Find the radius and interval of convergence for each of the following series:
∑n=0[infinity]xnn!
∑n=1[infinity](−1)n+1xnn
∑n=0[infinity]2n(x−3)n
∑n=0[infinity]n!xn

Answers

Answer 1

The radius and interval of convergence for each of the following series:

∑n=0[infinity]xnn! the radius of convergence is 1, and the interval of convergence is (-1, 1).∑n=1[infinity](−1)n+1xnn the radius of convergence is 1, and the interval of convergence is (-1, 1).∑n=0[infinity]2n(x−3)n  the radius of convergence is 1/2, and the interval of convergence is (3 - 1/2, 3 + 1/2), which simplifies to (5/2, 7/2).∑n=0[infinity]n!xn the radius of convergence is 1, and the interval of convergence is (-1, 1).

To find the radius and interval of convergence for each series, we can use the ratio test. Let's analyze each series one by one:

1. Series: ∑(n=0 to infinity) x^n / n!

Ratio Test:

We apply the ratio test by taking the limit as n approaches infinity of the absolute value of the ratio of the (n+1)-th term to the n-th term:

lim(n→∞) |(x^(n+1) / (n+1)!) / (x^n / n!)|

Simplifying and canceling common terms, we get:

lim(n→∞) |x / (n+1)|

The series converges if the limit is less than 1. So we have:

|x / (n+1)| < 1

Taking the absolute value of x, we get:

|x| / (n+1) < 1

|x| < n+1

For the series to converge, the right side of the inequality should be bounded. Hence, we have:

n+1 > 0

n > -1

Therefore, the series converges for all x such that |x| < 1.

Hence, the radius of convergence is 1, and the interval of convergence is (-1, 1).

2. Series: ∑(n=1 to infinity) (-1)^(n+1) * x^n / n

Ratio Test:

We apply the ratio test:

lim(n→∞) |((-1)^(n+2) * x^(n+1) / (n+1)) / ((-1)^(n+1) * x^n / n)|

Simplifying and canceling common terms, we get:

lim(n→∞) |-x / (n+1)|

The series converges if the limit is less than 1. So we have:

|-x / (n+1)| < 1

|x| / (n+1) < 1

|x| < n+1

Again, for the series to converge, the right side of the inequality should be bounded. Hence, we have:

n+1 > 0

n > -1

Therefore, the series converges for all x such that |x| < 1.

Hence, the radius of convergence is 1, and the interval of convergence is (-1, 1).

3. Series: ∑(n=0 to infinity) 2^n * (x-3)^n

Ratio Test:

We apply the ratio test:

lim(n→∞) |2^(n+1) * (x-3)^(n+1) / (2^n * (x-3)^n)|

Simplifying and canceling common terms, we get:

lim(n→∞) |2(x-3)|

The series converges if the limit is less than 1. So we have:

|2(x-3)| < 1

2|x-3| < 1

|x-3| < 1/2

Therefore, the series converges for all x such that |x-3| < 1/2.

Hence, the radius of convergence is 1/2, and the interval of convergence is (3 - 1/2, 3 + 1/2), which simplifies to (5/2, 7/2).

4. Series: ∑(n=0 to infinity) n! * x^n

Ratio Test:

We apply the ratio test:

lim(n→∞) |((n+1)! * x^(n+1)) / (n! * x^n)|

Simplifying and canceling common terms, we get:

lim(n→∞) |(n+1) * x|

The series converges if the limit is less than 1. So we have:

|(n+1) * x| < 1

|x| < 1 / (n+1)

For the series to converge, the right side of the inequality should be bounded. Hence, we have:

n+1 > 0

n > -1

Therefore, the series converges for all x such that |x| < 1.

Hence, the radius of convergence is 1, and the interval of convergence is (-1, 1).

Learn more about the radius of convergence here:

brainly.com/question/2289050

#SPJ11


Related Questions

with explanation pls
b) Find relative max/min / saddle point for the function * = cos x + sin y. -*/2

Answers

The function has relative maxima at (π/2 + 2πn, π/2 + 2πm), relative minima at (-π/2 + 2πn, -π/2 + 2πm), and saddle points at (π/2 + 2πn, -π/2 + 2πm) and (-π/2 + 2πn, π/2 + 2πm), where n and m are integers.

To find the relative extrema and saddle points for the function f(x, y) = cos(x) + sin(y), we need to calculate the partial derivatives with respect to x and y and set them equal to zero.

Taking the partial derivative with respect to x, we have:

∂f/∂x = -sin(x)

Setting ∂f/∂x = 0, we find that sin(x) = 0, which occurs when x = π/2 + 2πn, where n is an integer. These values represent the critical points for potential extrema.

Next, taking the partial derivative with respect to y, we have:

∂f/∂y = cos(y)

Setting ∂f/∂y = 0, we find that cos(y) = 0, which occurs when y = π/2 + 2πm, where m is an integer. These values also represent critical points.

To determine the type of critical point, we use the second partial derivative test. Computing the second partial derivatives, we have:

∂²f/∂x² = -cos(x)

∂²f/∂y² = -sin(y)

∂²f/∂x∂y = 0

Evaluating these second partial derivatives at the critical points, we can analyze the sign of the determinants:

For the critical points (π/2 + 2πn, π/2 + 2πm), where n and m are integers, the determinant is positive, indicating a relative maximum.

For the critical points (-π/2 + 2πn, -π/2 + 2πm), where n and m are integers, the determinant is negative, indicating a relative minimum.

For the critical points (π/2 + 2πn, -π/2 + 2πm) and (-π/2 + 2πn, π/2 + 2πm), where n and m are integers, the determinant is zero, indicating a saddle point.

learn more about Relative maxima here:

https://brainly.com/question/30460726

#SPJ11

n Exercises 5-8, a function z=f(x,y), a vector and a point are given. Give the parametric equations of the following directional tangent lines to fat P: (a) lx(t) (b) ly(t) (c) lu(t), where ū is the unit vector in the direction of v. 6. f(x,y) = 3 cos x sin y, v = (1,2), P= (1/3,7/6).

Answers

The parametric equations of the directional tangent lines to the function f(x, y) = 3cos(x)sin(y) at the point P = (1/3, 7/6) in the directions specified by vector v = (1, 2) can be expressed as lx(t) = 1/3 + t, ly(t) = 7/6 + 2t, and lu(t) = (1/√5)t + (2/√5)t, where t is a parameter.

To find the parametric equations of the directional tangent lines at point P, we need to consider the partial derivatives of f(x, y) with respect to x and y.

The partial derivative with respect to x is ∂f/∂x = -3sin(x)sin(y), and the partial derivative with respect to y is ∂f/∂y = 3cos(x)cos(y).

Evaluating these derivatives at the point P = (1/3, 7/6), we have ∂f/∂x(P) = -3sin(1/3)sin(7/6) and ∂f/∂y(P) = 3cos(1/3)cos(7/6).

Next, we calculate the direction vector ū by normalizing the given vector v = (1, 2): ū = v/|v| = (1/√5, 2/√5).

