At a constant temperature and pressure, there are initially 0.6400 moles in a balloon with a volume of 4.00 L. Gas is removed until there is a total of 0.3500 moles. Calculate the volume of the balloon after this change.

The equilibrium concentration of ethyl acetate is 4.02 M.

The balanced chemical equation for the reaction is:

acetic acid + ethanol ⇌ ethyl acetate + water

We are given that the initial concentration of acetic acid and ethanol is 8.29 M and that the equilibrium concentration of acetic acid is 3.28 M. Let's call the equilibrium concentration of ethyl acetate x.

Using the equilibrium constant expression for this reaction:

Kc = [ethyl acetate][water] / [acetic acid][ethanol]

We know that this reaction is balanced, meaning that the stoichiometric coefficients for the reactants and products are equal. Therefore, we can write:

Kc = [ethyl acetate][water] / [acetic acid][ethanol]

Kc = x(8.29 - 3.28) / (3.28)(8.29 - x)

Kc = 1.47

Now we can use the equilibrium constant expression to solve for x:

1.47 = x(8.29 - 3.28) / (3.28)(8.29 - x)

1.47(3.28)(8.29 - x) = x(8.29 - 3.28)

12.0437 - 1.47x = 8.29x - 27.1924

9.76x = 39.2361

x = 4.02 M

Therefore, the equilibrium concentration of ethyl acetate is 4.02 M.

learn more about reversible reaction here

https://brainly.com/question/21426719

#SPJ1

In 0.05μg, there are  [tex]6.9 * 10^{15} molecules[/tex]  of batrachotoxin.

To calculate the number of molecules of batrachotoxin, we first need to calculate the molar mass of the molecule. This can be done by adding up the atomic masses of the elements in the compound. The elements in batrachotoxin are carbon (C), hydrogen (H), nitrogen (N), and oxygen (O). The atomic masses of these elements are 12 g/mol for C, 1 g/mol for H, 14 g/mol for N, and 16 g/mol for O. Therefore, the molar mass of batrachotoxin is:

Molar mass = 12 g/mol C + 1 g/mol H + 14 g/mol N + 16 g/mol O

Molar mass = 43 g/mol

We then need to calculate the mass of 0.05 μg of batrachotoxin. This can be done by converting 0.05 μg to grams. To do this, we divide 0.05 μg by 1,000,000. This gives us:

[tex]\frac{0.05\mu g }{ 1,000,000 }= 0.00000005 g[/tex]

Now we can calculate the number of molecules of batrachotoxin in 0.05 μg by dividing the mass in grams by the molar mass:

Number of molecules =[tex]\frac{ 0.00000005 g }{ 43 g/mol}[/tex]

Number of molecules = [tex]1.16 * 10^{-8} mol[/tex]

Finally, we can calculate the number of molecules by multiplying the number of moles by Avogadro's number:

Number of molecules =[tex]\frac{1.16 * 10^{-8 }mol * 6.022 * 10^{23 }molecules}{mol}[/tex]

Number of molecules = [tex]6.9 * 10^{15} molecules[/tex]

Therefore, there are  [tex]6.9 * 10^{15} molecules[/tex]  of batrachotoxin in 0.05 μg.

learn more about molecules Refer:brainly.com/question/19556990

#SPJ1

complete question:Batrachotoxin, C31H42N2O6 an active component of South American arrow poison, is so toxic that 0.05μg can kill a person.

How many molecules is this? Express your answer as an integer

If the reaction's measured product has impurities that increase its mass over what it would be if it were pure, higher percent yields than 100% are attainable.

Because the real yield is frequently lower than the theoretical value, percent yield is typically lower than 100%. This may be due to incomplete or conflicting reactions or sample loss during recovery.

It implies that interest rates will increase further, yields will increase, and bond prices would decline as a result. So, it is likely that the bond market will continue to see unusually high levels of volatility in the near future.

