Hey can someone help me fill out these blanks

Hey Can Someone Help Me Fill Out These Blanks

Answers

Answer 1

Answer:

Constructive interference is when two waves interact causing larger waves because the crest will meet a crest or a trough will meet a trough which adds the waves together changing the size of the amplitude.

Destructive interference is when two waves interact causing smaller waves because the crest will meet a trough or a trough will meet a crest which subtracts the waves together changing the size of the amplitude.


Related Questions

Which equation would be used to calculate the rate constant from initial
concentrations?
O A. Kea
OB. PV = nRT
O C. k=
[Cror
[A] [B]
O D.
Rate
[A] [BY
-Ea
k = Ae RT

Answers

The equation that would be used to calculate the rate constant from initial concentrations is option C:

k = [C] / ([A] [B])

What is Concentration?

It is a measure of how much of a particular substance is dissolved in a given volume of a solution.

where [A] and [B] are the initial concentrations of the reactants and [C] is the concentration of the product at a given time. This equation is known as the rate law for a second-order reaction.

The other equations listed are:

A. Kea - This is not a standard equation used to calculate rate constants from initial concentrations.

B. PV = nRT - This is the ideal gas law, which relates the pressure, volume, temperature, and number of moles of an ideal gas.

Learn more about  Concentration from given link

https://brainly.com/question/26255204

#SPJ1

A sample of hydrogen nitrite or nitrous acid, HNO2 contains 8.8 x 1022 atoms. a. How many moles of nitric acid are in the sample? b. How much mass of nitric acid are in the sample?

Answers

Answer: The formula for nitrous acid is HNO2, not nitric acid (HNO3).

a. To find the number of moles of HNO2, we need to divide the number of atoms by Avogadro's number (6.022 x 10^23 atoms per mole):

moles = 8.8 x 10^22 atoms / 6.022 x 10^23 atoms/mol

moles = 0.146 mol HNO2

b. To find the mass of HNO2, we need to multiply the number of moles by the molar mass. The molar mass of HNO2 is:

1(1.008) + 1(14.01) + 2(15.99) = 63.01 g/mol

mass = 0.146 mol x 63.01 g/mol

mass = 9.20 g HNO2

Explanation:

In studying normal and mutant forms of a particular human enzyme, a geneticist came across a very interesting mutant form of the enzyme. The normal enzyme is 227-amino acids long, but the mutant form was 312-amino acid long, having that extra 85 amino acid as the block in the middle of the normal sequence. What are possible explanations for this phenomenon? How would you distinguish among them?

Answers

Determining the underlying cause of the mutant form of the enzyme would require a combination of genetic, molecular, and biochemical techniques to identify any differences.

What is the explanation?

The mutation may have resulted from an insertion of extra DNA sequence in the gene encoding the enzyme. This could occur due to a replication error or as a result of exposure to mutagens.

To distinguish this from other possibilities, one could sequence the DNA of the normal and mutant forms of the enzyme to identify the differences.

Learn more about enzyme:https://brainly.com/question/14953274

#SPJ1

A sample of helium at 20 °C occupies a volume of 9.89 L
at a pressure of 5.79 atm.
What volume does this helium sample occupy if the pressure is reduced to 5.15 atm
while maintaining the temperature at 20 °C?

Answers

The helium sample would occupy a volume of 11.12 L if the pressure is reduced to 5.15 atm while maintaining the temperature at 20 °C.

What do Charles Law and Boyle's Law mean?

According to Boyle's Law, gas volume grows as pressure lowers. According to Charles' Law, a gas expands in volume as its temperature rises. Moreover, Avogadro's Law states that as gas concentration rises, so does its volume.

The relationship between pressure, volume, and temperature of a gas is given by the ideal gas law:

PV = nRT

where P is the pressure of the gas, V is its volume, n is the number of moles of gas present, R is the gas constant, and T is the temperature of the gas in kelvins.

Assuming that the number of moles and the temperature of the gas remain constant, we can use the ideal gas law to solve for the new volume of the gas when the pressure is reduced:

P1V1 = P2V2

where P1 is the initial pressure, V1 is the initial volume, P2 is the final pressure, and V2 is the final volume.

