the application of heat or acid to a protein that causes its shape to change is known as ____.

Answers

Answer 1

The application of heat or acid to a protein that causes its shape to change is known as denaturation.

Denaturation is a process that alters the structure of a protein, leading to the disruption of its function. Proteins are complex molecules made up of long chains of amino acids that fold into intricate shapes, which are crucial for their biological activity.

The shape of a protein is determined by its amino acid sequence, as well as the environment in which it exists. External factors such as temperature and pH can affect the shape of a protein, leading to denaturation.

Denaturation can occur in a variety of ways, including exposure to high temperatures, extremes of pH, or certain chemicals. When a protein is denatured, its shape is disrupted, causing it to lose its biological activity. For example, the denaturation of enzymes can lead to their loss of function, resulting in a range of health problems.

Denaturation is an important process in many biological and industrial applications. In food processing, denaturation of proteins can be used to create desirable textures and flavors. In medicine, denaturation can be used to destroy disease-causing proteins. Understanding the process of denaturation is crucial for scientists and engineers in developing new therapies and products.

To know more about denaturation visit:

https://brainly.com/question/31089250

#SPJ11


Related Questions

We have created a 95% confidence interval for μ with the result (10, 15).

a) What decision will we make if we test H0 : μ = 16 versus H1 : μ ≠ 16 at α = 0.05? Justify your answer.

A) Reject H0 in favor of H1.

B) Accept H0 in favor of H1.

C) Fail to reject H0 in favor of H1.

D) We cannot tell what our decision will be from the information given.

Answers

According to the question Fail to reject H0 in favor of H1. The 95% confidence interval (10, 15) does not contain the value of 16, so we cannot reject H0 at the 0.05 level of significance.

What is confidence interval?

A confidence interval is a range of values that is used to estimate a population parameter with a certain degree of confidence. It is calculated by taking a sample from a population and using the sample statistics to estimate the population parameter. The confidence interval is a measure of the reliability of the estimate. It is calculated by taking into account the sample size, the variability of the sample, and the level of confidence desired. By increasing the sample size and decreasing the variability, the confidence interval can be made more reliable. The confidence interval provides a range of values within which the population parameter is likely to be found.

To learn more about confidence interval

https://brainly.com/question/29563989

#SPJ4

Based on the 95% confidence interval for μ with the result (10, 15), the decision that should be made if we test H0 : μ = 16 versus H1 : μ ≠ 16 at α = 0.05 is;

A. Reject H0 in favor of H1.

What is the 95% confidence interval for the population mean?

The 95% confidence interval for the population mean μ is (10, 15).

This means that one can be 95% confident that the true population mean falls between 10 and 15.

The null hypothesis H0: μ = 16 is to be tested against the alternative hypothesis H1: μ ≠ 16 at α = 0.05 level of significance.

The confidence interval (10, 15) does not contain the hypothesized value of μ = 16, it suggests that the population mean is significantly different from 16 at the 0.05 level of significance.

Therefore, reject the null hypothesis H0 in favor of the alternative hypothesis H1.

Learn more about confidence interval at: https://brainly.com/question/20309162

#SPJ4

kb for nh3 is 1.8 ´ 10^-5. what is the poh of a 0.15 m aqueous solution of nh4cl at 25.0 °c?

Answers

The pH of the solution is 8.46.

The first step is to write the chemical equation for the reaction between [tex]NH4Cl[/tex] and water:

[tex]NH4Cl + H2O ⇌ NH4+ + Cl- + H2O[/tex]

Since [tex]NH4Cl[/tex] is a salt, it dissociates completely in water, so the concentration of [tex]NH4+[/tex] in solution is equal to the initial concentration of [tex]NH4Cl[/tex], which is 0.15 M. Since [tex]NH4+[/tex]is the conjugate acid of [tex]NH3[/tex], it can react with water to form [tex]NH3[/tex]and[tex]H3O+[/tex]:

[tex]NH4+ + H2O ⇌ NH3 + H3O+[/tex]

The Kb for [tex]NH3[/tex] can be used to find the equilibrium constant, Keq, for this reaction:

[tex]Kb = [NH3][H3O+] / [NH4+]Keq = 1/Kb = [NH4+]/([NH3][H3O+])[/tex]

At equilibrium, the concentrations of NH4+ and NH3 will be equal, so:

[tex]Keq = [NH4+]/([NH3][H3O+]) = 1/([NH3]^2)[NH3] = sqrt(1/Keq * [NH4+]) = sqrt(Kb * [NH4+])[NH3] = sqrt(1.8 × 10^-5 × 0.15) = 0.024 M[H3O+] = Kb[NH3]/[NH4+] = 1.8 × 10^-5 × 0.024 / 0.15 = 2.88 × 10^-6 MpOH = -log([H3O+]) = -log(2.88 × 10^-6) = 5.54pH + pOH = 14[/tex], so:

[tex]pH = 14 - pOH = 14 - 5.54 = 8.46[/tex]

Therefore, the pH of the solution is 8.46.

To know more about pH refer to-

https://brainly.com/question/491373

#SPJ11

What are pr and vr called? is their use limited to isentropic processes?

Answers

Pr and Vr are dimensionless reduced pressure and reduced volume, respectively, and they are commonly used in thermodynamics to simplify the equations that describe the behavior of fluids. The use of Pr and Vr is not limited to isentropic processes.

Reduced pressure (Pr) is defined as the ratio of the actual pressure of a gas to its critical pressure, while reduced volume (Vr) is defined as the ratio of the volume of a gas to its critical volume. The critical point is the state at which a gas can no longer be liquefied by increasing its pressure at constant temperature.

These parameters are used in various thermodynamic relations, such as the compressibility factor, which describes the behavior of real gases. They are particularly useful when studying the behavior of fluids at different temperatures and pressures, as they allow for easy comparison of data for different substances.

Here you can learn more about thermodynamics

https://brainly.com/question/17074575#

#SPJ11  

what is the iupac name for this compound?group of answer choices 1-ethanaldehyde methyl aldehyde 1-ethanone ethanal methanal

Answers

The IUPAC name for the given compound [tex]CH_3CHO[/tex] is ethanal, which indicates that it is a two-carbon chain molecule with an aldehyde functional group attached to the first carbon atom. Here option D is the correct answer.

Ethanal is a common organic compound with the chemical formula [tex]C_2H_4O[/tex]. It is also known as acetaldehyde and is a colorless liquid with a pungent odor. It is an important intermediate in the production of various chemicals and is used in many industrial processes.

The IUPAC name for ethanal is derived from the longest carbon chain containing the aldehyde functional group. In this case, the carbon chain contains two carbon atoms, and the aldehyde functional group is attached to the first carbon atom. The prefix "eth-" indicates that there are two carbon atoms in the chain, and the suffix "-al" indicates that the molecule contains an aldehyde functional group.