To know more about percent yields visit:-

brainly.com/question/12704041

#SPJ1

Answer: To perform the conversions, we can use the following conversion factors:

1 atm = 760 mmHg

1 atm = 101.325 kPa

1 atm = 14.696 psi

1 atm = 101325 Pa

1 Torr = 1/760 atm

1 Pa = 1/101325 atm

Using these conversion factors, we can perform the conversions as follows:

958.5 mmHg = 958.5/760 atm = 1.2625 atm (rounded to 4 decimal places)

2.325 atm = 2.325 x 760 Torr = 1767 Torr (rounded to the nearest whole number)

444.4 kPa = 444.4/101.325 atm = 4.3817 atm (rounded to 4 decimal places)

1427.2 mmHg = 1427.2/760 atm = 1.8789 atm

= 1.8789 x 101325 Pa = 190694.87 Pa (rounded to 2 decimal places)

Therefore, the conversions are:

958.5 mmHg = 1.2625 atm

2.325 atm = 1767 Torr

444.4 kPa = 4.3817 atm

1427.2 mmHg = 190694.87 Pa

The conversions is given as: 958.5 mmHg=1.26 atm, 2.325 atm=1767.9 Torr, 444.4 kPa=4.381 atm and 1427.2 mmHg= 190237.2 Pa

Conversions refer to the process of changing a quantity or value from one unit of measurement to another. It involves converting the numerical value while maintaining the same physical quantity.

1 atm = 760 mmHg (Torr)

1 atm = 101.325 kPa

1 mmHg (Torr) = 133.322 Pa

Converting 958.5 mmHg to atm:

958.5 mmHg × (1 atm / 760 mmHg) = 1.26 atm

Converting 2.325 atm to Torr:

2.325 atm ×(760 mmHg / 1 atm) = 1767.9 Torr

Converting 444.4 kPa to atm:

444.4 kPa × (1 atm / 101.325 kPa) = 4.381 atm

Converting 1427.2 mmHg to Pa:

1427.2 mmHg × (133.322 Pa / 1 mmHg) = 190237.2 Pa

To know more about conversions, here:

https://brainly.com/question/33338623

#SPJ6

The empirical formula for the compound containing 37.5% carbon, 12.6% hydrogen, and 49.9% oxygen is CH₄O

The following data were obtained from the question:

From the above data, we can obtain the empirical formula for the compound as shown below:

Divide by their molar mass

C = 37.5 / 12 = 3.125

H = 12.6 / 1 = 12.6

O = 49.9 / 16 = 3.119

Divide by the smallest

C = 3.125 / 3.119 = 1

H = 12.6 / 3.119 = 4

O = 3.119 / 3.119 = 1

Thus, we can conclude that the empirical formula is CH₄O

Learn more about empirical formula:

https://brainly.com/question/29153210

#SPJ1

Answer:

Constructive interference is when two waves interact causing larger waves because the crest will meet a crest or a trough will meet a trough which adds the waves together changing the size of the amplitude.

Destructive interference is when two waves interact causing smaller waves because the crest will meet a trough or a trough will meet a crest which subtracts the waves together changing the size of the amplitude.

The answer to your question is D) An invasive species is not native to the ecosystem and causes harm.

Invasive species of plants and animals typically tend to overtake an ecosystem that they do not naturally occur in. Due to this, it causes the resources within the ecosystem to diminish which ultimately harms other species that naturally occur in said ecosystem.

Answer:

False. Magnets do not need to touch in order to be affected by magnetic force. Magnetic force is a non-contact force that can act on objects that are some distance apart. The strength of the force depends on the distance between the magnets and their magnetic properties.

The pressure exerted by 2 moles of CO2 gas at a temperature of 27 degrees Celcius and a volume of 4 liters would be 12.27 atm.

For an ideal gas:

PV = nRT

Where:

In this case, n = 2 mole, v = 4 liters, and R = 0.08206

T = 27 + 273.15 = 300.15 K

Now we can plug in the values:

P(4) = (2)(0.08206)(300.15)

P = (2)(0.08206)(300.15) / 4

P = 12.27 atm

Therefore, the pressure exerted by 2 moles of CO2 gas at a temperature of 27 degrees Celsius and a volume of 4 liters is 12.27 atm.

More on ideal gas can be found here: https://brainly.com/question/28257995

#SPJ1

Ca(OH)2 in an aqueous solution with a pH of 11.67 has a concentration of 2.50 x 10(-3) M.

