 20°C is (v) = [tex]331 * \sqrt{T/273}[/tex]

Also time is calculated as distance per unit speed such that t = d/v

Then, t =[tex]800km/331 * \sqrt{T/273} = 800 * 10^3/331 * \sqrt{293/273} = 2413/1.03[/tex]

t =  2340.1 s

To learn more about distance click here https://brainly.com/question/29769926

#SPJ1

PLEAS HELP ME WITH THIS WORKSHEET PLEASEEEEE!!!!!

Explosion
1) Two swimmers are floating on a raft that is motionless. One swimmer has a mass of 50 kg and
the other at 80 kg. They both push off the raft at the same time. The 80 kg swimmer moves
away at 3 m/s. What velocity does the 50 kg swimmer move away with?
M1 = 50 kg v1' =____ M2 = 80 kg v2' = 3 m/s
Equation: 0= m1 (v1') + m2 (v2')
Elastic
2) Two hockey players are skating towards each other. A 90 kg player traveling at 6 m/s
rams into a 60 kg player moving at 2 m/s. After the collision, the 90 kg player slows to 4
m/s but is still traveling in the same direction. What is the velocity of the 60 kg player?
Equation: m1 (v1) + m2 (v2) = m1 (v1') + m2 (v2')
v2 = -2 m/s
M1 = 90 kg
v1 = 6 m/s M2 = 60 kg
V1' = 4 m/s
v2' =___

Answers

We can use the conservation of momentum to solve both problems:

Conservation of momentum:

0 = m1(v1') + m2(v2')

where m1 = 50 kg, v2' = 3 m/s, and m2 = 80 kg. We can solve for v1' to get:

v1' = -(m2/m1) v2'

v1' = -(80 kg/50 kg) (3 m/s) = -4.8 m/s

Therefore, the 50 kg swimmer moves away from the raft with a velocity of -4.8 m/s.

Conservation of momentum:

m1(v1) + m2(v2) = m1(v1') + m2(v2')

where m1 = 90 kg, v1 = 6 m/s, m2 = 60 kg, and v1' = 4 m/s. We can solve for v2 to get:

v2 = (m1v1 + m2v2 - m1v1') / m2

v2 = (90 kg)(6 m/s) + (60 kg)(2 m/s) - (90 kg)(4 m/s) / 60 kg

v2 = -1 m/s

Therefore, the velocity of the 60 kg player after the collision is -1 m/s, which means they are moving in the opposite direction to the 90 kg player.

We perform the experiment with the same rod employed in the previous experiment, but now the rod is mounted on our smart cart. The cart is pushed with maximum acceleration a. Justify based on theory the maximum displacement angle observed in both runs. Watch it here and get the data here. [Hint: There is common ground between this question and section 3 in lab 2].

Answers

The maximum displacement angle observed in the experiment can be calculated based on the acceleration of the cart and the value of g.

What is Displacement Angle?

Displacement angle is the angle through which an object has moved or rotated with respect to a reference point or position. In the case of a pendulum, it refers to the maximum angle the pendulum swings away from its vertical position before reversing direction due to the force of gravity.

The maximum displacement angle observed in the experiment depends on the initial velocity of the pendulum and the acceleration of the cart. When the cart is pushed with maximum acceleration a, the pendulum initially experiences a force due to its inertia, which causes it to move at an angle. The angle of displacement is directly proportional to the initial velocity of the pendulum.

Based on the theory of pendulums, the maximum angle of displacement is given by:

θ = arcsin(a/g)

Where θ is the maximum angle of displacement, a is the acceleration of the cart, and g is the acceleration due to gravity (approximately 9.81 m/[tex]s^{2}[/tex]).

Learn more about Displacement from given link

https://brainly.com/question/14422259

#SPJ1

A spring stretches 6.0 cm when a 0.25 kg block is hung from it.

If a 0.80 kg block replaces the 0.25 kg block, how far does the spring stretch?