Therefore, the IUPAC name for [tex]CH_3CHO[/tex] can be written as ethanal, which is also known as acetaldehyde.

To learn more about IUPAC's name

https://brainly.com/question/30086566

#SPJ4

Complete question:

What is the IUPAC name for the following compound: [tex]CH_3CHO[/tex]?

a) 1-ethanal

b) methyl aldehyde

c) 1-ethanone

d) ethanal

e) methanal

find the binding energy (in mev) for lithium 3li8 (atomic mass = 8.022486 u).

Answers

The binding energy of [tex]^{3}Li_{8}[/tex] is 1.848 MeV.

How to find the binding energy of a nucleus?

The binding energy of a nucleus is the amount of energy that is required to completely separate all the protons and neutrons in the nucleus and move them infinitely far apart from each other. It is the energy equivalent of the mass defect of the nucleus, which is the difference between the mass of the nucleus and the sum of the masses of its individual protons and neutrons.

To find the binding energy of [tex]^{3}Li_{8}[/tex] , we need to first calculate the mass defect, which is the difference between the mass of the nucleus and the sum of the masses of its constituent protons and neutrons.

The atomic mass of [tex]^{3}Li_{8}[/tex]  is given as 8.022486 u. The mass of three protons and three neutrons is 3(1.00728 u) + 3(1.00867 u) = 6.03207 u.

So, the mass defect is 8.022486 u - 6.03207 u = 1.990416 u.

We can convert this mass defect to energy using Einstein's equation,

E = mc^2, where c is the speed of light.

The mass defect in kilograms is (1.990416 u)(1.66054 x [tex]10^{-27}[/tex]  kg/u) = 3.30728 x [tex]10^{-27}[/tex] kg.

The speed of light is 2.998 x [tex]10^{8}[/tex]  m/s. Plugging these values into the equation gives:

E = (3.30728 x [tex]10^{-27}[/tex] kg)(2.998 x [tex]10^{8}[/tex] m/s)^2 = 2.9653 x [tex]10^{-10}[/tex] J

Finally, we can convert this energy from joules to MeV (mega-electron volts) using the conversion factor 1 MeV = 1.60218 x [tex]10^{-13}[/tex] J:

E = (2.9653 x [tex]10^{-10}[/tex] J)/(1.60218 x [tex]10^{-13}[/tex] J/MeV) = 1.848 MeV

To know more about Binding energy:

https://brainly.com/question/28329990

#SPJ11

How many moles of oxygen gas react with 0.100 mol of pentane, C5H12? spark C$H12 (g)+_O2lg)®_CO2(g) +_H2O(g)

Answers

To determine how many moles of oxygen gas react with 0.100 mol of pentane, we need to use the balanced chemical equation provided. From the equation, we see that 1 mole of pentane reacts with 8 moles of oxygen gas to produce 5 moles of carbon dioxide gas and 6 moles of water vapor.

Therefore, if we have 0.100 mol of pentane, we will need:

0.100 mol pentane x (8 mol O2 / 1 mol pentane) = 0.800 mol O2

So, 0.800 moles of oxygen gas will react with 0.100 mol of pentane in this reaction.


In order to determine how many moles of oxygen gas react with 0.100 mol of pentane (C5H12), we first need to balance the chemical equation:

C5H12(g) + O2(g) → CO2(g) + H2O(g)

The balanced equation is:

C5H12(g) + 8O2(g) → 5CO2(g) + 6H2O(g)

From the balanced equation, we can see that 1 mole of pentane reacts with 8 moles of oxygen. To find out how many moles of oxygen are needed for 0.100 mol of pentane, we can use the following proportion:

1 mol C5H12 / 8 mol O2 = 0.100 mol C5H12 / x mol O2

Now, we can solve for x:

x mol O2 = (8 mol O2 * 0.100 mol C5H12) / 1 mol C5H12
x mol O2 = 0.800 mol O2

So, 0.800 moles of oxygen gas react with 0.100 moles of pentane.

Learn more about proportion here:-brainly.com/question/30657439

#SPJ11

in mass spectrometry, the substance with a 1 charge and a mass equal to the molar mass of an organic compound is called the

Answers

In mass spectrometry, the substance with a 1 charge and a mass equal to the molar mass of an organic compound is called the molecular ion or parent ion. This ion is formed by the removal of an electron from the organic compound during ionization.

The molecular ion provides information about the molecular weight of the compound and its composition. It is a crucial component of mass spectrometry analysis for identifying and characterizing organic compounds.

Mass spectrometry is a technique used to analyze the composition of organic compounds by ionizing and separating their ions based on their mass-to-charge ratio. The molecular ion represents the intact organic compound with one electron removed, providing a valuable starting point for determining the compound's molecular formula and structure.

To know more about molar mass visit :-

https://brainly.com/question/837939

#SPJ11

the chemical name for table salt is sodium chloride, or simply nacl. what type of chemical is nacl?

Answers

Answer:

it's still salt cause Nacl is simply salt or sodium chloride

The chemical name for table salt is sodium chloride, or simply NaCl. NaCl is an ionic compound.

What is Chemical?

A chemical is a substance made up of atoms or molecules that have specific properties and composition. Chemicals can undergo chemical reactions to form new substances, and they play an important role in many natural and industrial processes.

What is Ionic compounds?

Ionic compounds are chemical compounds made up of ions held together by electrostatic forces of attraction. They typically consist of a metal cation and a non-metal anion, and are characterized by high melting and boiling points, as well as the ability to conduct electricity when dissolved in water.

According to the given information:

NaCl is a compound chemical because it is made up of two different elements, sodium and chlorine, that are chemically bonded together.

The chemical name for table salt is sodium chloride, or simply NaCl. NaCl is an ionic compound, which is a type of chemical formed by the electrostatic attraction between positively charged ions (cations) and negatively charged ions (anions). In the case of NaCl, the cation is sodium (Na+) and the anion is chloride (Cl-).

To know more about chemical,ionic compounds visit:

https://brainly.com/question/19565800

#SPJ11

the turnover number per second of carbonic anhydrase is 600,000. the total number of resulting bicarbonate ions (produce by decomposition of carbonic acid) per 1 minute is:

Answers

The total number of resulting bicarbonate ions produced by carbonic anhydrase in one minute is 36,000,000.

We need to first calculate the number of enzyme turnovers that occur in one minute, and then multiply by the number of bicarbonate ions produced per enzyme turnover.

One turnover of carbonic anhydrase produces one molecule of bicarbonate ion for every molecule of carbonic acid decomposed.