The calcium hydroxide aqueous solution has a pH of 11.03. Two moles of hydroxide ions are created from one mole of an aqueous solution of calcium hydroxide.

The pH of a solution can be related to the concentration of hydroxide ions ([OH-]) through the equation: pH + pOH = 14

We can rearrange this equation to solve for [OH-]: [OH-] = 10^(-pOH)

Thus: Ca(OH)2 → Ca^2+ + 2 OH-

Since the molar ratio of Ca(OH)2 to [OH-] is 1:2, the concentration of hydroxide ions in the saturated solution can be calculated as follows:

[OH-] = 2 x [Ca(OH)2]

Now we can use the pH value given in the problem to calculate the pOH:

pOH = 14 - pH

pOH = 14 - 11.67

pOH = 2.33

Substituting this value into the equation for [OH-]:

[OH-] = 10^(-pOH)

[OH-] = 10^(-2.33)

[OH-] = 5.01 x 10^(-3) M

In order to get the concentration of the solution, we can apply the equation for the concentration of hydroxide ions in a saturated solution of Ca(OH)2:

[Ca(OH)2] = [OH-] / 2

[Ca(OH)2] = 5.01 x 10^(-3) M / 2

[Ca(OH)2] = 2.50 x 10^(-3) M

To know more about concentration visit:-

https://brainly.com/question/29276511

#SPJ1

Answer:

B subtract

Explanation:

they are pulling away from one another so a and c are out of the question then that leaves you with b or d but we're not dividing anything. soooo we're left with B.

Answer:

1. To determine the number of moles of copper in 5.00 grams of copper wire, we need to use the molar mass of copper. The molar mass of copper is 63.55 g/mol. We can use the following conversion factor:

1 mol Cu = 63.55 g Cu

Using this conversion factor, we can calculate the number of moles of copper:

5.00 g Cu × (1 mol Cu / 63.55 g Cu) = 0.0787 mol Cu

Therefore, there are 0.0787 moles of copper in 5.00 grams of copper wire.

2. To determine the number of moles of glycine molecules in 28.35 grams of glycine, we need to use the molar mass of glycine. The molar mass of glycine is 75.07 g/mol. We can use the following conversion factor:

1 mol glycine = 75.07 g glycine

Using this conversion factor, we can calculate the number of moles of glycine molecules:

28.35 g glycine × (1 mol glycine / 75.07 g glycine) = 0.3778 mol glycine

Therefore, there are 0.3778 moles of glycine molecules in 28.35 grams of glycine.

3. a. To determine the mass of the daily dietary allowance of vitamin C in grams, we can use the following conversion factor:

1 mol C6H8O6 = 176.12 g C6H8O6

Using this conversion factor, we can calculate the mass of the allowance:

1.42 × 10^-4 mol C6H8O6 × (176.12 g C6H8O6 / 1 mol C6H8O6) = 0.0248 g

Therefore, the mass of the daily dietary allowance of vitamin C for children aged 4-8 years is 0.0248 grams.

b. To determine the number of moles of carbon in 1.42 × 10^-4 mol of C6H8O6, we can use the molar mass of carbon. The molar mass of carbon is 12.01 g/mol. There are 6 carbons in each molecule of C6H8O6, so we can use the following conversion factor:

6 mol C / 1 mol C6H8O6

Using this conversion factor, we can calculate the number of moles of carbon:

1.42 × 10^-4 mol C6H8O6 × (6 mol C / 1 mol C6H8O6) = 8.52 × 10^-4 mol C

Therefore, there are 8.52 × 10^-4 moles of carbon in 1.42 × 10^-4 mol of C6H8O6.

(Please could you kindly mark my answer as brainliest you could also follow me so that you could easily reach out to me for any other questions)

We need to use the mole ratio and in this case the mole ratio of the MgCl2 to the chloride ions is 1:2

In chemistry, a mole ratio is the ratio of the amounts, in moles, of any two compounds or elements involved in a chemical reaction. It is determined by the coefficients of the balanced chemical equation for the reaction.

Mole ratios can be used in stoichiometric calculations to determine the amount of one substance that is required to react with a given amount of another substance, or to calculate the amount of product that will be formed from a given amount of reactant.