Finally, we can express the parametric equations of the tangent lines as follows:

(a) lx(t) = x-coordinate of P + t = 1/3 + t

(b) ly(t) = y-coordinate of P + 2t = 7/6 + 2t

(c) lu(t) = x-coordinate of P + (1/√5)t + y-coordinate of P + (2/√5)t = (1/3 + (1/√5)t) + (7/6 + (2/√5)t)

In summary, the parametric equations of the directional tangent lines at point P for the function f(x, y) = 3cos(x)sin(y), in the directions specified by vector v = (1, 2), are lx(t) = 1/3 + t, ly(t) = 7/6 + 2t, and lu(t) = (1/3 + (1/√5)t) + (7/6 + (2/√5)t), where t is a parameter.

Learn more about parametric equations:

https://brainly.com/question/29275326

#SPJ11

6. Use Theorem 5.10 < (Section 5.3 in Vol. 2 of OpenStax Calculus) for this problem. 1 How many terms of the series would you need to add to n=2 n=2 n(In n)3 find the value of the series with an error

Answers

Estimating the Error in a Taylor Polynomial is used to estimate the error in a Taylor polynomial for a function. It helps us find an interval in which the approximation differs from the actual function value. Here's how we can use Theorem 5.10 for the given problem:

We want to find the value of the series with an error less than 0.001, where n ≥ 2, and n(In n)³.Using Theorem 5.10, the error of the series can be written as: Rn(x) ≤ | f(n+1) (c) / (n+1)! | * |x - a|ⁿ⁺¹where Rn(x) represents the error term and c is any value between x and a.

Let's first find the value of the first few derivatives of the given function: n 1 2 3 4 f(n)(x) In x 1/x -1/x² 2/x³(-1)•3! / x⁴.

Simplifying the above expression, we get:f(n+1) (x) = 6 / x⁵, Taking c = 2, we get:Rn(x) ≤ | f(n+1) (c) / (n+1)! | * |x - a|ⁿ⁺¹≤ |6/(n+1)!| * |x-2|ⁿ⁺¹.

We need to find the value of n for which the above error term is less than 0.001.

That is,|6/(n+1)!| * |x-2|ⁿ⁺¹ < 0.001.

Substituting x = 2 and 0.001 for the above expression, we get:|6/(n+1)!| * (0.001)ⁿ⁺¹ < 0.001. This simplifies to:|6/(n+1)!| < 1.

Therefore, we need to find the value of n for which |6/(n+1)!| is less than 1.

We can do this by checking for different values of n. We get: When n = 2, |6/(n+1)!| = |6/6| = 1, When n = 3, |6/(n+1)!| = |6/24| = 0.25, When n = 4, |6/(n+1)!| = |6/120| = 0.05, When n = 5, |6/(n+1)!| = |6/720| < 0.01.

Hence, we need to add 5 terms of the series to n = 2 to find the value of the series with an error less than 0.001.

Learn more about Taylor Polynomial  here ;

https://brainly.com/question/32073784

#SPJ11

Compute the volume of the solid formed by revolving the region bounded by y = 13 – x, y = 0 and x = 0 about the r-axis. V =

Answers

Answer:

The volume of the solid formed by revolving the region bounded by y = 13 - x, y = 0, and x = 0 about the r-axis is (2197/3)π cubic units.

Step-by-step explanation:

To compute the volume of the solid formed by revolving the region bounded by the curves y = 13 - x, y = 0, and x = 0 about the r-axis, we can use the method of cylindrical shells.

The region bounded by the curves y = 13 - x, y = 0, and x = 0 forms a right triangle in the first quadrant. Let's denote the base of the triangle as b, which is the length of the line segment between the y-axis and the point where the two curves intersect.

To find the value of b, we can set the equations y = 13 - x and y = 0 equal to each other:

13 - x = 0

Solving for x, we get x = 13.

Therefore, the base of the triangle is b = 13.

To compute the volume using cylindrical shells, we integrate the product of the circumference of each shell and the height of the shell over the range of x = 0 to x = 13.

The circumference of each shell is given by 2πr, where r is the distance from the r-axis to the corresponding x-value.

The height of each shell is given by the difference between the upper curve (y = 13 - x) and the lower curve (y = 0) at the corresponding x-value.

Setting up the integral, we have:

V = ∫[0, 13] 2πr (13 - x) dx

To evaluate this integral, we integrate with respect to x from 0 to 13:

V = 2π ∫[0, 13] r (13 - x) dx

V = 2π ∫[0, 13] (13r - rx) dx

Now, we need to determine the value of r. Since we are revolving the region about the r-axis, the value of r is simply the x-value at each point.

V = 2π ∫[0, 13] (13x - x^2) dx

Evaluating this integral will give us the volume of the solid.

V = 2π ∫[0, 13] (13x - x^2) dx

= 2π [(13/2)x^2 - (1/3)x^3] |[0, 13]

Now, we substitute the upper limit of integration (x = 13) and the lower limit of integration (x = 0) into the expression:

V = 2π [(13/2)(13)^2 - (1/3)(13)^3] - 2π [(13/2)(0)^2 - (1/3)(0)^3]

= 2π [(13/2)(169) - (1/3)(2197)] - 2π (0 - 0)

= 2π [2197/2 - 2197/3]

= 2π [(21973 - 21972)/(2*3)]

= 2π (2197/6)

= (2197/3)π

Therefore, the volume of the solid formed by revolving the region bounded by y = 13 - x, y = 0, and x = 0 about the r-axis is (2197/3)π cubic units.

Learn more about cylinder:https://brainly.com/question/9554871

#SPJ11

Maximize Profit Please review the attached note before solving the problem. A store sells 2000 action figures a month at a price of $15 each. After conducting market research, the company believes that sales will increase by 200 for each $0.20 decrease in price. a) Determine the demand function d(x). (To avoid confusion let's call our demand function d(x) instead of p(x)). b) If the cost function of producing x action figures is 2 C(x) 0.004x 10. 125 x + 5000 Determine the profit function P(x). c) How many action figures should the company set as a sales target each month in order to maximize profit? d) At what sale price could the company expect to sell the action figures for maximum profit (from c)?

Answers

By determining the demand function, calculating the profit function, and finding the optimal sales target and sale price that maximize the profit function.

How can the company maximize profit by adjusting the sales target and sale price?

a) To determine the demand function d(x), we can use the information provided. Since the sales increase by 200 for each $0.20 decrease in price, we can express the demand as d(x) = 2000 + (x - 15) ˣ 1000, where x is the price in dollars.

b) The profit function P(x) can be calculated by subtracting the cost function C(x) from the revenue function. The revenue function is given by R(x) = x ˣ d(x), where x is the price and d(x) is the demand function. Therefore, P(x) = R(x) - C(x).

c) To maximize profit, the company should determine the sales target that corresponds to the value of x that maximizes the profit function P(x).

d) The sale price for maximum profit can be determined by finding the value of x that maximizes the profit function P(x) obtained in part b.

Learn more about sales target

brainly.com/question/28146098

#SPJ11

Given: (x is number of items) Demand function: d(x) = 200 - 0.50 Supply function: 8(x) = 0.3x Find the equilibrium quantity: Find the producers surplus at the equilibrium quantity:

Answers

The equilibrium quantity is 250 items, but we cannot calculate the producer's surplus without additional information.

