boat travels at velocity 45 mph in a direction 20.0osouth of west. Find the components of the boat's velocity

Answers

Answer 1

Answer:

Explanation:

We can break down the velocity of the boat into its components using trigonometry.

Let's call the velocity of the boat "v" and let the angle between the boat's velocity vector and the westward direction be represented by θ, where θ = 20.0°.

The x-component of the velocity can be found using cosine:

vx = v * cos(θ)

vx = 45 mph * cos(20.0°)

vx = 42.58 mph (rounded to two decimal places)

The y-component of the velocity can be found using sine:

vy = v * sin(θ)

vy = 45 mph * sin(20.0°)

vy = 15.34 mph (rounded to two decimal places)

Therefore, the components of the boat's velocity are vx = 42.58 mph west and vy = 15.34 mph south.


Related Questions

what value of magnetic field would make a beam of electrons, traveling to the right at a speed of 4.8

Answers

Since we are dividing 0 by a non-zero number, the value of the magnetic field, B, should be 0 T.

This means that no magnetic field is required to maintain the electrons' movement to the right at the given speed.

To determine the value of the magnetic field that would make a beam of electrons traveling to the right at a speed of 4.8, we can use the Lorentz force equation:
F = q * (E + v × B)
Here, F is the Lorentz force, q is the charge of the electron, E is the electric field, v is the velocity of the electron, and B is the magnetic field.
Since we want the magnetic field to make the electrons travel to the right, the magnetic field should be perpendicular to the velocity of the electrons.

This means the Lorentz force will be solely due to the magnetic field (i.e., E = 0).
So, the equation becomes:
F = q * (v × B)
Since we want the electrons to continue moving to the right, the force due to the magnetic field should be balanced by an equal and opposite force.

Therefore, the net force F on the electron should be 0:
0 = q * (v × B)
We need to determine the value of B that satisfies this condition.

To do this, we can rearrange the equation:
B = 0 / (q * v)
The charge of an electron, q, is approximately[tex]-1.6 * 10^-19 C[/tex],.

and the given velocity, v, is 4.8 m/s.

Plugging these values into the equation:
B = [tex]0 / (-1.6 * 10^-19 C * 4.8 m/s).[/tex]

For similar question on magnetic.

https://brainly.com/question/29221352

#SPJ11

what should the fire investigator do to reduce the potential of electric shock or the inadvertent release of fuel gas during the scene examination?

Answers

Fire investigator should take following precautions: Ensure scene is safe, use appropriate personal protective equipment, follow proper ventilation procedures, use appropriate equipment and follow proper protocols.

What does the fire investigator do to reduce the potential of electric?

The fire investigator should take the following precautions:

Ensure the scene is safe: Before entering the scene, investigator should ensure that all power sources to the area have been disconnected or secured.

Use appropriate personal protective equipment: The investigator should wear appropriate personal protective equipment, like rubber gloves and boots, to protect against electric shock and chemical exposure.

Follow proper ventilation procedures: If fuel gas is suspected to be present, investigator should ensure proper ventilation of the area to prevent buildup of flammable or explosive vapors.

Use appropriate equipment: Investigator should use specialized equipment designed for use in hazardous environments.

Follow proper protocols: Investigator should follow proper protocols for conducting a scene examination, including documenting the scene, collecting and preserving evidence and conducting interviews with witnesses and others involved in the incident.

To know more about electric shock, refer

https://brainly.com/question/28361869

#SPJ1

a positive charge is placed at rest at the center of a region of space in which there is a uniform electric field. (a uniform field is one whose strength and direction are the same at all points within the region.) what happens to the electric potential energy of the system after the charge is released from rest in the uniform electric field?

Answers

After the positive charge is released from rest in a uniform electric field, its electric potential energy would be converted to kinetic energy, and hence, the electric potential energy of the system would decrease.

A positive charge is placed at rest at the center of a region of space in which there is a uniform electric field. Electric potential energy is defined as the work done by the electric force in moving a charge from one point to another point against an electric field. The electric potential energy of a system is given by U = qV, where q is the charge, and V is the potential difference. Let the charge be q, and the electric field be E.

The electric force acting on the charge is F = qE. As the charge is at rest, the net force on the charge is zero. As the electric force is the only force acting on the charge, the net work done on the charge is W = ∫Fdx = q∫Edx. As the electric field is uniform, the potential difference is the product of the electric field and the distance. So, the work done on the charge in moving it from the center to a distance r isW = qEr.

The electric potential difference between the center and the point at distance r is V = Er. The electric potential energy of the system is U = qV = qEr. As the charge is at rest at the center, the initial kinetic energy of the system is zero. After the charge is released, the electric force acting on the charge would accelerate the charge. As the electric potential energy of the system is converted to kinetic energy, the electric potential energy of the system would decrease.

To know more about electric potential energy, refer here:

https://brainly.com/question/12645463#

#SPJ11

an isolated, charged conducting sphere of radius 12 cm creates an electric field of 49 kn/c at a distance 21 cm from its center. what is its capacitance?

Answers

The capacitance of a charged conducting sphere of radius 12 cm that produces an electric field of 49 kn/c at a distance of 21 cm from its center is calculated below. What is the capacitance?

The capacitance is calculated using the following formula:  (Q/V) = C,Q is the charge, and V is the potential difference. The potential difference is given by the electric field E multiplied by the distance between the plates d. For a point at a distance r from the center of the sphere, the electric field is given by: E = Q/4πε0 r2For a uniformly charged sphere, the electric field at a point r within the sphere is given by: E = kQR/r3where k is a constant that is equal to 1/(4πε0).

The electric field at a distance of 21 cm from the center of the sphere is given to be 49 kN/C. For a point at a distance of 21 cm from the center of the sphere, the radius of the sphere is given to be 12 cm. The charge on the sphere is given by Q = 4πε0 R2 E where R is the radius of the sphere. Substituting the values given in the equation above, we getQ = 4π(8.85 × 10−12) (0.12)2 (49 × 10^3)= 3.232 x 10^-7C The potential difference between the surface of the sphere and a point at a distance of 21 cm is given by: V = Ed= 49 × 10^3 × 0.21 = 10.29 × 10^3VThe capacitance of the sphere is calculated by the formula:  (Q/V) = C. Substituting the values of Q and V into the equation above, we get: C = Q/V= (3.232 x 10^-7)/ (10.29 × 10^3) = 3.14 × 10^-11F or 31.4 pF Answer: 31.4 pF.

