What is the value for x?
Angle A=73°
Angle B=(6x + 4)º
Angle C=(8y-7)° Enter your answer in the box.
X=

What Is The Value For X?Angle A=73Angle B=(6x + 4)Angle C=(8y-7) Enter Your Answer In The Box.X=

Answers

Answer 1

The value of x is 5 from the diagram.

The sum of angles in a triangle.

The sum of interior angle of a triangle is 180 degrees. Hence:

m<A + m<B + m<C = 180

From the information given,;

73 = 8y - 7 (base angles are equal)

8y = 80

y = 10

Take the sum of the angles:

73  + 6x + 4 + 73 = 180

6x + 150 = 180

6x = 30

x= 5

Hence the value of x is 5 from the diagram.

Learn more on triangles here: https://brainly.com/question/2938476

Answer 2

The value of x is 5.

Since triangle ABC is an isoceles triangle, angle A = Angle C(base angles of an isoceles triangle are equal)

Since angle A = 73° and angle C = (8y - 7)°

angle A = angle C

73 = 8y - 7

Adding 7 to both sides, we have

73 + 7 = 8y - 7 + 7

80 = 8y

Dividing both sides by 8, we have

y = 80/8

y = 10

Also, angle A + angle B + angle C = 180° (sum of angles in a triangle)

73 + 6x + 4 + 8y - 7 = 180

Collecting like terms, we have

73 + 4 - 7 + 6x + 8y = 180

6x + 8y + 70 = 180

Subtracting 70 from both sides, we have

6x + 8y + 70 - 70 = 180 - 70

6x + 8y = 110

Making x subject of the formula, we have

6x = 110 - 8y

x = (110 - 8y)/6

Substituting the value of y into the equation, we have

x = (110 - 8y)/6

x = (110 - 8 × 10)/6

x = (110 - 80)/6

x = 30/6

x = 5

So, the value of x is 5.

Learn more about angles in a triangles here:

https://brainly.com/question/7888180


Related Questions

help!!

Find the solution of the system of equations
shown on the graph.

Answers

Answer:

(0,6)

Step-by-step explanation:

When a system of equations is graphed, the point at which the lines intersect is a solution to the system. Looking at the graph, we can see that the lines intersect at (0,6). Therefore, (0,6) is a solution to the system of equations.

Rewrite in simplest terms: (10x + y) + (10x – 7y)
Oh

Answers

9514 1404 393

Answer:

  20x -6y

Step-by-step explanation:

Parentheses can be eliminated and like terms combined.

  10x +y +10x -7y

  = x(10 +10) +y(1 -7)

  = 20x -6y

Round 3292.53429 to the nearest hundred thousandth

Answers

Answer:

The answer is "0.00001"

Step-by-step explanation:

Given value:

[tex]\to 3292.53429[/tex]

when we round a hundred thousandths (100,000) value. So, the given rounding 3292.53429 to the nearest 0.00001.

Explain it too and is it x method?

Answers

Look when I factored this question I got 4(x+6)(x-8)
So Iam not sure either what the correct answer is but that’s what I got

Express 0.000000000936 in
scientific notation.
9.36x10
Enter

Answers

Answer:

9.36 x 10^(-10)

Step-by-step explanation:

3/7 to its decimal form and rounded to the nearest thousandth

Answers

Answer:

Decimal form: 0.4286

Step-by-step explanation:

The value of 3/7 in decimal form up to nearest thousands will be 0.4285.

A fraction 3/7 is given in the question.

We have to find it's decimal form and round-off it to nearest thousands.

What will be the value of 1/2 in decimal form rounded to units place ?

The value will be 0.5

To find the decimal form let's divide 3 by 7.

3 ÷ 7 = 0.428572

We have to round it to nearest thousands i.e., up to 4 places Right to decimal point.

The rounded value will be 0.4285.

thus , the decimal form of 3/7 will be 0.4285 rounded off to nearest thousands.

To learn more about how to convert fraction to decimal click here ;

https://brainly.com/question/13635105

#SPJ2

1) Graph the quadratic function given in standard form and identify the key features. Include at least 5 points on your
graph.
y=-x²-2x +1
Axis of Symmetry:
Vertex:
Y-intercept:
Domain:
Range:
Just question one plz help ASAP

Answers

Answer:

14

Step-by-step explanation:

TRAVEL It is about 350 miles from Ruidoso, New Mexico, to Abilene, Texas. Haruko has already driven 75 miles and made it to Roswell, New Mexico. She hopes to finish the rest of her trip, including stops, in 5 hours. Write an equation to find the average speed Haruko needs to drive to finish the rest of her trip in 5 hours.

