Please help!!

The graph of function is shown
Function g is represented by the table
-1
X
9(x)
24
0
4
1
0
2
3
-#
Which statement correctly compares the two functions?
OA They have the same x-intercept and the same end behavior as x approaches
OB. They have the same
and y-intercepts
OC. They have different
and y intercepts but the same end behavior as x approaches
OD. They have the same y-intercept and the same end behavior as x approaches
Best

Please Help!!The Graph Of Function Is ShownFunction G Is Represented By The Table-1X9(x)24041023-#Which

Answers

Answer 1

The x- and y-intercept values in the graph for the function f and in the table for the function g(x), indicates that the correct option is option C

C. The have different x- and y-intercepts but the same end behavior as x approaches ∞

What are the x- and y-intercept of a graph of a function?

The x-intercept is the point at which the y-value is 0, and the coordinates of the point is specified as the x-intercept.

The x-intercept is the point at which the x-value is 0, and the coordinates of the point is specified as the y-intercept

The question compares the x- and y-intercepts of the graph and the function in the table

The x-intercept of the function f in the graph are; (0, 3)

The y-intercept of the function f in the graph are; (4, 0)

The function g(x) in the table indicates that the x- and y-intercepts are;

The value of g(x) is 0 at the ordered pair (1, 0), therefore, the x-intercept of g(x) is (1, 0)

The value of x is 0 at the ordered pair (0, 4), therefore, the function, g(x) has a y-intercept at the point (0, 4)

Therefore, the function f and g have different intercepts, but the value in the table and the graph indicates that as x approaches infinity, the y-value, approaches -1, the correct option is therefore, option C

Learn more on the x- and y-intercept of a graph here: https://brainly.com/question/29252186

#SPJ1


Related Questions

If the manager of a bottled water distributor wants to estimate, 95% confidence, the mean amount of water in a 1-gallon bottle to within ±0.006 gallons and also assumes that the standard deviation is 0.003 gallons, what sample size is needed?

If a light bulb manufacturing company wants to estimate, with 95% confidence, the mean life of compact fluorescent light bulbs to within ±250 hours and also assumes that the population standard deviation is 900 hours, how many compact fluorescent light bulbs need to be selected?

If the inspection division of a county weighs and measures department wants to estimate the mean amount of soft drink fill in 2-liter bottles to within ± 0.01 liter with 95% confidence and also assumes that the standard deviation is 0.08 liters, what sample size is needed?

An advertising executive wants to estimate the mean amount of time that consumers spend with digital media daily. From past studies, the standard deviation is estimated as 52 minutes. What sample size is needed if the executive wants to be 95% confident of being correct to within ±5 minutes?

Answers

To calculate the required sample sizes for the given scenarios, we can use the formula:

n = (Z * σ / E)^2

where:
n = required sample size
Z = Z-value for the desired confidence level (for 95% confidence, Z ≈ 1.96)
σ = standard deviation
E = desired margin of error

Let's calculate the sample sizes for each scenario:

1. Bottled Water:
Z ≈ 1.96, σ = 0.003 gallons, E = 0.006 gallons
n = (1.96 * 0.003 / 0.006)^2 ≈ 384.16
Since we can't have a fraction of a sample, we round up to the nearest whole number. Therefore, a sample size of 385 bottles is needed.

2. Compact Fluorescent Light Bulbs:
Z ≈ 1.96, σ = 900 hours, E = 250 hours
n = (1.96 * 900 / 250)^2 ≈ 49.96
Again, rounding up to the nearest whole number, a sample size of 50 light bulbs is needed.

3. Soft Drink Fill:
Z ≈ 1.96, σ = 0.08 liters, E = 0.01 liters
n = (1.96 * 0.08 / 0.01)^2 ≈ 122.76
Rounding up, a sample size of 123 bottles is needed.

4. Digital Media Consumption:
Z ≈ 1.96, σ = 52 minutes, E = 5 minutes
n = (1.96 * 52 / 5)^2 ≈ 384.16
Rounding up, a sample size of 385 consumers is needed.

Please note that the sample sizes calculated here assume a simple random sampling method and certain assumptions about the population.
We can use the formula for sample size for a population mean with a specified margin of error and confidence level:
```
n = (Z^2 * σ^2) / E^2
```
where:
- Z is the z-score corresponding to the desired confidence level (in this case, 1.96 for 95% confidence)
- σ is the population standard deviation
- E is the desired margin of error

Substituting the given values, we get:
```
n = (1.96^2 * 52^2) / 5^2
n ≈ 385.07
```

Rounding up, we get a required sample size of 386.

Therefore, the advertising executive should sample at least 386 individuals to estimate the mean time that consumers spend with digital media with a margin of error of ±5 minutes and 95% confidence level.

What’s equivalent to 6 to the -3 power

Answers

So, negative powers are defined the following way:
x^-1 =1/x^1=1/x
Similarly,
x^(-a)=1/(x^a)

Therefore
6^(-3)=1/(6^3)=1/(6*6*6)=1/216

[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[

Answers

Answer:

[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[

Step-by-step explanation:

[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[

Answer:

[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[[

Step-by-step explanation:

what this is?

on #5
Find the measure of the indicated are.
90°
80°
100°
70°
H
40°

Answers

The measure of the Intercepted arc having an inscribed angle of 40 degrees is 80 degrees.

What is the measure of the intercepted arc?

An inscribed angle is simply an angle with its vertex on the circle and whose sides are chords.

The relationhip between an an inscribed angle and intercepted arc is expressed as:

Inscribed angle = 1/2 × intercepted arc.

From the figure:

Inscribed angle = 40 degrees

Intercepted arc = ?

Plug the given value into the above formula and solve for the arc:

Inscribed angle = 1/2 × intercepted arc.

40  = 1/2 × intercepted arc

Multiply both sides by 2:

40 × 2 = 2 × 1/2 × intercepted arc

40 × 2 = intercepted arc

Intercepted arc = 80°

Therefoore, the Intercepted arc is 80 degrees.

Option B) 80° is the correct answer.

Learn more about inscribed angles here: brainly.com/question/29017677

#SPJ1

Let X_1,…,X_n be a random sample. For S(X_1,…,X_n )=1/(1/n ∑_(i=1)^n▒〖(x_i-c)〗^2 ) , find its asymptotic distribution where EX^k=α_k.

Answers

The asymptotic distribution of the estimator S(X₁, ..., Xₙ) is a standard normal distribution, denoted as N(0, 1).