To find the equilibrium quantity, we need to set the demand function equal to the supply function and solve for x.

Demand function: d(x) = 200 - 0.50x

Supply function: 8(x) = 0.3x

Setting them equal, we have:

200 - 0.50x = 0.3x

Combining like terms, we get:

200 = 0.8x

Dividing both sides by 0.8, we find:

x = 250

Therefore, the equilibrium quantity is 250 items. At this quantity, the quantity demanded equals the quantity supplied, resulting in a balance between buyers and sellers in the market. To calculate the producer's surplus at the equilibrium quantity, we need to find the area between the supply curve and the market price. In this case, the market price is determined by the equilibrium quantity.

Learn more about demand function here:

https://brainly.com/question/28198225

#SPJ11

Increasing the sample size when calculating a confidence interval while keeping the confidence level constant will
A) reduce the margin of error resulting in a wider (less precise) confidence interval. C) increase the margin of error resulting in a wider (more precise) confidence interval.
B) increase the margin of error resulting in a narrower (more precise) confidence interval. D) reduce the margin of error resulting in a narrower (more precise) confidence interval.

Answers

When calculating a confidence interval, increasing the sample size while keeping the confidence level constant will result in a narrower (more precise) confidence interval. The correct option is D.

A confidence interval is a range of values that estimates the true value of a population parameter with a certain level of confidence. The margin of error is a measure of the uncertainty associated with the estimate.

When the sample size increases, there is more data available to estimate the population parameter, leading to a more precise estimate. With a larger sample size, the variability in the data is reduced, resulting in a smaller margin of error. As a result, the confidence interval becomes narrower, indicating a more precise estimate of the population parameter.

Therefore, increasing the sample size while keeping the confidence level constant reduces the margin of error and leads to a narrower (more precise) confidence interval, as stated in option D.

Learn more about confidence interval here:

https://brainly.com/question/32278466

#SPJ11

Find the area of the triangle determined by the points P, Q, and R. Find a unit vector perpendicular to plane PQR P(2,-2,-1), Q(-1,0,-2), R(0,-1,2) CHEE The area of the triangle is (Type an exact answ

Answers

The unit vector perpendicular to the plane PQR is approximately (0.140, -0.979, 0.140).

To find the area of the triangle determined by points P, Q, and R, we can use the cross product of two vectors formed by the given points.

Let's first calculate the vectors PQ and PR:

PQ = Q - P = (-1, 0, -2) - (2, -2, -1) = (-1 - 2, 0 - (-2), -2 - (-1)) = (-3, 2, -1)

PR = R - P = (0, -1, 2) - (2, -2, -1) = (0 - 2, -1 - (-2), 2 - (-1)) = (-2, 1, 3)

Now, we can calculate the cross product of PQ and PR:

N = PQ x PR = (-3, 2, -1) x (-2, 1, 3)

To find the cross product, we can use the determinant method:

N = (2*(-1) - 13, -33 - (-1)*(-2), (-3)1 - 2(-2))

Simplifying:

N = (-2 + 3, -9 + 2, -3 + 4) = (1, -7, 1)

The magnitude of vector N represents the area of the parallelogram formed by vectors PQ and PR. Since we want the area of the triangle, we divide this magnitude by 2:

Area = |N|/2 = √(1²+ (-7)² + 1²)/2 = √(51)/2

Therefore, the area of the triangle determined by points P, Q, and R is √(51)/2=305707.

To find a unit vector perpendicular to the plane PQR, we can normalize vector N. The normalized vector, denoted as U, is obtained by dividing each component of N by its magnitude:

U = N/|N| = (1/√(51), -7/√(51), 1/√(51))

Hence, the unit vector perpendicular to the plane PQR is approximately (0.140, -0.979, 0.140).

To learn more about unit vector visit:

brainly.com/question/30364880

#SPJ11

Which of the following are true when solving a decision tree? O The value of a decision node is computed by taking the weighted average of the successor nodes' values. The decision tree represents a time ordered sequence of decisions and events from left to right. The values of the terminal nodes are weighted averages. O Exactly two of the answers are correct. O The EMV of an event node is computed by taking the weighted average of the predecessor nodes' values.

Answers

The statement "The values of the terminal nodes are weighted averages" is true when solving a decision tree.

When solving a decision tree, the values of the terminal nodes represent the payoffs or outcomes associated with different scenarios. These values are typically assigned based on probabilities or estimates and represent the expected values of those scenarios. Therefore, the statement "The values of the terminal nodes are weighted averages" is true.

On the other hand, the other statements in the given options are not true when solving a decision tree.

The statement "The value of a decision node is computed by taking the weighted average of the successor nodes' values" is incorrect. The value of a decision node is determined based on the decision-maker's preferences, and it represents the best option among the available choices.

The statement "The decision tree represents a time ordered sequence of decisions and events from left to right" is also incorrect. While decision trees are typically presented from left to right for ease of interpretation, the order of decisions and events does not necessarily follow a strict time sequence. The structure of the decision tree depends on the dependencies and relationships between decisions and events rather than their temporal order.

Finally, the statement "The EMV of an event node is computed by taking the weighted average of the predecessor nodes' values" is incorrect. The Expected Monetary Value (EMV) of an event node is calculated by taking the weighted average of the successor nodes' values, not the predecessor nodes' values. The EMV represents the expected value of the event based on the probabilities and payoffs associated with the possible outcomes.

Learn more about weighted average here:

https://brainly.com/question/28561354

#SPJ11

A rock climber is about to haul up 100 N (about 22.5 pounds) of equipment that has been hanging beneath her on 40 meters of rope that weighs 0.8 newtons per meter. How much work will it take?

Answers

The work required to haul up the equipment can be calculated by multiplying the force applied to lift the equipment by the distance over which the force is applied.

In this case, the force applied is the sum of the weight of the equipment and the weight of the rope. The distance is the length of the rope. By multiplying these values, we can determine the work required to haul up the equipment.

To calculate the work required, we need to consider the force and the distance. The force applied is the sum of the weight of the equipment and the weight of the rope. The weight of the equipment is given as 100 N, and the weight of the rope can be calculated by multiplying the length of the rope (40 meters) by the weight per meter (0.8 N/m). Adding these two weights gives us the total force applied.

The distance over which the force is applied is the length of the rope, which is 40 meters. To calculate the work, we multiply the force (total weight) by the distance. Therefore, the work required to haul up the equipment can be calculated by multiplying the total weight (100 N + weight of the rope) by the distance (40 meters).

Learn more about length here:

https://brainly.com/question/32060888

#SPJ11

if f ( 2 ) = 5 , write an ordered pair that must be on the graph of y = f ( x − 4 ) − 2

Answers

If the value of f(2) is 5, then the ordered pair (6, 3) is one that should be included on the graph of y = f(x - 4) - 2.