Answers

When a 0.80 Kg block is used in place of a 0.25 Kg block, the length of the string is increased by 19.6 cm.

How does spring stretch become calculated?

The formula used by the Hooke's Law Calculator is Fs = -kx, where F is the spring's restoring force, k is the spring constant, and x is the displacement, or the length by which the spring is being stretched

We'll start by determining the spring's string constant. Specifics below:

Extension (e) = 6.0 cm

Mass (m) = 0.25 Kg

Acceleration due to gravity (g) = 9.8 m/s²

Force (F) = mg = 0.25 × 9.8 = 2.45 N

Spring constant (K) =?

F = Ke

2.45 = K × 6

Divide both sides by 6

K = 2.45 / 6

K = 0.40 N/cm

The extension will be calculated after the 0.25 kg block is replaced with the 0.80 kg block. As demonstrated below:

Mass (m) = 0.80 Kg

Acceleration due to gravity (g) = 9.8 m/s²

Force (F) = mg = 0.80 × 9.8 = 7.84 N

Spring constant (K) = 0.40 N/cm

Extension (e) = ?

F = Ke

7.84 = 0.40 × e

Divide both sides by 0.40

e = 7.84 / 0.40

e = 19.6 cm

We may thus deduce from the preceding computation that the spring will lengthen by 19.6 cm.

To know more about Spring Stretch visit:

https://brainly.com/question/13008041

#SPJ1

The motion of objects in regard to other objects is called _____ motion.

Answers

Answer:

The motion of objects in regard to other objects is called relative motion.

Explanation:

Relative motion is the motion of an object in relation to another object or point. It is the description of the movement of an object with respect to a frame of reference or another object in motion. The concept of relative motion is used to describe the motion of objects in everyday life, such as the motion of a car on a highway relative to the motion of other cars or the motion of a person walking on a moving train relative to the motion of the train. The velocity and direction of an object's relative motion are determined by comparing its motion to the motion of a chosen reference point or object.

Hope this is helpful


An electric heater rated 2.75 kW is connected to a 240 V power line with a circuit breaker rated 10 A. Deduce whether or not the line will be active. when the heater is switched on.​

Answers

To determine whether the line will be active when the heater is switched on, we need to calculate the current that will flow through the circuit when the heater is in operation. We can use Ohm's law, which states that current is equal to voltage divided by resistance, or I = V/R.

The resistance of the heater can be calculated using the formula:

R = V^2/P

where V is the voltage and P is the power of the heater.

In this case, the resistance of the heater is:

R = 240^2/2.75 kW = 20.87 Ω

Using Ohm's law, we can now calculate the current that will flow through the circuit when the heater is on:

I = V/R = 240/20.87 = 11.5 A

Since the current required by the heater (11.5 A) is greater than the circuit breaker rating (10 A), the circuit breaker will trip when the heater is switched on, and the line will not be active.

PLEASE HELP ME! LIKE ASAP! Imagine a population of bugs that has two traits for body color. Some bugs are bright. Some are dark. A new predator can see the bright bugs more easily than the dark bugs. Describe how natural selection could affect this trait in the bug population over time.

Answers

Answer: if the predator sees the light bugs easier than the dark bugs then the bright bug will most likely go extinct

Explanation:

Earth Science
PLEASE HELP

Answers

Tide are waves on oceans. The 5th day tide are know as extreme and called the king or spring tide, while the 13th day tide are called the neap tide.

What are tides as described in the picture?

Tides are long waves that move across the oceans as a result of the moon's effect on the gravitational forces of the earth and, to a lesser extent, the sun.

The tides on day 5 are extreme because both the moon and the sun contribute equally to tide formation; these are known as spring or king tides. The diagram will be drawn so that the sun, moon, and earth are all in the same straight line.