600,000 turnovers/second x 60 seconds/minute = 36,000,000 turnovers/minute

Since one molecule of carbonic acid produces one molecule of bicarbonate ion, the total number of resulting bicarbonate ions produced per minute is also:

36,000,000 bicarbonate ions/minute

To know more about bicarbonate ions, here

brainly.com/question/7378820

#SPJ1

The following data were collected for this reaction at 327 K: A(g) → B9) Time(min.) [A] (M) 4.80 0.2673 5.76 0.2227 7.20 0.1782 8.47 0.1515 9.60 0.1336 14.40 0.0891 19.20 0.0668 24.00 0.0535 28.80 0.0445 33.60 0.0382 38.40 0.0334 a) Determine the first half-life, using the first entry on the table as initial concentration:
t1/2) = t: (min) b) Determine the rate constant of the reaction (ignore units): k =

Answers

The concept of half-life is commonly used in the field of nuclear physics and chemistry to describe the time it takes for a substance to decay by half. The first half-life refers to the amount of time it takes for half of the original amount of a substance to decay.

a) To determine the first half-life, we need to find the time it takes for the concentration of A to decrease to half of its initial value. Using the first entry on the table as the initial concentration ([A]0 = 0.2673 M), we can calculate the half-life as follows:

0.2673 M → 0.13365 M (half of [A]0) after t = t1/2

0.13365 M / 0.2673 M = 0.5

ln (0.5) = -0.693 = -kt1/2

t1/2 = 0.693/k

Using the data from the table, we can calculate t1/2 as follows:

t1/2 = 0.693/k = (5.76 - 4.80) min = 0.96 min

Therefore, the first half-life is 0.96 minutes.

b) The rate constant of the reaction can be calculated using the integrated rate law for a first-order reaction:

ln ([A]t/[A]0) = -kt

Rearranging this equation gives:

k = -ln ([A]t/[A]0) / t

Using the data from the table, we can calculate the rate constant for the reaction as follows:

k = -ln ([A]t/[A]0) / t = -ln (0.13365/0.2673) / 0.96 min

k = 0.72202 min^-1 (ignore units)

Therefore, the rate constant of the reaction is 0.72202 min^-1.

TO KNOW MORE ABOUT first half-life CLICK THIS LINK -

brainly.com/question/20561725

#SPJ11

colligative properties depend only on the number of particles, not the identity of the solute. what evidence could you use to demonstrate this point?

Answers

The colligative properties depend only on the number of particles, not the identity of the solute. Here's an explanation using the terms you requested:

Colligative properties are properties of a solution that depend on the ratio of solute particles to solvent particles, rather than the specific identity of the solute. These properties include boiling point elevation, freezing point depression, vapor pressure lowering, and osmotic pressure.

To demonstrate this point, you could perform an experiment using two different solutes with similar molar masses, such as NaCl and KCl. Follow these steps:

1. Prepare two separate solutions by dissolving equal amounts (in moles) of NaCl and KCl in the same volume of water.

2. Measure the freezing point depression and boiling point elevation of each solution. This can be done by cooling and heating the solutions and observing the temperatures at which they freeze and boil, respectively.

3. Compare the observed changes in freezing point and boiling point for both solutions.

Since colligative properties depend only on the number of particles, not the identity of the solute, you should find that the freezing point depression and boiling point elevation are similar for both solutions, even though the solutes (NaCl and KCl) are different. This evidence supports the idea that colligative properties are dependent on the number of particles, rather than the identity of the solute.

To learn more about Boiling point elevation - brainly.com/question/16922336

#SPJ11

o cholesterol is a special lipid made of 4 carbon-based ring structures. why is cholesterol, and any molecule based from cholesterol, considered a lipid?

Answers

Cholesterol is considered a lipid because it has many of the same characteristics as other lipids. Lipids are organic compounds that are insoluble in water and are hydrophobic, or water-fearing. They are essential components of cell membranes and serve as a source of energy for the body.

Cholesterol, despite having a different chemical structure than most lipids, shares many of the same properties. It is insoluble in water and is primarily found in cell membranes, where it helps regulate the fluidity and permeability of the membrane. It is also an important precursor molecule for the synthesis of steroid hormones, such as testosterone and estrogen, and bile acids that aid in digestion.

Furthermore, molecules based on cholesterol, such as steroid hormones, are also considered lipids because they share many of the same properties. They are insoluble in water and are primarily involved in signaling pathways and regulating various physiological processes.

Overall, despite its unique chemical structure, cholesterol is considered a lipid because of its hydrophobic nature and its important roles in cell membranes and hormone synthesis.

To know more about lipids, refer

https://brainly.com/question/17352723

#SPJ11

A reaction has an equilibrium constant of 7.4x10^4 at 298 K. At 682K , the equilibrium constant is 0.76.

Find ?Horxn for the reaction.

Answers

A reaction has an equilibrium constant of 7.4x10⁻⁴ at 298 K. At 682K , the equilibrium constant is 0.76. Horxn/ enthalpy for the reaction is -38933.85 J/mol.

The scientific investigation of the interaction among heat (as well as energy) and physical activity is known as thermodynamics. A key concept in thermodynamics is enthalpy. It is a system's heat capacity. The enthalpy change that occurs throughout a reaction represents the heat that enters or exits the system. An important aspect that affects whether a reaction may occur depends on whether the heating rate of the system rises (i.e., because energy gets added) or lowers (i.e., when energy is given off).

ln(k2/K1)=(-ΔH / R)(1/T2-1/T1)

ln( 0.76./7.4x10⁻⁴)=(-ΔH / 8.31)(1/ 682-1/298)

ΔH = -38933.85 J/mol

To know more about enthalpy of reaction, here:

https://brainly.com/question/1657608

#SPJ1

Calculate (H+) and [OH^] for each solution at 25°C. Identify each solution as neutral, acidic, or basic. PH = 9. 31 = M a. [H+] =_______M(OH-)= ______M The solution is ____pH = -0. 47 b. (H+)=_________ M (OH-) =_______ M The solution is ______pH = 3. 09 c. (H+) =_______ M (OH-) =______ M The solution is______

Answers

[H+] = 0.01 M (OH-) = 0.01 M The answer is simple. pH = 9.31 b. (H+) = 0.0003 M (OH-) = 0.0014 M The mixture is acidic. pH = -0.47 c. (H+) = 0.001 M (OH-) = 0.001 M pH = 3.09, the solution is neutral. The acidity or basicity of a solution is determined by its pH.

The formula used to compute it is pH = -log[H+], where [H+] represents the amount of hydrogen ions in the solution. We may utilise the equation [H+][OH-] = 10-14 to get the [H+] and [OH-] for a given solution. According to this equation, the sum of [H+] and [OH-] at any temperature must equal 10-14. Using the formula [H+][OH-] = 10-14, we can get the [H+] and [OH-] for the first solution at 25°C.

Since [H+] = 10-9.31 because the pH of the solution is 9.31. By include this number in the formula, we may determine that [OH-] = 10-9.31/10-14 = 10-9.31-10-14 = 10-9.31. The result is a basic solution with a pH of 9.31 since [H+] = 10-9.31 and [OH-] = 10-9.31. Using the formula [H+][OH-] = 10-14, we can get the [H+] and [OH-] for the second solution at 25°C. [H+] = 10-0.47 since the solution's pH is -0.47.