Learn more about mole ratio:https://brainly.com/question/15288923

#SPJ1

At 273 K and 1 atm, the helium gas's volume is [tex]4.33 * 10^{-23} L[/tex] .

The volume of a gas can be calculated using the Ideal Gas Law, which states that PV = nRT,

where V is the gas's volume, n is its moles in existence, R is the ideal gas constant (8.314 J/mol K), T is the gas's temperature in Kelvin, and P is the gas's atmospheric pressure.

Given that the number of moles of the gas is 1.505 x 10-23 and the temperature is 273 K (0°C), we can rearrange the equation to solve for V:

[tex]V = \frac{nRT}{P}\\[/tex]

[tex]V = \frac{(1.505 * 10^{-23})(8.314 J/mol-K)(273 K)}{(1 atm)}[/tex]

[tex]V = 4.33 * 10^{-23} L[/tex]

Therefore, the volume of the helium gas at 273 K and 1 atm is [tex]4.33 * 10^{-23} L[/tex]

learn more about  helium gas Refer:brainly.com/question/13645498

#SPJ1

The standard change in Gibbs free energy for the reaction at 25 °C is 278.0 kJ/mol  for the given enthalpy of reaction .

The Gibbs free energy (or Gibbs energy as the preferred name; symbol G) is a thermodynamic potential that can be used to calculate the maximum amount of non-volume expansion work that a thermodynamically closed system can perform at constant temperature and pressure. It also serves as a prerequisite for processes like chemical reactions that may place under these conditions. The Gibbs free energy is denoted by the symbol G(p,T) = U+pV-TS = H-TS, where p denotes pressure, T denotes temperature, U denotes internal energy, V denotes volume, H denotes enthalpy, and S denotes entropy.

A thermodynamic quantity equal to a system's entire heat content. It is equivalent to the system's internal energy plus the product of pressure and volume.

According to the table, the standard Gibbs free energy of formation values are;

Fe₂O₃ (s) = -822.1 kJ/mol

Al₂O₃ (s) = -1675.2 kJ/mol

Al (s) = -1477.7 kJ/mol

Fe (s) = 0 kJ/mol

The reaction is:

Fe₂O₃ (s) + 2 Al (s) → Al₂O₃ (s) + 2 Fe (s).

Therefore, the standard change in Gibbs free energy for the reaction at 25 °C is:

AG = -822.1 kJ/mol + (2 x -1477.7 kJ/mol) - (-1675.2 kJ/mol) - (2 x 0 kJ/mol) = 278.0 kJ/mol

To know more about Gibbs free energy ,visit ;

https://brainly.com/question/20358734

#SPJ1

The balanced chemical equation for the reaction between hydrochloric acid (HCI) and sodium hydroxide (NaOH) is:

HCI + NaOH -> NaCl + H2O

From the equation, we can see that 1 mole of HCI reacts with 1 mole of NaOH to produce 1 mole of NaCl and 1 mole of water.

First, let's calculate the number of moles of HCI in 250 mL of 0.25 M solution:

Molarity (M) = moles of solute / volume of solution (L)

0.25 M = moles of HCI / 0.25 L

moles of HCI = 0.25 L x 0.25 M = 0.0625 moles

Since 1 mole of NaOH reacts with 1 mole of HCI, we will need 0.0625 moles of NaOH to neutralize the HCI.

Now, let's calculate the volume of 0.9 M NaOH solution needed to provide 0.0625 moles of NaOH:

Molarity (M) = moles of solute / volume of solution (L)

0.9 M = 0.0625 moles of NaOH / volume of NaOH solution (L)

volume of NaOH solution (L) = 0.0625 moles / 0.9 M = 0.0694 L = 69.44 mL

Therefore, 69.44 mL of 0.9 M NaOH solution would be required to titrate 250 mL of 0.25 M HCI solution.

Answer: Na2CO3(aq) + CuCl2(aq) → 2 NaCl(aq) + CuCO3(s).

Explanation:

Answer:

To calculate vapor pressure lowering:

Use ΔP = X2 * P2° equation, where X2 is the mole fraction of the solute and P2° is the vapor pressure of the pure solvent at the same temperature.

Calculate mole fraction of glycerol by using moles of glycerol and water.