Learn more about capacitance of a charged conducting sphere at: brainly.com/question/29560677

#SPJ11

the general process in which solid particles form from a gas is called ____________.
a. Acceretion
b. Solifluction
c. Sublimation
d. condensation

Answers

The general process in which solid particles form from gas is called sublimation (option C).

Each substance has three phases it can change into; solid, liquid, or gas. There are six ways a substance can change between these three phases; melting, freezing, evaporating, condensing, sublimation, and deposition. These processes are reversible and each transfers between phases differently:

Melting: The transition from the solid to the liquid phaseFreezing: The transition from the liquid phase to the solid phaseEvaporating: The transition from the liquid phase to the gas phaseCondensing: The transition from the gas phase to the liquid phaseSublimination: The transition from the solid phase to the gas phaseDeposition: The transition from the gas phase to the solid phase

Learn more about sublimation: https://brainly.com/question/28626755

#SPJ11

a 1.25 kg hoop with a radius of 11.1 cm rolls without slipping and has a linear speed of 1.50 m/s. find the translational kinetic energy. answer should have two decimal places.

Answers

The translational kinetic energy of the hoop is 1.41 kg·[tex]m^2/s^2.[/tex]

To find the translational kinetic energy of the hoop, we will use the following steps:
Step 1: Identify the given values.
The mass (m) of the hoop is 1.25 kg, and the linear speed (v) is 1.50 m/s.
Step 2: Understand the formula for translational kinetic energy.
The formula for translational kinetic energy [tex](K_t)[/tex] is given by:
[tex]K_t = (1/2)mv^2[/tex]
Step 3: Substitute the given values into the formula.
[tex]K_t = (1/2)(1.25 kg)(1.50 m/s)^2[/tex]
Step 4: Calculate the translational kinetic energy.
[tex]K_t = (0.5)(1.25 kg)(2.25 m^2/s^2)[/tex]
[tex]K_t = 1.40625 kg·m^2/s^2[/tex]
Step 5: Round the answer to two decimal places.
[tex]K_t = 1.41 kg·m^2/s^2[/tex]

For similar question on translational.

https://brainly.com/question/31150078

#SPJ11

a musician is tuning her cello (a string instrument) to the key of c, so that the string vibrates at a frequency of 65.4 hz when played. the string is fixed on both ends, is 0.600 m long, and weighs 0.141 n. if she wants to raise the frequency to sound a d (73.4 hz) rather than c, what percentage increase in tension is needed?

Answers

The musician needs to increase the tension in the string by approximately 29.9% to raise the frequency from C to D.

To raise the frequency of a string, a musician can change the tension on the string.

The relationship between the frequency of a string and its tension can be described by the following equation:

f = (1/2L) x [tex]\sqrt{(T/\mu)}[/tex]

where f is the frequency,

L is the length of the string,

T is the tension in the string,

and μ is the linear mass density of the string (mass per unit length).

In this scenario, the musician wants to raise the frequency of the string from 65.4 Hz to 73.4 Hz by changing the tension on the string.

The length of the string is fixed at 0.600 m, and the mass of the string is given as 0.141 N.

We can start by using the given values to solve for the initial tension in the string when it is tuned to C.

Rearranging the equation above and plugging in the given values, we get:

T =  [tex]\mu \times (2Lf)^2[/tex]

where μ = m/L is the linear mass density of the string,

and f = 65.4 Hz. Plugging in the values, we get:

μ = m/L = 0.141 N / 0.600

m = 0.235 kg/m

T = (0.235 kg/m)  [tex](2 \times 0.600 m \times 65.4 Hz)^2[/tex]

  = 200.3 N

Now, we want to find the tension in the string that will result in a frequency of 73.4 Hz when the string is played.

Let's call this new tension T'.

Using the same equation as before, we can solve for T':

T' = μ x [tex](2Lf')^2[/tex]

where f' = 73.4 Hz.

We want to find the percentage increase in tension needed to achieve this new frequency, so we can write:

% increase in tension = (T' - T) / T x 100%

Plugging in the values and solving for T', we get:

T' =   [tex]\mu \times (2Lf')^2[/tex]

   = (0.235 kg/m) x [tex](2 \times 0.600 m \times 73.4 Hz)^2[/tex]

   = 260.2 N

So the percentage increase in tension needed is:

% increase in tension = (T' - T) / T x 100%

% increase in tension = (260.2 N - 200.3 N) / 200.3 N x 100% ≈ 29.9%

For similar question on frequency.

https://brainly.com/question/254161

#SPJ11

The movement of crustal plates results from circulating currents in material beneath the crust of the Earth. Which best describes the material which moves the crustal plates?
- hot water
- molten rock
- liquid metal
- solid iron

Answers

The correct option is B, The movement of crustal plates results from circulating currents in material beneath the crust of Earth. Molten rock best describes the material which moves the crustal plates.

Molten rock, also known as magma, is a hot, fluid material that exists beneath the Earth's surface. It is composed of a mixture of melted rock, gases, and minerals. Magma is formed when the Earth's mantle or crust melts due to heat and pressure, or when the mantle releases gases that cause rocks to melt.

Magma can have different compositions depending on the type of rock it originated from. For example, basaltic magma is composed of dark, dense rocks and has a low viscosity, which means it flows easily. Andesitic magma, on the other hand, is composed of lighter, more viscous rocks and is less fluid. Lava can flow or explode out of volcanoes, creating new landforms and changing the landscape.