By entering this number into the equation, we can determine that [OH-] = 10-0.47/10-14 = 10-0.47. The result is an acidic solution with a pH of -0.47 since the [H+] = 10-0.47 and the [OH-] = 10-0.47. Using the formula [H+][OH-] = 10-14, we can get the [H+] and [OH-] for the third solution at 25°C.

Given that the solution's pH is [H+] = 10-3.09 since the solution's pH is 3.09. By include this number in the formula, we can determine that [OH-] = 10-3.09/10-14 = 10-3.09-10-14 = 10-3.09. The pH of the solution is 3.09, making it neutral since [H+] = 10-3.09 and [OH-] = 10-3.09.  

Learn more about  pH  at:

https://brainly.com/question/15289741

#SPJ1

what is the expression constant dissociation for ethylamine? what is the expression constant dissociation for ethylamine? kb

Answers

The answer is that the expression constant dissociation for ethylamine is known as Kb.

The Kb value for ethylamine can be determined by measuring the concentration of the products and reactants at equilibrium after the reaction:

C2H5NH2 + H2O ⇌ C2H5NH3+ + OH-.

The Kb expression for ethylamine is [C2H5NH3+][OH-]/[C2H5NH2].

Kb is the equilibrium constant for the dissociation of a weak base, like ethylamine, in water. It measures the extent to which the base dissociates in water to form hydroxide ions (OH-) and the conjugate acid of the base (C2H5NH3+). The higher the Kb value, the stronger the base. The Kb value for ethylamine is 6.4 x 10⁻⁴ at 25°C.

To know more about ethylamine  visit:

brainly.com/question/9439418

#SPJ11

25.0 mL of a 0.100 M NH3 is titrated with a strong acid. 0.100 M HCl. Calculate the pH of the NH3 solution at the following points during the titration: (Kb= 1.8 x 10^-5) A. Prior to the addition of any HCl. B: After the addition of 10.5 mL of a 0.100 M HCl. C: At the equivilance point. D: After the addition of 3 mL of 0.100 M HCl.

Answers

A. Prior to the addition of any HCl pH is 13.98:

Since no acid has been added yet, the solution contains only NH3 and NH4+ ions from the autoionization of water. The concentration of NH3 is 0.100 M, and the concentration of NH4+ can be calculated using the Kb expression:

Kb = [NH4+][OH-] / [NH3]

1.8 x 10^-5 = [NH4+][10^-14 / [NH3]

[NH4+] = Kb x [NH3] / [OH-]

           = 1.8 x 10^-5 x 0.100 / 10^-14 = 1.8 x 10^-10 M

The concentration of OH- can be calculated from the water autoionization constant (Kw):

Kw = [H+][OH-] = 10^-14

[OH-] = Kw / [H+] = 10^-14 / 10^-7 = 10^-7 M

The NH4+ concentration is very small compared to the NH3 concentration, so we can assume that all of the NH3 remains unreacted and use the expression for the base dissociation constant (Kb) to calculate the pH:

Kb = [NH4+][OH-] / [NH3]

1.8 x 10^-5 = (1.8 x 10^-10)(10^-7) / [NH3]

[NH3] = (1.8 x 10^-10)(10^-7) / 1.8 x 10^-5

         = 1.0 x 10^-13 M

pH = pKb + log([NH4+]/[NH3])

     = 9.24 + log(1.8 x 10^-10 / 1.0 x 10^-13)

     = 9.24 + 3.74 = 13.98

B. After the addition of 10.5 mL of a 0.100 M HCl pH turned into 5.15:

The amount of HCl added is:

0.100 M x 0.0105 L = 1.05 x 10^-3 mol HCl

This amount of acid reacts completely with NH3 to form NH4+:

NH3 + HCl → NH4+ + Cl-

The initial concentration of NH3 was 0.100 M, and the volume of the solution is now 25.0 mL + 10.5 mL = 35.5 mL = 0.0355 L. Therefore, the final concentration of NH3 is:

[NH3] = (0.100 mol / 0.0355 L) - (1.05 x 10^-3 mol / 0.0355 L) = 1.94 M

The concentration of NH4+ can be calculated using the Henderson-Hasselbalch equation:

pH = pKa + log([NH4+]/[NH3])

where pKa is the negative logarithm of the acid dissociation constant for NH4+ (pKa = 9.24, which is equal to the negative logarithm of Kb for NH3).

pH = 9.24 + log([NH4+]/[NH3]) = 9.24 + log(1.05 x 10^-3 / 1.94) = 5.15

C. At the equivalence point pH will be 9.25.

moles of HCl added = moles of NH3 initially present.

Moles of NH3 initially present = 0.0250 L x 0.100 mol/L = 0.00250 mol

Moles of HCl added = 0.0250 L x 0.100 mol/L = 0.00250 mol

Moles of NH3 remaining after the reaction with HCl = 0.00250 mol - 0.00250 mol = 0 mol

Therefore, the solution only contains NH4+ ions and water.

NH3 + HCl → NH4+ + Cl-

The initial concentration of NH3 was 0.100 M, so the concentration of NH4+ at the equivalence point is also 0.100 M.

The ammonium ion, NH4+, is the conjugate acid of NH3. The Kb of NH3 can be used to calculate the Kb of its conjugate acid, NH4+:

Kb(NH3) x Ka(NH4+) = Kw

Ka(NH4+) = Kw/Kb(NH3) = 1.0 x 10^-14/1.8 x 10^-5 = 5.6 x 10^-10

At the equivalence point, [NH4+] = 0.100 M, so:

pH = pKa + log([NH4+]/[NH3])

pH = 9.25 + log(0.100/0) = 9.25

Therefore, at the equivalence point, the pH of the solution is 9.25.

D. At 3 mL of HCl pH will be 8.13.

The moles of NH3 remaining in solution is:

moles NH3 = initial moles NH3 - moles HCl added

moles NH3 = (0.0250 L)(0.100 mol/L) - (0.0030 L)(0.100 mol/L)

moles NH3 = 0.00220 mol

The moles of NH4+ produced by the reaction of NH3 with HCl is equal to the moles of HCl added:

moles NH4+ = 0.0030 L x 0.100 mol/L = 0.00030 mol

The total volume of the solution after the addition of 3 mL of HCl is 0.0250 L + 0.0030 L = 0.0280 L. Therefore, the concentration of NH3 in the solution is:

[ NH3 ] = moles NH3 / total volume

[ NH3 ] = 0.00220 mol / 0.0280 L

[ NH3 ] = 0.0786 M

Since NH3 and NH4+ form a buffer solution, we can use the Henderson-Hasselbalch equation to calculate the pH:

pH = pKb + log([NH4+]/[NH3])

pH = 9.24 + log(0.00030/0.0786)

pH = 9.24 - 1.11

pH = 8.13

Therefore, the pH of the solution after the addition of 3 mL of 0.100 M HCl is 8.13.