Substituting the given values:

P1 = 5.79 atm

V1 = 9.89 L

P2 = 5.15 atm

T = 20 + 273.15 = 293.15 K (converting Celsius to Kelvin)

We can solve for V2:

P1V1 = P2V2

(5.79 atm)(9.89 L) = (5.15 atm)V2

V2 = (5.79 atm)(9.89 L) / (5.15 atm)

V2 = 11.12 L

To know more about temperature visit:-

brainly.com/question/29072206

#SPJ1

Chemistry Help Please! It's worth a lot of points
1.Copper is commonly used to make electrical wires. How many moles of copper are in 5.00 grams of copper wire?
2.Our bodies synthesize protein from amino acids. One of these amino acids is glycine, which has a molecular formula of C2H5O2N. How many moles of glycine molecules are contained in 28.35 grams of glycine?
3. Vitamin C is a covalent compound with the formula of C6H8O6. The recommended daily dietary allowance of vitamin C for children aged 4-8 years is 1.42 x 10-4 mol.
a. What is the mass of this allowance in grams?
b. How many moles of carbon are in 1.42 x 10-4 mol of C6H8O6?

Answers

Answer:

1. To determine the number of moles of copper in 5.00 grams of copper wire, we need to use the molar mass of copper. The molar mass of copper is 63.55 g/mol. We can use the following conversion factor:

1 mol Cu = 63.55 g Cu

Using this conversion factor, we can calculate the number of moles of copper:

5.00 g Cu × (1 mol Cu / 63.55 g Cu) = 0.0787 mol Cu

Therefore, there are 0.0787 moles of copper in 5.00 grams of copper wire.

2. To determine the number of moles of glycine molecules in 28.35 grams of glycine, we need to use the molar mass of glycine. The molar mass of glycine is 75.07 g/mol. We can use the following conversion factor:

1 mol glycine = 75.07 g glycine

Using this conversion factor, we can calculate the number of moles of glycine molecules:

28.35 g glycine × (1 mol glycine / 75.07 g glycine) = 0.3778 mol glycine

Therefore, there are 0.3778 moles of glycine molecules in 28.35 grams of glycine.

3. a. To determine the mass of the daily dietary allowance of vitamin C in grams, we can use the following conversion factor:

1 mol C6H8O6 = 176.12 g C6H8O6

Using this conversion factor, we can calculate the mass of the allowance:

1.42 × 10^-4 mol C6H8O6 × (176.12 g C6H8O6 / 1 mol C6H8O6) = 0.0248 g

Therefore, the mass of the daily dietary allowance of vitamin C for children aged 4-8 years is 0.0248 grams.

b. To determine the number of moles of carbon in 1.42 × 10^-4 mol of C6H8O6, we can use the molar mass of carbon. The molar mass of carbon is 12.01 g/mol. There are 6 carbons in each molecule of C6H8O6, so we can use the following conversion factor:

6 mol C / 1 mol C6H8O6

Using this conversion factor, we can calculate the number of moles of carbon:

1.42 × 10^-4 mol C6H8O6 × (6 mol C / 1 mol C6H8O6) = 8.52 × 10^-4 mol C

Therefore, there are 8.52 × 10^-4 moles of carbon in 1.42 × 10^-4 mol of C6H8O6.

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

Magnets mess touch in order to be affected by magnetic force true or false

Answers

Answer:

False. Magnets do not need to touch in order to be affected by magnetic force. Magnetic force is a non-contact force that can act on objects that are some distance apart. The strength of the force depends on the distance between the magnets and their magnetic properties.

Help and i will give you brislied

Answers

The answer to your question is D) An invasive species is not native to the ecosystem and causes harm.

Invasive species of plants and animals typically tend to overtake an ecosystem that they do not naturally occur in. Due to this, it causes the resources within the ecosystem to diminish which ultimately harms other species that naturally occur in said ecosystem.

Perform the conversions.
958.5 mmHg=

atm

2.325 atm=

Torr

444.4 kPa=

atm

1427.2 mmHg=

Pa

Answers

Answer: To perform the conversions, we can use the following conversion factors:

1 atm = 760 mmHg

1 atm = 101.325 kPa

1 atm = 14.696 psi

1 atm = 101325 Pa

1 Torr = 1/760 atm

1 Pa = 1/101325 atm

Using these conversion factors, we can perform the conversions as follows:

958.5 mmHg = 958.5/760 atm = 1.2625 atm (rounded to 4 decimal places)

2.325 atm = 2.325 x 760 Torr = 1767 Torr (rounded to the nearest whole number)

444.4 kPa = 444.4/101.325 atm = 4.3817 atm (rounded to 4 decimal places)

1427.2 mmHg = 1427.2/760 atm = 1.8789 atm

= 1.8789 x 101325 Pa = 190694.87 Pa (rounded to 2 decimal places)

Therefore, the conversions are:

958.5 mmHg = 1.2625 atm

2.325 atm = 1767 Torr

444.4 kPa = 4.3817 atm

1427.2 mmHg = 190694.87 Pa

The conversions is given as: 958.5 mmHg=1.26 atm, 2.325 atm=1767.9 Torr, 444.4 kPa=4.381 atm and 1427.2 mmHg= 190237.2 Pa

Conversions refer to the process of changing a quantity or value from one unit of measurement to another. It involves converting the numerical value while maintaining the same physical quantity.