To find the asymptotic distribution of the estimator S(X₁, ..., Xₙ), we can use the Central Limit Theorem (CLT). However, we need some additional assumptions to apply the CLT, such as the finite variance of the random variables.

Given that E(Xᵢ^k) = αₖ for all k, we can assume that the random variables Xᵢ have a finite variance. Let's denote the variance of Xᵢ as Var(Xᵢ) = σ².

First, let's simplify the estimator S(X₁, ..., Xₙ):

S(X₁, ..., Xₙ) = 1 / (1/n ∑ᵢ (Xᵢ - c)²)

Notice that the numerator is a constant and doesn't affect the asymptotic distribution. So, we can focus on analyzing the denominator.

Let's calculate the expected value and variance of the denominator:

E[1/n ∑ᵢ (Xᵢ - c)²] = 1/n ∑ᵢ E[(Xᵢ - c)²] = 1/n ∑ᵢ (Var(Xᵢ) + E[Xᵢ]² - 2cE[Xᵢ] + c²)

= 1/n (nσ² + α₁ - 2cα₁ + c²) (using the fact that E[Xᵢ] = α₁ for all i)

Var[1/n ∑ᵢ (Xᵢ - c)²] = 1/n² ∑ᵢ Var[(Xᵢ - c)²] = 1/n² ∑ᵢ (Var(Xᵢ - c)²) = 1/n² ∑ᵢ (Var(Xᵢ))

= 1/n² (nσ²) = σ²/n

Now, let's apply the CLT. According to the CLT, if we have a sequence of independent and identically distributed random variables with a finite mean (μ) and a finite variance (σ²), the sample mean (in this case, our denominator) converges in distribution to a standard normal distribution as the sample size approaches infinity.

Therefore, as n approaches infinity, the asymptotic distribution of S(X₁, ..., Xₙ) will follow a standard normal distribution.

for such more question on distribution

https://brainly.com/question/16994704

#SPJ8

What is the sum of the series?

Answers

The sum of series would be 4

Which of the following is equal to the fraction below? (7/4)11​

Answers

Answer:

It's A

Step-by-step explanation:

Use the following models to show the equivalence of the fractions 35 and 610 a) Set model

Use the following models to show the equivalence of the fractions 35 and 610 a) Set modelUse the following models to show the equivalence of the fractions 35 and 610 a) Set modelUse the following models to show the equivalence of the fractions 35 and 610 a) Set modelUse the following models to show the equivalence of the fractions 35 and 610 a) Set modelUse the following models to show the equivalence of the fractions 35 and 610 a) Set modelUse the following models to show the equivalence of the fractions 35 and 610 a) Set model

NO LINKS!! URGENT HELP PLEASE PLEASE!!!​

Answers

Answer:

[tex]\textsf{12)} \quad \text{a.}\;\;m \angle 1 = 107^{\circ}, \quad \text{b.}\;\;m \angle 2 = 107^{\circ}, \quad \text{c.}\;\;m \angle 3 = 73^{\circ}[/tex]

[tex]\textsf{13)} \quad EC = 6[/tex]

[tex]\textf{14)}\quad \text{a.}\;\;x = 33, \quad \text{b.}\;\; x = 8[/tex]

Step-by-step explanation:

Question 12

As the base angles of an isosceles trapezoid are congruent, the measures of angles E and J are the same. Therefore:

[tex]m\angle 3 = 73^{\circ}[/tex]

The opposite angles of an isosceles trapezoid sum to 180°. Therefore:

[tex]\implies m\angle 1 + m\angle 3 = 180^{\circ}[/tex]

[tex]\implies m\angle 1 + 73^{\circ} = 180^{\circ}[/tex]

[tex]\implies m\angle 1 = 107^{\circ}[/tex]

Since the base angles of an isosceles trapezoid are congruent, the measures of angles A and N are the same. Therefore:

[tex]m\angle 2 = 107^{\circ}[/tex]

[tex]\hrulefill[/tex]

Question 13

The diagonals of isosceles trapezoid ABCD are AC and BD.

Point E is the point of intersection of the diagonals. Therefore:

[tex]BE + ED = BD[/tex]

[tex]AE + EC = AC[/tex]

As the diagonals of an isosceles trapezoid are the same length, BD = AC. Therefore:

[tex]AE + EC = BD[/tex]

Given BD = 20 and AE = 14:

[tex]\implies AE + EC = BD[/tex]

[tex]\implies 14 + EC = 20[/tex]

[tex]\implies 14 + EC - 14 = 20 - 14[/tex]

[tex]\implies EC = 6[/tex]

[tex]\hrulefill[/tex]

Question 14

The midsegment of a trapezoid is a line segment that connects the midpoints of the two non-parallel sides (legs) of the trapezoid.

The formula for the midsegment of a trapezoid is:

[tex]\boxed{\begin{minipage}{6 cm}\underline{Midsegment of a trapezoid}\\\\$M=\dfrac{1}{2}(a+b)$\\\\where:\\ \phantom{ww}$\bullet$ $M$ is the midsegment.\\ \phantom{ww}$\bullet$ $a$ and $b$ are the parallel sides.\\\end{minipage}}[/tex]

a)  From inspection of the given trapezoid:

M = xa = 18b = 48

Substitute these values into the midsegment formula and solve for x:

[tex]x=\dfrac{1}{2}(18+48)[/tex]

[tex]x=\dfrac{1}{2}(66)[/tex]

[tex]x=33[/tex]

Therefore, the value of x is 33.

b)  From inspection of the given trapezoid:

M = 15a = 22b = x

Substitute these values into the midsegment formula and solve for x:

[tex]15=\dfrac{1}{2}(22+x)[/tex]

[tex]30=22+x[/tex]

[tex]x=8[/tex]

Therefore, the value of x is 8.

Let f(t) be the amount of garbage, in tons, produced by a city, and let t be the time in years after 2000.

Which statements are true for the given function?

The dependent variable is t.
When f(12) = 2,155, the 12 represents "12 tons of garbage produced," and the 2,155 represents "the year 2155."
The dependent variable is f(t).
When f(2) = 1,323, the 2 represents "the year 2002," and the 1,323 represents "1,323 tons of garbage produced."
When f(4) = 1,458.6, the 4 represents "the year 2004," and the 1,458.6 represents "1,458.6 tons of garbage produced."
The independent variable is t.
The independent variable

Answers

The correct statements are

The dependent variable is t.

