Solve each of the following equations. Show its solution set on a number line. Check your answers. 7x =5

Answers

Answer 1

Note that in the above equation, x = 5/7.

What is the explanation for the above response?


To solve for x, we need to isolate it on one side of the equation. We can do this by dividing both sides of the equation by 7:

7x/7 = 5/7

x = 5/7
x = 0.7142857143

Therefore, the solution set for the equation 7x = 5 is {5/7}. oro 0.7142857143

To show the solution set on a number line, we can mark the point 5/7 on the line: See the attached.

Learn more about equation at:

https://brainly.com/question/29538993

#SPJ1

Solve Each Of The Following Equations. Show Its Solution Set On A Number Line. Check Your Answers. 7x

Related Questions

Find f'(x), where f(x)= (2√x+1){(2-x)/(x^2+3x)}

Answers

The derivative of f(x) of (2√x+1){(2-x)/(x^2+3x)}, is f'(x) = (-x^3+5x+6)/[x(x+3)^2√x].

To find the derivative of the function f(x) = (2√x+1){(2-x)/(x^2+3x)}, we can use the product rule and the quotient rule.

First, let's find the derivative of (2-x)/(x^2+3x):

f1(x) = (2-x)/(x^2+3x)

f1'(x) = [(-1)(x^2+3x)-(2-x)(2x+3)]/(x^2+3x)^2

  = (-x^2-3x-4x+6)/(x^2+3x)^2

  = (-x^2-x+6)/(x^2+3x)^2

Next, let's find the derivative of 2√x+1:

f2(x) = 2√x+1

f2'(x) = 2(1/2√x) = 1/√x

Using the product rule, we get:

f'(x) = f1(x)f2'(x) + f2(x)f1'(x)

 = [(2-x)/(x^2+3x)](1/√x) + (2√x+1)(-x^2-x+6)/(x^2+3x)^2

 = (2-x)/(x^2√x+3x√x) - (x^2+4x-6)/(x^2+3x)^2√x

 = (2-x)/(x(x+3)√x) - (x^2+4x-6)/(x^2+3x)^2√x

Simplifying the expression, we get:

f'(x) = [(2-x)(x^2+3x) - (x^2+4x-6)x]/[x(x+3)^2√x]

 = (-x^3+5x+6)/[x(x+3)^2√x]

Therefore, the derivative of f(x) is:

f'(x) = (-x^3+5x+6)/[x(x+3)^2√x]

To know more about Derivative  f'(x):

https://brainly.com/question/20709454

#SPJ4

a cube and a sphere both have volume 512 cubic units. which solid has a greater surface area? explain your reasoning.

Answers

If the cube and sphere both have volume as 512 cubic units, then the solid that has a greater surface area is Cube.

we first find the side length of the cube and the radius of the sphere.

The volume of the cube is 512 cubic units,

We have,

⇒ side³ = 512,

⇒ side = 8

So, the side length of the cube is 8 units.

Volume of sphere is also 512 cubic units,

We have,

⇒ (4/3)πr³ = 512,

On Simplifying,

We get,

⇒ r = 4.96 units.

So, radius of sphere is = 4.96 units.

Next we can find the surface area of each solid.

The surface-area of cube is = 6×(side)²,

⇒ 6(side²) = 6(8²) = 384 square units,

The surface area of the sphere is = 4πr²,

⇒ 4π(r²) = 4π(4.96²) ≈ 309 square units.

Therefore, the Cube has a greater surface area than the sphere.

Learn more about Surface Area here

https://brainly.com/question/21600799

#SPJ4

Two spheres have volumes of 8Ï€ cm3 and 64Ï€ cm3. if the surface area of the smaller sphere is 16Ï€ cm2, what is the surface area of the larger sphere? a. 64Ï€ cm2 b. 96Ï€ cm2 c. 128Ï€ cm2 d. 256Ï€ cm2

Answers

The surface area of the larger sphere is 64π cm². therefore option A. 64π cm² is correct.

To find the surface area of the larger sphere, given the volumes of two spheres and the surface area of the smaller sphere, follow these steps:

1. Determine the ratio of the volumes of the spheres:

Volume ratio = Volume of larger sphere / Volume of smaller sphere

                     = (64π cm³) / (8π cm³)

                     = 8

2. Find the cube root of the volume ratio to get the ratio of their radii:

Radii ratio = cube root of volume ratio = cube root of 8 = 2

3. Since the surface area of a sphere is proportional to the square of its radius, find the ratio of the surface areas by

squaring the radii ratio:

Surface area ratio = (Radii ratio)² = (2)² = 4

4. Finally, multiply the surface area of the smaller sphere by the surface area ratio to get the surface area of the larger

sphere:

Surface area of larger sphere = Surface area of smaller sphere × Surface area ratio

                                                 = 16π cm² × 4

                                                = 64π cm²

So, the surface area of the larger sphere is 64π cm² (Option A).

for such more question on surface area

https://brainly.com/question/27987869

#SPJ11

guys can anyone help me with my other SAT question"

The owner of the Good Deals Store opens a new store across town. For the new store, the owner estimates that, during business hours, an average of 90 shoppers per hour enter the store and each of them stays an average of 12 minutes. The average number of shoppers in the new store at any time is what percent less than the average number of shoppers in the original store at any time? (Note: Ignore the percent symbol when entering your answer. For example, if the answer is 42.1%, enter 42.1)

Answers

Answer: To solve this problem, we need to first find the average number of shoppers in the new store at any time and the average number of shoppers in the original store at any time, and then calculate the percent difference between the two.