To know more about pH during titration know here:

https://brainly.com/question/15681801?#

#SPJ11

2. Give IUPAC names for the following compounds. (a) CH3OCH(CH3)CH OH (b) PhOCH2CH3 (c) OCHZ (d) (e) H (f) H ОСН, ; ОСН, OH O CHZ -ОСН, H H Cl H Н (i) CH,CHZ (h) CH30 H Br

Answers

Answer,

Hi!

I'd be happy to help you provide IUPAC names for the compounds listed in your question. However, it seems that the chemical structures for some compounds are not provided clearly or completely. I will provide the IUPAC names for the ones that are clear,

Explained:

(a) CH3OCH(CH3)CH2OH: The IUPAC name for this compound is 2-methoxy-2-methylpropan-1-ol.

(b) PhOCH2CH3: The IUPAC name for this compound is ethyl phenyl ether (common name) or ethoxybenzene (IUPAC systematic name).

For the remaining compounds (c) to (i), please provide the correct and complete chemical structures so I can accurately provide the IUPAC names for them.

To learn more about IUPAC Name ,refer below:

https://brainly.com/question/16631447?source=quick-results&auto-scroll=true&q=IUPAC%20NAME

#SPJ11

about atomic structure and light spectra, which one of the following statements is not correct? (a) energy levels of electrons in atoms can help explain spectral lines of light. (b) it is possible that different molecules have the same spectral lines (e.g., emission/absorption lines). (c) absorption of photons (i.e., absorption lines in spectra) corresponds to the orbital transition of electrons from the lower energy levels to the higher energy levels. (d) emission of photons (i.e., emission lines in spectra) corresponds to the orbital transition of electrons from the higher energy levels to the lower energy levels.

Answers

The statement that is not correct is (b) - it is not possible for different molecules to have the same spectral lines. Each molecule has a unique arrangement of electrons in its atoms, which determines the energy levels and transitions that can occur within that molecule.

Therefore, each molecule will have a unique set of emission and absorption lines in its spectra. The energy levels of electrons in atoms can help explain the spectral lines of light, as stated in statement (a). When an electron in an atom transitions from a higher energy level to a lower one, it emits a photon of a specific energy, which corresponds to a specific wavelength of light. Similarly, when an electron absorbs a photon of a specific energy, it can transition to a higher energy level, creating an absorption line in the spectrum, as stated in statement (c). Statement (d) is also correct - emission lines in spectra correspond to the orbital transition of electrons from higher energy levels to lower energy levels. Overall, understanding atomic structure and light spectra is important in fields such as chemistry, physics, and astronomy, as it helps us understand the behavior of matter and energy at the atomic and molecular level.

learn more about atoms here

https://brainly.com/question/14156701

#SPJ11

during the experiment, a student observed the following: 1. bubbles formed upon addition of hydrochloric acid. 2. a white precipitate formed upon addition of silver nitrate. 3. a white precipitate formed upon addition of barium chloride which ions are known to be in the unknown solution? select all which apply.

Answers

Based on the observations made during the experiment, it can be inferred that the unknown solution contained chloride ions (Cl-) as evidenced by the formation of bubbles upon the addition of hydrochloric acid, and the formation of a white precipitate upon the addition of both silver nitrate and barium chloride.

Therefore, the correct answer would be:

- Chloride ions (Cl-)
Based on the observations during the experiment, the following ions are present in the unknown solution:

1. Since bubbles formed upon the addition of hydrochloric acid, there is likely a carbonate or bicarbonate ion (CO3²- or HCO3^-) present, as they react with HCl to form carbon dioxide gas (CO2) and water.

2. A white precipitate formed upon the addition of silver nitrate indicates the presence of a halide ion, such as chloride (Cl-), bromide (Br-), or iodide (I-). Silver halides (e.g., AgCl, AgBr, AgI) are known to form white precipitates.

3. The formation of a white precipitate upon the addition of barium chloride suggests the presence of a sulfate ion (SO4^2-) in the solution, as barium sulfate (BaSO4) forms a white precipitate.

Therefore, the ions present in the unknown solution are carbonate or bicarbonate (CO3^2- or HCO3^-), a halide ion (Cl-, Br-, or I-), and sulfate (SO4²-).

For more information on hydrochloric acid visit:

brainly.com/question/15231576

#SPJ11

calculate the number of vacancy sites in an ionic conductor in which the metal ions are the predominant charge carriers. assume a room-temperature ionic conductivity of 10 17 1/o cm and an ionic mobility of 10 17 m 2 /v s. does the calculated result make sense? discuss how the vacancies might have been introduced into the crystal.

Answers

Controlling and optimizing the vacancy concentration is an important consideration in designing and utilizing ionic conductors for various applications.

To calculate the number of vacancy sites in an ionic conductor with metal ions as predominant charge carriers, we can use the equation:

n = σ/zeμ

where n is the number of vacancy sites, σ is the ionic conductivity, z is the charge of the metal ion, e is the elementary charge, and μ is the ionic mobility.

Plugging in the given values of σ = 10¹⁷ 1/o cm and μ = 10¹⁷ m²/v s, we get:

n = (10¹⁷ 1/o cm) / (1.6 x 10⁻¹⁹C) / (1 x 10¹⁷ m²/v s) = 6.25 x 10¹⁹ sites/cm³

This calculated result makes sense as it falls within the typical range of vacancy concentrations in ionic conductors. The vacancies may have been introduced into the crystal during the manufacturing process or through exposure to high temperatures or radiation.

Overall, the presence of vacancies in the crystal structure can enhance ionic conductivity by providing more available sites for metal ion movement. However, excessive vacancy concentrations can also lead to reduced conductivity and structural instability. Therefore, controlling and optimizing the vacancy concentration is an important consideration in designing and utilizing ionic conductors for various applications.

To know more about ionic conductor, refer

https://brainly.com/question/2293866

#SPJ11

5. Calculate the pH of the solution at the endpoint Ks=2.2 x 10-10 OH (aq) + HT (aq) T2-(aq) +H2O (1) pt--1109EH,0

6. compare the ph of the endpoint recorded in your data sheet to that calculated in q5. comment on its similarity or difference.

Answers

5.The pH of the solution at the endpoint is 9.66.

To calculate the pH of the solution at the endpoint, we need to use the dissociation constant expression (Ks) for the reaction given in the question.

Ks = [T2-][H3O+]/[HT]

At the endpoint, the concentration of HT (the acid) is equal to the concentration of T2- (the conjugate base), so we can substitute them with x.