1 atm = 760 mmHg (Torr)

1 atm = 101.325 kPa

1 mmHg (Torr) = 133.322 Pa

Converting 958.5 mmHg to atm:

958.5 mmHg × (1 atm / 760 mmHg) = 1.26 atm

Converting 2.325 atm to Torr:

2.325 atm ×(760 mmHg / 1 atm) = 1767.9 Torr

Converting 444.4 kPa to atm:

444.4 kPa × (1 atm / 101.325 kPa) = 4.381 atm

Converting 1427.2 mmHg to Pa:

1427.2 mmHg × (133.322 Pa / 1 mmHg) = 190237.2 Pa

To know more about conversions, here:

https://brainly.com/question/33338623

#SPJ6

A 0.5998g sample of a new compound has been analyzed and found to contain the following masses of elements: carbon = 0.1.565g ; hydrogen = 0.02627g ; oxygen = 0.4170g. Calculate the empirical formula of the compound.

Answers

The empirical formula of a novel compound is CH2O if an analysis of a 0.5998g sample reveals that it contains the following masses of elements: carbon (0.1.565g), hydrogen (0.02627g), and oxygen (0.4170g).

What's in a 23.0 g sample of a substance?

You need to be aware of a compound's molar mass in order to ascertain its molecular formula. You can then decide which multiple of the empirical formula corresponds to the right molecular formula. 12.0g of carbon, 3.0g of hydrogen, and 8.0g of oxygen make up a compound in a 23.0g sample.

Which chemical has an empirical formula that is 92.3% carbon and 7.7% hydrogen?

In a hydrocarbon, carbon makes up 92.3% of the mass and hydrogen makes up 7.7%.

To know more about empirical formula visit:-

https://brainly.com/question/14044066

#SPJ1

CuCl2(aq)+Na2CO3(aq) complete and balance the precipitation reaction.

Answers

Answer: Na2CO3(aq) + CuCl2(aq) → 2 NaCl(aq) + CuCO3(s).

Explanation:

use particle diagram to present the reactant and products of a reaction between aluminium and hydrochloric acid

pls draw

Answers

During the reaction, the hydrochloric acid molecules break apart into hydrogen ions (H+) and chloride ions (Cl-), which then react with the aluminium atoms to form aluminium chloride (AlCl₃) and hydrogen gas (H₂).

Calculation-

            HCl       HCl

             |         |

            Al        Al   aluminium

             |         |

            HCl       HCl

             |         |

            H₂         Cl₂

Here's a particle diagram to represent the reaction between aluminium and hydrochloric acid.

In the diagram, the reactants (hydrochloric acid and aluminium) are shown on the left-hand side, while the products (hydrogen gas and aluminium chloride) are shown on the right-hand side. The circles represent individual particles, with the blue circles representing aluminium atoms, the green circles representing chlorine atoms from hydrochloric acid, and the white circles representing hydrogen atoms from hydrochloric acid.

to know more about aluminium and hydrochloric acid here:

brainly.com/question/31305643

#SPJ1

calculate the pressure exerted by 2 mole of CO2 gas at temperature of 27 degrees Celsius and volume of 4 liters(dm3)​

Answers

The pressure exerted by 2 moles of CO2 gas at a temperature of 27 degrees Celcius and a volume of 4 liters would be 12.27 atm.

Ideal gas problem

For an ideal gas:

PV = nRT

Where:

P is the pressureV is the volumen is the number of molesT is the temperatureR is a constant

In this case, n = 2 mole, v = 4 liters, and R = 0.08206

T = 27 + 273.15 = 300.15 K

Now we can plug in the values:

P(4) = (2)(0.08206)(300.15)

P = (2)(0.08206)(300.15) / 4

P = 12.27 atm

Therefore, the pressure exerted by 2 moles of CO2 gas at a temperature of 27 degrees Celsius and a volume of 4 liters is 12.27 atm.