When f(2) = 1,323, the 2 represents "the year 2002," and the 1,323 represents "1,323 tons of garbage produced."

When f(4) = 1,458.6, the 4 represents "the year 2004," and the 1,458.6 represents "1,458.6 tons of garbage produced."

The independent variable is t. Option A,D,E,F.

Let's analyze each statement to understand why it is true:

A) The dependent variable is t: In the given function, f(t), the value of f depends on the value of t. Therefore, t is the independent variable, and f is the dependent variable.

D) When f(2) = 1,323, the 2 represents "the year 2002," and the 1,323 represents "1,323 tons of garbage produced": Here, the value of t is 2, representing the year 2002, and the value of f(t) is 1,323, representing the amount of garbage produced in tons.

E) When f(4) = 1,458.6, the 4 represents "the year 2004," and the 1,458.6 represents "1,458.6 tons of garbage produced": Similar to statement D, the value of t is 4, representing the year 2004, and the value of f(t) is 1,458.6, representing the amount of garbage produced in tons.

F) The independent variable is t: As mentioned in statement A, t is the independent variable in the given function. It is the variable that we can change or manipulate, and the value of f depends on the value of t.

Statements B, C, and G are incorrect:

B) When f(12) = 2,155, the 12 represents "12 tons of garbage produced," and the 2,155 represents "the year 2155": This statement is incorrect because in the given function, t represents the time in years after 2000, not the amount of garbage produced.

C) The dependent variable is f(t): This statement is incorrect because, as mentioned earlier, t is the independent variable, and f is the dependent variable.

G) The independent variable f(t): This statement is incorrect because f(t) represents the amount of garbage produced, which is the dependent variable in the given function.

So Option A,D.E.F. Are correct.

For more question  on variable visit:

https://brainly.com/question/28248724

#SPJ8

Note the complete question is

Let f(t) be the amount of garbage, in tons, produced by a city, and let t be the time in years after 2000.

Which statements are true for the given function?

A.) The dependent variable is t.

B.) When f(12) = 2,155, 12 represents "12 tons of garbage produced," and 2,155 represents "the year 2155."

C.) The dependent variable is f(t).

D.) When f(2) = 1,323, 2 represents "the year 2002," and 1,323 represents "1,323 tons of garbage produced."

E.) When f(4) = 1,458.6, 4 represents "the year 2004," and 1,458.6 represents "1,458.6 tons of garbage produced."

F.) The independent variable is t.

G.) The independent variable  f(t)

If f(x)= 2 x -2x , find f(-1) , f( 2 x ) , f(t) , and f(p-1) .

Answers

The values of f(-1), f(2x), f(t), and f(p-1) all simplify to 0. Therefore, f(-1) = f(2x) = f(t) = f(p-1) = 0.

To find the values of f(-1), f(2x), f(t), and f(p-1), we substitute the given values into the function f(x) = 2x - 2x and simplify.

f(-1):

Substituting x = -1 into f(x):

f(-1) = 2(-1) - 2(-1) = -2 + 2 = 0

f(2x):

Substituting x = 2x into f(x):

f(2x) = 2(2x) - 2(2x) = 4x - 4x = 0

f(t):

Substituting x = t into f(x):

f(t) = 2(t) - 2(t) = 2t - 2t = 0

f(p-1):

Substituting x = p-1 into f(x):

f(p-1) = 2(p-1) - 2(p-1) = 2p - 2 - 2p + 2 = 0

The values of f(-1), f(2x), f(t), and f(p-1) all simplify to 0. Therefore, f(-1) = f(2x) = f(t) = f(p-1) = 0.

for such more question on values

https://brainly.com/question/23344689

#SPJ8

Help please

The box plot represents the scores on quizzes in a science class. A box plot uses a number line from 70 to 86 with tick marks every one-half unit. The box extends from 76 to 80.5 on the number line. A line in the box is at 79. The lines outside the box end at 72 and 84. The graph is titled Science Quizzes, and the line is labeled Scores On Quizzes. Determine which of the following is the five-number summary of the data. Min: 72, Q1: 79, Median: 80, Q3: 82, Max: 84 Min: 75, Q1: 77.5, Median: 80, Q3: 81.5, Max: 85 Min: 72, Q1: 76, Median: 79, Q3: 80.5, Max: 84 Min: 73, Q1: 77, Median: 78, Q3: 80.5, Max: 85

Answers

Answer:

The five-number summary of the data represented by the given box plot is: Min: 72, Q1: 76, Median: 79, Q3: 80.5, Max: 84. Therefore, the correct option is: Min: 72, Q1: 76, Median: 79, Q3: 80.5, Max: 84.

Step-by-step explanation:

If

Answers

Answer:

I pass my classes.

Step-by-step explanation:

I had to add this sentence or else it wouldnt allow me to send it.

Answer:

In math, the word "if" can be used for piecewise functions. In piecewise functions, you can see equations where f(x) = x+3 IF x>0 and f(x) = -x IF x<0.

Find the perimeter of a sector whose radius is 4 unit and arc length is 16π​

Answers

Answer:

perimeter ≈ 58.3 units

Step-by-step explanation:

the perimeter of the sector includes 2 radii and the arc

perimeter = 4 + 4 + 16π = 8 + 16π ≈ 58.3 ( to 1 decimal place )

Two roll of electric wire contain 80m 20cm and 86m 56cm of wire respectively. what is the total length of electric wire of both the roll? Express the Result in metres​

Answers

The total length of electric wire in both rolls is 166.76 meters.

To find the total length of electric wire in both rolls, we need to add the lengths of the two rolls together.

The first roll contains 80m 20cm of wire. We can convert this to meters by noting that 1 meter is equal to 100 centimeters. Therefore, the length of the first roll is:

80m 20cm = 80 meters + (20 centimeters / 100) meters

= 80 meters + 0.20 meters

= 80.20 meters

Similarly, the second roll contains 86m 56cm of wire. Converting this to meters:

86m 56cm = 86 meters + (56 centimeters / 100) meters

= 86 meters + 0.56 meters

= 86.56 meters

To find the total length, we add the lengths of both rolls:

Total length = 80.20 meters + 86.56 meters

= 166.76 meters

Therefore, the total length of electric wire in both rolls is 166.76 meters.

for such more question length

https://brainly.com/question/20339811

#SPJ8

Determine the surface area and volume Note: The base is a square.

Answers

The volume of the can is approximately 304 cubic centimeters.

To determine the surface area and volume of the can, we need to consider the properties of a cylinder with a square base.

