Arrange the balanced biochemical equations for all the reactions in the payoff phase of glycolysis and the conversion of pyruvate to lactate. First step Last step Answer Bank Pyruvate + NADH+H lactatc + NAD 1,3-Bisphosphoglycerate + ADP — 3-phosphoglycerate + ATP Glyceraldehyde 3.phosphate + P + NAD+ 1,3-bisphosphoglycerate + NADH + H+ Phosphoenolpyruvate + ADP — pyruvate + ATP 2-Phosphoglycerate phosphoenolpyruvate 3-Phosphoglycerate 2-phosphoglycerate

Some anaerobic prokaryotes use nitrate (no−3 ) as the terminal electron acceptor for energy metabolism. assuming 100 efficiency, can produce 3 ATP synthesized by the oxidation of NADH by nitrate

During anaerobic respiration, anaerobic prokaryotes use nitrate (NO3-) as the terminal electron acceptor instead of oxygen.
The electrons from NADH are transferred to nitrate through a series of electron carriers in the electron transport chain.
The electron transport chain generates a proton gradient across the membrane, which is used to synthesize ATP via oxidative phosphorylation.
Generally, 1 NADH molecule can generate up to 3 ATP molecules through the process of oxidative phosphorylation, assuming 100% efficiency.
So, the oxidation of NADH by nitrate can potentially synthesize up to 3 ATP molecules per NADH molecule, under the assumption of 100% efficiency.

Learn more about anaerobic prokaryotes here, https://brainly.com/question/29639551

#SPJ11

The student should dissolve 1.87 g of NH4Cl in the given 250 mL 0.20 M NH3 solution to create a buffer with pH 9.0.

To turn the given ammonia solution into a buffer with a specific pH, we need to add its conjugate acid, ammonium ion (NH4+), and its amount should be such that the pH of the buffer is equal to the desired pH.

First, we need to calculate the concentration of NH3 in the given solution.

Given,

Volume of solution = 250 mL = 0.25 L

Molarity of NH3 solution = 0.20 M

The number of moles of NH3 in 0.25 L of 0.20 M solution = 0.20 x 0.25 = 0.05 moles

NH3 + H2O ⇌ NH4+ + OH-

The dissociation constant of NH3, Kb = 1.8 x 10^-5

Using the Kb expression, we can calculate the concentration of OH- ions in the solution.

Kb = [NH4+][OH-]/[NH3]

Since the concentration of OH- ions is very small compared to NH3 and NH4+, we can assume that [OH-] = [NH4+]

So, Kb = [NH4+]^2/[NH3]

[NH4+] = √(Kb x [NH3]) = √(1.8 x 10^-5 x 0.05) = 1.5 x 10^-3 M

Now, we need to calculate the amount of NH4Cl to be added to the solution to get the desired pH.

Let's assume we want to create a buffer with pH 9.0.

The Henderson-Hasselbalch equation for a buffer is pH = pKa + log([A-]/[HA])

We know that the pKa of NH4+/NH3 buffer is 9.25 (from tables or calculation).

pH = 9.0, pKa = 9.25, [A-] = [NH3] = 0.05 M, and [HA] = [NH4+]

9.0 = 9.25 + log([NH4+]/0.05)

log([NH4+]/0.05) = -0.25

[NH4+] = 0.05 x 10^(-0.25) = 0.035 M

The amount of NH4Cl needed to prepare 0.035 M NH4+ solution can be calculated by stoichiometry.

NH4Cl → NH4+ + Cl-

1 mole of NH4Cl produces 1 mole of NH4+

So, 0.035 moles of NH4+ requires 0.035 moles of NH4Cl

The molar mass of NH4Cl is 53.5 g/mol.

The mass of NH4Cl required = 0.035 x 53.5 = 1.87 g

The student should dissolve 1.87 g of NH4Cl in the given 250 mL 0.20 M NH3 solution to create a buffer with pH 9.0.

Learn more about Buffer with ph

brainly.com/question/31462788

#SPJ11

The heat released by the reaction is approximately 271.9 kJ.

The balanced chemical equation for the reaction is:

Fe₂O₃ + 3CO → 2Fe + 3CO₂

From the equation, we see that 1 mole of Fe₂O₃ reacts with 3 moles of CO, producing 2 moles of Fe and 3 moles of CO₂.

To determine the amount of heat released by the reaction, we need to use the enthalpy of formation values for the reactants and products. Assuming standard conditions, we can use the following values:

ΔHf°(Fe₂O₃ ) = -824.2 kJ/mol

ΔHf°(CO) = -110.5 kJ/mol

ΔHf°(Fe) = 0 kJ/mol

ΔHf°(CO₂) = -393.5 kJ/mol

Using these values and the stoichiometry of the reaction, we can calculate the heat released by the reaction to be:

ΔH°rxn = (2 mol Fe × 0 kJ/mol) + (3 mol CO2 × -393.5 kJ/mol) - (1 mol Fe₂O₃  × -824.2 kJ/mol) - (3 mol CO × -110.5 kJ/mol)

ΔH°rxn = -1139.8 kJ/mol

To calculate the heat released for 34.0 g of Fe₂O₃ , we need to convert the mass of Fe₂O₃  to moles, and then multiply by the heat released per mole:

34.0 g Fe₂O₃  × (1 mol Fe₂O₃ /159.69 g) × (-1139.8 kJ/mol) = -271.9 kJ

As a result, the heat produced by the reaction is roughly 271.9 kJ.