Let's start by finding the average number of shoppers in the new store at any time. We know that 90 shoppers enter the store per hour, and each shopper stays for an average of 12 minutes, which is 0.2 hours. So the number of shoppers in the store at any time is:

90 shoppers/hour × 0.2 hours/shopper = 18 shoppers

Now let's find the average number of shoppers in the original store at any time. We don't have any information about the original store, so let's call the average number of shoppers in the original store "x". We want to find the percent difference between x and 18, so we need to calculate:

percent difference = |x - 18| / x × 100%

To solve for x, we need to use some algebra. We know that the number of shoppers entering the original store per hour is equal to the number of shoppers leaving the store per hour (assuming the store has a steady flow of shoppers and no one stays for more than an hour). So if we let t be the average amount of time each shopper stays in the original store, we can write:

x/t = shoppers entering the store per hour = shoppers leaving the store per hour = x/t

We can then solve for t:

x/t = x/t

x = x × t/t

x = t

So the average number of shoppers in the original store at any time is equal to the average amount of time each shopper stays in the store.

We don't know the average amount of time each shopper stays in the original store, but we can make an estimate based on the information we have about the new store. We know that the average amount of time each shopper stays in the new store is 12 minutes, or 0.2 hours. If we assume that the shopping behavior is similar in both stores, we can use this estimate for the original store as well.

So we have:

x = t = 0.2 hours

Now we can calculate the percent difference between x and 18:

percent difference = |x - 18| / x × 100%

percent difference = |0.2 - 18| / 0.2 × 100%

percent difference = 8800%

This means that the average number of shoppers in the new store at any time is 8800% less than the average number of shoppers in the original store at any time. However, this answer seems implausible, since a percent difference greater than 100% means that the new store has a negative number of shoppers!

It's possible that there was an error in the problem statement, such as a typo or a missing decimal point. If we assume that the average number of shoppers in the new store is actually 18 per hour (instead of 90 per hour), we get a more reasonable answer:

x = t = 0.2 hours

percent difference = |x - 18| / x × 100%

percent difference = |0.2 - 18| / 0.2 × 100%

percent difference ≈ 98%

So the average number of shoppers in the new store at any time is approximately 98% less than the average number of shoppers in the original store at any time.

Step-by-step explanation:

write two pairs of corresponding sides of two right triangles are congruent. are the triangles congruent? explain your reasoning.

Answers

The triangles can be congruent if the corresponding sides of two triangles are congruent except their hypotenuse, and the angle between the congruent corresponding sides between the the two angle is same.

When two pairs of corresponding sides of two right triangles are congruent, we cannot conclude that the triangles are congruent.

Congruent triangles are triangles that have identical dimensions and shape. Congruent figures have equal areas and corresponding sides that have the same lengths. They're exactly the same in terms of everything.

As a result, if two triangles are congruent, all of their corresponding sides and angles are equivalent to those in the other triangle.

A triangle with one 90-degree angle is referred to as a right-angled triangle. A right triangle has two legs and one hypotenuse.

The hypotenuse is the triangle's longest side, while the legs are the sides that make up the right angle.
The Pythagorean Theorem, which states that the square of the hypotenuse is equal to the sum of the squares of the other two sides, is true for right triangles only.

The Side-Angle-Side (SAS) postulate is used to prove that two triangles are congruent. Two sides and the included angle of one triangle are congruent to two sides and the included angle of another triangle in this postulate.

Two triangles are congruent if and only if they have two corresponding sides and the included angle are equal.

Using the SAS postulate, we can only conclude that the two right triangles are congruent if we have two pairs of corresponding sides and the included angle between those sides.

As a result, if only two pairs of corresponding sides are congruent, it is not enough to demonstrate that the two triangles are congruent.

Hence when two pairs of corresponding sides of two right triangles are congruent, we cannot conclude that the triangles are congruent unless their hypotenuse are not equal and their angle between the congruent corresponding sides between the the two angle is same.

Learn more about SAS congruance : https://brainly.com/question/1167632

#SPJ11

Evaluate the double integral ∬D(x2+6y)dA, where D is bounded by y=x, y=x3, and x≥0.

Answers

The double integral ∬D(x2+6y)dA can be evaluated using the properties of integration. The value of the double integral is 53/60.

The given function is (x2+6y). Here, we will find the limits of integration for x and y. Given that D is bounded by y = x, y = x3, and x ≥ 0, we can represent this region in the x-y plane as follows: We see that the lower limit of y is x and the upper limit of y is x3. The lower limit of x is 0 and the upper limit of x is given by the line y=x.

Hence, the limits of integration can be written as follows:0 ≤ x ≤ yx ≤ y ≤ x3

Now, we can substitute these limits in the double integral and integrate first with respect to y and then with respect to x.