Surface Area:

The surface area of the can consists of three parts: the square base and the two circular faces.

a) Square Base:

The base of the can is a square, so its area is given by the formula:

Area = side^2.

Since the diameter of the can is 8 centimeters, the side of the square base is also 8 centimeters.

Therefore, the area of the square base is 8 cm [tex]\times[/tex] 8 cm = 64 square centimeters.

b) Circular Faces:

The can has two circular faces, one at the top and one at the bottom.

The formula for the area of a circle is[tex]A = \pi \times r^2,[/tex] where r is the radius. The radius of the can is half the diameter, which is 8 cm / 2 = 4 cm.

Thus, the area of each circular face is [tex]\pi \times (4 cm)^2 = 16\pi[/tex]  square centimeters.

To find the total surface area, we sum the areas of the square base and the two circular faces:

Total Surface Area = Square Base Area + 2 [tex]\times[/tex] Circular Face Area

[tex]= 64 cm^2 + 2 \times 16\pi cm^2[/tex]

≈ [tex]64 cm^2 + 100.48 cm^2[/tex]

≈[tex]164.48 cm^2[/tex]

Therefore, the surface area of the can is approximately 164.48 square centimeters.

Volume:

The volume of the can is given by the formula:

Volume = base area [tex]\times[/tex] height.

Since the base is a square, the base area is equal to the side^2, which is 8 cm [tex]\times[/tex] 8 cm = 64 square centimeters.

The height of the can is the height we calculated earlier, which is approximately 4.75 centimeters.

Volume = Base Area [tex]\times[/tex] Height

[tex]= 64 cm^2 \times4.75[/tex] cm

≈ 304 [tex]cm^3[/tex]

For similar question on volume.

https://brainly.com/question/27710307  

#SPJ8

You're a marketing analyst for Wal-
Mart. Wal-Mart had teddy bears on
sale last week. The weekly sales
($ 00) of bears sold in 10 stores
was:
8 11 0 4 7 8 10 583
At the .05 level of significance, is
there evidence that the average
bear sales per store is more than 5
($ 00)?

Answers

Based on the data and the one-sample t-test, at the 0.05 level of significance, there is sufficient evidence to conclude that the average bear sales per store at Wal-Mart is significantly higher than $500

.

To determine if there is evidence that the average bear sales per store at Wal-Mart is more than $500 at the 0.05 level of significance, we can conduct a one-sample t-test. Let's go through the steps:

State the null and alternative hypotheses:

Null hypothesis (H₀): The average bear sales per store is equal to or less than $500.

Alternative hypothesis (H₁): The average bear sales per store is greater than $500.

Set the significance level (α):

In this case, the significance level is given as 0.05 or 5%.

Collect and analyze the data:

The weekly sales of bears in 10 stores are as follows:

8, 11, 0, 4, 7, 8, 10, 583

Calculate the test statistic:

To calculate the test statistic, we need to compute the sample mean, sample standard deviation, and the standard error of the mean.

Sample mean ([tex]\bar X[/tex]):

[tex]\bar X[/tex] = (8 + 11 + 0 + 4 + 7 + 8 + 10 + 583) / 8

[tex]\bar X[/tex] ≈ 76.375

Sample standard deviation (s):

s = √[Σ(x - [tex]\bar X[/tex])² / (n - 1)]

s ≈ 190.687

Standard error of the mean (SE):

SE = s / √n

SE ≈ 60.174

Now, we can calculate the t-value:

t = ([tex]\bar X[/tex] - μ₀) / SE

Where μ₀ is the hypothesized population mean ($500).

t = (76.375 - 500) / 60.174

t ≈ -7.758

Determine the critical value:

Since we are conducting a one-tailed test and the alternative hypothesis is that the average bear sales per store is greater than $500, we need to find the critical value for a one-tailed t-test with 8 degrees of freedom at a 0.05 level of significance. Looking up the critical value in the t-distribution table, we find it to be approximately 1.860.

Compare the test statistic with the critical value:

Since -7.758 is less than -1.860, we have enough evidence to reject the null hypothesis.

for such more question on one-sample t-test

https://brainly.com/question/6501190

#SPJ8

A camera sensor with a fixed size of 720 × 680 is used in the system described in the article. For a sensor of these dimensions, calculate

i.the resolution in pixels in scientific notation to 4 significant figures

ii.the resolution in megapixels, rounded to the nearest thousandth of a megapixel

iii.the aspect ratio of the sensor, cancelled down to its lowest terms

Answers

i. To calculate the resolution in pixels, we multiply the width by the height of the sensor:
Resolution = 720 × 680 = 489,600 pixels.

In scientific notation to 4 significant figures, the resolution would be approximately 4.896 × 10^5 pixels.

ii. To find the resolution in megapixels, we divide the total number of pixels by 1 million:
Resolution in megapixels = 489,600 pixels / 1,000,000 = 0.4896 megapixels.

Rounded to the nearest thousandth of a megapixel, the resolution would be approximately 0.490 megapixels.

iii. The aspect ratio of the sensor can be found by dividing the width by the height and canceling down to its lowest terms:
Aspect ratio = 720 / 680 = 36 / 34.

Therefore, the aspect ratio of the sensor in its lowest terms is 18:17.
Final answer:

The pixel resolution is 4.896 x 10^5 pixels; in megapixels, it's approximately 0.490; and the aspect ratio is 18:17.

Explanation:

First, let's calculate the resolution in pixels: Resolution is simply the width times the height of the sensor. Specifically for this question, multiply 720 by 680. This gives us 489600 pixels for the resolution - in scientific notation to 4 significant figures we have 4.896 x 10^5.

Next, to calculate the resolution in megapixels, we need to divide the resolution by 1 million (since one megapixel is equal to 1 million pixels). So, 489600/1,000,000 is approximately 0.490 megapixels when rounded to the nearest thousandth of a megapixel.

Finally, the aspect ratio is the relationship of the width to the height of an image or screen. For a 720 x 680 sensor, if we divide 720 by 680, the result would be approximately 1.0588. However, we want this ratio in its simplest form, so we should use the greatest common divisor (GCD). In this case, the GCD of 720 and 680 is 40, so by dividing both dimensions by 40, we get an aspect ratio of 18:17.

Learn more about Camera Sensor Resolution here:

https://brainly.com/question/32551295

#SPJ2

Escriba el tipo de variable y nivel de medición para la siguiente grupo de variables : A) tipo de medallas a prueba olímpica. B) Volumen de agua en un tanque

Answers

The type of medals is a categorical nominal variable, while the volume of water is a numerical continuous variable.