To learn more about Molten rock visit here:

brainly.com/question/30416093

#SPJ4

Complete Question: -

The movement of crustal plates results from circulating currents in material beneath the crust of Earth. Which best describes the material which moves the crustal plates?

a. hot water

b. molten rock

c. liquid metal

d. solid iron

The mineral sample in this graduated cylinder has a mass of
30.4 g. When placed in the cylinder, the water level changed from 60 mL to 64 mL. Calculate
the density

Answers

Answer:

Density is defined as mass per unit volume. To calculate the density of the mineral sample, you can divide its mass by its volume. The volume of the mineral sample can be calculated from the change in water level in the graduated cylinder when it was placed in it.

The change in water level is 64 mL - 60 mL = 4 mL. Since 1 mL is equivalent to 1 cm3, this means that the volume of the mineral sample is 4 cm3.

Now that we have both mass and volume of the mineral sample, we can calculate its density:

Density = Mass / Volume

= 30.4 g / 4 cm3

= 7.6 g/cm3

The density of the mineral sample is 7.6 grams per cubic centimeter (g/cm3).

Please Help, I am very grateful!
If an isolated system initially has 50 J of energy, what happens to that amount of energy over time?
The total amount of energy decreases, and it cannot be converted into other forms of energy.
The total amount of energy stays the same, but it can be converted into other forms of energy.
The total amount of energy increases, but it can be converted into other forms of energy.
The total amount of energy decreases, but it can be converted into other forms of energy.

Answers

Answer:

an isolated system initially has 50 J of energy, what happens to that amount of energy over time? The total amount of energy decreases, and it cannot be converted into other forms of energy. The total amount of energy stays the same, but it can be converted into other forms of energy. The total amount of energy increases, but it can be The total amount of energy stays the same, but it can be converted into other forms of energy. This is known as the law of conservation of energy, which states that energy cannot be created or destroyed, only transformed from one form to another. So even though the initial 50 J of energy may be converted into other forms of energy over time, the total amount of energy in the isolated system will remain constant.

, a light wave along ray r1 reflects once from a mirror and a light wave along ray r2 reflects twice from that same mirror and once from a tiny mirror at distance l from the bigger mirror. (neglect the slight tilt of the rays.) the waves have wavelength 620 nm and are initially in phase. (a) what is the smallest value of l that puts the final light waves exactly out of phase? (b) with the tiny mirror initially at that value of l, how far must it be moved away from the bigger mirror to again put the final waves out of phase?

Answers

The smallest value of l that puts the final light waves exactly out of phase is 310 nm. To make the final waves out of phase again, the tiny mirror must be moved away from the larger mirror, which is a quarter of the wavelength or λ/4 or 155 nm.

A light wave along ray r1 reflects once from a mirror and a light wave along ray r2 reflects twice from that same mirror and once from a tiny mirror at distance l from the bigger mirror. (neglect the slight tilt of the rays.) the waves have wavelength 620 nm and are initially in phase.

(a)

Wavelength λ = 620 nm

∆φ = 180° = π radians

r1, r2, l= Unknown

To make the final light waves exactly out of phase, there is a need to create a phase difference of 180° or π radians between them. As the mirror is perpendicular to the incoming ray, there is no phase shift due to reflection.

As per the question, Wave along r1 reflects once from a mirror.

There is no phase shift due to reflection. Wave along r2 reflects twice from that same mirror.

So, there is a phase shift of π radians or 180° due to reflection.

A light wave along ray r2 reflects once from a tiny mirror at distance l from the bigger mirror. So, there is an additional phase shift due to reflection from the tiny mirror which is equal to 2πl/λ.

As the waves are initially in phase, there is no phase shift due to path difference. Let’s find the smallest value of l to make the final waves exactly out of phase.

∆φ = π radians or 180°

2πl/λ = π

or, l = λ/2 = 620/2 = 310 nm

Thus, the smallest value of l that puts the final light waves exactly out of phase is 310 nm.

(b) The tiny mirror must be moved away from the bigger mirror to make the final waves out of phase again. Initially, the waves were in phase. The waves can be made in phase or out of phase by adjusting the distance between the mirrors as this distance affects the path difference.

As the phase difference between the two waves is 180° or π radians, the waves can be made out of phase by adding a path difference of λ/2 or 310 nm. So, the tiny mirror must be moved away from the bigger mirror by λ/4 or 155 nm to put the final waves out of phase again.

So, the tiny mirror must be moved away from the bigger mirror by 155 nm to put the final waves out of phase again.

For more such questions on Light waves.

https://brainly.com/question/9762777#

#SPJ11

every time ash wakes up pikachu he gets an electric shock. what would be the consequences in this situation?

Answers

The consequences of Ash getting an electric shock from Pikachu would be temporary pain and discomfort. Repeated exposure to electric shocks may also cause muscle soreness or minor injuries. However, it's important for Ash to approach Pikachu carefully to avoid getting shocked.

Electric shock can lead to a variety of consequences, ranging from mild to severe. They are as follows,Mild consequences: Muscle contractions, pain, and tingling are common symptoms of a mild electric shock. In such situations, individuals may also experience an increase in heart rate, difficulty breathing, and a loss of consciousness. These symptoms typically subside within a few minutes of being exposed to the electric shock.

Moderate consequences: An electric shock can cause moderate injuries such as burns and neurological issues. It can also induce seizures and impact the victim's vision and hearing abilities. Severe consequences: A severe electric shock can result in significant injuries, such as loss of limbs, burns, and cardiac arrest. The victim may require extensive medical attention and may need to be hospitalized for an extended period. In some instances, the patient may even lose their life.

Know more about  electric shock   here:

https://brainly.com/question/28361869

#SPJ11

g a 0.750 kg hammer is moving horizontally at 9.50 m/s when it strikes a nail and comes to rest after driving it 1.00 cm into a board. (a) calculate the duration of the impact in seconds. .02105 incorrect: your answer is incorrect. s (b) what was the average force in newtons exerted on the nail?