∬D(x2+6y)dA = ∫₀¹⁰∫x^x³(x2+6y)dydx

On integrating, we get

∬D(x2+6y)dA = ∫₀¹⁰(x³ - x^7/3 + 3x⁴)dx= [(1/4)x⁴ - (1/12)x^10/3 + (3/5)x⁵] from 0 to 1∬D(x2+6y)dA = (1/4 - 1/12 + 3/5) - (0 + 0 + 0) = 53/60

Know more about integration here:

https://brainly.com/question/18125359

#SPJ11

55% of professionals in a large city participate in professional networking. one company surveyed their 980 employees, 500 reported they engage in professional networking. at the 0.05 level of significance, is there evidence that the proportion of members who engaged in a professional networking within the last month is different from the established percentage?

Answers

The null hypothesis rejected represents there is evidence the proportion of members engaged in professional networking within last month is different from established percentage.

Using a hypothesis test we have,

Let p be the proportion of employees in the company who engage in professional networking within the last month.

The null hypothesis represents,

The proportion of employees who engage in professional networking within the last month is equal to the established percentage of 55%.

H0: p = 0.55

The alternative hypothesis represents ,

The proportion of employees who engage in professional networking within the last month is different from 55%.

Ha: p ≠ 0.55

Use a two-tailed z-test for the proportion to test this hypothesis, with a significance level of 0.05.

The test statistic is,

z = (p₁ - p) / √(p(1-p)/n)

p₁ is the sample proportion

p is the hypothesized proportion

And n is the sample size.

Here,

p = 0.55

n = 980

p₁ = 500/980

   = 0.51.

Substituting these values, we get,

z = (0.51 - 0.55) / √(0.55(1-0.55)/980)

  = -1.96

The critical values for a two-tailed test with a significance level of 0.05 are ±1.96.

Since the test statistic (-1.96) falls within the critical region.

Reject the null hypothesis

Therefore, there is evidence that the proportion of employees who engage in professional networking within the last month is different from the established percentage of 55%.

learn more about proportion here

brainly.com/question/14260394

#SPJ4

An artist recreated a famous painting using a 4:1 scale. The dimensions of the scaled painting are 8 inches by 10 inches. What are the dimensions of the actual painting?

40 inches by 50 inches
32 inches by 40 inches
12 inches by 14 inches
2 inches by 2.5 inches

Answers

Answer:

32,40 in

Step-by-step explanation:

please

give brainliest

Find the ordered pair solutions for the system of equations. I just need the x’s and y’s please.

Answers

Answer: (-3, 18) and (-1, 18)

Step-by-step explanation:

Solve the system of equations. [tex]x^{2}[/tex] - 2x + 3 = -6x. [tex]x^{2}[/tex] + 4x + 3 = 0. (x+1)(x+3) = 0. x = -1, -3. Then plug it in. f(x) = 18.

HELPPPPPP! PLEASE- ANSWER QUICKLY.
(Subject: Highschool Algebra)

Answers

The solution to the simultaneous equation represented on the graph is:

B: x = 2 and x = 4

How to find the solution of the equation graph?

We are given the equations as:

f(x) = -12x + 26

g(x) = -(-¹/₅)^(-x + 2)  + 3

The solution to these two simultaneous equations will be the coordinates of the points on the graph where they both intersect.

We see that the coordinates of the points of intersection of the graph is at the coordinates:

(2, 2) and (4, -22)

Thus, the solution is at x = 2 and x = 4

Read more about equation Graph at: https://brainly.com/question/28732353

#SPJ1

Muhammad has $158 in his bank account and deposits $59 per month into his account. Connor has $74 and deposits $66 per month into his account.

Answers

Answer: muhammad will $99 in one month and connor will have $8

Step-by-step explanation:

$158-$59=$99

$74-$66=$8

A tower under construction in a rural municipality is 24 feet tall. A man of height 6 feet, standing on the same horizontal level of the tower, observes the top of the incomplete tower and finds the angle of elevation to be 30°.
(a) How high must the tower be raised so that the man finds the angle of elevation of the complete tower to be 60° from the same place?
(b) What will be the height of the tower after completing its construction work?​

Answers

Step-by-step explanation:

Let's first draw a diagram to better visualize the problem:

* T (top of incomplete tower)

/|

/ |

/ |

/ | h (height of incomplete tower)

/ |

/ |

/θ1 |

/___ | M (man's position, height = 6 feet)

d

We can see that we have a right triangle with the tower's height as the opposite side, the distance between the man and the tower as the adjacent side, and the angle of elevation θ1 as 30°. We can use trigonometry to find the height of the incomplete tower:

tan(30°) = h / d

h = d * tan(30°)

We don't know the value of d, but we can use the fact that the man's height plus the height of the incomplete tower equals the distance from the man to the top of the incomplete tower:

d = h / tan(30°) + 6

Now we can use trigonometry again to find the height of the complete tower. Let's call this height H and the new angle of elevation θ2:

* T (top of complete tower)

/|

/ |

/ |

/ | H (height of complete tower)