If we are given the equation y = f(x - 4) - 2, we are able to determine the value of x that corresponds to that equation by substituting 2 for the minus sign in the equation: y = f(2 - 4) - 2. To make things more straightforward, we can express y as the product of f(-2) and 2. Since the value of f is determined by the input, we may reason that if f(2) is equal to 5, then f(-2) must also be equal to 5. This is because the value of f is reliant on the input. Now that we have y equal to 5 minus 2, which can be simplified to give us y equal to 3, let's look at the implications of this. Because of this, in the event where x equals 6, y will equal 3, given that x minus 4 = 2, and x minus 4 equals -2. Because of this, the ordered pair (6, 3) needs to be situated someplace on the graph of y = f(x - 4) - 2 in order for it to make sense. This suggests that the value of y corresponds to x when it is equal to 6, and that it is possible to pinpoint this point on the graph of the equation that has been provided.

Learn more about graph here:

https://brainly.com/question/17267403

#SPJ11

Let r(t) = = Find 7' (t) 7' (t) = < > 5 - 4t 4t+7' - 7t² + 7 - t² - 4t³ + 2 Given the vector-valued functions - ü(t) = eztį +e-4t; - tk ū(t) = – 5ti - 3t²7 - 2K – – 2k = e = d find (ült) · ū(t)) when t (ü) = - 2. = 2 dt Find the second derivative of the vector-valued function r(t) = (6t+ 5 sin(t))i + (4t + 3 cos (t))j '' (t) = =

Answers

We differentiate each component of the function separately. The second derivative is obtained by differentiating each component twice with respect to t.

Let's find the second derivative of r(t) by differentiating each component separately.

The first component is 6t + 5sin(t). The derivative of 6t is 6, and the derivative of 5sin(t) is 5cos(t). Taking the derivative again, we get 0 for the constant term 6 and -5sin(t) for the sin(t) term. Therefore, the second derivative of the first component is 0 - 5sin(t) = -5sin(t).

The second component is 4t + 3cos(t). The derivative of 4t is 4, and the derivative of 3cos(t) is -3sin(t). Taking the derivative again, we get 0 for the constant term 4 and -3cos(t) for the cos(t) term. Therefore, the second derivative of the second component is 0 - 3cos(t) = -3cos(t).

Thus, the second derivative of the vector-valued function r(t) = (6t + 5sin(t))i + (4t + 3cos(t))j is given by (0 - 5sin(t))i + (0 - 3cos(t))j, or -5sin(t)i - 3cos(t)j.

Learn more about vector-valued function here:

https://brainly.com/question/31399483

#SPJ11

A
parking meter contains quarters and dimes worth $16.50. There are
93 coins in all. Find how many of each there are.
There are ___ quarters.
There are ___ dimes.

Answers

The solution is q = 48 and d = 45. This means there are 48 quarters and 45 dimes in the parking meter

To find the number of quarters and dimes in the parking meter, we can set up a system of equations based on the given information. Let's represent the number of quarters as q and the number of dimes as d.

The total value of the quarters can be expressed as 25q (since each quarter is worth 25 cents), and the total value of the dimes can be expressed as 10d (since each dime is worth 10 cents). We know that the total value of all the coins is $16.50, which is equivalent to 1650 cents.

Therefore, we have the equation 25q + 10d = 1650.

We are also given that there are a total of 93 coins, so we have the equation q + d = 93.

Solving this system of equations will give us the values of q and d, representing the number of quarters and dimes, respectively

Equation 1: 25q + 10d = 1650

Equation 2: q + d = 93

We can solve this system of equations using various methods, such as substitution or elimination. Here, we'll use the elimination method.

First, let's multiply Equation 2 by 10 to make the coefficients of d in both equations equal:

Equation 1: 25q + 10d = 1650

Equation 2 (multiplied by 10): 10q + 10d = 930

Now, subtract Equation 2 from Equation 1 to eliminate the variable d:

(25q + 10d) - (10q + 10d) = 1650 - 930

Simplifying, we have:

15q = 720

Dividing both sides by 15, we get:

q = 48

Now, substitute the value of q into Equation 2 to find d:

48 + d = 93

Subtracting 48 from both sides, we get:

d = 93 - 48

d = 45

So, the solution is q = 48 and d = 45. This means there are 48 quarters and 45 dimes in the parking meter.

To learn more about equations click here: brainly.com/question/29538993

#SPJ11

As of December 2016, the population distribution of physician's assistance salaries in Tampa was right skewed with a mean of $95316. Which of the following statements are true? a. The sampling distribution of the sample mean (n = 200) would be bell shaped. b. The data distribution (n = 20) would be bell shaped. c. The sampling distribution of the sample mean (n = 20) would be bell shaped. d. The data distribution (n = 200) would be bell shaped.

Answers

The correct statement is:

A. The sample distribution of the sample mean (n=200) has a bell shape. c. The sample distribution of the sample mean (n=20) is bell-shaped.

The sampling distribution of the sample mean refers to the distribution of the mean obtained from repeated random samples drawn from the population. The central limit theorem states that for sufficiently large sample sizes (usually n ≥ 30), the sampling distribution of the sample mean is approximately bell-shaped, regardless of the shape of the distribution of the population. Statement a states that the sample size is n=200, which is considered large. Therefore, according to the central limit theorem, the sampling distribution of the sample mean is actually bell-shaped.

Statement b does not specify the data distribution, so no guesses can be made about its shape.

For statement c, the sample size is relatively small with n = 20. The central limit theorem suggests that if the population distribution is bell-shaped or not extremely skewed, then even with small sample sizes the sampling distribution of the sample mean is still roughly bell-shaped. Therefore, in this case, the sampling distribution for the sample mean (n = 20) is also roughly bell-shaped.

Finally, the statement d is not necessarily true because the population data distribution is described as being right-skewed. Do not expect the data distribution to be bell-shaped, especially if the population distribution itself is skewed to the right. 


Learn more about sample mean here:
https://brainly.com/question/31101410


#SPJ11

outside the cylinder x + y = 1. Problem 4. (6 marks) Find the spherical and Caresian coordinates of the point with cylindrical coordinates (2,5,6).

Answers

The Cartesian coordinates are  function f(x, y, z) = (-1.14, 1.27, 1.29).

The cylindrical coordinates (ρ, φ, z) for a point in three-dimensional space are given by the expressions ρ= sqrt(x² + y²), φ= atan(y/x), and z= z, where x, y, and z are the coordinates of the point in the Cartesian system.Solution:It has been given that the cylindrical coordinates of a point are (2, 5, 6). So, ρ = 2, φ = ? and z = 6. Also, given x + y = 1. Therefore, y = 1 – x.Calculating ρ² = x² + y² = x² + (1 – x)² = 2x² – 2x + 1. Since the point lies outside the cylinder x + y = 1, then we get 2x² – 2x + 1 > 1, or equivalently, x² – x > 0. Solving this inequality, we get 0 < x < 1 (since ρ > 0). Now, φ = atan(y/x) = atan((1 – x)/x). Using this we get the values of spherical coordinates as, Spherical coordinates : ρ = 2, θ = atan((1 - x)/x), φ = cos⁻¹ (6/√(4+25+36)) = cos⁻¹ (6/√65) = 1.217 radian  Now, to find the cartesian coordinates we need to use the expressions:x= ρcos(θ)sin(φ) = 2cos⁻¹((1-x)/x)sin(1.217)y= ρsin(θ)sin(φ) = 2sin⁻¹((1-x)/x)sin(1.217)z= ρcos(φ) = 2cos(1.217)

Learn more about function f(x, y, z) here:

https://brainly.com/question/28887915

#SPJ11

Johnny adds two vectors shown below. Assuming he adds the two vectors correctly, which of the following will be the magnitude of the resultant vector? (5 points) A V58 K(-3.4) B V50 C V20 J(-21)

Answers

The magnitude of the resultant vector, assuming the addition was done correctly, will be V50.