Answers

Answer:

55 mph

Step-by-step explanation:

Given that:

Total miles of journey = 350 miles

Miles already driven = 75 miles

To cover the rest of the journey in 5 hours, the average speed of travel. Will be:

Recall:

Speed = (Distance left to cover ÷ budgeted travel time)

Distance left to cover : (total miles - distance already driven)

Average speed required = (350 - 75) / 5

= 275 / 5

= 55 mph

PLEASE HELP
f(x) = x2. What is g(x)?

Answers

Answer: Choice C.  g(x) = (3x)^2

To confirm this, plug in x = 1 and you'll find that:

g(x) = (3x)^2

g(1) = (3*1)^2

g(1) = (3)^2

g(1) = 3*3

g(1) = 9

Showing that (1,9) is on the red g(x) curve.

Here are two rectangles.

Complete this sentence:

The two rectangles are similar and the scale factor is __

Answers

Answer:

It is

Scale Factor = Ratio of Side Lengths

= 12/8 = 9/6 = 1.5.

Step-by-step explanation:

Hope this helped have an amazing day!

The two rectangles are similar and the scale factor is 3/2.

Given data:

The first rectangle is represented as ABCD

The second rectangle is represented as PQRS

Now, the dimensions of ABCD is 8 cm x 6 cm

The dimensions of PQRS is 12 cm x 9 cm

So, the scale factor is represented as k and the value of k is :

k = length of PQRS / length of ABCD

So, k = 12 / 8

k = 3/2

Hence , the similar rectangles have a scale factor of 3/2

To learn more about rectangle click :

https://brainly.com/question/15225905

#SPJ2

A ball is thrown upward at an angle of 30° to the horizontal and lands on the top edge of a building that is 20 m away. The top edge is 5.0 m above the throwing point. How fast was the ball thrown? Use: sin30°=0.5 and cos30°=0.9
a. 20 m/s
b. 11 m/s
c. 52.3 m/s
d. 16 m/s​

Answers

Answer:

The correct option is;

a. 20 m/s

Step-by-step explanation:

The given parameters are;

The angle at which the ball is thrown, θ = 30° to the horizontal

The horizontal distance of the top edge of the building where the ball lands from where the ball is thrown, x = 20 m

The height of the top edge of the building above the throwing point = 5 meters

Let "v" represent the speed with which the ball is thrown

We have;

The vertical component of the speed with which the ball is thrown, [tex]v_y[/tex] = v × sin(θ) = v × sin(30°) = v × 0.5 = 0.5·v

[tex]v_y[/tex] = 0.5·v

The horizontal component of the speed with which the ball is thrown, vₓ = v × cos(θ) = v × cos(30°) = v × 0.9 = 0.9·v

vₓ = 0.9·v

The kinematic equation of the motion is y = [tex]v_y[/tex]·t - (1/2)·g·t², where;

y = The vertical height reached = 5 metes

t = The time taken to reach the specified 5 m, height

g = The acceleration due to gravity = 9.8 m/s², we have;

Therefore, we have;

5 = 0.5·v·t - (1/2)·9.8·t²...(1)

Also, from the horizontal motion of the ball, we have the following kinematic equation of motion;

x = vₓ × t

Therefore, by substituting the known values, we have;

20 = 0.9·v × t

∴ v = 20/(0.9·t) = 200/(9·t)...(2)

Substituting the value of t in equation (1) gives;

5 = 0.5·v·t - (1/2)·9.8·t² = 0.5·(200/(9·t))·t - (1/2)·9.8·t²

∴ 5 = 0.5·(200/(9·t))·t - (1/2)·9.8·t² = 100/9 - 4.9·t²

4.9·t² = 100/9 - 5 = 55/9

t = √(55/(9 × 4.9)) ≈ 1.116766

The time taken to reach the specified 5 m height = t ≈ 1.116766 seconds

From equation (2), we have, v = 200/(9·t) = 200/(9 × 1.116766) ≈ 19.8987 m/s

The speed with which the ball is thrown = v ≈ 19.8987 m/s ≈ 20 m/s. to the nearest whole number.