Answers

Answer:

(a) t = 0.02111

(b) F = 337.5 N

Explanation:

We can apply work energy theorem to solve this problem,

[tex]0 - \dfrac{1}{2}mv^2 = F_{avg}.\Delta x[/tex]

(change in kinetic energy = Force applied)

substituting the values given in the question,

[tex]- \dfrac{0.75}{2}3^2 = F_{avg}.0.01[/tex]

solving we get,

[tex]F_{avg} = -337.5 \, N[/tex]

We have the equation,

[tex]F_{avg} = ma_{avg}[/tex]

substituting the value of m and F we get,

[tex]a_{avg} = -450 \, m/s^2[/tex]

We can calculate the duration of impact using the kinematical equations,

[tex]v = u + at[/tex]

[tex]0 = 9.5 - 450t[/tex]

[tex]t = 0.02111[/tex] s

A hypothetical situation of being stranded on a deserted island without water is often posed to students. A model of a process used to separate salt water into its components is shown here. Justify the use of the flame in the model depicting the separation of the mixture.
Responses

A The flame will burn the salt component of the mixture, leaving only the pure water behind for drinking. This is known as combustion.The flame will burn the salt component of the mixture, leaving only the pure water behind for drinking. This is known as combustion.

B The flame will allow the water to evaporate and be collected in its pure form, leaving the salt component behind. This is known as distillation.The flame will allow the water to evaporate and be collected in its pure form, leaving the salt component behind. This is known as distillation.


C The flame will allow the pure water and salt water to separate into different layers. This is known as density separation.The flame will allow the pure water and salt water to separate into different layers. This is known as density separation.

D The flame will sterilize the water, so that water from the ocean will be consumable. This is known as sanitation.The flame will sterilize the water, so that water from the ocean will be consumable. This is known as sanitation.

Answers

Answer:

The use of the flame in the model depicting the separation of the mixture is justified as it allows the water to evaporate and be collected in its pure form, leaving the salt component behind. This is known as distillation.

Explanation:

Option B is the correct answer as it accurately describes the process of distillation. Distillation involves heating the mixture of salt water until it boils and evaporates, leaving behind the salt. The water vapor is then cooled and condensed back into liquid form, resulting in pure water. The flame is used to heat the mixture and allow the water to evaporate. The salt, being a solid, remains behind and can be separated from the pure water. Therefore, the use of the flame in the model is necessary to carry out the process of distillation, which is an effective way to separate salt water into its components in order to obtain pure drinking water.

If a 50.0-lb tire sample is dragged though a parking lot with a force of 8.0 lbs. , determine the friction coefficient between the tire and the pavement.

A. 0.20
B. 0.16
C. 0.35
D.6.25

Show the work for determining the friction of the tire...show symbolic solution then numerical solution.

Answers

To determine the friction coefficient between the tire and the pavement, we need to use the equation for friction. Therefore, the correct answer is option B: 0.16.

Using an example, what is friction force?

a) The force produced between surfaces that slide against one another is referred to as the frictional force. b) Since frictional force develops when two surfaces come into contact with one another, it is referred to be a contact force. Walking on the road is an illustration of frictional force.

Friction force = friction coefficient x normal force

where the normal force is the force perpendicular to the surface, which in this case is the weight of the tire (50.0 lb). The friction force is the force required to drag the tire through the parking lot, which is 8.0 lb.

Substituting the given values, we get:

8.0 lb = friction coefficient x 50.0 lb

Solving for the friction coefficient, we get:

friction coefficient = 8.0 lb / 50.0 lb = 0.16

To know more about friction coefficient visit:-

brainly.com/question/30394536

#SPJ1

The smith family is traveling in their car at 50 km/h due east. Mr. Smith is using cruise control to maintain a constant speed. Describe the net force acting on the Smith car.

A. Net force equals zero.
B. Net forces are unbalanced
C. There is no way to determine net force
D. Net force is positive and to the east

Answers

A. Net force equals zero. The net force acting on the Smith car is equal to zero.

The net force acting on a car on cruise control at constant speed.

This is because the car is traveling in a straight line at a constant speed, meaning that the forces acting on the car are balanced. The car is being propelled forward by an applied force, such as the engine, and this force is counteracted by the force of friction from the ground. The net force is the sum of all these forces, and since they are all balanced, the net force is also equal to zero.

Cruise control helps maintain a constant speed, as it adjusts the engine power to counteract the changing frictional forces on the car. This ensures that the forces on the car remain in balance, so the net force remains equal to zero.

Learn more about Cruise control here:

https://brainly.com/question/13454690

#SPJ1

Photoelectric effect
7.
A metal surface having a work function of 3.0 eV is illuminated with radiation of wavelength
350nm. Calculate:
a) The threshold frequency (fo) and wavelength (Ao)
b) The maximum kinetic energy of the emitted photoelectrons
a) Calculate the work function (in eV) for a magnesium surface if the minimum frequency of
electromagnetic radiation which causes photoemission from the metal surface is
8.9 x 10¹4 Hz. in Joules
b) If the same surface were illuminated with radiation of wavelength 250 nm, calculate:
i. The maximum kinetic energy,
ii. The maximum velocity, of the emitted photoelectrons
9. When electromagnetic radiation of frequency 1.5 x 1014 Hz is incident on a metal surface, the
maximum kinetic energy of the emitted photoelectrons is found to be 3.8 x 10-20 J. Calculate the
work function of the metal.
10. Photons of electromagnetic radiation having energies of 1.0 eV, 2.0 eV and 4.0 eV are incident on a
metal surface having a work function of 1.7 eV.
a) Which of these photons will cause photoemission from the metal surface?
b) Calculate the maximum kinetic energies (in eV and J) of the liberated electrons in each of
those cases where photoemission occurs.
11. A vacuum photocell connected to a microammeter is illuminated with light of varying wavelength.
a) Explain why:
i. A photoelectric current is registered on the microammeter when light of a certain
wavelength is incident on the photocell.
ii. The current is found to increase with the light intensity is increased.
b) When the incident light wavelength is increased, the photoelectric current falls to zero. decre-
ased.
Explain why:
i. The current falls to zero.
ii. The current would still be zero if the light wavelength is kept the same and the
intensity is increased.