To know more about the Reaction, here

https://brainly.com/question/14903519

#SPJ4

The pH of butanoic acid after titration with NaOH is 5.00 when 19.87 mL of base is added.

First, write out the balanced chemical equation for the reaction:

CH₃CH₂CH₂COOH(aq) + NaOH(aq) → CH₃CH₂CH₂COONa(aq) + H₂O(l)

Since the initial volume of butanoic acid is 20.00 mL and the concentration is 0.1000 M, the initial moles of butanoic acid are:

n = V x C = (20.00 mL) x (0.1000 mol/L) = 0.00200 mol

Next, determine how many moles of NaOH were added to reach the endpoint. The volume of NaOH added at the endpoint is 19.87 mL, but convert this to liters to use it in the calculation:

V(NaOH) = 19.87 mL ÷ 1000 mL/L = 0.01987 L

The number of moles of NaOH added is:

n(NaOH) = V(NaOH) x C(NaOH) = (0.01987 L) x (0.1000 mol/L) = 0.001987 mol

Since the stoichiometric ratio of butanoic acid to NaOH is 1:1, this means that 0.001987 mol of butanoic acid were neutralized by the NaOH.

The moles of butanoic acid remaining after the titration is:

n(BA) = n(initial) - n(NaOH) = 0.00200 mol - 0.001987 mol = 0.000013 mol

The concentration of butanoic acid remaining in solution is:

C(BA) = n(BA) / V = 0.000013 mol / 0.02000 L = 6.5 x 10⁻⁴ M

To determine the pH at this point, use the equilibrium expression for butanoic acid:

Ka = [CH₃CH₂CH₂COO⁻][H₃O⁺] / [CH₃CH₂CH₂COOH]

Assume that the concentration of H₃O⁺ is equal to the concentration of OH⁻ added by the NaOH, which is:

[OH-] = n(NaOH) / V = 0.001987 mol / 0.02000 L = 0.09935 M

Since we know the value of Ka and the concentrations of the butanoic acid and its conjugate base, we can rearrange the equilibrium expression to solve for [H₃O⁺]:

[H3O+] = (Ka x [CH₃CH₂CH₂COOH]) / [CH₃CH₂CH₂COO⁻]

= (1.54 x 10⁻⁵) x (6.5 x 10⁻⁴ M) / (0.1000 M - 6.5 x 10⁻⁴ M)

= 1.00 x 10⁻⁵ M

Finally, use the definition of pH to calculate the pH:

pH = -log[H₃O⁺] = -log(1.00 x 10⁻⁵) = 5.00

Therefore, the pH during the titration of butanoic acid with NaOH after 19.87 mL of the base have been added is 5.00.

Find out more on titration here: https://brainly.com/question/13031875

#SPJ1

The four peaks observed in the aromatic region of the infrared spectrum of aspirin are due to the presence of an aromatic ring in the molecule's chemical structure.

Aspirin, also known as acetylsalicylic acid, contains a six-carbon benzene ring that has a characteristic absorption pattern in the aromatic region of the infrared spectrum.

The number of peaks in the aromatic region of the infrared spectrum depends on the number and symmetry of the hydrogen atoms attached to the aromatic ring. The four peaks observed in the aromatic region of the spectrum of aspirin correspond to the different vibrations of the hydrogen atoms attached to the benzene ring.

These peaks' positions and intensities can provide information about the specific functional groups present in the molecule, as well as the sample's purity and quality. Therefore, the four peaks observed in the aromatic region of the spectrum of aspirin can be used to identify and confirm the presence of the benzene ring in the molecule.

To learn abo aromatic region:

https://brainly.com/question/31431033

#spj4

The proper order for the given reactions, starting with elemental copper and ending with the production of elemental copper, is as follows:

Cu(s) + 4HNO₃(aq) → Cu(NO₃)₂(aq) + 2NO₂(g)

Cu(NO₃)₂(aq) + 2HCl(aq) → CuCl₂(aq) + 2HNO₃(aq)

CuCl₂(aq) + Mg(s) → MgCl₂(aq) + Cu(s)

1. The first reaction involves elemental copper (Cu) reacting with nitric acid (HNO₃) to form copper(II) nitrate (Cu(NO₃)₂) and nitrogen dioxide (NO₂) gas.

2. In the second reaction, copper(II) nitrate (Cu(NO₃)₂) reacts with hydrochloric acid (HCl) to produce copper(II) chloride (CuCl₂) and nitric acid (HNO₃).