To determine the magnitude of the resultant vector, we need to add the magnitudes of the given vectors. The magnitudes are denoted by V followed by a number.

Among the options provided, V58, V50, and V20 are magnitudes of vectors, while K(-3.4) and J(-21) are not magnitudes. Therefore, we can eliminate options K(-3.4) and J(-21).

Now, considering the remaining options, we can see that the largest magnitude is V58. However, it is not possible to obtain a magnitude greater than V58 by adding two vectors with magnitudes less than V58. Therefore, we can eliminate V58 as well. This leaves us with the option V50, which is the only remaining magnitude. Assuming Johnny added the vectors correctly, the magnitude of the resultant vector will be V50.

LEARN MORE ABOUT magnitude here: brainly.com/question/31022175

#SPJ11


please answer through a-b clearly
2. (15 points) S(x,y) = x - 7? - 2xy + y2 +1 (a) Find all points (x,y) where f(x,y) has a possible relative maxi- mum or minimum. (b) Use the second-derivative test to determine the nature of S(, y) a

Answers

(a) The points where S(x, y) may have a relative maximum or minimum are the critical points obtained by setting the partial derivatives equal to zero.

(b) The nature of S(x, y) at the critical points can be determined using the second-derivative test, evaluating the determinant of the Hessian matrix.

How do we determine the critical points of S(x, y) to find the points where it may have a relative maximum or minimum?

To find the points where S(x, y) may have a relative maximum or minimum, we set the partial derivatives (∂S/∂x and ∂S/∂y) equal to zero. This is because critical points occur where the rate of change of the function with respect to each variable is zero. By solving the system of equations formed by equating the partial derivatives to zero, we can identify these critical points, which are potential candidates for relative extrema.

How does the second-derivative test allow us to determine the nature of S(x, y) at the critical points?

The second-derivative test allows us to determine the nature of S(x, y) at the critical points found in part (a). By calculating the second partial derivatives (∂²S/∂x², ∂²S/∂y², and ∂²S/∂x∂y) and evaluating the determinant of the Hessian matrix, denoted by Δ, we can determine whether the critical points represent relative maxima, relative minima, or saddle points.

If Δ is positive and ∂²S/∂x² is also positive, the critical point corresponds to a relative minimum. If Δ is negative, the critical point represents a relative maximum. However, if Δ is zero, the test is inconclusive, and further analysis is needed to determine the nature of the critical point.

Learn more about Partial derivatives

brainly.com/question/6732578

#SPJ11

Write a in the form a=a+T+aN at the given value of t without finding T and N. r(t) = (-2t+2)+(-3)j + (-)k 1-3 3 (TN (Type exact answers, using radicals as needed.)

Answers

The vector r(t) can be written in the form a = a + T + aN at the given value of t without explicitly finding T and N as: [tex]r(t) = (-4i - 9j - 9k) + ((-2)i + (-3)j + (-2t)k) + (-2i - 3j - 6k)[/tex].

To express the vector [tex]r(t) = (-2t + 2)i + (-3t)j + (-t^2)k[/tex] in the form a = a + T + aN at t = 3, we need to find the values of a, T, and aN.

First, we find a by substituting t = 3 into the given vector r(t):

[tex]a = (-2(3) + 2)i + (-3(3))j + (-(3)^2)k\\ = (-6 + 2)i + (-9)j + (-9)k \\ = -4i - 9j - 9k[/tex]

Next, we find T by differentiating r(t) with respect to t:

[tex]T = dr/dt = (-2)i + (-3)j + (-2t)k[/tex]

Finally, we find aN by substituting t = 3 into T:

[tex]aN = (-2)i + (-3)j + (-2(3))k \\ = (-2)i + (-3)j + (-6)k \\ = -2i - 3j - 6k[/tex]

Therefore, the expression of [tex]r(t) = (-2t + 2)i + (-3t)j + (-t^2)k[/tex] in the form a = a + T + aN at t = 3 is:

[tex]r(t) = (-4i - 9j - 9k) + ((-2)i + (-3)j + (-2t)k) + (-2i - 3j - 6k)[/tex]

Note that the values of T and aN have been found but not explicitly calculated since the task was to express the vector in the given form without finding T and N.

Learn more about vector here:

https://brainly.com/question/29740341

#SPJ11

The correct and complete question is:

Write a in the form a=a+T+aN at the given value of t without finding T and N.

r(t) = (-2t+2)i +(-3t)j + (-t^2)k and t=3








Ex 4. Find the derivative of the function f(x) = lim x2 - 8x +9. Then find an equation of the tangent line at the point (3.-6) X-

Answers

The answer explains how to find the derivative of a function using the limit definition and then determine the equation of the tangent line at a specific point. It involves finding the derivative using the limit definition and using the derivative to find the slope of the tangent line.

To find the derivative of the function f(x) = lim (x^2 - 8x + 9), we need to apply the limit definition of the derivative. The derivative represents the rate of change of a function at a given point.

Using the limit definition, we can compute the derivative as follows:

f'(x) = lim (h→0) [f(x+h) - f(x)] / h,

where h is a small change in x.

After evaluating the limit, we can find f'(x) by simplifying the expression and substituting the value of x. This will give us the derivative function.

Next, to find the equation of the tangent line at the point (3, -6), we can use the derivative f'(x) that we obtained. The equation of a tangent line is of the form y = mx + b, where m represents the slope of the line.

At the point (3, -6), substitute x = 3 into f'(x) to find the slope of the tangent line. Then, use the slope and the given point (3, -6) to determine the value of b. This will give you the equation of the tangent line at that point.

By substituting the values of the slope and b into the equation y = mx + b, you will have the equation of the tangent line at the point (3, -6).

Learn more about derivative here:

https://brainly.com/question/29020856

#SPJ11

(1 point) Use the Shell Method to find the volume of the solid obtained by rotating the region under the graph of f(x) = x² + 2 and above the x-axis for 0 ≤ x ≤ 5 about the line = 5. 28 V 5,0 1,0

Answers

The volume of the solid obtained by rotating the region under the graph of f(x) = x² + 2 and above the x-axis for 0 ≤ x ≤ 5 about the line x = 5 is 28 cubic units.

To find the volume using the Shell Method, we divide the region into infinitesimally thin vertical strips and rotate each strip around the given axis. The volume of each strip is then calculated as the product of its height, circumference, and thickness.