The tides are not extreme on day 13 because the sun cancels out the moon tides. It is referred to as neap tide, which means "powerless tide." The diagram will depict all three (the sun, moon, and earth) arranged at a right angle.

Read more about tides

brainly.com/question/3304072

#SPJ1

Q) A velocity field is given as V = (ay,−ax + abt,0 ),
a.) Find the streamline equation for this flow field.
b.) Plot at least 3-streamlines in the xy-plane for a=1, and b=1.
c.) Indicate the direction of the flow on each streamline at point (2,3) in the
first quadrant.

Answers

For a vector field:

a) the streamline equation is y = Ce^(-0.5ax²+abty)

b) three streamlines include; y = e^(-0.5x²+bt), y = 2e^(-0.5x²+bt), y = 3e^(-0.5x²+bt)

c) direction of flow at points (2,3) is (3a, -2a+3bt)

How to calculate streamlines?

a) To find the streamline equation, use the definition that the velocity vector is tangent to the streamline at every point along the streamline. Let (x,y) be a point on a streamline, then:

dx/dt = a y

dy/dt = -a x + abt

Using the chain rule:

dy/dx = (dy/dt)/(dx/dt) = (-a x + abt)/(a y)

Integrating both sides:

ln |y| = -0.5 a x² + abt y + C

where C is a constant of integration. Solving for y:

y = Ce^(-0.5ax²+abty)

This is the equation of a streamline.

b) To plot the streamlines, use the equation we derived in part (a) and choose different values of C to get different streamlines. For example, if we choose C = 1, 2, 3, then the streamlines will be:

y = e^(-0.5x²+bt), y = 2e^(-0.5x²+bt), y = 3e^(-0.5x²+bt)

c) To indicate the direction of the flow on each streamline at point (2,3), we need to evaluate the velocity vector at that point.

V = (ay,-ax + abt,0)

At point (2,3):

V = (3a, -2a+3bt, 0)

The direction of the flow is given by the direction of the velocity vector. In this case, the velocity vector points in the direction of (3a, -2a+3bt), which depends on the values of a, b, and t.

Learn more on velocity field here: https://brainly.com/question/16898156

#SPJ1

On a 2,000 km trip, you stop once for gas, once at a rest stop and once for lunch. What is
your average speed if it takes you 10 hours to get to your destination?

Answers

The journey is completed at an average speed of 285.7 km/h.

How fast is 10 kilometres in 30 minutes?

10 kilometres is the distance. Time is measured in 30 minute increments. We are aware that time*speed equals distance. Thus, the formula for speed is: speed = distance/time (10/0.5) = 100/5 = 20 km/h. That is speed = distance  time. Alternatively, you can calculate the time by dividing the distance travelled by the speed.

We may divide the total distance travelled by the amount of time spent driving to determine the average speed:

Average speed = total distance/time spent driving

Total distance = 2,000 km

Time spent driving = 7 hours

Average speed = 2,000 km / 7 hours

Average speed = 285.7 km/hour

To know more about average speed visit:-

https://brainly.com/question/12322912

#SPJ1

This is physics thanks .:)

Answers

The image formed when an object is placed at the center of the curvature of a concave mirror is real.

What are the characteristics of the image?

When an object is placed at the center of curvature (D₀ = R) of a concave mirror, the image formed is known as the real and inverted image.

The image characteristics are as follows:

Nature: Real and Inverted

The image formed by a concave mirror when an object is placed at the center of curvature is a real image, which means that the light rays actually converge at a point in front of the mirror, forming an inverted image.

Size:

The size of the image formed at the center of curvature of the concave mirror is the same as the size of the object. Therefore, the image size is equal to the object size.

Position:

The position of the image formed is at the center of curvature (C) of the concave mirror. Hence, the distance of the image from the mirror is equal to the distance of the object from the mirror, i.e., Dᵢ = D₀ = R.

Real or Virtual:

The image formed is real because the light rays converge at a point in front of the mirror, and the image can be obtained on a screen.