More on ideal gas can be found here: https://brainly.com/question/28257995

#SPJ1

Special rules or laws to predict predominant products for alcohols and ethers in organic chemistry

Answers

As alcohols and ethers undergo various reactions, there are a number of organic chemistry rules and principles that may be utilised to anticipate the main products that will result from those reactions.

How does Markovnikov's law relate to alcoholic beverages?

Given that the water molecule can be thought of as H—OH, the Markovnikov's rule-following regioselectivity of alcohol products indicates that the hydrogen atom joins to the double bond carbon that has more hydrogen atoms, and the OH group attaches to the carbon that has fewer hydrogen atoms.

The Markovnikov rule is what?

According to Markovnikov's rule, when an asymmetrical alkene is combined with an asymmetrical reagent, the reagent's negative half will connect to the carbon atom that has the fewest hydrogen atoms.

To know more about organic chemistry visit:-

https://brainly.com/question/14623424

#SPJ1

HCI + NaOH ->>
NaCl + H₂O
What volume of sodium hydroxide (NaOH) 0.9 M would be required to titrate 250 mL of hydrochloric acid (HCI)
0.25 M?
62.5 mL NaOH
(yellow)
69.44 mL NaOH
(purple)
90 mL NaOH
(blue)

Please help!!!!

Answers

The balanced chemical equation for the reaction between hydrochloric acid (HCI) and sodium hydroxide (NaOH) is:

HCI + NaOH -> NaCl + H2O

From the equation, we can see that 1 mole of HCI reacts with 1 mole of NaOH to produce 1 mole of NaCl and 1 mole of water.

First, let's calculate the number of moles of HCI in 250 mL of 0.25 M solution:

Molarity (M) = moles of solute / volume of solution (L)

0.25 M = moles of HCI / 0.25 L

moles of HCI = 0.25 L x 0.25 M = 0.0625 moles

Since 1 mole of NaOH reacts with 1 mole of HCI, we will need 0.0625 moles of NaOH to neutralize the HCI.

Now, let's calculate the volume of 0.9 M NaOH solution needed to provide 0.0625 moles of NaOH:

Molarity (M) = moles of solute / volume of solution (L)

0.9 M = 0.0625 moles of NaOH / volume of NaOH solution (L)

volume of NaOH solution (L) = 0.0625 moles / 0.9 M = 0.0694 L = 69.44 mL

Therefore, 69.44 mL of 0.9 M NaOH solution would be required to titrate 250 mL of 0.25 M HCI solution.

a 0.1 m acid solution at 298 k would conduct electricity best of the acid had ka value of

Answers

As the conductivity of a 0.1 M acid solution at 298 K depends on the acid's strength, a specific Ka value cannot be determined.

How can you figure out the acid's ka value, which would allow it to conduct electricity most effectively?

We may utilize the following relationship between Ka and the level of ionization to estimate the Ka value that would produce the maximum conductivity for a 0.1 M acid solution at 298 K:

α²/(1-α) = Ka/[H+]

α²/(1-α) = Ka/0.1

1²/(1-1) = Ka/0.1\sKa = 0

Given that only strong acids completely breakdown into ions in solution, it follows that the acid would need to be strong with a Ka value significantly greater than zero in order to conduct electricity most effectively.

To learn more about conductivity of acid visit:

brainly.com/question/28721140

#SPJ1

Consider the following equilibrium reaction having gaseous reactants and products which of the following would result from increasing only the concentration of hydrochloric acid

Answers

Answer:the concetraion of chrolune decrease

Explanation:because the chrolune not stable

9: Archer used a balloon that contained 1.505 x 10-23 of Helium particles. Calculate the volume of the gas at 273 k and at 1 atm?​

Answers

At 273 K and 1 atm, the helium gas's volume is [tex]4.33 * 10^{-23} L[/tex] .

The volume of a gas can be calculated using the Ideal Gas Law, which states that PV = nRT,

where V is the gas's volume, n is its moles in existence, R is the ideal gas constant (8.314 J/mol K), T is the gas's temperature in Kelvin, and P is the gas's atmospheric pressure.

Given that the number of moles of the gas is 1.505 x 10-23 and the temperature is 273 K (0°C), we can rearrange the equation to solve for V:

[tex]V = \frac{nRT}{P}\\[/tex]

[tex]V = \frac{(1.505 * 10^{-23})(8.314 J/mol-K)(273 K)}{(1 atm)}[/tex]

[tex]V = 4.33 * 10^{-23} L[/tex]

Therefore, the volume of the helium gas at 273 K and 1 atm is [tex]4.33 * 10^{-23} L[/tex]

learn more about  helium gas Refer:brainly.com/question/13645498

#SPJ1

Which is NOT a compound?
A. silicon dioxide
B. water
C. carbon dioxide gas
D. oxygen gas

Answers

Answer: Oxygen

Explanation: Its found on the periodic table as an element.