The speed with which the ball is thrown is approximately 20 m/s

Answer:

The answer is:

a) 20 m/s

Hope it helps:D

it takes 12 people to pull 30 tons of goods how many people would it take to pull 60 tons of goods ​

Answers

Answer:

24

Step-by-step explanation:

60 is double of 30 so double 12 to get your answer, 12 time two is 24

A line is perpendicular to y = 3x - 8
and intersects the point (2,2).
What is the equation of this
perpendicular line?

Answers

Since the line is perpendicular, we know that the slope is reciprocal and negative to the other one.

So,

y = -4x + b

We want to find the y-intersect (b) so substitute the intersected points and solve for it.

2 = -4(2) + b

2 = -8 + b

2 + 8 = b

10 = b

So the complete equation would be:

y = -4x + 10

Kira is on her way home in her car. Her drive is 30 miles long. She has finished one-third of the drive so far. How far has she driven?

Answers

Answer:

10 miles

Step-by-step explanation:

1/3 × 30 miles = 10 miles

Answer:

Step-by-step explanation:

30 * 1/3 = 10  :)

What is the interval notation for the compound inequality? x≤−4 or x≥5
(−∞, −4) or (5, ∞)
(−∞, −4] or [5, ∞)
(−4,5)
[−4,5]

Answers

Answer:

(-∞, -4] or [5, ∞)

Step-by-step explanation:

Because the solutions for x can also be equal to -4 and 5, brackets are used.

And because the solutions for x can be any number less than -4 or any number greater than 5, -∞ and ∞ are used respectively.

Solve.
y= 2x - 6
4x – 2y = 14
Use the substitution method.

Answers

Answer:

y=2x-6. ---------(1)

4x-2y=14. --------(2)

substituting equation 2 in 1

4x-2(2x-6)=14

4x-4x+12=14

so it has no solution

Step-by-step explanation:

As you can see in the image below, the answer is no solution.

Answer Plz, ASAP. Within 10 minutes will be Marked as Brainliest ​

Answers

[tex]\large\bold{\underline{\underline{To \: Find:-}}}[/tex]

[tex] \sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=?[/tex]

[tex]\large\bold{\underline{\underline{Explanation:-}}}[/tex]

They are asking us to find the determinant

[tex]\boxed{\sf \left|\begin{array}{c c} a & b \\ c & d \end{array}\right| =ad-bc}[/tex]

Now using the above formula it becomes

[tex]\left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right| \: = sin20 \degree cos70 \degree - ( - cos20 \degree sin70 \degree) \: \\ \\ = sin20 \degree cos70 \degree + cos20 \degree sin70 \degree [/tex]

Now using the formula

[tex]\boxed{\sf sin(A+B)=sinAcosB+cosAsinB}[/tex]

it becomes

[tex] \longrightarrow \: sin(20 + 70) \\ \\ \longrightarrow \: sin(90 \degree) = 1[/tex]

★Therefore

[tex] \boxed{\sf \left|\begin{array}{c c} sin20\degree & -cos20\degree \\ sin70\degree & cos70\degree \end{array}\right|=1}[/tex]

━━━━━━━━━━━━━━━━━━━

★Extra information:-

What is a matrix?

☄It is a rectangular representation or array of numbers,symbols and many more functions

☄It is represented in rows and columns

━━━━━━━━━━━━━━━━━━━━━━━━━━

Line A passes through points (2, 9) and (7, 3). Line B passes through points (1, 4) and (7, 9). Are line A and line B parallel or perpendicular?

Answers

they are perpendicular (mark brainliest pls)

What is the expression shown

Answers

Answer:

There is nothing but your question and you should try on your own

Step-by-step explanation:

Answer:

N/A

Step-by-step explanation:

There is not context with this problem, therefore it cannot be solved.

In the figure, point C is the midpoint of (A/E) Use the figure to answer the questions.

Avery says that AbC /DeC by the ASA congruence postulate. Do you agree or disagree Explain?
Suppose it is also known that point C is also the midpoint of (B/D Which postulate or theorem can be used to prove that aBC/DeC? Justify your answer.

Answers

Answer:

Disagree ΔABC ≅ ΔDEC by ASA butt by SAS

Step-by-step explanation:

point C is the midpoint of (A/E), C is also the midpoint of (B/D )

BC = CD   and AC = CE

∠BCA = ∠ECD

ΔABC ≅ ΔDEC by SAS not by ASA

PLEASE HELP ASSP !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!

Answers

Answer:

A: 2/9

Step-by-step explanation:

think of an event that might occur at three different speeds and describe it.