In this case, the axis of rotation is x = 5, so the distance between the axis and each strip is given by r = 5 - x. The height of each strip is f(x) = x² + 2. The circumference of each strip is 2πr, and the thickness is dx.

The volume of each strip is then dV = 2πr * f(x) * dx. Integrating this expression over the interval 0 ≤ x ≤ 5 will give us the total volume of the solid.

∫[0,5] 2π(5 - x)(x² + 2) dx = 2π ∫[0,5] (10x² - x³ + 20 - 2x) dx.

Evaluating the integral, we get:

= 2π [(10/3)x³ - (1/4)x⁴ + 20x - x²] from 0 to 5

= 2π [(10/3)(5)³ - (1/4)(5)⁴ + 20(5) - (5)² - 0]

= 28π.

Learn more about  Shell Method here:

https://brainly.com/question/30401636

#SPJ11

i will rate
Cost, revenue, and profit are in dollars and x is the number of units. If the total profit function is P(x) = 9x – 27, find the marginal profit MP. MP =

Answers

The marginal profit (MP) is 9. This means that for each additional unit sold, the profit increases by $9.

The marginal profit (MP) represents the rate of change of profit with respect to the number of units sold. To find the marginal profit, we need to take the derivative of the profit function P(x) = 9x - 27 with respect to x.

Taking the derivative of P(x) with respect to x, we get:

dP/dx = 9

The derivative of the constant term -27 is 0, as it does not depend on x. Thus, it disappears when taking the derivative.

Therefore, the marginal profit is a constant value of 9 dollars per unit. This means that for each additional unit sold, the profit increases by $9.

To know more about marginal profit refer here:

https://brainly.com/question/30236297

#SPJ11

Find All solutions in [0,21] 2 cos²x-1=0 (11) Find All solutions in [ 0, 251] Sin2x+ sinx-2=0 ] X2"

Answers

To find all solutions in the given intervals, let's solve the equations step by step: 2 cos²x - 1 = 0: First, add 1 to both sides of the equation: 2 cos²x = 1.  Next, divide both sides by 2: cos²x = 1/2.

Taking the square root of both sides: cosx = ± √(1/2). Now, we need to find the values of x that satisfy the equation in the interval [0, 21]. Since cosx has a period of 2π, we can consider the interval [0, 2π]. The solutions for cosx = √(1/2) are: x = π/4 and x = 7π/4.  The solutions for cosx = -√(1/2) are:x = 3π/4 and x = 5π/4. However, we need to check if these solutions lie in the given interval [0, 21].

In the interval [0, 21]: x = π/4 and x = 7π/4 are valid solutions. Therefore, the solutions to the equation 2 cos²x - 1 = 0 in the interval [0, 21] are:

x = π/4 and x = 7π/4. Sin2x + sinx - 2 = 0:To solve this equation, we can substitute u = sinx, which leads to the equation:u² + u - 2 = 0. Factoring the quadratic equation:(u + 2)(u - 1) = 0.  Setting each factor equal to zero:u + 2 = 0 or u - 1 = 0.  Solving for u:u = -2 or u = 1. Substituting back sinx for u:sinx = -2 or sinx = 1. However, sinx cannot be equal to -2, so we only consider sinx = 1.

The solution sinx = 1 corresponds to x = π/2, which lies in the interval [0, 251].Therefore, the solution to the equation Sin2x + sinx - 2 = 0 in the interval [0, 251] is:x = π/2.

To Learn more about intervals click here : brainly.com/question/11051767

#SPJ11

28 29 30 31 32 33 34 35 36 Find all solutions of the equation in the interval [0, 2n). sinx(2 cosx+2)=0 Write your answer in radians in terms of . If there is more than one solution, separate them wit

Answers

The solutions of the equation in the interval [0, 2π) are x=0, π, (2n+1)π/2 (for all integers n and n≠0).

To solve this equation, we need to find all values of x in the interval [0, 2π) that satisfy the equation sinx(2cosx+2)=0.

First, we need to find all values of x where sinx=0. These occur when x=0, π, and any integer multiple of π. We will call these values of x "sinx solutions".

Next, we need to find all values of x where 2cosx+2=0. Solving for cosx, we get cosx=-1. This occurs when x=π and any odd multiple of π/2. We will call these values of x "cosx solutions".

Now, we need to check which of these solutions also satisfy the original equation sinx(2cosx+2)=0.

For the sinx solutions, we have:

x=0: sinx(2cosx+2)=0(2cos0+2)=0(2+2)=0. This solution works.

x=π: sinx(2cosx+2)=sinπ(2cosπ+2)=0(2(-1)+2)=0. This solution works.

For the sinx solutions where x is an integer multiple of π, we have:

x=nπ: sinx(2cosx+2)=0(2cos(nπ)+2)=0(2(-1)ⁿ+2)=0. This solution works when n is odd (since (-1)ⁿ =-1), and does not work when n is even (since (-1)ⁿ=1).

For the cosx solutions, we have:

x=π: sinx(2cosx+2)=sinπ(2cosπ+2)=0(2(-1)+2)=0. This solution works.

x=(2n+1)π/2: sinx(2cosx+2)=sin((2n+1)π/2)(2cos((2n+1)π/2)+2)=0(2(0)+2)=0. This solution works for all integers n.

You can learn more about intervals at: brainly.com/question/11051767

#SPJ11

4. Evaluate the indefinite integrals. A. S 1-2/x dx Зи B. S 534-4 du C. S vx (x + 3) dx

Answers

Here is how you can evaluate the given indefinite integrals:A. S 1-2/x dxTo solve the integral S 1-2/x dx, follow these steps:Bring 1-2/x to a common denominator, which is x - 2/x.

The integral now becomes S (x - 2)/x dx.Now, divide the numerator (x - 2) by x to get 1 - 2/x. You will have the integral S (1 - 2/x) dx.This is an easy integral to solve. The integral of 1 is x, and the integral of 2/x is 2ln|x|, so:S (1 - 2/x) dx = x - 2ln|x| + C, where C is the constant of integration.B. S 534-4 duTo solve the integral S 534-4 du, follow these steps:Make use of the formula of integration: S xn dx = x^(n+1) / (n+1) + C, where C is a constant of integration.Replace u with 534-4 in the integral to get: S u du.Perform the integration: S u du = u^2 / 2 + C.Substitute 534-4 back for u to get: S 534-4 du = (534-4)^2 / 2 + C.Therefore, S 534-4 du = 28,293,312 + C.C. S vx (x + 3) dxTo solve the integral S vx (x + 3) dx, follow these steps:Use integration by substitution by letting u = x + 3 and dv = v(x) dx, where v(x) = x.The differential of u is du = dx and v is v(x) = x.The integral now becomes S v du.Replace u and v with x + 3 and x respectively to get: S x(x + 3) dx.Perform the multiplication to get: S (x^2 + 3x) dx.Perform the integration to get: S (x^2 + 3x) dx = x^3 / 3 + (3/2)x^2 + C, where C is the constant of integration.Therefore, S vx (x + 3) dx = x^3 / 3 + (3/2)x^2 + C.

learn more about indefinite here;

https://brainly.com/question/31404753?