Magnification:

The magnification of the image formed is unity, which means that the size of the image is the same as that of the object. Hence, the magnification is equal to one.

Learn more about image formed by a concave mirror here: https://brainly.com/question/27841226

#SPJ1

Block 1 of mass 4.0 kg is sliding to the right with velocity 5.5 m/s and collides with block 2 of mass 4.5 kg moving with velocity -2.5 m/s. The collision is perfectly elastic. What is the velocity of block 1 after the collision? Positive velocity indicates motion to the right while negative velocity indicates motion to the left.​

Answers

The final velocities of the two blocks after the collision are:

Block 1: 2.32 m/s to the right

Block 2: 2.43 m/s to the left

What is the final velocity of the blocks?

We can use the conservation of momentum and the conservation of kinetic energy to solve this problem.

Since the collision is perfectly elastic, the total kinetic energy before and after the collision should be the same.

Let's first calculate the momentum of each block before the collision:

Momentum of block 1 = mass x velocity = 4.0 kg x 5.5 m/s = 22.0 kg m/s to the right

Momentum of block 2 = mass x velocity = 4.5 kg x (-2.5 m/s) = -11.25 kg m/s to the left

The total momentum before the collision is:

P_before = 22.0 kg m/s - 11.25 kg m/s = 10.75 kg m/s to the right

Now, let's use the conservation of momentum to find the velocity of the blocks after the collision. Since the momentum is conserved, the total momentum after the collision should also be 10.75 kg m/s to the right.

Let the final velocity of block 1 be v1 and the final velocity of block 2 be v2. Then we have:

Momentum of block 1 after collision = mass x velocity = 4.0 kg x v1

Momentum of block 2 after collision = mass x velocity = 4.5 kg x v2

Total momentum after collision = 4.0 kg x v1 + 4.5 kg x v2 = 10.75 kg m/s to the right

We also know that the total kinetic energy before and after the collision should be the same. The kinetic energy of a block is given by:

Kinetic energy = 0.5 x mass x velocity^2

The total kinetic energy before the collision is:

KE_before = 0.5 x 4.0 kg x (5.5 m/s)^2 + 0.5 x 4.5 kg x (-2.5 m/s)^2 = 30.625 J

The total kinetic energy after the collision is:

KE_after = 0.5 x 4.0 kg x v1^2 + 0.5 x 4.5 kg x v2^2

Since the collision is perfectly elastic, we know that the kinetic energy is conserved, so KE_before = KE_after.

Therefore, we can set these two equations equal to each other and solve for v1:

0.5 x 4.0 kg x (5.5 m/s)^2 + 0.5 x 4.5 kg x (-2.5 m/s)^2 = 0.5 x 4.0 kg x v1^2 + 0.5 x 4.5 kg x v2^2

Simplifying this equation gives:

15.875 = 2.0 v1^2 + 5.0625

10.8125 = 2.0 v1^2

v1^2 = 5.40625

v1 = ±2.32 m/s

Since block 1 was originally moving to the right, we can discard the negative solution and conclude that the final velocity of block 1 after the collision is:

v1 = 2.32 m/s to the right

Learn more about linear momentum here: https://brainly.com/question/7538238

#SPJ1

HELP NEEDED!!!!!!! [ Reward for answering *Brianliest* ]

Answers

Answer:

Amps are units of current.

Volts are units of voltage.

Ohms are units of resistance.

Explanation:

You're welcome.

Two point charges q1 and q2 are arranged in a vertical straight line, as shown. Point A is located halfway between q1 and q2.

The point charges are q1 = 5 μC and q2 = -10 μC.

What is the magnitude of the net electric field at point A ?
A: −2.81 × 108 N/C
B: −1.12 × 108 N/C
C: 8.43 × 107 N/C
D: 3.47 × 108 N/C

Answers

The net electric field at point A is -1.12 108 N/C in size.