Ks = [x][H3O+]/[x]

Simplifying this expression, we get:

Ks = [H3O+

We can solve for the concentration of H3O+ by plugging in the value of Ks:

2.2 x 10-10 = [H3O+]

Taking the negative logarithm of both sides, we get:

pH = -log([H3O+]) = -log(2.2 x 10-10) = 9.66

So the pH of the solution at the endpoint is 9.66.

6.Comparing this pH to the endpoint recorded in the data sheet will depend on the specific experiment and data collected. However, we can comment on the similarity or difference in general. If the pH recorded in the data sheet is close to 9.66, then the experiment was successful in reaching the endpoint.

If the pH recorded in the data sheet is significantly different from 9.66, then there may have been errors in the titration or calculations. It is important to analyze the sources of error and evaluate the accuracy and precision of the results.

To know more about ph at endpoint refer here:

https://brainly.com/question/30157790?#

#SPJ11

Consider the following reaction:
CO(g)+2H2(g)?CH3OH(g)
Kp=2.26 104 at 25 C. Calculate ?.Grxn for the reaction at 25 C under each of the following conditions. A) Standard conditions
B) At equilibrium
C) PCH3OH= 1.5 atm ; PCO=PH2= 1.5 10x2 atm

Answers

The given reaction conditions allow us to calculate the number of moles of each gas present in the reaction mixture, as well as the extent of the reaction (i.e. the number of moles of methanol produced).

The reaction given is a synthesis gas reaction where methanol is produced by the catalytic conversion of carbon monoxide and hydrogen gas. The equation for the reaction is as follows:
CO + 2H2 → CH3OH
From the given conditions, we can see that the partial pressures of carbon monoxide (PCO) and hydrogen gas (PH2) are both 1.5 x 10^2 atm. The partial pressure of methanol (PCH3OH) is also 1.5 atm.
The partial pressure of a gas is defined as the pressure that the gas would exert if it occupied the same volume alone at the same temperature. The ideal gas law, PV = nRT, can be used to calculate the number of moles of each gas present in the reaction mixture.
Assuming that the temperature and volume are constant, we can use the ideal gas law to calculate the number of moles of carbon monoxide and hydrogen gas present in the reaction mixture.
PCO = nCO/VT and PH2 = nH2/VT
where nCO and nH2 are the number of moles of carbon monoxide and hydrogen gas, respectively, V is the volume of the reaction mixture, and T is the temperature in Kelvin.
From the equation for the synthesis gas reaction, we can see that one mole of carbon monoxide reacts with two moles of hydrogen gas to produce one mole of methanol. Therefore, the number of moles of methanol produced can be calculated as follows:
nCH3OH = (PCH3OH x V)/(RT)
From the given partial pressure of methanol, we can calculate the total pressure of the reaction mixture as follows:
PT = PCO + PH2 + PCH3OH
Using the ideal gas law, we can calculate the total number of moles of gas present in the reaction mixture:
nT = (PT x V)/(RT)
Finally, we can calculate the extent of the reaction (i.e. the number of moles of methanol produced) as follows:
nCH3OH produced = (nT/2) - (nCO/2)
Overall, the given reaction conditions allow us to calculate the number of moles of each gas present in the reaction mixture, as well as the extent of the reaction (i.e. the number of moles of methanol produced).

for more such questions on methanol

https://brainly.com/question/13630889

#SPJ11

How many H atoms are there in 12.5 g of (NH4)2CO3

Answers

There are 3.011×10²³ H atoms in 12.5 g of (NH₄)₂CO₃.

To determine the number of H atoms in 12.5 g of (NH₄)₂CO₃, we need to use the molar mass of (NH₄)₂CO₃ and Avogadro's number. The molar mass of (NH₄)₂CO₃ can be calculated by adding the atomic masses of all the atoms in one molecule of (NH₄)₂CO₃. This gives a molar mass of 96.086 g/mol.

Next, we can calculate the number of moles of (NH₄)₂CO₃ in 12.5 g by dividing the mass by the molar mass:

moles of (NH₄)₂CO₃ = 12.5 g / 96.086 g/mol = 0.130 moles

Since there are two NH₄ ions in one molecule of (NH₄)₂CO₃, there are also 0.260 moles of NH₄ in 12.5 g of (NH₄)₂CO₃.

Now we can calculate the number of moles of H atoms in 0.260 moles of NH₄ by multiplying by the number of H atoms per NH₄ ion, which is 4:

moles of H atoms = 0.260 moles NH₄ × 4 H atoms / 1 NH₄ ion = 1.040 moles H atoms

Finally, we can use Avogadro's number (6.022×10²³ atoms/mol) to convert moles of H atoms to the actual number of H atoms:

number of H atoms = 1.040 moles H atoms × 6.022×10²³ atoms/mol = 3.011×10²³ H atoms

Therefore, there are 3.011×10²³ H atoms in 12.5 g of (NH₄)₂CO₃.

To know more about molar mass refer here:

https://brainly.com/question/20552052#

#SPJ11

what is the relevant reaction that occurs when a solution of strong acid is added to a buffer comprised of a weak acid (ha) and weak base (a-)?

Answers

The relevant reaction that occurs when a solution of strong acid is added to a buffer comprised of a weak acid (HA) and weak base (A⁻) is the reaction between the strong acid and the weak base.

When a strong acid is added to the buffer, it reacts with the weak base (A⁻) in the buffer. This reaction results in the formation of the conjugate acid of the weak base (HA) and H⁺ ions. The H⁺ ions that are produced in the reaction are then consumed by the weak acid (HA) in the buffer to form more A⁻ ions and maintain the buffer's pH.

In summary, when a solution of strong acid is added to a buffer comprised of a weak acid and weak base, the relevant reaction that occurs is the reaction between the strong acid and the weak base. This reaction results in the formation of the conjugate acid of the weak base and H⁺ ions, which are then consumed by the weak acid in the buffer to maintain the pH of the buffer.

To know more about buffer, visit:

https://brainly.com/question/22821585

#SPJ11

onsider a reaction that changes the entropy of the universe by 519 j/k. if the temperature is 245 k, what would the free energy change be in j?

Answers

The free energy change would be equal to the change in enthalpy minus 127,155 J. However, we cannot determine the exact value of ΔG without knowing the change in enthalpy.

To answer this question, we need to use the equation for the change in Gibbs free energy:

ΔG = ΔH - TΔS

where ΔH is the change in enthalpy, T is the temperature in Kelvin, and ΔS is the change in entropy.

We know that the change in entropy of the universe is 519 J/K and the temperature is 245 K. We don't have information about the change in enthalpy, but we can assume that it is constant. Therefore, we can rearrange the equation to solve for ΔG:

ΔG = ΔH - TΔS
ΔG = ΔH - (245 K) (519 J/K)
ΔG = ΔH - 127,155 J

So the free energy change would be equal to the change in enthalpy minus 127,155 J. However, we cannot determine the exact value of ΔG without knowing the change in enthalpy.