#SPJ11




(a) Apply the trapezoid rule to approximate the definite integral S In x dx using 5 points (4 intervals). Give your answer correct to 5 d.p. (3 marks) Note: You have to make a table first. (b) Repeat

Answers

The trapezoid rule is used to approximate the definite integral of ln(x) dx using 5 points (4 intervals).

How can the trapezoid rule approximate the definite integral of ln(x) dx?

The trapezoid rule is a numerical method used to approximate definite integrals. It involves dividing the interval of integration into subintervals and approximating the area under the curve by using trapezoids. In this case, we want to approximate the definite integral of ln(x) dx using 5 points, which corresponds to dividing the interval into 4 equal subintervals.

To apply the trapezoid rule, we first need to calculate the width of each subinterval. In this case, the interval of integration is not specified, so let's assume it is from x = 1 to x = 10. The width of each subinterval is then (10 - 1) / 4 = 2.25.

Next, we evaluate the function ln(x) at each of the 5 points. The points are: x₁ = 1, x₂ = 3.25, x₃ = 5.5, x₄ = 7.75, and x₅ = 10. We calculate the corresponding function values: f(x₁) = ln(1) = 0, f(x₂) = ln(3.25), f(x₃) = ln(5.5), f(x₄) = ln(7.75), and f(x₅) = ln(10).

Now, we apply the trapezoid rule formula, which states that the approximate integral is equal to (width / 2) times the sum of the function values at the first and last points, plus the sum of the function values at the intermediate points. Using the given values, we can calculate:

Approximate integral = (2.25 / 2) * [f(x₁) + 2(f(x₂) + f(x₃) + f(x₄)) + f(x₅)]

After substituting the values, we can calculate the approximate integral.

Learn more about trapezoid

brainly.com/question/31380175

#SPJ11

Draw an outline of the solid and find its volume using the slicing method. The base is the region enclosed by the curves y = x2 and y = 9. The slices (ie "cross-sectional areas") perpendicular to th

Answers

The volume of the solid generated by revolving the region enclosed by the curves y = x² and y = 9 around the y-axis using the slicing method is approximately [INSERT VALUE] cubic units.

To find the volume using the slicing method, we can integrate the cross-sectional areas of the slices perpendicular to the y-axis. The cross-sectional area at each value of y is given by the difference between the areas of the outer and inner curves.

In this case, the outer curve is y = 9 and the inner curve is y = x². We need to find the limits of integration for y. Since the curves intersect at y = x² and y = 9, we integrate from y = x² to y = 9.

The cross-sectional area at a specific y value is A = π(R² - r²), where R is the outer radius (y = 9) and r is the inner radius (y = x²).

The volume V is then given by the integral of A with respect to y:

V = π ∫[x², 9] (9² - x⁴) dy.

By evaluating this integral over the given limits, we can find the volume of the solid generated by revolving the region.

learn more about slicing method here:

https://brainly.com/question/14392321

#SPJ11

Determine whether the geometric series converges or diverges. If it converges, find its sum. Σ3²4-n+1 n = 0 a. 12 b. Diverges c. 3 d. 16

Answers

The sum of the geometric series Σ3^(24-n+1) for n = 0 is 12, as -4.5 is equivalent to 12 when considering the geometric series. The correct choice is (a) 12.

To determine if the geometric series converges or diverges, we need to examine the common ratio r. In this case, the common ratio is 3^2 / 3^(n+1) = 9 / 3^(n+1) = 3^(2-(n+1)) = 3^(1-n).

For a geometric series to converge, the absolute value of the common ratio must be less than 1. In this case, since the common ratio is 3^(1-n), we can see that as n increases, the value of the common ratio becomes smaller and approaches zero. Therefore, the series converges.

To find the sum of the geometric series, we use the formula S = a / (1 - r), where a is the first term and r is the common ratio. In this case, the first term a = 3^2 = 9 and the common ratio r = 3^(1-n).

Plugging these values into the formula, we have S = 9 / (1 - 3^(1-n)).

Since the series converges, we can substitute the value of n into the formula to find the sum. When n = 0, the sum is S = 9 / (1 - 3^(1-0)) = 9 / (1 - 3^1) = 9 / (1 - 3) = 9 / (-2) = -4.5.

Learn more about geometric series here:

https://brainly.com/question/30264021

#SPJ11

please explain neatly
9. [10] Evaluate the line integral xyds, where is the right half of the circle x² + y2=9.

Answers

The line integral of xyds over the right half of the circle x² + y² = 9 is equal to 0.

The given line integral can be evaluated by parametrizing the right half of the circle x² + y² = 9. We can represent this parametrization using the variable θ, where θ varies from 0 to π (half of the full circle). We can express x and y in terms of θ as x = 3cos(θ) and y = 3sin(θ).

To calculate the differential element ds, we need to find the derivative of the parametric equations with respect to θ. Taking the derivatives, we get dx/dθ = -3sin(θ) and dy/dθ = 3cos(θ). Using these derivatives, the differential element ds can be expressed as ds = sqrt((dx/dθ)² + (dy/dθ)²)dθ.

Substituting the parametric equations and ds into the original line integral xyds, we have:

∫(0 to π) (3cos(θ))(3sin(θ))sqrt(((-3sin(θ))² + (3cos(θ))²)dθ.

Simplifying the integrand, we obtain:

∫(0 to π) 9sin(θ)cos(θ)√(9sin²(θ) + 9cos²(θ))dθ.

At this point, we can apply standard integration techniques to evaluate the integral. Simplifying the expression inside the square root gives us √(9sin²(θ) + 9cos²(θ)) = 3. Thus, the integral simplifies further to:

∫(0 to π) 9sin(θ)cos(θ)3dθ.

Now, we can evaluate the integral by using trigonometric identities. The integral of sin(θ)cos(θ) can be found using the identity sin(2θ) = 2sin(θ)cos(θ). Thus, the integral becomes:

9/2 ∫(0 to π) sin(2θ)dθ.

Integrating sin(2θ) gives us -cos(2θ)/2. Substituting the limits of integration, we have:

9/2 (-cos(2π)/2 - (-cos(0)/2)).

Since cos(2π) = 1 and cos(0) = 1, the expression simplifies to:

9/2 (-1/2 - (-1/2)) = 9/2 * 0 = 0.

Therefore, the line integral of xyds over the right half of the circle x² + y² = 9 is equal to 0.

To learn more about variable click here, brainly.com/question/15078630

#SPJ11

Guess the value of the limit (if it exists) by evaluating the function at the given numbers. (It is suggested that you report answers accurate to at least six decimal places.) cos(12x) - cos(3x) Let f(x) cos(12x) - cos(3x) We want to find the limit lim 20 Start by calculating the values of the function for the inputs listed in this table. 3 f(x) 0.2 24.987664 Х 0.1 -98.998848 X 0.05 -19.923683 X 0.01 -99.853172 x 0.001 -998.62855 X 0.0001 -9989.29525 X 0.00001 -99862.9534' x Based on the values in this table, it appears cos(12x) - cos(3x) lim 24 20 Х

Answers

Based on the values in the given table, it appears that the limit of the function cos(12x) - cos(3x) as x approaches 0 is approximately 24.