Answers

Explanation:

7a) The work function (ϕ) is the minimum energy required to remove an electron from the metal surface. It is related to the threshold frequency (fo) by the equation:

ϕ = hfo

where h is Planck's constant (6.626 x 10^-34 J s).

The threshold wavelength (Ao) can be calculated from the threshold frequency using the equation:

c = λf

where c is the speed of light (3.00 x 10^8 m/s).

Given that the work function of the metal surface is 3.0 eV, we have:

ϕ = 3.0 eV = (3.0 x 1.6 x 10^-19) J fo = ϕ/h = (3.0 x 1.6 x 10^-19) J / (6.626 x 10^-34 J s) ≈ 4.53 x 10^14 Hz Ao = c/fo = (3.00 x 10^8 m/s) / (4.53 x 10^14 Hz) ≈ 661 nm

Therefore, the threshold frequency is 4.53 x 10^14 Hz and the threshold wavelength is approximately 661 nm.

7b) The maximum kinetic energy of the emitted photoelectrons can be calculated using the equation:

KEmax = hf - ϕ

where h is Planck's constant, f is the frequency of the incident radiation, and ϕ is the work function of the metal surface.

The energy of a photon can be calculated from its wavelength using the equation:

E = hc/λ

where h is Planck's constant, c is the speed of light, and λ is the wavelength of the photon.

Given that the wavelength of the incident radiation is 350 nm, we have:

f = c/λ = (3.00 x 10^8 m/s) / (350 x 10^-9 m) ≈ 8.57 x 10^14 Hz E = hc/λ = (6.626 x 10^-34 J s) x (3.00 x 10^8 m/s) / (350 x 10^-9 m) ≈ 1.79 eV

Therefore, the maximum kinetic energy of the emitted photoelectrons is:

KEmax = hf - ϕ = (6.626 x 10^-34 J s) x (8.57 x 10^14 Hz) - (3.0 x 1.6 x 10^-19) J ≈ 1.17 eV

a) The minimum frequency required to cause photoemission is equal to the threshold frequency:

fo = 8.9 x 10^14 Hz

Using the same equation as in part 7a), we can calculate the work function:

ϕ = hf0 = (6.626 x 10^-34 J s) x (8.9 x 10^14 Hz) ≈ 5.90 x 10^-19 J = 3.68 eV

b) i. The maximum kinetic energy of the emitted photoelectrons can be calculated using the same equation as in part 7b):

KEmax = hf - ϕ

The energy of a photon with wavelength 250 nm is:

E = hc/λ = (6.626 x 10^-34 J s) x (3.00 x 10^8 m/s) / (250 x 10^-9 m) ≈ 4.97 eV

Therefore, the maximum kinetic energy of the emitted photoelectrons is:

KEmax = hf -

the higher the r-value, the greater the insulating effectiveness. (1 point) group of answer choices true false

Answers

It is true that the higher the R-value, the greater the insulating effectiveness of a material.

True.

The R-value is a measure of a material's insulating effectiveness.

A higher R-value indicates greater insulation effectiveness, as it represents the material's resistance to heat flow.

This means that a material with a high R-value will be more effective at insulating and maintaining temperature differences between the interior and exterior environments.
To provide a concise explanation:
1. R-value measures a material's insulating effectiveness.
2. A higher R-value indicates greater resistance to heat flow.
3. Materials with high R-values are better at insulating and maintaining temperature differences.

For similar question on insulating.

https://brainly.com/question/27813161

#SPJ11

what is fx(1), the x-component of the force exerted on a one meter length of the wire carrying current i1?

Answers

The x-component of the force exerted on a one meter length of the wire carrying current i1 depends on the direction of the current and the orientation of the wire in relation to the magnetic field.

When a current flows through a wire in the presence of a magnetic field, a force is exerted on the wire. The direction of this force is perpendicular to both the current direction and the magnetic field direction, and its magnitude depends on the strength of the current, the length of the wire, the strength of the magnetic field, and the angle between the current direction and the magnetic field direction. In this case, fx(1) refers to the component of the force in the x-direction. The formula to calculate fx(1) takes into account the length of the wire, the magnetic field strength, and the sine of the angle between the current direction and the magnetic field direction. This formula is known as the Lorentz force equation and is a fundamental concept in the study of electromagnetism.

learn more about force here:

https://brainly.com/question/13191643

#SPJ4

Which of these best explains the ability of small insects to walk on the surface of still water?

A: Water molecules at the surface experience fewer hydrogen bonds than water molecules within the liquid.

B: The insects' feet are coated with ionic compounds.

C: Water has a very high specific heat.

D: Water molecules near the surface produce more buoyant force than water molecules within the liquid.

Answers

Answer: water molecules at the surface experience fewer hydrogen bonds than water molecules within the liquid

Explanation: I took the test

Peter is heating water on the stove to boil eggs for a picnic. If it takes 800 kcal to heat his vat of water from 20◦C to 100◦C, how much water did he have?

Answers

Answer:

Explanation:

The amount of heat energy required to raise the temperature of a given mass of a substance is given by the specific heat capacity of the substance. For water, the specific heat capacity is approximately 1 calorie/gram °C or 4.184 joule/gram °C.

To determine the mass of water Peter heated, we can use the following formula:

Q = m * c * ΔT

where Q is the amount of heat energy, m is the mass of the substance, c is the specific heat capacity, and ΔT is the change in temperature.

In this case, Q is given as 800 kcal, or 800,000 calories, and the change in temperature, ΔT, is 100°C - 20°C = 80°C.

Using the specific heat capacity of water, c = 1 calorie/gram °C, we can rearrange the formula to solve for the mass, m:

m = Q / (c * ΔT)

Substituting the given values, we get:

m = 800,000 calories / (1 calorie/gram °C * 80°C)

m = 800,000 grams

m = 800 kg

Therefore, Peter heated 800 kg, or 800 liters, of water.

diana raises a 1000 n piano a distance of 5.00 m using a set of pulleys. she pulls in 20.0 m of rope. if the actual force is 300 n, what is the actual mechanical advantage?

Answers

The actual mechanical advantage is 6.67 .