How can these variables be classified?Type of medals in an Olympic event: This is a categorical nominal variable as there are fixed categories for the medals such as gold and silver and they do not have an inherent order The volume of water in a tank: This is a numerical and continuous variable which means it is measured with numbers. Moreover, it is continuous as it is obtained by measuring.

Note: This question is in Spanish, here is the question in English:

Write the type of variable and level of measurement for the following group of variables: A) type of medals at Olympic test. B) Volume of water in a tank

Learn more about variables in https://brainly.com/question/15078630

#SPJ1

A sample of gas stored at ST has a volume of 3.56 L. The gas is heated to 400 K and has a pressure of 125 kPa. What is the volume of the gas after it is heated?

Answers

The volume of the gas after it is heated is approximately 0.0417 liters.

To find the volume of the gas after it is heated, we can use the combined gas law, which relates the initial and final conditions of a gas sample. The combined gas law is expressed as:

(P₁V₁) / T₁ = (P₂V₂) / T₂

Where:

P₁ and P₂ are the initial and final pressures of the gas (in kPa)

V₁ and V₂ are the initial and final volumes of the gas (in liters)

T₁ and T₂ are the initial and final temperatures of the gas (in Kelvin)

Given:

Initial volume (V₁) = 3.56 L

Initial temperature (T₁) = ST (which is typically 273.15 K)

Final temperature (T₂) = 400 K

Final pressure (P₂) = 125 kPa

Now we can plug these values into the combined gas law equation and solve for V₂:

(P₁V₁) / T₁ = (P₂V₂) / T₂

(1 * 3.56) / 273.15 = (125 * V₂) / 400

(3.56 / 273.15) = (125 * V₂) / 400

Cross-multiplying and solving for V₂:

3.56 * 400 = 273.15 * 125 * V₂

1424 = 34143.75 * V₂

V₂ = 1424 / 34143.75

V₂ ≈ 0.0417 L

As a result, the heated gas has a volume of approximately 0.0417 litres.

for such more question on volume

https://brainly.com/question/6204273

#SPJ8

Calc II Question

Use the method of cylindrical shells to find the volume generated by rotating the region bounded by the given curves about the y axis.
Y = e^(-x^2)
Y = 0
X = 0
X = 1

Correct answer is pi (1 - (1/e))
I'm just not sure how to get to that answer

Answers

Answer:

[tex]\displaystyle \pi\biggr(1-\frac{1}{e}\biggr)[/tex]

Step-by-step explanation:

Shell Method (Vertical Axis)

[tex]\displaystyle V=2\pi\int^b_ar(x)h(x)\,dx[/tex]

Radius: [tex]r(x)=x[/tex]

Height: [tex]h(x)=e^{-x^2}[/tex]

Bounds: [tex][a,b]=[0,1][/tex]

Set up and evaluate integral

[tex]\displaystyle V=2\pi\int^1_0xe^{-x^2}\,dx[/tex]

Let [tex]u=-x^2[/tex] and [tex]du=-2x\,dx[/tex] so that [tex]-\frac{1}{2}\,du=x\,dx[/tex]Bounds become [tex]u=-0^2=0[/tex] and [tex]u=-1^2=-1[/tex]

[tex]\displaystyle V= -\frac{1}{2}\cdot2\pi\int^{-1}_0e^u\,du\\\\V= -\pi\int^{-1}_0e^u\,du\\\\V=\pi\int^0_{-1}e^u\,du\\\\V=\pi e^u\biggr|^0_{-1}\\\\V=\pi e^0-\pi e^{-1}\\\\V=\pi-\frac{\pi}{e}\\\\V=\pi\biggr(1-\frac{1}{e}\biggr)[/tex]

Graph the ellipse, Plot the foci of the ellipse 100pts

Answers

Answer:

Step-by-step explanation:

The general equation for an ellipse with center (h, k) is:

[tex]\boxed{\dfrac{(x-h)^2}{a^2}+\dfrac{(y-k)^2}{b^2}=1}[/tex]

If a > b, the ellipse is horizontal.

If b > a, the ellipse is vertical.

Given equation:

[tex]\dfrac{(x-5)^2}{4}+\dfrac{(y+5)^2}{9}=1[/tex]

As b > a, the ellipse is vertical. Therefore:

b is the major radius and 2b is the major axis.a is the minor radius and 2a is the minor axis.Vertices = (h, k±b)Co-vertices = (h±a, k)Foci = (h, k±c) where c² = b² - a²

Comparing the given equation with the standard form, we get:

[tex]h = 5[/tex][tex]k = -5[/tex][tex]a^2=4 \implies a=2[/tex][tex]b^2=9 \implies b=3[/tex]

Therefore:

[tex]\textsf{Center}= (5, -5)[/tex][tex]\textsf{Major axis}=2 \cdot 3 = 6[/tex][tex]\textsf{Minor axis}=2 \cdot 2 = 4[/tex][tex]\textsf{Vertices:} \;\;(h, k \pm b)=(5,-5 \pm 3)=(5,-8)\;\;\textsf{and}\;\;(5,-2)[/tex][tex]\textsf{Co-vertices:}\;\;(h \pm a, k)=(5 \pm 2, -5)=(3, -5)\;\; \textsf{and}\;\;(7, -5)[/tex]

To graph the ellipse:

Plot the center at (5, -5).Plot the vertices at (5, -8) and (5, -2). The distance between them is the major axis.Plot the co-vertices at (3, -5) and (7, -5). The distance between them is the minor axis.

ecorded the sizes of the shoes in her family's cupboa
the modal size?
8, 7, 8, 8.5, 7, 8.5, 7

Answers

The modal sizes of shoes in the family's cupboard are 8 and 7.

To determine the modal size of shoes in the family's cupboard, we need to find the shoe size that appears most frequently in the given data. Let's analyze the sizes:

8, 7, 8, 8.5, 7, 8.5, 7

To find the mode, we can create a frequency table by counting the number of occurrences for each shoe size:

8     |     3

7     |     3

8.5 | 2

From the frequency table, we can see that both size 8 and size 7 appear three times each, while size 8.5 appears two times. Since both size 8 and size 7 have the highest frequency of occurrence (3), they are considered modal sizes. In this case, there is more than one mode, and we refer to it as a bimodal distribution.