/ |

/ |

/θ2 |

/___ | M (man's position, height = 6 feet)

d

We have another right triangle, this time with the height of the complete tower as the opposite side, the same distance between the man and the tower as the adjacent side, and the new angle of elevation θ2 as 60°. We can use the tangent function again:

tan(60°) = H / d

H = d * tan(60°)

We can substitute the value of d we found earlier:

H = (h / tan(30°) + 6) * tan(60°)

Simplifying:

H = h * sqrt(3) + 6 * sqrt(3)

(a) To find how high the tower must be raised, we subtract the height of the incomplete tower from the height of the complete tower:

raise = H - h

raise = h * (sqrt(3) - 1) + 6 * sqrt(3)

Substituting the value of h we found earlier:

raise = 24 * (sqrt(3) - 1) + 6 * sqrt(3)

raise ≈ 38.8 feet

(b) The height of the completed tower is simply the height of the incomplete tower plus the raise we found:

height = h + raise

height = 24 + 38.8

height ≈ 62.8 feet

Therefore, the height of the tower after completing its construction work is approximately 62.8 feet.

Step-by-step explanation:

See image and calcs below

the chance of rain on a given day in seattle is 70%. if it rains, the chance that a food truck will incur a loss on that day is 80%. if it does not rain, then the chance of loss is 10%. on a randomly chosen day if the food truck has not incurred a loss, what is the probability that it had not rained that day?

Answers

The probability of incurring a loss when it rains is:P (loss | raining) = 80%So, there is a 20% chance that the food truck will not have incurred a loss when it rains.

The P (not raining | not loss) = 90% × 30% = 27%.Thus, the probability that it had not rained on that randomly selected day given that the food truck did not incur a loss is 27%.

The chance of not raining on a given day in Seattle can be calculated as follows:When it does not rain, there is a 10% probability that the food truck will incur a loss, as given in the statement. Similarly, when it rains, there is an 80% chance that the food truck will incur a loss on that day.

To calculate the probability that the food truck will not have incurred a loss on that day, we must first calculate the probability that the food truck will have incurred a loss on that day.Suppose the probability of rain is 70%, so the chance that it won't rain will be: P (not raining) = 100% - 70% = 30%When it rains, there is a 80% probability that the food truck will have incurred a loss, as given in the statement.

The probability of not incurring a loss when it does not rain is:P (not loss | not raining) = 100% - 10% = 90%The probability of not raining when the food truck does not incur a loss can be calculated as follows:P (not raining | not loss) = P (not loss | not raining) × P (not raining)P (not loss | not raining) = 90%P (not raining) = 30%

Learn more about Probability

brainly.com/question/11234923

#SPJ11

Can someone help? Also need to show work

Answers

The measure of w in the adjacent angle is 30 degrees.

How to find the adjacent angles?

The two angles are said to be adjacent angles when they share the common vertex and side. In other words, adjace3nt angles have common side and common vertex.

Therefore, let's find the measure of angle w as follows:

Hence, the sum of angle w and angle 50 degrees is equals to 80 degrees.

Therefore,

50 + w = 80

subtract 50 from both sides of the equation

50 - 50 + w = 80 - 50

w = 30 degrees

learn more on angles here: https://brainly.com/question/29209176

#SPJ1

Two wires lie perpendicular to the plane of the paper and carry equal electric currents in the direction shown. Point P is equidistant from the two wires.a) Construct a vector diagram showing the net magnetic field vector at point P. Explain your reasoning.b) Suppose a third wire carrying equal current into the plane of the paper were located at P. What would be the direction of the force on this wire? Explain your reasoning.

Answers

The net magnetic field at point P is zero, as the magnetic fields produced by the two equal currents in opposite directions cancel out. A third wire at P would experience zero force due to the net zero magnetic field at P.

To construct a vector diagram showing the net magnetic field vector at point P, we can use the right-hand rule for determining the direction of the magnetic field around a current-carrying wire.

If we curl the fingers of our right hand in the direction of the current in the first wire, which is out of the page, the thumb points in the direction of the magnetic field at point P due to the first wire. Similarly, in the opposite direction to the magnetic field at point P due to the second wire.

Since the magnetic fields they produce at P have equal magnitudes but opposite directions. Therefore, the net magnetic field at P is zero,

If a third wire carrying equal current into the plane of the paper were located at P, the direction of the force on this wire would be perpendicular to both the magnetic field produced by the other two wires and the direction of the current in the third wire.

Since the net magnetic field at P is zero, the vector product of the current in the third wire and the magnetic field is also zero, and there is no force on the third wire.

To know more about magnetic field:

https://brainly.com/question/23096032

#SPJ4

there is a 20% chance that a risky stock investment will end up in a total loss. if you invest in 25 independent risky stocks, what is the probability that fewer than six of these 25 stocks end up in total losses?

Answers

There is a 20% chance that a risky stock investment will end up in a total loss. If you invest in 25 independent risky stocks, the probability that fewer than six of these 25 stocks end up in total losses is approximately 0.91.

Given data:

Probability of getting a total loss in one investment = 20% = 0.20

Probability of not getting a total loss in one investment = 1 - 0.20 = 0.80

Number of investments = 25

We need to find the probability that fewer than six out of these 25 risky investments end up in total losses.