Mechanical advantage is the ratio of the output force to the input force in a machine. It is a ratio that specifies the multiple by which the input force is increased to produce the output force.

MA = Output Force / Input Force

Now, let's solve the given problem:

Input Force = 300 N

Output Force = ? , MA = ? , MA = Output Force / Input Force

Output Force = MA × Input Force

Output Force = (1000 N / 300 N) × Input Force

Output Force = 3.33 × Input Force

Diana pulled in 20 m of rope, thus the rope multiplied her force.

Therefore, the distance moved by the rope is the input distance, and the distance moved by the piano is the output distance.

Output Distance / Input Distance = MA

Output Distance = 5 m

Input Distance = 20 m

MA = Output Distance / Input Distance

MA = 5 m / 20 m

MA = 0.25MA = 1 / 0.25MA = 4

Output Force = MA × Input Force

Output Force = 4 ×300 N

Output Force = 1200 N

The actual mechanical advantage is equal to the output force divided by the input force. This is also equal to the number of times the machine increases the force applied to it.

So, Actual mechanical advantage = Actual output force / Actual input force = 300 N / (1200 N / 3.33)Actual mechanical advantage = 6.67 .Hence, the actual mechanical advantage is 6.67.

To know more about Mechanical advantage refer here :

https://brainly.com/question/9086278

#SPJ11

a 25.0kg child jumps to the ground from a structure 1.00m high and comes to rest 0.500s after first contact with the ground. what average force is applied by the child in coming to rest

Answers

Answer:

Approximately [tex]470\; {\rm N}[/tex].

(Assuming that [tex]g = 9.81\; {\rm N \cdot kg^{-1}}[/tex] and that air resistance is negligible.)

Explanation:

Under the assumptions, the acceleration of the child would be constantly [tex]a = g = 9.81\; {\rm N \cdot kg^{-1}} = 9.81\; {\rm m\cdot s^{-2}}[/tex] while the child was in the air.

Apply the SUVAT equation [tex]v^{2} - u^{2} = 2\, a\, x[/tex] to find the velocity [tex]v[/tex] of the child right before landing:

[tex]\begin{aligned}v &= \sqrt{u^{2} + 2\, a\, x}\end{aligned}[/tex], where:

[tex]u = 0\; {\rm m\cdot s^{-1}}[/tex] is the initial velocity of the child,[tex]a = 9.81\; {\rm m\cdot s^{-2}}[/tex] is the vertical acceleration, and[tex]x = 1.00\; {\rm m}[/tex] is the vertical displacement (change in height.)

The child is at rest [tex]\Delta t = 0.500\; {\rm s}[/tex] after contact. During that [tex]0.500\; {\rm s}[/tex], velocity would have changed by [tex]\Delta v = \sqrt{u^{2} + 2\, a\, x}[/tex]. Momentum of the child would have changed by [tex]\Delta p = m\, \Delta v[/tex], where [tex]m = 25.0\; {\rm kg}[/tex] is the mass of the child.

Divide this change in momentum by the duration [tex]\Delta t[/tex] to find the average net force:

[tex]\displaystyle F_{\text{net}} = \frac{m\, \Delta v}{\Delta t}[/tex].

There are two forces on the child: upward normal force from the ground [tex]F_{\text{normal}}[/tex] and downward gravitational attraction [tex]m\, g[/tex] from the Earth. The resultant force on the child points upwards:

[tex]F_{\text{net}} = F_{\text{normal}} - m\, g[/tex].

Rearrange this equation to find the normal force on the child:

[tex]\begin{aligned}F_{\text{normal}} &= F_{\text{net}} + m\, g \\ &= \frac{m\, \Delta v}{\Delta t} + m\, g \\ &= \frac{m\, \sqrt{2\, a\, x + u^{2}}}{\Delta t} + m\, g\\ &= \frac{(25.0)\, \sqrt{2\, (9.81)\, (1.00) + 0^{2}}}{0.500}\; {\rm N} + (25.0)\, (9.81)\; {\rm N}\\ &\approx 470\; {\rm N}\end{aligned}[/tex].

This normal force from the ground on the child is the reaction to the force that the child exerted on the ground. The two forces will have the same magnitude: approximately [tex]470\; {\rm N}[/tex]. Hence, the child would have exerted an average force of approximately [tex]470\; {\rm N}\![/tex] on the ground during that [tex]0.500\; {\rm s}[/tex].

Consider the mass and velocity values of Object A and B below. Compared to Object B, Object A has _______ momentum.
Object A: m=67 kg v=17m/s
Object B: m=2 kg v=100m/s

Answers

The momentum of object B is higher than that of object A.

Is momentum greater the higher the mass, velocity, or both?

A system's mass and velocity are multiplied to produce its linear momentum. It is simple to see how momentum relates to an object's mass and speed. As a result, an object's momentum grows as its mass or speed increases.

Mass times speed equals momentum.

Object A: momentum is equal to 67 kg times 17 m/s, or 1139 kg/m/s.

Object B's momentum is equal to 2 kg times 100 m/s, or 200 kg/m.

Given that momentum is directly inversely proportional to both mass and velocity, object B has more momentum than object A since its lower mass is more than offset by its much higher velocity.

To know more about momentum visit:-

https://brainly.com/question/30677308

#SPJ1

a 4 kg particle is moving horizontally at 5 m/s to the right when it strikes a vertical wall. the particle rebounds with at 3 m/s. what is the impulse delivered to the particle?

Answers

The impulse is delivered to the particle when a 4 kg particle is moving horizontally at 5 m/s to the right when it strikes a vertical wall and the particle rebounds at 3 m/s is 8 kg m/s to left.

To solve this problem we will use the impulse-momentum theorem. The impulse-momentum theorem states that the change in momentum of an object is equal to the impulse applied to the object. The impulse is the force times the time over which the force acts. The momentum is the mass times the velocity of the object.