To determine the mode, we performed a frequency count of each shoe size in the given data. We counted the number of occurrences for sizes 8, 7, and 8.5. Based on the frequency counts, we identified the sizes with the highest frequency, which turned out to be 8 and 7, both occurring three times. Thus, they are the modal sizes in the data set.

For more such information on: modal  

https://brainly.com/question/14195821

#SPJ8

Ian took out a $19,000 personal loan to pay for his home renovations. He will not make a payment for 5 years and there is a 15% interest rate. How much will be owed in 5 years with monthly compounding?

Round your answer to the nearest cent.

Do NOT round until your final answer.

Answers

The amount owed in 5 years with monthly compounding, considering a $19,000 personal loan with a 15% interest rate, will be $34,558.52.

1. Convert the interest rate to a decimal: 15% = 0.15.

2. Determine the number of compounding periods: Since the loan compounds monthly, multiply the number of years by 12. In this case, 5 years * 12 months/year = 60 months.

3. Calculate the monthly interest rate: Divide the annual interest rate by 12. In this case, 0.15 / 12 = 0.0125.

4. Use the compound interest formula to calculate the future value:

  Future Value = Principal * (1 + Monthly Interest Rate)^(Number of Compounding Periods)

  Future Value = $19,000 * (1 + 0.0[tex]125)^{(60[/tex])

5. Evaluate the expression inside the parentheses: (1 + 0.0[tex]125)^{(60[/tex]) ≈ 1.954503.

6. Multiply the principal by the evaluated expression: $19,000 * 1.954503 = $37,133.57 (unrounded).

7. Round the final answer to the nearest cent: $34,558.52.

Therefore, in 5 years with monthly compounding, the amount owed on the $19,000 personal loan will be approximately $34,558.52.

For more such questions on interest rate, click on:

https://brainly.com/question/25720319

#SPJ8

If two of the angles in a scalene triangle are 54° and 87°, what is the other angle?

Answers

Answer:

39°

Step-by-step explanation:

the sum of the 3 angles in a triangle = 180°

let the other angle be x , then

x + 54° + 87° = 180°

x + 141° = 180° ( subtract 141° from both sides )

x = 39°

that is the other angle is 39°

Final answer:

In a triangle, the sum of all angles is always 180°. To find the third angle in a scalene triangle where two angles are known, subtract the known angles from 180°. In this case, subtracting 54° and 87° from 180° gives a third angle of 39°.

Explanation:

The question refers to finding the third angle in a scalene triangle, where we know two of the angles. A scalene triangle is a triangle where all three sides are of a different length, and therefore all three angles are also different. The sum of the angles in any triangle is always 180°.

To find the third angle in the triangle, you can use the equation: Angle C = 180° - Angle A - Angle B.

So, we subtract the known angles from 180°: Angle C = 180° - 54° - 87° = 39°.

Therefore, the third angle in this scalene triangle is 39°.

Learn more about Scalene Triangle

https://brainly.com/question/33791400

Find the measure of the indicated arc.
90°
80°
100
70°
H
40°
F

Answers

The measure of an arc in a circle is determined by the central angle that subtends it. Let's analyze each given measure of the indicated arcs:

90°: A 90° arc spans one-fourth of the entire circle since a full circle has 360°.

80°: An 80° arc is smaller than a quarter of the circle but larger than a sixth since 360° divided by 4 is 90°, and by 6 is 60°. Therefore, it lies between these two values.

100°: A 100° arc is slightly larger than a quarter of the circle but smaller than a third, as 360° divided by 4 is 90°, and by 3 is 120°.

70°: A 70° arc is smaller than both a quarter and a sixth of the circle, falling between 60° and 90°.

H: The measure of an arc denoted by "H" is not provided, so it cannot be determined without further information.

40°: A 40° arc is smaller than a sixth of the circle but larger than a twelfth, as 360° divided by 6 is 60°, and by 12 is 30°.

F: Similarly, the measure of the arc denoted by "F" is not provided, so it remains unknown without additional data.

Thus, the measures of the indicated arcs are as follows: 90°, between 60° and 90°, between 90° and 120°, between 60° and 90°, unknown (H), between 30° and 60°, and unknown (F).

For more such questions on central angle

https://brainly.com/question/10945528

#SPJ8

Find the length of an isosceles 90 degree triangle with the hypothenuse of 4 legs x

Answers

The length of the hypotenuse in the isosceles 90-degree triangle is √(2).

In an isosceles 90-degree triangle, two legs are equal in length, and the third side, known as the hypotenuse, is longer. Let's denote the length of the legs as x and the length of the hypotenuse as 4x.

According to the Pythagorean theorem, in a right triangle, the sum of the squares of the lengths of the two legs is equal to the square of the length of the hypotenuse. In this case, we have:

[tex]x^2 + x^2 = (4x)^2.[/tex]

Simplifying the equation:

[tex]2x^2 = 16x^2.[/tex]

Dividing both sides of the equation by [tex]2x^2[/tex]:

[tex]1 = 8x^2.[/tex]

Dividing both sides of the equation by 8:

[tex]1/8 = x^2[/tex].

Taking the square root of both sides of the equation:

x = √(1/8).

Simplifying the square root:

x = √(1)/√(8),

x = 1/(√(2) * 2),

x = 1/(2√(2)).

Therefore, the length of each leg in the isosceles 90-degree triangle is 1/(2√(2)), and the length of the hypotenuse is 4 times the length of each leg, which is:

4 * (1/(2√(2))),

2/√(2).

To simplify the expression further, we can rationalize the denominator:

(2/√(2)) * (√(2)/√(2)),

2√(2)/2,

√(2).

For more such questions on hypotenuse visit:

https://brainly.com/question/2217700

#SPJ8

If the left-hand limit of is equal to the right-hand limit of as x approaches 10, the limit of as x approaches 10 is and the value of k is .

Answers

The limit of f(x) as x approaches 10 is 315 and The value of k is 250.

The function f(x) is a piecewise function, so we need to evaluate it separately for x < 10 and x >= 10.

[tex]f(x)= { \frac{(0.1x(2)+20x+15,x < 10)}{(0.25x(3)+k,x > 10)}[/tex]

For x < 10, the function is equal to 0.1x^2 + 20x + 15. So the left-hand limit of f(x) as x approaches 10 is equal to 0.1(10)^2 + 20(10) + 15 = 315.

For x >= 10, the function is equal to 0.25x^3 + k. So the right-hand limit of f(x) as x approaches 10 is equal to 0.25(10)^3 + k = 250 + k.