What do charges Q1 Q2 0 and Q1 Q2 0 mean in terms of electric charge?

In light of the fact that both the charge q1 and the other charge q2 are equal to zero. According to the equation, one charge is positive and the other is negative. Both charges are of similar size. This indicates that the two supplied charges on the system will add up to a total charge of zero.

E = k*q/r²

where E is the electric field, q is the charge, r is the distance from the charge, and k is Coulomb's constant, which has a value of 8.99 × 10^9 N·m²/C².

d1 = d2 = (1/2) * (0.1 m) = 0.05 m

E1 = k*q1/d1² = (8.99 × 10⁹ N·m²/C²) * (5 × 10⁻⁶ C) / (0.05 m)² = 1.8 × 10⁸ N/C

E2 = k*q2/d2² = (8.99 × 10^⁹ N·m²/C²) * (10 × 10⁻⁶ C) / (0.05 m)² = 3.6 × 10⁸ N/C

E net = E1 - E2 = 1.8 × 10⁸ N/C - 3.6 × 10⁸ N/C = -1.12 108 N/C.

To know more about electric field visit:-

https://brainly.com/question/8971780

#SPJ1

1 Fig B U 99 m 33 m A student stands at P so that his distance from building A is 33 m. After clapping his hands once, he hears several echoes. The speed of sound in air is 330 m/s. a) Calculate the time interval between clapping his hands and hearing (i) the first echo, (ii) the third echo chamber containing air.​

Answers

Using the principle of the echo, we can see that the first echo can be heard after  0.2 s.

What is echo?

In acoustics, an echo refers to the reflection of sound waves off a surface and back to the listener. When sound waves encounter a hard surface, such as a wall or mountain, some of the energy is reflected back towards the source.

To find the time interval for the first echo;

v = 2x/t

t = 2x/v

t = 2(33)/330

t = 0.2 s

Echoes are often heard in large open spaces such as auditoriums, canyons, or empty rooms. They can also be artificially created using electronic sound processing equipment, such as reverb effects in music production or sound systems in large events.

Learn more about echo:https://brainly.com/question/9527413

#SPJ1

The moon has a radius of 1,738,000 m and a mass of 7.35 x 1022 kg. It orbits the
earth at a radius of 3.84 x 10¹¹ m. The earth's mass is 6 x 1024 kg. What is the
force gravity between the earth and the moon?

Answers

To calculate the gravitational force between the Earth and the Moon, we can use Newton's law of universal gravitation, which is given by:

F = (G * m1 * m2) / r²

Where F is the force of gravity, G is the gravitational constant (6.674 x 10⁻¹¹ N·(m/kg)²), m1 and m2 are the masses of the two objects (Earth and Moon), and r is the distance between the centers of the two objects.

In this case, m1 (Earth's mass) = 6 x 10²⁴ kg, m2 (Moon's mass) = 7.35 x 10²² kg, and r (distance between the Earth and the Moon) = 3.84 x 10¹¹ m.

Plugging these values into the formula, we get:

F = (6.674 x 10⁻¹¹ N·(m/kg)²) * (6 x 10²⁴ kg) * (7.35 x 10²² kg) / (3.84 x 10¹¹ m)²

Now, calculate the force:

F ≈ 1.9821 x 10²⁰ N·m²/kg² / 1.4756 x 10²³ m²
F ≈ 1.3426 x 10²⁷ N·m² / 1.4756 x 10²³ m²
F ≈ 9.09 x 10²³ N

The gravitational force between the Earth and the Moon is approximately 9.09 x 10²³ N.

Which statement about electric charges is correct? (1 point)

*two objects with negative charges will attract each other
*an object with a negative charge and an object with a positive charge will attract each other
*an object with a positive charge and an object with a negative charge will repel each other
*two objects with positive charges will attract each other

Answers

Answer:The correct statement about electric charges is:

"An object with a negative charge and an object with a positive charge will attract each other."