To know more about entropy, refer

https://brainly.com/question/419265

#SPJ11

for the galvanic cell pictured below, which statement is true? a. potassium ions from the salt bridge flow toward the fe electrode as the electrode is oxidized. b. potassium ions from the salt bridge flow toward the half-cell where fe3 is reduced. c. potassium ions from the salt bridge flow toward the cr electrode as the electrode is oxidized. d. potassium ions from the salt bridge flow toward the half-cell where cr3 is reduced.

Answers

The correct statement for the given galvanic cell is: b. potassium ions from the salt bridge flow toward the half-cell where Fe3+ is reduced.


1. In a galvanic cell, a spontaneous redox reaction occurs, where one half-cell undergoes oxidation (loses electrons) and the other half-cell undergoes reduction (gains electrons).

2. The salt bridge maintains electrical neutrality by allowing the flow of ions between the two half-cells.

3. The statement that potassium ions flow toward the half-cell where Fe3+ is reduced indicates that they are compensating for the increase in negative charge in that half-cell due to the reduction of Fe3+ to Fe2+ (Fe3+ + e- → Fe2+).

4. As electrons flow from the anode (oxidation half-cell) to the cathode (reduction half-cell), the salt bridge allows for the flow of cations (such as K+) to the reduction half-cell and anions (such as NO3-) to the oxidation half-cell, thus maintaining charge balance.

In conclusion, statement b is true because potassium ions from the salt bridge flow toward the half-cell where Fe3+ is reduced to maintain electrical neutrality during the redox reaction in the galvanic cell.

Learn more about electrical neutrality here:

brainly.com/question/13015042

#SPJ11

The solubility of bacro4(s) in water is 3. 7 milligrams in 1. 0 l at 25 °c. What is the value of ksp for bacro4?

Answers

The value of Ksp for Ba[tex]CrO_4[/tex] is approximately 2.49 × [tex]10^{-16 }[/tex]at 25 °C.

[tex]BaCrO_4[/tex](s) ↔ [tex]Ba_2[/tex]+(aq) + [tex]CrO_42[/tex]-(aq)

The equilibrium expression for the solubility product of BaCrO4 is:

Ksp = [[tex]Ba_2[/tex]+][[tex]CrO_42[/tex]-]

We can use the given solubility  [tex]CrO_42[/tex] to calculate the concentrations of [tex]Ba_2[/tex]+ and [tex]CrO_42[/tex]- at equilibrium:

[tex]BaCrO_4[/tex](s) ↔ [tex]Ba_2[/tex]+(aq) + [tex]CrO_42[/tex]-(aq)

Initial: 0 0 0

Equilibrium: x x 3.7x[tex]10^{-6}[/tex] mol/L

Since 1 L of water contains 3.7 mg of BaCrO4 at equilibrium, the molar solubility of BaCrO4 is:

molar solubility = (3.7 mg / BaCrO4) / (molar mass of BaCrO4)

= (3.7 × [tex]10^{-6 }[/tex]mol / L) / (233.39 g / mol)

≈ 1.58 × [tex]10^{-8}[/tex] M

Therefore, at equilibrium, [[tex]Ba_2[/tex]+] = [[tex]CrO_4[/tex]2-] = x = 1.58 × [tex]10^{-8}[/tex] M.

Substituting these values into the equilibrium expression for Ksp:

Ksp = [[tex]Ba_2[/tex]+][[tex]CrO_4[/tex]2-] = (1.58 × [tex]10^{-8}[/tex])² ≈ 2.49 × [tex]10^{-16}[/tex]

Ksp, or the solubility product constant, is a measure of the solubility of a sparingly soluble salt in a solvent. It is a constant value that describes the equilibrium between the solid salt and its ions in the solution. Ksp is the product of the concentrations of the ions raised to the power of their stoichiometric coefficients, each raised to the power of their respective coefficients.

Ksp is a measure of the maximum amount of salt that can be dissolved in a solvent at a given temperature and is dependent on the temperature, pressure, and ionic strength of the solution. If the ion concentration exceeds the Ksp, then the salt will precipitate out of the solution until a new equilibrium is reached.

To learn more about Ksp visit here:

brainly.com/question/27132799

#SPJ4

Calculate the minimum of oxygen required for the complete combustion of a mixture of 20cm³ of CO (Carbon Monoxide) and 20cm³ of H₂ (Hydrogen gas)​

Answers

The minimum amount of oxygen required for the complete combustion of 20cm³ of CO and 20cm³ of H₂ would be 20.16 cm³ at STP.

Stoichiometric problem

The balanced chemical equation for the combustion of CO and H2 is:

CO + 1/2O2 → CO2

H2 + 1/2O2 → H2O

From the equation, we can see that one mole of CO requires 1/2 mole of O2, while one mole of H2 requires 1/2 mole of O2.

20 cm³ CO at STP = 20/24000 = 0.00083 moles CO20 cm³ H2 at STP = 20/24000 = 0.00083 moles H2

From the balanced equation, we can see that each mole of CO requires 1/2 mole of O2, while each mole of H2 requires 1/2 mole of O2.

Therefore, we need 0.00083/2 = 0.00042 moles of O2 for the combustion of CO and the same amount for the combustion of H2.

The total amount of O2 required is the sum of the amounts needed for each reactant:

Total O2 required = 0.00042 + 0.00042 = 0.00084 moles0.00084 moles O2 × 24000 cm³/mol = 20.16 cm³ O2

Therefore, the minimum amount of oxygen required for the complete combustion of 20 cm³ of CO and 20 cm³ of H2 is approximately 20.16 cm³ at STP.

More on stoichiometric problems can be found here: https://brainly.com/question/29775083

#SPJ1

Consider the following half-reactions. Which of these is the strongest reducing agent listed here?I2(s) + 2 e- → 2 I-(aq) Eo = 0.53 VS2O82-(aq) + 2 e- → 2 SO42-(aq) Eo = 2.01 VCr2O72-(aq) + 14 H+ + 6 e- → Cr3+(aq) + 7 H2O(l) Eo = 1.33 V1. I2(s)2. I-(aq)3. S2O82-(aq)4. SO42-5. Cr2O72-6. Cr3+(aq)

Answers

The strongest reducing agent listed here is the one with the most negative Eo value, which indicates a greater tendency to lose electrons and undergo reduction. In this case, the half-reaction with the most negative Eo value is I2(s) + 2 e- → 2 I-(aq) with an Eo value of 0.53 V.

Therefore, the answer is option 1, I2(s).To determine the strongest reducing agent, we need to consider the half-reactions and their standard reduction potentials (E°).