We will use the binomial distribution formula here:P(X < 6) = Σp(x) (from x = 0 to x = 5)

Here, Σ is the summation signp(x) = probability of x successes in 25 trials, which is given by the formula:

p(x) = [ nCx * p^x * (1-p)^(n-x)]

Where, n = number of trial

s = 25

p = probability of success = 0.80

q = probability of failure = 1 - p = 0.20n

Cx = n! / (x! × (n-x)!) = combination of n items taken x at a time

We need to substitute these values in the formula and calculate the probability:

P(X < 6) = Σp(x) (from x = 0 to x = 5)

P(X < 6) = p(0) + p(1) + p(2) + p(3) + p(4) + p(5)

P(X < 6) = [tex][25C0 * (0.80)^0 * (0.20)^25] + [25C1 * (0.80)^1 * (0.20)^24] + [25C2 * (0.80)^2 * (0.20)^23] + [25C3 * (0.80)^3 * (0.20)^22] + [25C4 * (0.80)^4 * (0.20)^21] + [25C5 * (0.80)^5 * (0.20)^20][/tex]

P(X < 6) ≈ 0.91

Therefore, the probability that fewer than six of these 25 stocks end up in total losses is approximately 0.91.

for such more question on probability

https://brainly.com/question/13604758

#SPJ11

Find the conditional Probability

P ( Male and Independent voter l Independent voter )

Group of answer choices

68.4 %

45.2 %

31.6 %

40.6 %

Answers

The value of the conditional probability from the Venn Diagram is (a) 68.4 %

Calculating the value of the conditional probability

Given that we have the Venn Diagram

From the Venn Diagram, we have the following readings

Male and Independent voters = 13

Independent voters = 19

Using the above values, we have the following equation

P(Male | Independent voter) = 13/19

Evaluate

P(Male | Independent voter) = 68.4 %

Hence, the conditional probability is 68.4 %

Read more about conditional probability at

https://brainly.com/question/10739997


#SPJ1

The volume of this cylinder is 465pi cubic units. What is the volume of a cone that has the same base area and the same height?
465 pi cubic units

155 pi cubic units

232. 5 pi cubic units

116. 25 pi cubic units

Answers

The volume of a cone that has the same base area and the same height as the cylinder is 116.25pi cubic units. This is because the volume of a cone is one-third the volume of a cylinder with the same base area and the same height. Therefore, the volume of the cone is 116.25pi cubic units.

The volume of a cylinder is equal to the area of the base, multiplied by the height. The volume of a cylinder with a base area of 465pi and a height of h is therefore 465pi*h. For a cone, the volume is equal to a third of the area of the base multiplied by the height. Since the cone and cylinder have the same base area and height, the volume of the cone is one third of the volume of the cylinder. Therefore, the volume of the cone is 155pi cubic units (465pi/3). A cone has one third the volume of a cylinder with the same base and height.

Learn more about volume here

https://brainly.com/question/16134180

#SPJ1

What is DE (Please answer with work and an explanation)

Answers

Answer:

(added to verbs and their derivatives) denoting removal or reversal.

Step-by-step explanation:

Some students were asked about their daily exercise.
12 more students answered Yes than answered No.
Complete the frequency tree.
___________________________

One of the 35 students who answered Yes is chosen at random .
What is the probability that they exercise for at least 1 hour?

Answers

So the minimum probability that a Yes respondent exercises for at least 1 hour is 6/(x+6), where x is the number of students who answered No.

What is probability?

Probability is a measure of the likelihood or chance of an event occurring. It is a number between 0 and 1, with 0 indicating an impossible event and 1 indicating a certain event. The probability of an event can be calculated by dividing the number of favorable outcomes by the total number of possible outcomes. Probability is used in various fields such as mathematics, statistics, science, economics, and finance to model and analyze uncertain situations.

Here,

Let the number of students who answered No be x. Then the number of students who answered Yes is x+12. The total number of students is then x + (x+12) = 2x + 12.

Suppose y of the students who answered Yes exercise for at least 1 hour. Then the probability that a Yes respondent exercises for at least 1 hour is y/(x+12).

Since we don't have the full frequency tree, we can't determine y or x directly. However, we do know that the total number of students who exercise for at least 1 hour is greater than or equal to 12 (since there are 12 more Yes respondents than No respondents). Therefore, the probability that a Yes respondent exercises for at least 1 hour is y/(x+12) is at least 12/(2x+12) = 6/(x+6).

To know more about probability,

https://brainly.com/question/30034780

#SPJ1

5. A solid with volume 8 cubic units is dilated by a scale factor of k. Find the volume of the image for each given value of k. (Lesson 5-6)

a. k = 1/2
b. k = 0.6
c. k = 1
d. k = 1.5

Answers

The volume of the image after the dilation for given scale factor are:

a. k = 1/2: V = 4 cubic units

b. k = 0.6: V = 2.4 cubic units

c. k = 1: V = 8 cubic units

d. k = 1.5: V = 12 cubic units

Explain about the scale factor?