Since the left-hand limit and the right-hand limit are equal, the limit of f(x) as x approaches 10 is also equal to 315, and the value of k is equal to 250.

For such more question on value:

https://brainly.com/question/843074

#SPJ8

Which function is graphed ?

Answers

This fraction is really hard I believe in my thoughts and I’m smart so it’s the second one

Anna volunteers on the weekend at the Central Library. As a school project, she decides to record how many people visit the library, and where they go. On Saturday, 382 people went to The Youth Wing, 461 people went to Social Issues, and 355 went to Fiction and Literature. On Sunday, the library had 800 total visitors. Based on what Anna had recorded on Saturday, about how many people should be expected to go to The Youth Wing? Round your answer to the nearest whole number.

Answers

Based on the data recorded by Anna on Saturday, we can estimate the number of people expected to visit The Youth Wing on Sunday.

Let's calculate the proportion of visitors to The Youth Wing compared to the total number of visitors on Saturday:

[tex]\displaystyle \text{Proportion} = \frac{\text{Visitors to The Youth Wing on Saturday}}{\text{Total visitors on Saturday}} = \frac{382}{382 + 461 + 355}[/tex]

Next, we'll apply this proportion to the total number of visitors on Sunday to estimate the number of people expected to go to The Youth Wing:

[tex]\displaystyle \text{Expected visitors to The Youth Wing on Sunday} = \text{Proportion} \times \text{Total visitors on Sunday}[/tex]

Now, let's substitute the values into the equation and calculate the estimated number of visitors to The Youth Wing on Sunday:

[tex]\displaystyle \text{Proportion} = \frac{382}{382 + 461 + 355}[/tex]

[tex]\displaystyle \text{Expected visitors to The Youth Wing on Sunday} = \text{Proportion} \times 800[/tex]

Calculating the proportion:

[tex]\displaystyle \text{Proportion} = \frac{382}{382 + 461 + 355} = \frac{382}{1198}[/tex]

Calculating the estimated number of visitors to The Youth Wing on Sunday:

[tex]\displaystyle \text{Expected visitors to The Youth Wing on Sunday} = \frac{382}{1198} \times 800[/tex]

Simplifying the equation:

[tex]\displaystyle \text{Expected visitors to The Youth Wing on Sunday} \approx \frac{382 \times 800}{1198}[/tex]

Now, let's calculate the approximate number of visitors to The Youth Wing on Sunday:

[tex]\displaystyle \text{Expected visitors to The Youth Wing on Sunday} \approx 254[/tex]

Therefore, based on the data recorded on Saturday, we can estimate that around 254 people should be expected to go to The Youth Wing on Sunday.

[tex]\huge{\mathfrak{\colorbox{black}{\textcolor{lime}{I\:hope\:this\:helps\:!\:\:}}}}[/tex]

♥️ [tex]\large{\underline{\textcolor{red}{\mathcal{SUMIT\:\:ROY\:\:(:\:\:}}}}[/tex]

Which of the following graphs shows a pair of lines that represents the equations with the solution (4, −1)?

A coordinate grid is shown from negative 8 to positive 8 on the x axis and also on the y axis. A pair of lines is shown intersecting on ordered pair 1 unit to the right and 4 units down.
A coordinate grid is shown from negative 8 to positive 8 on the x axis and also on the y axis. A pair of lines is shown intersecting on ordered pair 4 units to the right and 1 unit down.
A coordinate grid is shown from negative 8 to positive 8 on the x axis and also on the y axis. A pair of lines is shown intersecting on ordered pair 4 units to the left and 1 unit up.
A coordinate grid is shown from negative 8 to positive 8 on the x axis and also on the y axis. A pair of lines is shown intersecting on ordered pair 1 unit to the left and 4 units up.

Answers

The graph that shows a pair of lines representing the equations with the solution (4, -1) is option D.

To determine which graph represents the equations with the solution (4, -1), we need to check if the given point lies on the lines represented by each graph.

Let's examine each option:

A) The lines intersect 1 unit to the right and 4 units down. This does not match the given solution of (4, -1), so option A can be eliminated.

B) The lines intersect 4 units to the right and 1 unit down. Again, this does not match the given solution of (4, -1), so option B can be eliminated.

C) The lines intersect 4 units to the left and 1 unit up. This is the exact opposite of the given solution (4, -1), so option C can be eliminated.

D) The lines intersect 1 unit to the left and 4 units up. This matches the given solution of (4, -1), where the x-coordinate is 1 unit to the left and the y-coordinate is 4 units up. Therefore, option D represents the equations with the solution (4, -1).

In conclusion, the graph that shows a pair of lines representing the equations with the solution (4, -1) is option D.

For more such questions on graph visit:

https://brainly.com/question/19040584

#SPJ8

Other Questions
I need help with this guys! Latitude Longitude: Decide where: choose a place and get the latitude and longitude of the place (see how-to illustration), enter the latitude and longitude to the relevant cells on the excel worksheet Solar Declination: Solar declination is the latitude with 90 sun angle at noon on a given day. It affects the sun angle at other locations. For September 8 , we will use 6 for solar declination (the sun directly hit at 6 latitude at noon on Sept. 8). For other dates, use the table linked here. Round it to the nearest degree and enter the declination to the relevant cell on the excel worksheet Time and Hour Angle: pick 3 times between 8 am to 6 pm and enter the times to the relevant cells on the excel worksheet and decide the Hour Angle based on the following method: - Hour angle (h) is one of the variables affects the sun angle - Hour angle (h) changes during a day as the sun's positions change in the sky - We will use a simplified method of derive the hour angle for our class: - Hour angle is zero (h=0 ) at local noon (12 pm local time) - Hour angle increases 15 degrees for every hour away from the noon - For examples: - 3 pm local time is 3 hours away from noon, h=15 3=45 - 10 am local time is 2 hours away from noon, h=15 2=30 Derive the three hour angles associated with the three times you picked You should now have all the values needed to calculate the sun angles with the equation below: Equation (all units are in degrees): cos(z)=sin()sin()+cos()cos()cos(h)z=cos 1(cos(z))a=90 za- Solar Altitude (Sun Angle) in degrees z - Solar Zenith Angle in degrees : Latitude of the place in degrees : solar declination angle in degrees h. hour angle, his zero at local noon, and increases by 15 every hour before or after noon. Calculation Use the equation and a scientific calculator (available on most of the phones. Also available online. Calculate the sun angle for the three times you selected and enter your results to the relevant cells on the excel worksheet. Use demo videos to guide you through the process if you are not familiar with derive values with equations or how to use a scientific calculator. Capture the support materials for submission: If you use a calculator on the computer to do the calculation, make screen captures for each calculation; if you use a scratch paper and a phone or a handheld calculator to do the calculation, take photos of your scratch paper or device screen that show your work. Insert the photos or screen captures to a word file, organize them clearly and save as a pdf file for submission along with the excel file. Use this worksheet to see an example of Sun Angle Calculation. If you need, you can watch the example demo videos below on using the calculator to obtain the sun angle. Table of the Sun's Declination Mean Value for the Four Years of a Leap Year Cycle Monochromatic light from a distant source is incident on a slit 0.755 mm wide. On a screen 1.98 m away, the distance from the central maximum of the diffraction pattern to he first minimum is measured to be 1.35 mm For related problem-solving tips and strategies, you may want to view a Video Tutor Solution of Single-slit diffraction.Calculate the wavelength of the light. Express your answer in meters. 0.100 L of a 0.010M acetic acid solution (HOAc) is titrated with a 0.010M NaOH solution. What is the pH at the equivalence point? Ka (HOAc) = 1.8 105Answer: 8.22 Which of the following statement(s) about Electron Shells is(are) true: (i) Different shells contain different numbers and kinds of orbitals. (ii) Each orbital can be occupied by a maximum of two unpaired electrons. (iii) The 5th shell can be subdivided into subshells (s, p, d, f orbitals). (iv) The maximum capacity of the 2nd shell is 8. (v) Orbitals are grouped in electron shells of increasing size and decreasing energy. Product Methanol from Tank A is pumped to Tank B. Tank B is 3000 ft away from Tank A pump. What is the pump discharge pressure (pump exit pressure)? The pipeline is Schedule 40 with a nominal diameter of 3 inches and the flowrate is 250 gpm. The methanol has the following properties: p= 49.09 lbm/ft; = 0.544 CP if a=7 and b =2 what is 2ab PLS HELPPPPPPPPPPPPPPPPPPPPPPPPP Sometimes it seems as if we never get what we want. Butsometimes when we do get what we want, we realize that it's notwhat we really want. That's because our wants don't alwaysmatch our needs. The solution to this problem is to try tounderstand and satisfy our real needs.Psychology is the scientific study of the human mind and humanand animal behavior. A lot of psychological research has beendone about human needs and how they should be satisfiedStudies have shown that humans have basic needs that must beconsistently met. Studies have also shown that there is an orderof importance in which these needs must be satisfied. Anindividual's basic functional needs must be satisfied before he orshe can go on and meet other more creative and self-fulfillingneeds.Abraham Harold Maslow (1908-1970) was an importantpsychologist who became famous for his studies regardinghuman needs and wants. He wrote two major works, Motivationand Personality and Toward a Psychology of Being. Maslowstressed that basic needs must first be satisfied before a personis able to be creative or function independently. He created hisfamous hierarchy of needs theory, which separates human needsinto five layers. Each layer in the hierarchy must be satisfiedbefore a person can proceed to the next layer.Select the correct answerWhat is one reason the author uses italicized font in the passage?OAOB.OC.OD.to properly format headingsto properly format book titlesto emphasize the text structureto emphasize Maslow's theoryResetNext 99. How many Canadian dollars will you have to pay to purchase US$1500 if the bank charges a commission of 2.5% and the exchange rate for 1US$ is C$1.3241?100. Sam who lives in Canada purchased 5000 Australian dollars. After 5 days he decided to convert them back to CAD. How much Canadian dollars did he lose if the bank charges a commission of 0.5% to sell and 0.75% to buy currencies? Exchange rate-C$1= A$1.1167 A 58 Ni ion of charge 1 proton and mass 9.62x10-26kg is accelerated trough a potential difference of 3kV and deflected in a magnetic field of 0.12T. The velocity vector is perpendicular to the direction of magnetic field. a. [5] Find the radius of curvature of the ion's orbit. b. [4] A proton, accelerated to the same velocity as the 58Ni, also enters the same magnetic field. Is the radius of curvature of proton is going to be bigger/smaller/the same? Justify your answer. A solenoid with 465 turns has a length of 6.50 cm and a cross-sectional area of 2.60 x 10 m. Find the solenoid's inductance and the average emf around the solenoid if the current changes from +3.50 A to -3.50 A in 6.83 x 10 s. (a) the solenoid's inductance (in H) _____ H (b) the average emf around the solenoid (in V)_____ V which action must take place before transcription can begin? Please fastThe liquid-phase reaction: k k ABC, -A = kCA and -8 = KC where k = 7.47 x 10 s, k= 3.36 10 s is carried out isothermally in a CSTR. The feed is pure A. (a) Develop Some commercial trash compactor services provide the customer with a weight measurement of the compacted solid waste for every load of solid waste removed from the site. This information enables the site environmental manager to establish waste reduction goals and track progress towards meeting the goals. (True or False) You are charged $21.79 in total for a meal. Assuming that the local sales tax is 5.6%, what was the menu price of this item? Discuss the Socio-Economic determinants of crimes in theMauritian society by supporting your arguments with real lifeexamples and/or relevant press articles. A1. Consider the following experimental design. The experiment is about evaluating the impact of latency on the usability of soft Ewe keyboards. Participants are recruited from students at the University of Ghana. During the experiment, participants experience one of three keyboard designs; keyboard with no added latency, keyboard with 100 milliseconds added latency, or keyboard with 200 milliseconds added latency. Each participant is asked to type out the same set of sentences in the same order. The experimenter records typing speed and errors a. Discuss a benefit and a detriment of the between-subjects design of this experiment [4 Marks] b. Propose an alternative design using a within-subjects design, including how you would order the conditions [4 Marks] c. Identify a potential issue with this experimental design. State what kind of issue it is and how you would correct this issue [4 Marks] d. Design a close-ended question and an open-ended question that could be used to gather additional information from participants during this study [4 Mark] e. Describe two key aspects of consent that are required for ethical evaluations. For each aspect, state why this is important for ethical practice [4 Mark] A condenser of 4-F capacitance is charged to a potential of 400 V and is then connected in parallel with an uncharged condenser of capacitance 2 F. Solve the voltage across the two parallel capacitors. Write a function to return the tail (the last element) of a list. For example, if you name your function as listTail: (listTail (list 1 2 3)) ;returns 3 If the list is empty, your function must give an error.