Calculate the PH of the solution in the Image

Answers

The solution has a pH of around 5.93.

Why is the buffer system of CH3COOH and CH3COONa used?

When a weak acid or a weak base is applied in modest amounts, buffer solutions withstand the pH shift. A buffer made of a weak acid and its salt is an example of which is an acetic acid and sodium acetate solution (CH3COOH + CH3COONa).

The weak acid is then partially dissociated in water, resulting in the conjugate base and hydrogen ions:

CH3COOH + H2O ⇌ H3O+ + CH3COO-

The acid dissociation constant, Ka, which is what this reaction's equilibrium constant is, is as follows:

Ka = [H3O+][CH3COO-]/[CH3COOH]

The Henderson-Hasselbalch equation may be used to determine the pH of a solution:

pH = pKa + log([A-]/[HA])

To begin with, we must figure out how much CH3COOH is present in the solution:

moles of CH3COOH = M x V = 0.15 mol/L x 0.050 L = 0.0075 mol

mass of CH3COOH = moles x molar mass = 0.0075 mol x 60.05 g/mol = 0.450 g

After adding sodium acetate, the solution's residual CH3COOH will be:

0.450 g - 1.00 g

= -0.55 g

The amount of sodium acetate supplied may be used to determine the CH3COO- concentration:

moles of CH3COO-=1.00g/82.03 g/mol

=0.0122 mol

The concentration of CH3COO- in the solution will be:

0.0122 mol/0.050 L=0.244 M

The Henderson-Hasselbalch equation may now be used to determine the pH of the solution:

pH = pKa + log([A-]/[HA])

pKa = -log(Ka) = -log(1.75 x 10⁻⁵) = 4.756

[A-]/[HA] = [CH3COO-]/[CH3COOH]

= 0.244 M / 0.0075 M = 32.53

pH = 4.756 + log(32.53)

= 5.93

To know more about solution visit:-

https://brainly.com/question/22695394

#SPJ1

Question 6 of 10
Which prefix indicates a molecule with 7 carbon atoms?
OA. Non-
OB. Dec-
C. Hept-
OD. Eth-

Answers

Answer:

Hept

Explanation:

Non- 9 C9

Dec- 10 C10

Eth- 2 C2

Hepth- 7 C7

So the answer is D, because it idicates a molecule with 7 carbon atoms.

Hopefully this helps! :)

What are some ways you can increase the percent yield of this reaction?

Answers

If the reaction's measured product has impurities that increase its mass over what it would be if it were pure, higher percent yields than 100% are attainable.

What influences the increase or decrease in % yield?

Because the real yield is frequently lower than the theoretical value, percent yield is typically lower than 100%. This may be due to incomplete or conflicting reactions or sample loss during recovery.

What does an increase in yield mean?

It implies that interest rates will increase further, yields will increase, and bond prices would decline as a result. So, it is likely that the bond market will continue to see unusually high levels of volatility in the near future.

To know more about percent yields visit:-

brainly.com/question/12704041

#SPJ1

Is a mole to mole ratio needed? Yes or no
If the answer is yes what is it?

Answers

We need to use the mole ratio and in this case the mole ratio of the MgCl2 to the chloride ions is 1:2

What is the mole ratio?

In chemistry, a mole ratio is the ratio of the amounts, in moles, of any two compounds or elements involved in a chemical reaction. It is determined by the coefficients of the balanced chemical equation for the reaction.

Mole ratios can be used in stoichiometric calculations to determine the amount of one substance that is required to react with a given amount of another substance, or to calculate the amount of product that will be formed from a given amount of reactant.

Learn more about mole ratio:https://brainly.com/question/15288923

#SPJ1

Martha has a large amount of 1.25 M H₂SO4 in her lab. She needs 36 grams of H₂SO4
for a chemical reaction she wants to perform. How many liters of the solution should she use?
Show work to receive credit.

Answers

Martha needs to use 0.294 liters or 294 milliliters of the 1.25 M H₂SO4 solution to obtain 36 grams of H₂SO4.

What is Chemical Reaction?