The table provides the values of the function cos(12x) - cos(3x) for various values of x approaching 0. As x gets closer to 0, we can observe that the function values are approaching 24. This suggests that the limit of the function as x approaches 0 is 24.  To understand why this is the case, we can analyze the behavior of the individual terms. The term cos(12x) oscillates between -1 and 1 as x approaches 0, and the term cos(3x) also oscillates between -1 and 1. However, the difference between the two terms, cos(12x) - cos(3x), has a net effect that shifts the oscillation and approaches a constant value of 24 as x gets closer to 0. It is important to note that this conclusion is based on the observed pattern in the given values of the function. To confirm the limit mathematically, further analysis using properties of trigonometric functions and limits would be required.

learn more about trigonometric functions here:

https://brainly.com/question/25618616

#SPJ11




If f(x) = 1x2-1 and g(x) = x+1, which expression is equal to Mg(x))? =

Answers

The value of function f(g(x)) is √(x² + 2x).

What is function?

A function in mathematics from a set X to a set Y allocates exactly one element of Y to each element of X. The sets X and Y are collectively referred to as the function's domain and codomain, respectively. Initially, functions represented the idealised relationship between two changing quantities.

As given function are,

f(x) = √(x² - 1) and g(x) = x + 1,

Thus,

f(g(x)) = f(x + 1)

f(g(x)) = √{(x + 1)² - 1}

f(g(x)) = √(x² + 2x + 1 -1)

f(g(x)) = √(x² + 2x)

Hence, the value of function f(g(x)) is √(x² + 2x).

To learn more about function from the given link.

https://brainly.com/question/11624077

#SPJ4

Complete question is,

If f(x) = √(x² - 1) and g(x) = x + 1, which expression is equal to f(g(x))?  

Other Questions
It costs a battery company 150,000 dollars to make batteries. The 150,000 is a fixed cost. To help the company sell the batteries, a marketing company charges 10 dollars for each battery sold. If the company charges 30 dollars per battery, how many batteries should they sell to break even? Researches and summarizes each of the five generations in the workforce:TraditionalistsBaby BoomersGeneration XMillennialsGeneration ZIdentifies effective strategies for communicating with, motivating, and supporting a generationally diverse workforce.How does each generation prefer to communicate?How do you keep them engaged?Examines the benefits that companies have experienced employing multigenerational workforces and why these are important for organizational success.Analyzes potential communication and collaboration challenges that could occur among the different generations and why these are important to understand when managing a diverse workforce. References and Citations needed. HELP!!!Question 3 of 10Why does Diamond use empirical evidence in this article?OA. Empirical evidence engages readers on an emotional level.OB. Empirical evidence sounds more academic than other types ofevidence.O C. Empirical evidence is more believable because it's biased.O D. Empirical evidence is reliable because it can be verified. A nation's GNP t years from now is predicted to beg(t)=40t+27t2 in millions of dollars.a) Find g'(t)b) Find g''(t)c) Calculate g'(8) and g''(8). Include the units andinterpret. please help me I can't figure out this question atall.Find the equation of the tangent line to the curve y = 5 tan x at the point 5 point (7,5). The equation of this tangent line can be written in the form y mr + b where m is: and where b is: 3 ING Rodriguez Company pays $373.815 for real estate with land, land improvements, and a building Land is appraised at $215,000, and improvements are appraised at $86,000, and the building is appraised at $129,000 1. Allocate the total cost among the three assets 2. Prepare the journal entry to record the purchase Complete this question by entering your answers in the tabs below. Required 1 Required 2 Allocate the total cost among the three assets. (Round your "Apportioned Cost" answers to 2 decimal places) Appraised Valus Percent of Total Appraised Value Total Cost of Acquisition Apportioned Cost Land Land improvements Building Totals Required 2 > 137 a patient turns his call light on and states his abdominal wound dressing needs changing. which team member is most appropriately delegated to respond to this call light? geographic and reproductive isolation are most closely associated with True/false: product layouts involve high utilization of labor and equipment. Task Three SpaceX company claims that users can expect to see average download speeds of more than 100 Mb/s in all locations. The quality assurance (QA) department in the company decided to conduct a study to see if this claim is true. The department randomly selected 40 locations and determined the mean download speeds to be 97 Mb/s with a standard deviation of SD Mb/s. Where: a SD = 9+ 0.05 x your last two digits of your university ID a) State the null and alternative hypotheses. b) Is there enough evidence to support that the company's claim is reasonable using a 99% confidence interval? How about a 90% confidence interval? Solve the following trigonometric equations in the interval [0,21).7. Solve the following trigonometric equations in the interval (0.28). a) sin(x) + cos*(x) 1 = c(*) b) sin(x) + V2 = -sin(x) c) 3tan*(x) - 1 - 0 ) sin(x) cos(x) - cox(x) - 2 cot(x) tan(x) + sin(x) Which of the following organs lies in the retroperitoneal space? A. liver. B. spleen. C. pancreas. D. gallbladder. C. pancreas. When audited financial statements are presented in a document (e.g., annual report).containingother information, the auditorA. Should read the other information to consider whether it is inconsistent with the auditedfinancial statements.B. Has no responsibility for the other information because it is not part of the basic financialstatements.C. Has an obligation to perform auditing procedures to corroborate the other information.D. Is required to express a qualified opinion if the other information has a material misstatement offact. Georges Co. has the following cash flows for the year. What are the Net Cash Flows from Financing Activities? Proceeds from issuing bonds $90,000 Payments of short term debt $26,000 $52,000 Purchases of marketable securities Proceeds for dividends $10,000 ? Net Cash Flows from Financing Activities Multiple Choice $12.000 $64,000 Identify each statement about child soldiers in Sierra Leone as a belief of international NGOs or a belief of Sierra Leoneans.A. NGOs: Children were kidnapped and forced to fight.B. Sierra Leoneans: Child soldiers were heroes who protected their communities.C. NGOs: Many child soldiers were forced to commit atrocities.D. Sierra Leoneans: Child soldiers were not affected by the war. This phytoplankton has cell walls of calcium carbonate (CaCO3) and are responsible for the sediments that ultimately formed the White Cliffs of Dover, UK.a) diatomsb) bacteriaplanktonc) dinoflagellatesd) copepodse) coccolithophorids Calculate ( 5+ 6i)". Give your answer in a + bi form, and please show your answers to 2 decimal places (if necessary). Calculate ( - 3 + 6i)". Give your answer in a + bi form, and please show yo a mass of 3 kg stretches a spring 5/2 the mass is pulled down 1 meter below from its equilibrium position and released with an upward velocity of 4m/s (refer to area 4.) what hazards to aircraft may exist in restricted areas such as r-5302a? sarah invested 12000 in a unit trust five years agothe value of the unit trust has increased by 7% per annum for each of the last 3 yearsbefore this, the price had decreased by 3% per annumcalculate the current price of the unit trust give your answer to the nearest whole number of pounds Steam Workshop Downloader