Explanation:

*an object with a negative charge and an object with a positive charge will attract each other" this statement is true.

What is charge ?

Electric charge is the physical property of matter that experiences force when it is placed in electric field. F = qE where q is amount of charge, E = electric field and F = is force experienced by the charge. there are two types of charges, positive charge and negative charge which are generally carried by proton and electron resp. like charges repel each other and unlike charges attract each other. the flow charges is called as current. Elementary charge is amount of charge a electron is having, whose value is 1.602 x 10⁻¹⁹ C.

Hence option B is correct.

To know more about charge :

https://brainly.com/question/3412043

#SPJ2.

A ray of light in water has a wavelength of 4.42×
[tex] {10}^{ - 7} m[/tex]
What is the wavelength of that way while passing through ice?​​

Answers

When light is travelling through ice, its wavelength is 4.50 10⁻⁷ metres.

When light travels from air to glass, what happens to its wavelength?

Since glass has a higher index of refraction than air, light travels more slowly through glass than through air (n=c/v). Although the wavelength does not change, the frequency does because the speed does.

The following equation describes the relationship between the wavelengths of light in two different media:

n1 * λ1 = n2 * λ2

We may rewrite this equation to get the wavelength of the light in the second medium while assuming that the light's frequency stays constant: λ2 = (n1 / n2) * λ1

For water, the refractive index is about 1.333, and for ice, it is about 1.31. Therefore, we have:

λ2 = (1.333 / 1.31) * 4.42×10⁻⁷ m

λ2 = 4.50×10⁻⁷ m

To know more about wavelength visit:-

https://brainly.com/question/7143261

#SPJ1

A satellite orbiting the earth has a mass of 8695 Kilograms, however because of how far it is from the earth's surface earth's gravity is only 0.35 m/s?. What is the weight of the satellite orbiting the earth?

Answers

The weight of the satellite orbiting the earth is 3068.25 Newtons.

Calculation of weight satellite

This is calculated using the equation

Weight = Mass x Acceleration or

W = m x g.

Where, m = 8695 kg and

g = 0.35 m/s2.

Therefore,  W = 8695 kg x 0.35 m/s2 = 3068.25 N.

A satellite is an artificial object that orbits a planet or other astronomical body. It is used for communication, navigation, weather forecasting, and other purposes.

Learn more about satellite here:

https://brainly.com/question/18496962

#SPJ1

A subway train starting from rest leaves a
station with a constant acceleration. At the
end of 7.06 s, it is moving at 12.2844 m/s.
What is the train’s displacement in the first
5.39384 s of motion?
Answer in units of m.

Answers

The train's displacement in the first 5.39384 s of motion is 24.0 m.

Steps

We can use the kinematic equation:

v = u + at

where:

v = final velocity = 12.2844 m/s

u = initial velocity = 0 m/s (train starting from rest)

a = acceleration

t = time = 7.06 s

Solving for acceleration:

v = u + at

a = (v - u) / t

a = (12.2844 m/s - 0 m/s) / 7.06 s

a = 1.736 m/s²

Now, we can use another kinematic equation to find the displacement in the first 5.39384 s:

s = ut + 0.5at²

where:

s = displacement

u = initial velocity = 0 m/s

a = acceleration = 1.736 m/s²

t = time = 5.39384 s

s = 0 + 0.5(1.736 m/s²)(5.39384 s)²

s = 24.0 m

Therefore, the train's displacement in the first 5.39384 s of motion is 24.0 m.