Answers

Answer:

tornado!

Step-by-step explanation:

sometimes tornados can start off slow and sometimes they can go really fast.

Have no idea how to do this lok

Answers

Answer:

that hard

Step-by-step explanation:

What is the solution to the system below?
y = -3x - 2
6x + 2y = -4

Answers

Answer:

Infinitely many solutions

Step-by-step explanation:

Since y=-3x-2, plug it in (2)

6x+2(-3x-2)=-4.

Distribute:

6x-6x-4=-4

-4=-4

Infinetly many solutions.

Hope this helps :)

the diagram shows two parallel lines cut by a transversal. If the measure of < 3 = ( 7y + 15) and the measure of < 5 = ( 110 - 2y) , what is the measure of <4​

Answers

Step-by-step explanation:

Angle 3 + Angle 5 = 180° (C-angles)

Therefore 7y + 15 + 110 - 2y = 180, 5y = 55, y = 11.

Angle 4 = Angle 5 (Z-angles)

Hence Angle 4 = 110 - 2y = 110 - 2(11) = 88°.

Help me on this math problem please! I’ve been stuck on it for 15 mins now

Answers

Answer:

Step-by-step explanation:

P = perimeter = 114

P =2 * length +2* width

P = 2(2x - 3) + 2(x)

114 =  4x-6  + 2x

114 = 6x -6

19 = x -1

20 = x

check it  

2( 2x -3)+2x =  ?  

4x -6 +2x=?

6x -6 = ?

6(20)-6 =?

120-6 = 114

yep this is correct

BC = 17.89
DC = 16
with reference to the figure sin x=?
a.0.250
b. 0.447
c.0.894
d. 1

Answers

Answer:

c

Step-by-step explanation:

The value of sin x in the given right triangle is 0.894.

What sine of an angle?

The sine of an angle is a trigonometric function that is defined as the ratio of the length of the side opposite the angle to the length of the hypotenuse in a right triangle.

Given is right triangle ABC, we need to find the value of sin x,

So, we see that the figure is divided into three similar triangles,

Namely,

Δ CDB ~ Δ BDA ~ Δ CBA,

Therefore, according to the definition of similarity,

We have,

CD / CB = BD / BA = 16/17.89

Therefore, BD / BA = 0.894

Also,

sin x = BD / BA

Therefore,

sin x = 0.894

Hence the value of sin x in the given right triangle is 0.894.

Learn more about sine of an angle, click;

https://brainly.com/question/3827723

#SPJ7

PLEASE HELPP
What is the solution to the following system of equations?

x − 3y = 6
2x + 2y = 4

(-1, 3)
(3, -1)
(1, -3)
(-3, 1)

Answers

Answer:

The solution to the system of equations be:

[tex]x=3,\:y=-1[/tex]

Hece, option B is correct.

Step-by-step explanation:

Given the system of equations

[tex]\begin{bmatrix}x-3y=6\\ 2x+2y=4\end{bmatrix}[/tex]

Multiply x − 3y = 6 by 2:      2x-6y=12

[tex]\begin{bmatrix}2x-6y=12\\ 2x+2y=4\end{bmatrix}[/tex]

so

[tex]2x+2y=4[/tex]

[tex]-[/tex]

[tex]\underline{2x-6y=12}[/tex]

[tex]8y=-8[/tex]

so the system of equations becomes

[tex]\begin{bmatrix}2x-6y=12\\ 8y=-8\end{bmatrix}[/tex]

Solve 8y = -8 for y

[tex]8y=-8[/tex]

Divide both sides by 8

[tex]\frac{8y}{8}=\frac{-8}{8}[/tex]

[tex]y=-1[/tex]

[tex]\mathrm{For\:}2x-6y=12\mathrm{\:plug\:in\:}y=-1[/tex]

[tex]2x-6\left(-1\right)=12[/tex]

[tex]2x+6=12[/tex]

subtract 6 from both sides

[tex]2x+6-6=12-6[/tex]

[tex]2x=6[/tex]

Divide both sides by 2

[tex]\frac{2x}{2}=\frac{6}{2}[/tex]

[tex]x=3[/tex]

Therefore, the solution to the system of equations be:

[tex]x=3,\:y=-1[/tex]

Hence, option B is correct.