Calculate vapor pressure of pure water at 50°C using the Antoine equation.

Substitute the values and calculate the vapor pressure lowering, which is 0.459 torr for this problem.

The vapor pressure lowering is 0.213 torr when 10.0 mL of glycerol is added to 500 mL of water at 50°C.

Pressure exerted by vapor in thermodynamic equilibrium with its condensed phases at a certain given temperature in closed system is called vapor pressure.

ΔP = X2 * P0 * (1 - (ρ1 / ρ2))

ΔP is vapor pressure lowering, X2 is mole fraction of the solute (glycerol), P0 is vapor pressure of solvent (water), and ρ1 and ρ2 are the densities of solvent and solution, respectively.

As, moles of glycerol = mass of glycerol / molar mass of glycerol

moles of glycerol = (10.0 mL)(1.26 g/mL) / (92.09 g/mol)

moles of glycerol = 0.136 mol

and moles of water = mass of water / molar mass of water

= (500 mL)(0.988 g/mL) / (18.02 g/mol)

moles of water = 27.5 mol

So, total moles = moles of glycerol + moles of water

total moles = 0.136 mol + 27.5 mol

total moles = 27.6 mol

X2 (mole fraction of glycerol) = moles of glycerol / total moles

= 0.136 mol / 27.6 mol

X2 = 0.00493

ΔP = X2 * P0 * (1 - (ρ1 / ρ2))

= (0.00493)(92.5 torr) * (1 - (0.988 g/mL / 1.250 g/mL))

ΔP = 0.213 torr

Therefore, the vapor pressure lowering is 0.213 torr when 10.0 mL of glycerol is added to 500 mL of water at 50°C.

To know more about vapor pressure, refer

https://brainly.com/question/4463307

#SPJ1

Two solid potassium (K) combine with two liquid water (H2O) molecules to generate two aqueous potassium hydroxide (KOH) and one gaseous hydrogen (H2) molecule. For this reaction, the chemical equation is balanced as follows:

2K(s) + 2H2O(l) → 2KOH(aq) + H2(g)

The chemical reaction between potassium and water is depicted in this equation. Two liquid water (H2O) molecules and two solid potassium (K) atoms serve as the reactants.

The reaction moves from the left to the right, as shown by the arrow sign, which also denotes its direction.

In the reaction, hydrogen gas and potassium hydroxide are created when potassium atoms interact with water molecules.

Two molecules of aqueous potassium hydroxide (KOH) and one molecule of gaseous hydrogen (H2) are the reaction's end products.

According to the correctly balanced chemical equation, two potassium atoms and two water molecules combine to form two molecules of potassium hydroxide and one hydrogen gas molecule.

learn more about potassium hydroxide here

https://brainly.com/question/28330489

#SPJ1

Answer:the concetraion of chrolune decrease

Explanation:because the chrolune not stable

Answer:

The change in pH is 0.04.

The ratio of neutrons to protons, or the N/Z ratio, plays a crucial role in determining a nucleus' stability. The range of N/Z ratios in which nuclei are stable is generally referred to as the belt of stability.

If the forces between the constituents of the nucleus are equal, an atom is stable. If these forces are out of balance or if the nucleus has an excessive amount of internal energy, an atom is unstable (radioactive).

Z = 104 for Rutherfordium, element 104. The isotopes 261Rf and 262Rf, having masses of 261 and 262, respectively, have the longest half-lives. Accordingly, N/Z ratios are:

261Rf: N/Z = (261-104)/157 = 1.08

262Rf: N/Z = (262-104)/158 = 1.09

These N/Z ratios are a little bit higher than the average belt of stability values, which are about 1.0 for heavy nuclei. These isotopes are thought to be reasonably stable because they are close enough.

Z = 109 for Meitnerium, element 109. The isotopes 278Mt and 282Mt, with masses of 278 and 282, respectively, have the longest half-lives. Accordingly, N/Z ratios are:

278Mt: N/Z

To know more about neutrons visit:-

https://brainly.com/question/29248303

#SPJ1

The helium sample would occupy a volume of 11.12 L if the pressure is reduced to 5.15 atm while maintaining the temperature at 20 °C.