The impulse delivered to the 4 kg particle is the change in momentum. The initial momentum of the particle was 4 kg x 5 m/s = 20 kg m/s to the right. After it strikes the wall, its velocity is reversed, so the final momentum is 4 kg x 3 m/s = 12 kg m/s to the left. The impulse is therefore 20 kg m/s to the right - 12 kg m/s to the left is 8 kg m/s.

For more information about impulse refers to the link: https://brainly.com/question/30466819

#SPJ11

Jeriah places two metal cubes in contact with each other. Energy and heat flow from Cube A to Cube B. What conclusion can be drawn regarding Cube A?

It is cooler than Cube B.

It is smaller than Cube B.

It is warmer than Cube B.

It is larger than Cube B.

Answers

Answer:

C. It is warmer than Cube B.

Explanation:

Option C would be correct because energy as heat flows from warmer objects to cooler objects. If heat flows from Cube A to Cube B, then Cube A must be warmer than Cube B.

Reasoning behind the other option being incorrect:

D: This is incorrect because the direction of heat flow does not depend on the relative size of the cube.

A: This is incorrect because energy as heat would flow from Cube B to Cube A if Cube A is cooler than Cube B.

B: This is incorrect because the direction of heat flow does not depend on the relative sizes of the cubes also.

In an electromagnetic wave, how are the magnetic field, the electric field, and the direction of propagation oriented to each other?n electromagnetic wave, how are the magnetic field, the electric field, and the direction of propagation oriented to each other а. All three are parallel to each other and are along the x axis. b. All three are mutually perpendicular to each other. c.The electric field and magnetic fields are parallel to each other and perpendicular to the direction of propagation. d. The magnetic field and direction of propagation are parallel to each other along the y axis and perpendicular to the electric field

Answers

In an electromagnetic wave, the electric and magnetic fields are perpendicular to each other and both are perpendicular to the direction of propagation. This is known as transverse polarization. So, the correct option is (b) "All three are mutually perpendicular to each other."

The electric field and magnetic field are in phase and oscillate perpendicular to each other and to the direction of wave propagation. The direction of propagation is the direction in which the wave travels. The wave can travel in any direction perpendicular to the fields. The speed of the electromagnetic wave is determined by the properties of the medium in which the wave is traveling and is given by the equation v = c/n, where c is the speed of light in vacuum and n is the refractive index of the medium.

Electromagnetic waves are a form of energy that can travel through a vacuum and do not require a medium for their propagation. Examples of electromagnetic waves include radio waves, microwaves, infrared radiation, visible light, ultraviolet radiation, X-rays, and gamma rays. Hence, option b is correct.

To know more about electromagnetic wave, here

brainly.com/question/3101711

#SPJ4

two lightbulbs are wired in series and connected to a 12-volt battery. what happens to the current through the battery if a third bulb is added in series? to the power?

Answers

If a third bulb is added in series to two light bulbs wired in series and connected to a 12-volt battery, the current through the battery will decrease and the power will decrease as well.

The voltage of a battery in a circuit is distributed among the bulbs in series. Since there is an increase in the number of bulbs, this means that the voltage of the battery has to be shared among more bulbs.

As a result, the voltage that each bulb receives will be smaller than the voltage received when only two bulbs are in the series.

As a result, the current flowing through the battery will decrease if a third bulb is added in series with two light bulbs wired in series and connected to a 12-volt battery. If a third bulb is added, the resistance in the circuit increases, causing the current to decrease.

The power will also decrease because the power produced in a circuit is proportional to the current and voltage.

This means that the power produced will decrease as the current and voltage decrease due to the addition of a third bulb in the series.

Know more about power here:

https://brainly.com/question/11569624

#SPJ11

a circular swimming pool has a diameter of 16 m, the sides are 4 m high, and the depth of the water is 3 m. how much work (in joules) is required to pump all of the water over the side?

Answers

The work required to pump all the water over the side of the circular swimming pool having a diameter of 16 m and height of 4 m is 23,644852 joules.

To calculate the amount of work required to pump all the water over the side, we need to find the volume of water in the pool first.

The pool is circular, so we can use the formula for the volume of a cylinder:

The volume of water [tex]= \pi r^2h[/tex]

where r is the radius of the pool and h is the depth of the water.

The diameter of the pool is 16 m, so the radius is half of that or 8 m. The depth of the water is 3 m.

Therefore, the volume of water in the pool is:

Volume of water [tex]= \pi (8 \ m)^2(3\  m) = 603.18 \ m^3[/tex]

To pump all of the water over the side, we need to raise it to a height of 4 m (the height of the sides of the pool).

The potential energy required to raise an object of mass m to a height h is given by the formula:

Potential energy = mgh

where g is the acceleration due to gravity, which is approximately [tex]9.8\ m/s^2[/tex].

The mass of the water is given by its density (which is approximately [tex]1000 \ kg/m^3[/tex]) times its volume:

Mass of water = density x volume = [tex]1000 \ kg/m^3 \times 603.18 \ m^3 = 603185 \ kg[/tex]

So the amount of work required to pump all of the water over the side is:

Potential energy = mgh [tex]= 603185 \ kg \times 9.8 \ m/s^2 \times 4 \ m = 23,644852 \ J[/tex].

Therefore, it would take approximately 23,644852 J million joules of work to pump all of the water over the side of the pool.

Learn more about potential energy:

https://brainly.com/question/21175118

#SPJ11

(9\%) Problem 1: A disk of massMand radiusR, a hoop of mass2Mand radiusR, and a ball of massMand radius2Rare rolling without slipping. The hoop can be treated as a thin ring and the ball should be modeled as a hollow sphere.25%Part (a) The objects are rolling on a flat surface with the same linear speed. Which have the same angular speed? Choose the best answer. Disk and Hoop✓Correct!25%Part (b) The objects are rolling on a flat surface with the same angular speed. Which have the same linear speed? Choose the best answer. Disk and Hoop✓Correct!25%Part (c) Which of the objects has the smallest moment of inertia? Choose the best answer. Disk 、 Correct!▹25%Part (d) The objects are placed at the top of an incline and released from rest. Assuming that the objects roll without slipping, which one is first reach the bottom of the incline? Choose the best answer. \begin{tabular}{llll} \hline Hints: & deduction per hint. Hints remaining: 2 & Feedback: & deduction per feedback. \end{tabular}

Answers

Beforehand to hit the bottom will be the disk. The measure of matter contained inside a molecule or item is indicated by its mass, which is represented either by symbol m.