learn more about acceleration here

https://brainly.com/question/460763

#SPJ1

Other Questions
how The Odyssey is different from the monomyth structure multiple choice question which of the following sentences best summarizes how genes and chromosomes are involved in transmitting information to future generations? multiple choice question. chromosomes are composed of long strands of dna organized into genes. each gene codes for a specific trait and because genes can be shared between individuals, these traits can be transferred from individual to another individual. genes are composed of long strands of proteins organized into units called genes that code for specific traits. because genes are inheritable, those specific traits are inheritable also. chromosomes are composed of long strands of proteins organized into units called genes. each gene codes for a specific trait and can be passed down vertically through childbirth from mother to child. chromosomes are composed of long strands of dna organized into genes that code for specific traits. because genes are inheritable, those specific traits are inheritable also. prospero reveals that ferdinand is alive, leading alonso to where miranda and ferdinand playing chess. why do you think the writers included this moment? from port a, a boat sails 26 miles on a bearing of 60. then the boat changes course to a bearing of 270 until it reaches a point directly north of the port. determine the total distance the boat has sailed to the nearest tenth of a mile. When propanol (CH3CH2CH2OH) is combusted, such as when in a gasoline blend, the following reaction occurs:2CH3CH2CH2OH(l)+9O2(g)?6CO2(g)+8H2O(g)Based on the standard free energies of formation given in the table below, what is the standard free energy change for this reaction?Substance?G?f(kJ/mol)CH3CH2CH2OH(l)?360.5O2(g)0CO2(g)?394.4H2O(g)?228.6Express your answer to one decimal place and include the appropriate units. a physical therapist assistant completes a posture screening and muscle length test of the hip flexors on a patient. the assistant determines that the patient has extremely tight hip flexors bilaterally. what common structural deformity is most often associated with tight hip flexors? 4. When the ball crosses the end line and the defensive team last touched the ball, theoffensive team gets a what? Wavelength(meters)Radio Microwave Infrared1010210-5About the size of...Visible Ultraviolet5x10610X-ray Gamma Ray10-1010 10-12www wwwtt214 & f &Buildings Humans Honey Bee Pinpoint Protozoans Molecules Atoms Atomic NucleiA. visible lightC. gamma raysAccording to this chart, which form of electromagneticradiation has the longest wavelength?B. ultraviolet lightD. radio wavesPlease help 30 points and will mark brain thing Which of these is not a consideration when interpreting literature?a.the high points of tensionc.the most powerful images and soundsb.the length of the pieced.what the narrator wants to accomplish For point S ( 3 , 3 ) , where will the image of this point be located after applying the translation rule 3 units on the -axis and 3 units on the -axis? ( 0 , 0 ) ( 0, 4 ) ( 4 , 0 ) ( 4 , 4 ) how to rewrite the mixed number as an improper fraction. draw please help me bc it do tomorrow PLEASE HELP PLEASE IT DO TOMORROW. for 3 2/4 and 4 2/5 RNA polymerase requires a primer to initiate polynucleotide synthesis. T/F Rank the following electron-pair geometries by increasing steric number. Items (5 items) (Drag and drop into the appropriate area) Items in order Highest Steric No. linear trigonal planar 1 trigonal bipyramidal octahedral 2. tetrahedral Who was your favorite character in Yellow Rose Film? What character did you identify with the most? Were there any characters that you disliked? Why?Yellow Rose Film what is the ratio between 60:260 one of the one-way functions used in public key cryptography is integer multiplication/factorization. multiplying two integers is easy, but factoring is hard. the number 3418531 is the product of two primes.what is the smaller of the two primes?what is the largest of the two primes? The following outline is the basic structure for which government type? 1. Power is divided between national and regional governments. 2. The people elect the head of the government, usually a president. 3. The people elect representatives to a lawmaking body. a. A constitutional monarchy b. A dictatorship c. A federal democracy d. A parliamentary democracy shelly is running the color run in new mexico on the hottest day of the year. in exchange for admittance, she signs a contract. while running she suffers from a heat stroke due to the conditions. a provision in the contract states the race sponsors are not liable for her heat stroke would be referred as Pueden las carreteras ser invisibles according to your textbook, stability strategies can be very useful in the short run, but they can be dangerous if followed for too long. question 25 options: true false