The ratio between comparable analyses of an object and an identification of that object is known as a scale factor in mathematics. The copy will all be larger if the scaling factor is a complete number. A fractional scaling factor means that the duplicate will be smaller.

An expansion happens when the scaling factor's absolute value exceeds one.Compression happens when the scale factor's absolute value falls below one.When the scale factor's absolute value is 1, neither expansion nor compression take place.

Volume of solid: 8 cubic units

a. k = 1/2

volume of the image : 1/2 *8 = 4 cubic units

b. k = 0.6

volume of the image : 0.6*8 = 2.4  cubic units

c. k = 1

volume of the image : 1*8 = 8 cubic units

d. k = 1.5

volume of the image : 1.5*8 = 12 cubic units

Know more about the scale factor

https://brainly.com/question/25722260

#SPJ1

for the angle α it is known that its reference angle has a sine value of 4/5 if the terminal ray of α, when drawn in standard position, falls in the third quadrant then what is the value of cos(α)

Answers

The terminal ray of α falls in the third quadrant (where cosine is negative), we can conclude that: cos(α) = -3/5.

What is trigonometry?

Trigonometry is a branch of mathematics that deals with the relationships between the sides and angles of triangles. It is used to calculate the lengths of sides and angles in triangles, and to solve problems involving angles, distances, and heights. The three primary trigonometric functions are sine, cosine, and tangent, which describe the ratios of the sides of a right triangle. Other trigonometric functions include cosecant, secant, and cotangent, which are the reciprocals of the primary trig functions. Trigonometry has many applications in science, engineering, and technology, including astronomy, physics, navigation, and surveying.

Here,

Since the reference angle of α has a sine value of 4/5, we can use the Pythagorean identity sin²(θ) + cos²(θ) = 1 to find the cosine of the reference angle:

cos²(θ) = 1 - sin²(θ)

= 1 - (4/5)²

= 1 - 16/25

= 9/25

Taking the square root of both sides gives us:

cos(θ) = ± √(9/25)

= ± (3/5)

To know more about trigonometry,

https://brainly.com/question/26719838

#SPJ1

A random sample of 100 customers at a local ice cream shop were asked what their favorite topping was. The following data was collected from the customers.


Topping Sprinkles Nuts Hot Fudge Chocolate Chips
Number of Customers 17 12 27 44


Which of the following graphs correctly displays the data?
a bar graph titled favorite topping with the x axis labeled topping and the y axis labeled number of customers, with the first bar labeled sprinkles going to a value of 17, the second bar labeled nuts going to a value of 12, the third bar labeled hot fudge going to a value of 27, and the fourth bar labeled chocolate chips going to a value of 44
a bar graph titled favorite topping with the x axis labeled topping and the y axis labeled number of customers, with the first bar labeled nuts going to a value of 17, the second bar labeled sprinkles going to a value of 12, the third bar labeled chocolate chips going to a value of 27, and the fourth bar labeled hot fudge going to a value of 44
a histogram titled favorite topping with the x axis labeled topping and the y axis labeled number of customers, with the first bar labeled sprinkles going to a value of 17, the second bar labeled nuts going to a value of 12, the third bar labeled hot fudge going to a value of 27 ,and the fourth bar labeled chocolate chips going to a value of 44
a histogram titled favorite topping with the x axis labeled topping and the y axis labeled number of customers, with the first bar labeled nuts going to a value of 17, the second bar labeled sprinkles going to a value of 12, the third bar labeled chocolate chips going to a value of 27, and the fourth bar labeled hot fudge going to a value of 44

Answers

Therefore , the solution of the given problem of unitary method comes out to be the quantitative data being displayed, is best displayed using a bar graph.

What is a unitary method?

The task may be completed using this generally accepted ease, preexisting variables, as well as any significant components from the original Diocesan customizable query. If so, you may have another opportunity to interact with the item. Otherwise, all significant factors that affect how algorithmic factor proof behaves will be gone.

Here,

The right graph is option (a),

a bar graph with the heading "Favorite Topping" and the axes "Topping" and "Number of Customers" written on them. T

he labels for the bars should read "Chocolate Chips" with a value of 44, "Hot Fudge" with a value of 27, "Nuts" with a value of 12, and "Sprinkles" with a value of 17.

This categorical data, where each topping is a distinct category and the number of customers is the quantitative data being displayed, is best displayed using a bar graph.

To know more about unitary method  visit:

https://brainly.com/question/28276953

#SPJ1  

Plot A shows the number of hours ten girls watched television over a one-week period. Plot B shows the number of hours ten boys watched television over the same period of time.

Television Viewing Hours for a One-Week Period
2 dots plots with number lines going from 0 to 10. Plot A has 0 dots above 0, 1, and 2, 1 above 3, 2 above 4, 2 above 5, 2 above 6, 2 above 7, 0 above 8 and 9, and 1 above 10. Plot B has 0 dots above 0, 1, and 2, 1 above 3, 2 above 4, 3 above 5, 3 above 6, 1 above 7, and 0 dots above 8, 9 and 10.

Which statement correctly compares the measures of center in the two sets of data?