According to Boyle's Law, gas volume grows as pressure lowers. According to Charles' Law, a gas expands in volume as its temperature rises. Moreover, Avogadro's Law states that as gas concentration rises, so does its volume.

The relationship between pressure, volume, and temperature of a gas is given by the ideal gas law:

PV = nRT

where P is the pressure of the gas, V is its volume, n is the number of moles of gas present, R is the gas constant, and T is the temperature of the gas in kelvins.

Assuming that the number of moles and the temperature of the gas remain constant, we can use the ideal gas law to solve for the new volume of the gas when the pressure is reduced:

P1V1 = P2V2

where P1 is the initial pressure, V1 is the initial volume, P2 is the final pressure, and V2 is the final volume.

Substituting the given values:

P1 = 5.79 atm

V1 = 9.89 L

P2 = 5.15 atm

T = 20 + 273.15 = 293.15 K (converting Celsius to Kelvin)

We can solve for V2:

P1V1 = P2V2

(5.79 atm)(9.89 L) = (5.15 atm)V2

V2 = (5.79 atm)(9.89 L) / (5.15 atm)

V2 = 11.12 L

To know more about temperature visit:-

brainly.com/question/29072206

#SPJ1

Arrhenius base -  Releases OH ions when dissolved in water

Arrhenius acid - Releases H+ ions when dissolved in water

Bronsted-Lowry base  - Accepts a proton

Bronsted-Lowry acid - donates a proton

An Arrhenius base is a molecule that decomposes into an OH- or hydroxide in solution when dissolved in water. Look for a molecule ending in OH that does not follow CHx, which denotes an alcohol, to identify the Arrhenius base. Examples of Arrhenius bases include sodium hydroxide, or NaOH.

A substance that raises the concentration of H+ ions in an aqueous solution is known as an Arrhenius acid. Traditional Arrhenius acids are highly polarized covalent substances that dissociate in water to form an anion (A-) and the cation H+. Often, the H+ is referred to as a proton.

Count the hydrogens on each component before and after the reaction to determine if it is an acid or a basic. If there are fewer hydrogens, then the substance is acid (donates hydrogen ions). The material is the base if the hydrogen count has increased (accepts hydrogen ions).

To know more about the Bronsted-Lowry base visit;

https://brainly.com/question/12377772

#SPJ1

The solution has a pH of around 5.93.

When a weak acid or a weak base is applied in modest amounts, buffer solutions withstand the pH shift. A buffer made of a weak acid and its salt is an example of which is an acetic acid and sodium acetate solution (CH3COOH + CH3COONa).

The weak acid is then partially dissociated in water, resulting in the conjugate base and hydrogen ions:

CH3COOH + H2O ⇌ H3O+ + CH3COO-

The acid dissociation constant, Ka, which is what this reaction's equilibrium constant is, is as follows:

Ka = [H3O+][CH3COO-]/[CH3COOH]

The Henderson-Hasselbalch equation may be used to determine the pH of a solution:

pH = pKa + log([A-]/[HA])

To begin with, we must figure out how much CH3COOH is present in the solution:

moles of CH3COOH = M x V = 0.15 mol/L x 0.050 L = 0.0075 mol

mass of CH3COOH = moles x molar mass = 0.0075 mol x 60.05 g/mol = 0.450 g

After adding sodium acetate, the solution's residual CH3COOH will be:

0.450 g - 1.00 g

= -0.55 g

The amount of sodium acetate supplied may be used to determine the CH3COO- concentration:

moles of CH3COO-=1.00g/82.03 g/mol

=0.0122 mol

The concentration of CH3COO- in the solution will be:

0.0122 mol/0.050 L=0.244 M

The Henderson-Hasselbalch equation may now be used to determine the pH of the solution:

pH = pKa + log([A-]/[HA])

pKa = -log(Ka) = -log(1.75 x 10⁻⁵) = 4.756

[A-]/[HA] = [CH3COO-]/[CH3COOH]

= 0.244 M / 0.0075 M = 32.53

pH = 4.756 + log(32.53)

= 5.93

To know more about solution visit:-

https://brainly.com/question/22695394

#SPJ1

0.50 mοI οf  titanium diοxide is prοduced with 100 g οf titanium tetrachIοride. Thus the cοrrect answer is οptiοn (c).