Here are the half-reactions and their potentials:

1. I2(s) + 2 e- → 2 I-(aq) E° = 0.53 V
2. S2O82-(aq) + 2 e- → 2 SO42-(aq) E° = 2.01 V
3. Cr2O72-(aq) + 14 H+ + 6 e- → 2 Cr3+(aq) + 7 H2O(l) E° = 1.33 V

Recall that a reducing agent is a substance that donates electrons, so it undergoes oxidation. Therefore, we need to reverse the given half-reactions to represent the oxidation process. The potentials will have the opposite sign when reversed:

1. 2 I-(aq) → I2(s) + 2 e- E° = -0.53 V
2. 2 SO42-(aq) → S2O82-(aq) + 2 e- E° = -2.01 V
3. 2 Cr3+(aq) + 7 H2O(l) → Cr2O72-(aq) + 14 H+ + 6 e- E° = -1.33 V

The strongest reducing agent will have the most negative oxidation potential, as it is most likely to donate electrons:

1. I-(aq) E° = -0.53 V
2. SO42-(aq) E° = -2.01 V
3. Cr3+(aq) E° = -1.33 V

With E° = -2.01 V, SO42- is the strongest reducing agent among the listed species.

Learn more about standard reduction here:- brainly.com/question/23881200

#SPJ11

Devise a synthesis of each compound from an alkyl halide using any other organic or inorganic reagents

Answers

Alkyl Halide: Ethyl Bromide Synthesis: Ethyl Bromide can be synthesized by reacting ethyl alcohol with hydrobromic acid and sulfuric acid.

What is ethyl?

Ethyl is an organic compound and a member of the alkane family of hydrocarbons, with the chemical formula C2H5. It is a colorless, flammable liquid with a sweet, disagreeable odor. Ethyl is used in industry for the production of fuel, solvents, and antifreeze agents. It is also used as a laboratory reagent for the synthesis of other compounds, and as a raw material in the production of ethanol and ethylene glycol. Because of its relatively low boiling point and low toxicity, ethyl is used as a low-cost solvent in many chemical reactions. Ethyl is also used in the production of a variety of pharmaceuticals, such as anticonvulsants, antihistamines, and anesthetics. It is also used in the production of explosives, as well as in food flavoring and perfumes.

1. Alkyl Halide: Ethyl Bromide

Synthesis: Ethyl Bromide can be synthesized by reacting ethyl alcohol with hydrobromic acid and sulfuric acid. The reaction proceeds as follows:

ethyl alcohol + hydrobromic acid + sulfuric acid → ethyl bromide + water + sulfur dioxide.

2. Alkyl Halide: Propyl Bromide

Synthesis: Propyl Bromide can be synthesized by reacting propanol with hydrobromic acid and sulfuric acid. The reaction proceeds as follows:

propanol + hydrobromic acid + sulfuric acid → propyl bromide + water + sulfur dioxide.

To learn more about ethyl

https://brainly.com/question/31613155

#SPJ4

An Alkyl Halide such as Ethyl Bromide can be synthesized by reacting ethyl alcohol with hydrobromic acid and sulfuric acid.

What are alkyl halides?

Alkyl halides or haloalkanes are a subclass of organic compounds that have an alkyl group's carbon atom bound to one of the halogen atoms—fluorine, chlorine, bromine, or iodine.

An alkyl group is a straight or branching chain of carbon atoms with hydrogen atoms connected to them.

The synthesis of ethyl bromide by reacting ethyl alcohol with hydrobromic acid and sulfuric acid is as follows:

ethyl alcohol + hydrobromic acid + sulfuric acid → ethyl bromide + water + sulfur dioxide.

Learn more about alkyl halides at: https://brainly.com/question/29713613

#SPJ4

Other Questions
A light ray can change direction when going from one material into another. that phenomenon is known as __________.refractionscatteringabsorptionreflection when your company is at fault and you must write a letter granting the customers claim,T/F Someone please help me venus wholesale company started carrying a new product in december. purchases and sales of this product during the month were: december 20 purchased 120 units at $82 per unit. december 26 sold 100 units. december 28 purchased 120 units at $90 per unit. at year-end, venus restates the carrying value of its inventory using periodic last-in, first-out (lifo) costing procedures. under periodic costing procedures, the last-in, first-out (lifo) cost of the inventory is: The accountant of Bacon Co. Has returned to work after a sabbatical break of some years. She is unaware of the issue of HKAS 1 (revised) or the new Companies Ordinance and has prepared draft financial statements as follows in accordance with what she remembers of HKAS 1 prior to the revision: What warning symptoms are most common prior to a myocardial infarction? Select all that apply.increased appetitesensation of indigestionincreased muscle strengthfatigueangina gains from trade occur as a result of responses a economic interaction.economic interaction. b more equality among people.more equality among people. c government intervention.government intervention. d less scarcity. a litmus test for cult organizations is that _____ is/are part of the structure. are compounds whose enthalpies of formation are highly negative somewhat or very stable or unstable? Cohesiveness is important because it 's been found to be related to the group 's : A ) identity . B ) relations . C ) purpose D) Productivity light of wavelength 605.0 nm is incident perpendicularly on a soap film with an index of refraction of 1.48 suspended in air. what is the smallest thickness of the film for which the reflections from the film undergo fully constructive interference? The hand position that is used most often when cutting uniform or increasing layers is called ______.A. palm to palmB. undercuttingC. cutting over fingersD. cutting below fingers Consider the minimization problem:Minimize:P(w1,w2,w3)=5w1+6w2+4w3Subject to:w1+2w2 65w1+3w2+3w324w1,w2,w3,0.Write down the initial simplex tableau of the corresponding dual problem, and use the theorem of duality to find the minimum value of P in the primal problem. during arrest and before questioning, defendants are usually advised of their ________. broadly most nearly meansResponseswidely.Answer A: widely.Aliberally.Answer B: liberally.Bloosely.Answer C: loosely.Croughly. Claude Ebair has hired a team of chemists to create the world's longest lasting perfume, which he plans to cal 24/7. On their first attempt, the chemists combined 5 milliliters of a substance containing 2% sandalwood with another substance containing 6% sandalwood to get a substance containing 5% sandalwood. How many milliliters of the substance containing 6% sandalwood must the chemists have used? a medical or pathological cause for compulsive sexual behavior is most likely if the person group of answer choices suffered sexual abuse as a child. grew up in a strict, religious home. showed a recent onset of symptoms. has had the symptoms throughout adulthood. has developed an increasing tolerance for sex. Calculate the standard cell potential at 25 oC, Eo or Eocell, for the reaction:Pb2+(aq) + Cu(s) --> Pb(s) + Cu2+(aq) Eo = ?where,Cu2+(aq) + 2e- --> Cu(s) Eo = 0.34V Pb2+(aq) + 2e- --> Pb(s) Eo = - 0.13 V Does Java use strict name equivalence, loose name equivalence, or structural equivalence when determining if two primitive types are compatible and/or equivalent? What about for non-primitive types? Give examples to justify your answer. 4. Demonstrate whether each of the following series is absolutely convergent, conditionally convergent, or divergent. 1931 (a) (-1)-1 41 (-1)n-1