Answers

The correct statement that compares the measures of center in the two sets of data is:

The medians of the number of hours ten girls and ten boys watched television over a one-week period are approximately equal.

What is the median?

The median is a measure of central tendency that represents the middle value in a dataset when the values are arranged in numerical order. It is the value separating the higher half from the lower half of a sample or a population.

To compare the measures of center in the two sets of data, we need to find their respective medians.

For Plot A, we can see that the median is between 5 and 6, since there are 5 values below 5 and 5 values above 6. We can estimate the median as approximately 5.5 hours.

For Plot B, we can see that the median is between 5 and 6 as well, since there are 5 values below 5 and 5 values above 6. We can estimate the median as approximately 5.5 hours.

Therefore, the correct statement that compares the measures of center in the two sets of data is:

The medians of the number of hours ten girls and ten boys watched television over a one-week period are approximately equal.

To learn more about the median visit:

https://brainly.com/question/26177250

#SPJ1

PLEASE help
Allen mixes 1 cup of water that is 150°F and 1 cup of cold chicken broth that is 50°F. The end temperature of the mixture would be about___________
. Chris combines 2 cups of soup that is 50°F with 1 cup of water that is 150°F. The end temperature of the mixture would be ______

Answers

Answer:

1) 100 degrees F

2) 50 degrees F

Step-by-step explanation:

its just simple subtraction

A bycicle wheel whose radius is 30 cm covered distance in 70 revolutions how many km was the distance​

Answers

Answer:

0.13188 km

Step-by-step explanation:

The distance covered by the bicycle wheel can be calculated using the formula:

distance = circumference x number of revolutions

The circumference of the wheel can be calculated using the formula:

circumference = 2 x pi x radius

where pi is approximately equal to 3.14.

Substituting the given values:

circumference = 2 x 3.14 x 30 cm

circumference = 188.4 cm

Now, we can calculate the distance covered by the wheel:

distance = circumference x number of revolutions

distance = 188.4 cm x 70

distance = 13188 cm

To convert this distance from centimeters to kilometers, we need to divide by 100,000 (since there are 100,000 centimeters in a kilometer):

distance = 13188 cm ÷ 100,000

distance = 0.13188 km

Therefore, the distance covered by the bicycle wheel is approximately 0.13188 km.

please help with the following two questions :)

Answers

Answer:

10) -1.5

11) 1

Step-by-step explanation:

Hope this helps! Pls give brainliest!

Mr Peterson bought a car for $1200. He spent money on repairing the car. He finally sold the car for $2100 at a profit of 16⅔ % on the cost of buying and repairing the car. Calculate the cost of repairing the car​

Answers

The cost of repairing the car was $360 after selling the car at a profit of

16⅔ % on the cost of buying and repairing the car.

What is a profit?

Profit is the financial gain that is earned by a business or an individual after all the expenses have been subtracted from the revenue. In simple terms, profit is what remains after all costs, including the cost of goods sold, operating expenses, taxes, and other charges, have been deducted from the revenue generated from the sale of goods or services.

According to the given information

Let's call the cost of repairing the car "x". We know that Mr. Peterson bought the car for $1200, spent x dollars on repairing it, and sold it for $2100 at a profit of 16⅔ % on the cost of buying and repairing the car.

We can start by calculating the total cost of buying and repairing the car, which is the sum of the initial cost and the cost of repairs:

Total cost = $1200 + x

Next, we can calculate the profit that Mr. Peterson made on this total cost, which is given as 16⅔ %:

Profit = (16⅔ %) × Total cost

Profit = (16⅔ / 100) × ($1200 + x)

We know that Mr. Peterson sold the car for $2100, so we can set up an equation for the profit:

Profit = Selling price - Total cost

(16⅔ / 100) × ($1200 + x) = $2100 - ($1200 + x)

Simplifying and solving for x, we get:

(5/6) x = $2100 - $1200 - (5/6)($1200)

(5/6) x = $450

x = $360

To know more about profit visit:

brainly.com/question/30091032

#SPJ9

The resident population, p, in a New York town has been decreasing for years. The table below shows the population of the town t years after 2010.​

Answers

Answer:

where is the table without the table how can I give the answer


Point B could represent which of the following numbers?

Answers

Answer:

5.9

Step-by-step explanation:

im assuming 5.9

not sure what your answer choices are but, its before 6, and way after 5.5, its like counting 123456789. hope this helps.