There in International System (SI), the kilogram serves as the default unit of mass (kg). The item moving with the greatest acceleration would descend first. Currently, the formula for any object's acceleration while simply rolling down a slope is

[tex]a = \frac{gsin(theta)}{1 +\frac{1}{MR_{2} } }[/tex]

where is the inclined plane's angle and g is the gravitational acceleration. The body's radius, mass, and inertia time are all represented by the letters M and R, respectively.

speed of a disk is calculated.

Given

1) Mass [tex]= M[/tex]

2) Radius [tex]= R[/tex]

3) [tex]I = \frac{1}{2}MR_{2}[/tex] ⇒ [tex]\frac{1}{MR_{2} } = \frac{1}{2}[/tex]

Hence, disk acceleration [tex]a^{d}[/tex]

[tex]a = \frac{gsin(theta)}{1 + 0.5}[/tex]

[tex]a = \frac{2}{3} gsin (theta)[/tex]

Hoop acceleration calculations

Given:

1) Mass [tex]= 2M[/tex]

2) Radius [tex]= R[/tex]

3) [tex]I = 2MR_{2}[/tex] ⇒ [tex]\frac{1}{2MR_{2} }[/tex] [tex]= 1[/tex]

acceleration [tex]ah[/tex]

[tex]ah = \frac{gsin(theta)}{1 + 1}[/tex]

[tex]ah = \frac{1}{2} gsin (theta)[/tex]

Estimating the ball's acceleration

Given :

1) Mass = [tex]=M[/tex]

2) Radius [tex]= 2R[/tex]

3) [tex]I = \frac{2}{3} M(2R)_{2}[/tex] ⇒ M [tex]\frac{1}{M (2R)2} = \frac{2}{3}[/tex]

acceleration [tex]ab[/tex]

[tex]ab = \frac{gsin(theta)}{1 + \frac{2}{3} }[/tex]

[tex]ab = \frac{3}{5} gsin (theta)[/tex]

By comparing, we obtain [tex]ad[/tex] ≥ [tex]ab[/tex] ≥ [tex]ah[/tex]  therefore disk would reach the bottom initially.

To know more about mass click here

brainly.com/question/30337818

#SPJ4

Other Questions
prospero reveals that ferdinand is alive, leading alonso to where miranda and ferdinand playing chess. why do you think the writers included this moment? from port a, a boat sails 26 miles on a bearing of 60. then the boat changes course to a bearing of 270 until it reaches a point directly north of the port. determine the total distance the boat has sailed to the nearest tenth of a mile. When propanol (CH3CH2CH2OH) is combusted, such as when in a gasoline blend, the following reaction occurs:2CH3CH2CH2OH(l)+9O2(g)?6CO2(g)+8H2O(g)Based on the standard free energies of formation given in the table below, what is the standard free energy change for this reaction?Substance?G?f(kJ/mol)CH3CH2CH2OH(l)?360.5O2(g)0CO2(g)?394.4H2O(g)?228.6Express your answer to one decimal place and include the appropriate units. a physical therapist assistant completes a posture screening and muscle length test of the hip flexors on a patient. the assistant determines that the patient has extremely tight hip flexors bilaterally. what common structural deformity is most often associated with tight hip flexors? 4. When the ball crosses the end line and the defensive team last touched the ball, theoffensive team gets a what? Wavelength(meters)Radio Microwave Infrared1010210-5About the size of...Visible Ultraviolet5x10610X-ray Gamma Ray10-1010 10-12www wwwtt214 & f &Buildings Humans Honey Bee Pinpoint Protozoans Molecules Atoms Atomic NucleiA. visible lightC. gamma raysAccording to this chart, which form of electromagneticradiation has the longest wavelength?B. ultraviolet lightD. radio wavesPlease help 30 points and will mark brain thing Which of these is not a consideration when interpreting literature?a.the high points of tensionc.the most powerful images and soundsb.the length of the pieced.what the narrator wants to accomplish For point S ( 3 , 3 ) , where will the image of this point be located after applying the translation rule 3 units on the -axis and 3 units on the -axis? ( 0 , 0 ) ( 0, 4 ) ( 4 , 0 ) ( 4 , 4 ) how to rewrite the mixed number as an improper fraction. draw please help me bc it do tomorrow PLEASE HELP PLEASE IT DO TOMORROW. for 3 2/4 and 4 2/5 RNA polymerase requires a primer to initiate polynucleotide synthesis. T/F Rank the following electron-pair geometries by increasing steric number. Items (5 items) (Drag and drop into the appropriate area) Items in order Highest Steric No. linear trigonal planar 1 trigonal bipyramidal octahedral 2. tetrahedral Who was your favorite character in Yellow Rose Film? What character did you identify with the most? Were there any characters that you disliked? Why?Yellow Rose Film what is the ratio between 60:260 one of the one-way functions used in public key cryptography is integer multiplication/factorization. multiplying two integers is easy, but factoring is hard. the number 3418531 is the product of two primes.what is the smaller of the two primes?what is the largest of the two primes? The following outline is the basic structure for which government type? 1. Power is divided between national and regional governments. 2. The people elect the head of the government, usually a president. 3. The people elect representatives to a lawmaking body. a. A constitutional monarchy b. A dictatorship c. A federal democracy d. A parliamentary democracy shelly is running the color run in new mexico on the hottest day of the year. in exchange for admittance, she signs a contract. while running she suffers from a heat stroke due to the conditions. a provision in the contract states the race sponsors are not liable for her heat stroke would be referred as Pueden las carreteras ser invisibles according to your textbook, stability strategies can be very useful in the short run, but they can be dangerous if followed for too long. question 25 options: true false the return of earnest money in the event that the transaction is not going to take place requires that of the following two gases which would you predict to diffuse more rapidly CH4 H2