A N S W E R :

x - 3y = 6 ......[Equation (i) ]2x + 2y = 4 ......[Equation (ii)]

⚽ From Equation (i) we get :

x = 6 + 3y......[Equation (iii)]

⚽ Now, Substitute the equation (iii) in equation (ii) we get :

→ 2(6 + 3y) + 2y = 4

→ 12 + 6y + 2y = 4

→ 8y = 4 - 12

→ 8y = -8

→ y = -8 ÷ 8

y = -1

⚽ Now Substituting value of y = -1 in equation (iii) we get :

→ x = 6 + 3y

→ x = 6 + 3(-1)

→ x = 6 + (-3)

→ x = 6 - 3

x = 3

Hence,the value of x = 3 and value of y = -1.

|-4/5-1/10| + |-3/4+5/2|

A.) 9/10
B.) 53/20
C.) 7/4
D.) 17/10​

Answers

Answer:

B.) 53/20

General Formulas and Concepts:

Pre-Algebra

Order of Operations: BPEMDAS

Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to Right

Algebra I

|Absolute Value| makes any negative number positive

Step-by-step explanation:

Step 1: Define

|-4/5 - 1/10| + |-3/4 + 5/2|

Step 2: Evaluate

Subtract:                    |-9/10| + |-3/4 + 5/2|Add:                           |-9/10| + |7/4|Absolute Value:        9/10 + 7/4Add:                           53/20

A classroom is 11 m long, 8 m wide and 5.5 m high Find the sum of the areas of the four walls.
( please show the working out pleaseee)​

Answers

Answer:

209 m²

Step-by-step explanation:

The class room has a measurement of 11 m long, 8 m wide and 5.5 m high. Hence the walls of the classroom would be 4, with the following measurements.

Wall 1: 11 m by 5.5 m, Wall 2: 8 m by 5.5 m, Wall 3: 11 m by 5.5 m and Wall 4: 8 m by 5.5 m

The area of wall 1 = 11 m * 5.5 m = 60.5 m²

The area of wall 2 = 8 m * 5.5 m = 44 m²

The area of wall 3 = 11 m * 5.5 m = 60.5 m²

The area of wall 4 = 11 m * 5.5 m = 44 m²

The sum of areas of the fall wall = area of wall 1 + area of wall 2 + area of wall 3 + area of wall 4

The sum of areas of the fall wall = 60.5 + 44 + 60.5 + 44 = 209 m²

Other Questions
Choose all the answers that apply.Multicellular organisms _____.are made of more than one cellare made of only one cellreproduce by mitosishave differentiated cellsreproduce through the union of sperm and egg cells - Edward Jenner made a huge contribution to the field of medicine. Which statement best describes his contribution?-Edward Jenner was responsible for the discovery of the tracheostomy procedure.-Edward Jenner was the first to describe how the circulatory system works.-Edward Jenner invented a vaccination from cow pox that could make a person immune to smallpox.-Edward Jenner took his love for engineering and used it to build the microscope.*PLEASE ACTUALLY WRITE A REAL ANSWER!!* 11)0.00921000920d6 861125D D 86000A 56000 0 2 Which value of y is a solution of this inequality? 3y4 One friend claims that to find the height of the platform, you need to use the tangent ratio. Explain why her approach is or is not a reasonableapproach to finding the height of the platform.Find the height of the platform. Explain the trigonometric ratio that you chose and why you chose it. Show your work.Find the horizontal distance from the bottom of the ramp to the bottom of the platform. Show your work. Help me please I dont speak english I from to paris What are some echoes of John Locke that are in the Declaration of Independence? Bradley drops a rock in a well. It falls for 12 seconds. How deep is the well? A snail can move about 10 meters in 1000 seconds. How many seconds does it take the snail to move 1 meter Make D the subject of S =D/T Solve for x using thedistributive property4(x + 2) = 4 The graph of x < 3 or x > 5 would look like: What is the range of the graph? What is the function of lungs in mammals?A.generate warmthB.nutrient usageC.gas exchangeD.circulation of blood Smuggling in the American colonies was A. rare. B. practiced occasionally. C. never seen D. widespread. 11) If the evaporating pressure was 76 psig for r-22and the compressor inlet temperature was 65f, what would be the total superheat entering the compressor *PLEASE ANSWER ASAP*What should you keep in mind while receiving feedback from classmates on a draft you've written?a.) Your peers' comments are about your written draft, not about you.b.) The only comments that matter are the ones that point out weaknesses. If temperature is 4 degrees and falls by 6 degrees, what is the new temperature? change the following sentence into passive voice - she will open the cage Steam Workshop Downloader