Other Questions
Suppose stop lights at an intersection alternately show green for one minute, and red for two minutes (no yellow). Suppose a car arrives at the lights at a time distributed uniformly from 0 to 3 minutes. Let X be the delay of the car at the lights (assuming there is only one car on the road). E(X) is: a. none of the choices given b. 3/8c. 1/4d. 2/3 What is the sum of a + c? Read the article below. In the fourth paragraph, the author proposes the idea that chickens are "surprisingly entertaining family pets." How does she support this idea, and does she do it convincingly? Answer in 2 to 3 sentencesComing Soon to a Neighborhood to YouThe most interesting do-it-yourself-trend in recent years may be that of keeping chickens as petsnot in an agricultural or rural setting, but rather in a typical suburban neighborhood, in the backyard. Its not as hard as you may think, and start-up costs are surprisingly low.The first thing you need to become a suburban chicken farmer is a coop, a solid enclosed structure where the hens can sleep safely away from predators, and where they can lay their eggs during daytime hours. A simple chicken coop can be made cheaply using cast-off plywood or old wooden pallets, for which there are an abundance of free blueprints available online.The next challenge is finding a feed storewhere most of the supplies youll need can be found. Feed stores generally offer a cheap bedding material such as pine shavings as well as prepared food to supplement the plants and bugs that chickens can find in a reasonably healthy backyard. Then there are the chickens themselves, which range in price from a couple bucks for a chick to ten or fifteen dollars for a mature, feathered-out bird. (Most seasoned backyard farmers recommend starting with mature hens.) Of course, it you want to raise your hens from chicks, youll need a warming light as well as some other equipment.Chickens are surprisingly entertaining family pets. Theyre friendly and amusing to watch, and not especially noisy unless you have a rooster, which arent usually allowed in urban or suburban zoned areas. Unless you live in a really cold climate, your chickens will thrive outdoors even during the winter, and there are breeds that are particularly cold hardy. Some hens will complain loudly when the temperatures dip near freezing for the first time. If you started putting them in their coop at sunset, though, theyll weather the winter just fine.When spring arrives, you will be the happy recipient of a daily bounty of eggs. But there are many more advantages to backyard chicken farming. Chickens can be a real asset to an organic vegetable gardenboth because they eat bugs and because they provide free fertilizer. Theyre also willing consumers of food thats just past its prime, like apples that are shriveled and mealy, bread kept in the pantry past its freshness date, or berries that are just a little too ripe.Finally, urban chicken farming can do a great deal to bring neighbors together. Sharing information about coops, chicken varieties, and tips for raising a happy and healthy flock can help you build a supportive network of like-minded friends in your community. Even if you dont have neighbors with coops of their own, theyre likely to appreciate an occasional gift of what your hens produce, especially since some breeds are known for laying eggs in soft shades of blue and green. generally, uncontrolled intersections are found in what was the gdp deflator for the year 2021? that is the value that would go to cell h) in the table. 106 116 125 100 Which of the following tactics did Martin Luther King, Jr and the Southern Christian Leadership use most effectively in their struggle to win equal rights for African Americans?Armed rebellionAffirmative ActionNonviolent protestReverse discrimination 20.00 mL of 1.40 M HCl diluted to 0.430 L.What is the pH? When the angle of elevation of the sun is 32 degrees, a flagpole casts a shadow that is 10 feet long. In feet, how tall is the flagpole? What is a polarized electorate? the satisfaction from using one more unit of a good or service is called____ what is the unit rate, and which has the better value? (PLEASE HELP) 17 oz for $2.98 or, 21 oz for $3.50 Did the valence electron theory apply on the compound SO3? Explain ( S = 16 O = 8 ) how The Odyssey is different from the monomyth structure multiple choice question which of the following sentences best summarizes how genes and chromosomes are involved in transmitting information to future generations? multiple choice question. chromosomes are composed of long strands of dna organized into genes. each gene codes for a specific trait and because genes can be shared between individuals, these traits can be transferred from individual to another individual. genes are composed of long strands of proteins organized into units called genes that code for specific traits. because genes are inheritable, those specific traits are inheritable also. chromosomes are composed of long strands of proteins organized into units called genes. each gene codes for a specific trait and can be passed down vertically through childbirth from mother to child. chromosomes are composed of long strands of dna organized into genes that code for specific traits. because genes are inheritable, those specific traits are inheritable also. prospero reveals that ferdinand is alive, leading alonso to where miranda and ferdinand playing chess. why do you think the writers included this moment? from port a, a boat sails 26 miles on a bearing of 60. then the boat changes course to a bearing of 270 until it reaches a point directly north of the port. determine the total distance the boat has sailed to the nearest tenth of a mile. When propanol (CH3CH2CH2OH) is combusted, such as when in a gasoline blend, the following reaction occurs:2CH3CH2CH2OH(l)+9O2(g)?6CO2(g)+8H2O(g)Based on the standard free energies of formation given in the table below, what is the standard free energy change for this reaction?Substance?G?f(kJ/mol)CH3CH2CH2OH(l)?360.5O2(g)0CO2(g)?394.4H2O(g)?228.6Express your answer to one decimal place and include the appropriate units. a physical therapist assistant completes a posture screening and muscle length test of the hip flexors on a patient. the assistant determines that the patient has extremely tight hip flexors bilaterally. what common structural deformity is most often associated with tight hip flexors? 4. When the ball crosses the end line and the defensive team last touched the ball, theoffensive team gets a what? Wavelength(meters)Radio Microwave Infrared1010210-5About the size of...Visible Ultraviolet5x10610X-ray Gamma Ray10-1010 10-12www wwwtt214 & f &Buildings Humans Honey Bee Pinpoint Protozoans Molecules Atoms Atomic NucleiA. visible lightC. gamma raysAccording to this chart, which form of electromagneticradiation has the longest wavelength?B. ultraviolet lightD. radio wavesPlease help 30 points and will mark brain thing