In a chemical reaction, the atoms and molecules of the reactants are rearranged to form new compounds or products. Chemical reactions involve the breaking and forming of chemical bonds between atoms and molecules, which involves the absorption or release of energy.

We can use the formula:

to find the volume of the 1.25 M H₂SO4 solution that contains 36 grams of H₂SO4.

First, we need to calculate the number of moles of H₂SO4 in 36 grams:

molar mass of H₂SO4 = 2 x atomic mass of H + atomic mass of S + 4 x atomic mass of O

= 2 x 1.008 + 32.06 + 4 x 16.00

= 98.08 g/mol

moles of H₂SO4 = mass / molar mass

= 36 g / 98.08 g/mol

= 0.3675 mol

Now we can use the formula above to solve for the volume of the solution:

1.25 M = 0.3675 mol / volume (in liters)

volume (in liters) = 0.3675 mol / 1.25 M

= 0.294 L

= 294 mL

Learn more about  Chemical Reaction from given link

https://brainly.com/question/25769000

#SPJ1

Macmillan Learning
Calculate the standard change in Gibbs free energy for the reaction at 25 °C. Standard Gibbs free energy of formation values can
be found in this table.
Fe₂O3(s) + 2Al(s)
AG=

Bi
B
1
Al₂O₂ (s) + 2 Fe(s)
45°F Cloudy
kJ/mol
4 ENG
9:05 PM
3/23/2003
48
4
+
B
*

Answers

The standard change in Gibbs free energy for the reaction at 25 °C is 278.0 kJ/mol  for the given enthalpy of reaction .

What is Gibbs free energy ?

The Gibbs free energy (or Gibbs energy as the preferred name; symbol G) is a thermodynamic potential that can be used to calculate the maximum amount of non-volume expansion work that a thermodynamically closed system can perform at constant temperature and pressure. It also serves as a prerequisite for processes like chemical reactions that may place under these conditions. The Gibbs free energy is denoted by the symbol G(p,T) = U+pV-TS = H-TS, where p denotes pressure, T denotes temperature, U denotes internal energy, V denotes volume, H denotes enthalpy, and S denotes entropy.

What is enthalpy of reaction ?

A thermodynamic quantity equal to a system's entire heat content. It is equivalent to the system's internal energy plus the product of pressure and volume.

According to the table, the standard Gibbs free energy of formation values are;

Fe₂O₃ (s) = -822.1 kJ/mol

Al₂O₃ (s) = -1675.2 kJ/mol

Al (s) = -1477.7 kJ/mol

Fe (s) = 0 kJ/mol

The reaction is:

Fe₂O₃ (s) + 2 Al (s) → Al₂O₃ (s) + 2 Fe (s).

Therefore, the standard change in Gibbs free energy for the reaction at 25 °C is:

AG = -822.1 kJ/mol + (2 x -1477.7 kJ/mol) - (-1675.2 kJ/mol) - (2 x 0 kJ/mol) = 278.0 kJ/mol

To know more about Gibbs free energy ,visit ;

https://brainly.com/question/20358734

#SPJ1

What is the empirical formula for a compound containing 37.5% carbon, 12.6% hydrogen, and 49.9% oxygen? A. CH₂O B. C₂HO5 C. C₂H₁203 D. C₂H₂O₂​

Answers

The empirical formula for the compound containing 37.5% carbon, 12.6% hydrogen, and 49.9% oxygen is CH₄O

How do i determine the empirical formula?

The following data were obtained from the question:

Carbon (C) = 37.5%Hydrogen (H) = 12.6%Oxygen (O) = 49.9%Empirical formula =?

From the above data, we can obtain the empirical formula for the compound as shown below:

Divide by their molar mass

C = 37.5 / 12 = 3.125

H = 12.6 / 1 = 12.6

O = 49.9 / 16 = 3.119

Divide by the smallest

C = 3.125 / 3.119 = 1

H = 12.6 / 3.119 = 4

O = 3.119 / 3.119 = 1

Thus, we can conclude that the empirical formula is CH₄O

Learn more about empirical formula:

https://brainly.com/question/29153210

#SPJ1

If 24.00 grams of aluminum react with 30.00 grams of chlorine, how much aluminum chloride will be produced?
18.80 g
37.61 g
118.6 g
42.63 g

Answers

34.5777 grams of sugar

If two forces are going in opposite directions, find the net force by (A. multiply), (B. subtract), (C. add), (D. divide) the forces.