The baIanced chemicaI equatiοn fοr the reactiοn is:

TiCI₄ + 2 H₂O → TiO₂ + 4 HCI

Frοm the equatiοn, we can see that 1 mοIe οf TiCI₄ prοduces 1 mοIe οf TiO₂.

Tο caIcuIate the number οf mοIes οf TiO₂ prοduced frοm 100 g οf TiCI₄, we need tο first determine the number οf mοIes οf TiCI₄ present in 100 g.

The mοIar mass οf TiCI₄ is 189.68 g/mοI (47.867 + 4 x 35.453). Using this mοIar mass, we can caIcuIate the number οf mοIes οf TiCI₄ in 100 g as:

mοIes οf TiCI₄= mass οf TiCI₄/ mοIar mass οf TiCI₄

mοIes οf TiCI₄= 100 g / 189.68 g/mοI

mοIes οf TiCI₄= 0.5276 mοI

Since 1 mοIe οf TiCI₄ prοduces 1 mοIe οf TiO₂, the number οf mοIes οf TiO₂ prοduced is aIsο 0.5276 mοI.

Therefοre, the cοrrect answer is οptiοn (c) 0.50 mοI.

Learn more about titanium dioxide here:

brainly.com/question/12162067

#SPJ1

0.5 moles of [tex]H_{2[/tex][tex]O_{2}[/tex] produces 8 grams of [tex]O_{2}[/tex].

What is Moles?

Mole is a unit of measurement used in chemistry to express the amount of a substance. It is defined as the amount of a substance that contains the same number of entities (such as atoms, molecules, or ions) as there are atoms in 12 grams of carbon-12. This number is known as Avogadro's number.

To use dimensional analysis, we need to set up the given equation in terms of units. We can use the molar mass of[tex]H_{2}[/tex][tex]O_{2}[/tex] and [tex]O_{2}[/tex] to convert between moles and grams:

2[tex]H_{2}[/tex]O2 → 2[tex]H_{2}[/tex] + [tex]O_{2}[/tex]

The balanced equation shows that 2 moles of [tex]H_{2}[/tex][tex]O_{2}[/tex] produce 1 mole of [tex]O_{2}[/tex]. We can use this ratio to convert between moles of [tex]H_{2}[/tex][tex]O_{2}[/tex]and moles of[tex]O_{2}[/tex].

0.5 moles of [tex]H_{2}[/tex]O2 x (1 mole of [tex]O_{2}[/tex] / 2 moles of[tex]H_{2}[/tex][tex]O_{2}[/tex]) = 0.25 moles of [tex]O_{2}[/tex]

Now we can use the molar mass of [tex]O_{2}[/tex] to convert moles to grams:

0.25 moles of [tex]O_{2}[/tex] x (32 g of [tex]O_{2}[/tex] / 1 mole of [tex]O_{2}[/tex]) = 8 g of [tex]O_{2}[/tex]

Learn more about Moles from the given link

brainly.com/question/15356425

#SPJ1

Answer:

Hept

Explanation:

Non- 9 C9

Dec- 10 C10

Eth- 2 C2

Hepth- 7 C7

So the answer is D, because it idicates a molecule with 7 carbon atoms.

Hopefully this helps! :)

The balanced equation for the reaction between silver nitrate (AgNO3) and sodium chloride (NaCl) to form silver chloride (AgCl) and sodium nitrate (NaNO3) is:

AgNO3 + NaCl → AgCl + NaNO3

A balanced equation is a representation of a chemical reaction that shows the reactants and products involved, as well as the ratios in which they combine. The law of conservation of mass states that in a chemical reaction, the mass of the reactants must be equal to the mass of the products, which means that the number and type of atoms on both sides of the equation must be the same.

To balance an equation, coefficients are added to the reactants and products so that the number of atoms of each element on the left side of the equation is equal to the number on the right side. For example, the combustion of methane gas can be represented by the equation CH4 + 2O2 → CO2 + 2H2O.  Balanced equations are essential for understanding chemical reactions and predicting the amount of reactants needed and products formed.

To learn more about Balanced equation visit here:  

brainly.com/question/12192253

#SPJ4