Answers

The answer is B. If both forces are pulling on eachother then you have to subtract to find the difference. In a problem where it’s not multiple choice it would look like this. 3N (newtons) left and 4N right. So the difference would be 1N—> (right and left are shown with arrows)

Answer:

B subtract

Explanation:

they are pulling away from one another so a and c are out of the question then that leaves you with b or d but we're not dividing anything. soooo we're left with B.

The lethal dose of aspirin is 50 mg per kg of body weight. How many 325 mg tablets would be deadly for a 60 lb child?

Answers

To determine the number of 325 mg tablets of aspirin that would be deadly for a 60 lb child, we first need to convert the weight to kg.

1 lb is equal to 0.453592 kg. Therefore, a 60 lb child weighs approximately 27.2155 kg (60 x 0.453592).

The lethal dose of aspirin is 50 mg per kg of body weight. Therefore, for a 27.2155 kg child, the lethal dose would be 1,360.775 mg (27.2155 x 50).

Each aspirin tablet is 325 mg. Therefore, the number of tablets that would be deadly for the child would be 4.19 (1,360.775 / 325).

However, it is important to note that even a slightly higher dose of aspirin can be harmful to a child, and it is never recommended to give aspirin to children without consulting a doctor first.

To know more about aspirin, visit :

https://brainly.com/question/29133232

#SPJ1

2K(s) + 2H₂O(l) → 2KOH(aq) + H₂(g) in word form

Answers

Two solid potassium (K) combine with two liquid water (H2O) molecules to generate two aqueous potassium hydroxide (KOH) and one gaseous hydrogen (H2) molecule. For this reaction, the chemical equation is balanced as follows:

2K(s) + 2H2O(l) → 2KOH(aq) + H2(g)

Steps

The chemical reaction between potassium and water is depicted in this equation. Two liquid water (H2O) molecules and two solid potassium (K) atoms serve as the reactants.

The reaction moves from the left to the right, as shown by the arrow sign, which also denotes its direction.

In the reaction, hydrogen gas and potassium hydroxide are created when potassium atoms interact with water molecules.

Two molecules of aqueous potassium hydroxide (KOH) and one molecule of gaseous hydrogen (H2) are the reaction's end products.

According to the correctly balanced chemical equation, two potassium atoms and two water molecules combine to form two molecules of potassium hydroxide and one hydrogen gas molecule.

learn more about potassium hydroxide here

https://brainly.com/question/28330489

#SPJ1

2. What happens when heat is removed from a substance at a critical temperature?
O A. The substance releases heat but won't change temperature until the state changes completely.
B. The temperature of the substance will change rapidly as heat is lost until the state changes completely.
C. The heat is cycled back into the substance, causing the temperature to increase.
D. The substance changes temperature at the same rate before, during, and after the change of state.

Answers

B. The temperature of the substance will change rapidly as heat is lost until the state changes completely.
Other Questions
1. Briefly explain with specific examples of your choice arguments of the idea that agricultural projects are transversal function and cannot be executed successfully without the collaboration amongst a variety of social partners. hii.am tejaswhat is the viscosity animals can move as a result of what energy conversion? Edit this autobiographical narrative to give me full marks but make sure it is in between 700 - 750 words:With enthusiasm coursing through my veins, a water bottle, and sliced apples, I prepared myself for my first kindergarten excursion. I gave my mother a final wave as I joined the rest of my class, mounted with anticipation. I spent most of the 30-minute journey glued to the window, watching the landscape as it scrolled past. The desolate terrain outside was peppered with grey, gnarled bushes, their wiry branches reaching out like spindly fingers. What type of farm environment is this? There is no grass for the cows and the chicks. I mumbled to myself, perplexed if this trip would be worth it.As the bus turned, the farm conversely came into view and a chorus of excited yelps filled the bus. The entrance was marked by a tattered oak sign reading BRIDGES FARM'', beckoning us with its rustic charm. Stepping out of the bus, the air was palpably crisper, with the sweet fragrance of ripe berries infusing my senses with its delightful sweetness.To begin our trip, we were allowed to grab a handful of succulent strawberries to feed to the chickens. But as any group of roguish mischievous kindergarteners might, we sneakily gobbled away at a few of the fruits before setting our bags down at the entrance hall and proceeding towards our first destination: the chicken coop.It was there that they introduced us to our sociable farmer, who regaled us with intriguing facts about the feathered creatures.Chickens are some of the most fascinating creatures. For example, how many of you like dinosaurs? Well, did you know chickens are one of the closest he exclaimed, his voice competing with the raucous cacophony of frenzied clucking that echoed from the henhouse.I shuffled closer to the chickens and perched down to get a better view. Its fluffy, buttery-yellow plumage seems softer than the gentlest of clouds. However, before I could reach through the fence to caress it, I realised the farmers voice had grown quite faint.He had been interrupted by the mischievous antics of one young boy who had boldly reached into the coop to pilfer an egg. Swiftly intervening, the farmer admonished the child and discussed with him the importance of an egg to the mother. He then redirected our attention to the next location: the pig's pen. As we walked closer to the pen, I realised I was much too short to see any of the pigs. I lifted myself onto my tiptoes, yearning for a vantage point to catch a glimpse of the muddy swine that lay beyond the fence. Unfortunately, I soon realised that I had inadvertently stumbled upon a filthy mass of flesh hovering directly over my head. In response to this incident, my whole class erupted in laughter. Oblivious to the source of their amusement, I attempted to chuckle along with them, only to discover later that I was the butt of the joke.Upon looking up, I was confronted with the jowl of a rather large hog. Its chin was mere centimetres from my face. As I craned my neck upwards, I was drenched in a slimy trail of saliva that trickled down onto my nose, rendering me motionless with revulsion. To my dismay, it became evident that this particular pig was more interested in my hat than the generous amount of corn kernels in its trough. I attempted to back away. A symphony of lip-smacking, snorting, and gobbles filled my ears as the pig persisted, only releasing me a little as it encountered a tough patch of fabric. Its rubbery snout sniffed at my hat string before chewing on it. I was now face to face with the beastly creature. All I saw were shades of brown and glossy pink as well as small strings of navy fabric that coated its lips because at this point my eyes were swelling with tears. It tugged me closer, causing me to cling onto the fence with all my might in a futile attempt to pull myself away.My efforts were ultimately successful, but only because the pig had forcefully pushed me back, successfully devouring my entire hat. All that was left was the remains of the iron-on school logo patch, which lay neatly on my fringe, coated in pig slobber and fragments of dried mud. I sulked, my face was burning with embarrassment and I had no hat to hide it Characterize the popular literature written by Chicanos prior to 1965 Can someone answer this in a paragraph Which option is an example of a renewable resource?A. Heat and energy made from burning coalB. Fuel created by pulling petroleum from the groundOC. Power from a hydroelectric dam on a riverD. Nuclear power formed by pulling energy from atoms Rank the structures in order of decreasing electrophilic strength. Most electrophilic CI *NH2 Least electrophilic Answer Bank Find the indicated measure in parallelogram ABCD. State which theorem you used. If the taking turns procedure takes place on this distribution of goods, who would walk away with each pile? Person A chooses first. Pile 1 Pile 2 Pile 3 Pile 4 Pile 5 Pile 1 will go to(No answer given) Pile 2 will go to(No answer given) Pile 3 will go to (No answer given)Pile 4 will go to (No answer given) + Person A views,21% 13% 22% 18% 26% Person B views 24% 17% 14% 22% 23%In this situation, did each person get their fair share? (No answer given) when kellogg's dropped olympic swimmer michael phelps as a celebrity endorser, its decision was based on Functionalist theory focuses on the influence of individuals on the larger society.false true Brian multiplies 1.098 by powers of 10.1.098 101 = 10.981.098 102 = 109.81.098 103 = 1,0981.098 104 = 10,980By what power of 10 would Brian multiply 1.098 to get a product of 1,098,000? . A major reason for the continuous warfare between the Plains Indians andthe settlers was that the Indians (a) wanted the horses of the settlers (b)resented the destruction of the buffalo herds by the settlers (c) wanted theguns and powder of the fur traders (d) were determined to save theirextensive farmlands.1:feb Which of the following is a potential drawback to using the Internet to vote in elections?A. Computers are inefficient at counting results, prolonging election timesB. Young people with more computer knowledge may vote more regularlyC. It can make it difficult for lower-income voters without a computerD. Internet voting is untested, and any side-effects are unknown what value of will result in no power being dissipated by the resistor, ? the end products of the citric acid cycle include all of the following except In contrast to his (Mozarts) Symphony Number 39, his 40th symphony is not very good. True or False. the cryptococcal antigen test used to diagnose cryptococcus neoformans meningitis is based on what type of rapid methodology if the tax were removed, pizza eaters and sellers would be better off, but the government would lose tax revenue. suppose that consumers and producers voluntarily transferred some of their gains to the government. could all parties (including the government) be better off than they were with a tax? explain using the labeled areas in your graph.