3. The third reaction involves copper(II) chloride (CuCl₂) reacting with magnesium (Mg) to form magnesium chloride (MgCl₂) and elemental copper (Cu).

By arranging the reactions in this order, we ensure that the first reaction starts with elemental copper and the fourth reaction ends with the production of elemental copper. It is important to balance the reactions to ensure the conservation of mass, as indicated in the balanced equations provided in the original question.

To know more about nitric acid refer here:

https://brainly.com/question/29769012#

#SPJ11

It will take 13.2 hours for 28 g of the substance to be depleted to 3.5 g.

We can use the following radioactive decay formula to solve this problem:

N = N0 * (1/2)^(t/T)

Where:

N = Final amount of the substance

N0 = Initial amount of the substance

t = Time passed

T = Half-life of the substance

Let's first find the number of half-lives that will pass as 28 g of the substance is depleted to 3.5 g:

28 g * (1/2)^(n) = 3.5 g

(1/2)^(n) = 3.5 g / 28 g

(1/2)^(n) = 0.125

n = log(0.125)/log(1/2)

n = 3

So, 3 half-lives will pass. Since the half-life is 4.4 hours, the total time it will take is:

t = n * T

t = 3 * 4.4 hr

t = 13.2 hr

Therefore, it will take 13.2 hours for 28 g of the substance to be depleted to 3.5 g.

Learn more about radioactive decay

brainly.com/question/1770619

#SPJ11

The rate constant at 398 °C would be approximately 10.5 L mol–1 s–1.To calculate the activation energy (Ea), we can use the Arrhenius equation: k = A * exp(-Ea/RT)

where k is the rate constant, A is the pre-exponential factor, Ea is the activation energy, R is the gas constant (8.314 J/K mol), and T is the temperature in Kelvin.

We can use the two given rate constants and their corresponding temperatures to create two equations with two unknowns (A and Ea) and then solve for Ea.

ln(k1/k2) = Ea/R * (1/T2 - 1/T1)

where k1 and T1 are the rate constant and temperature at 355 °C and k2 and T2 are the rate constant and temperature at 405 °C. Plugging in the values, we get: ln(3.2/23) = Ea/(8.314*[tex]10^{3}[/tex]) * (1/678 - 1/728)

Solving for Ea, we get: Ea = 80.8 kJ/mol

To calculate the rate constant at 398 °C, we can use the same Arrhenius equation with the Ea we just calculated and the given temperature: k = A * exp(-Ea/RT), k = A * exp([tex]-80.810^{3}[/tex]/([tex]8.31410^{3}[/tex] * 671)), k = 10.5 L mol–1 s–1 (approximately)

So the rate constant at 398 °C would be approximately 10.5 L mol–1 s–1.

To know more about Arrhenius equation, refer here:

https://brainly.com/question/30505650#

#SPJ11

Answer:

a)HNO2 + H2O → H3O+ + NO2−

b)HAsO42− + H2O ⇌ H3O+ + H2AsO4−

c)(CH3)3NH + H2O ⇌ (CH3)3NH+ + OH−

Explanation:

a) The ionization of HNO2 in water is:

HNO2 + H2O → H3O+ + NO2−

b) The ionization of HAsO42− in water is:

HAsO42− + H2O ⇌ H3O+ + H2AsO4−

c) The ionization of (CH3)3NH in water is:

(CH3)3NH + H2O ⇌ (CH3)3NH+ + OH−

To know more about writing chemical equations for ionization of weak acids refer to this link-https://brainly.com/question/31773938

#SPJ11

To calculate the standard Gibbs free energy for a reaction, we need the balanced chemical equation and the standard Gibbs free energies of formation (ΔGf°) for each compound involved. Unfortunately, you did not provide any reaction or specific compounds to analyze. However, I can give you the general formula to calculate the standard Gibbs free energy change (ΔG°) for a reaction:

ΔG° = Σ (ΔGf° of products) - Σ (ΔGf° of reactants)

Once you have the balanced equation and the respective ΔGf° values, plug them into this formula, perform the calculation, and express your answer as an integer with the appropriate units (typically kJ/mol).

To know more about standard Gibbs free energy click here

https://brainly.com/question/30654218

#SPJ11

The change in the free energy of the reaction can be obtained as 63.49 kJ/mol

Understanding and forecasting the behavior of systems, such as chemical reactions, phase transitions, and biological processes, depends heavily on the concept of free energy. It aids in the study of equilibrium and energy transitions and offers insights into the direction and viability of these processes.

We know that;

ΔG = ΔH - TΔS

ΔG = (-1204) - (298 * (-217.1))

= 63.49 kJ/mol

Learn more about Gibbs free energy:https://brainly.com/question/13795204

#SPJ4

The initial mass of the substance 8.00 hours ago was 195 g. A radioactive substance is one that spontaneously emits radiation, such as alpha or beta particles, in order to become more stable. The half-life of a radioactive substance is the amount of time it takes for half of the original sample to decay or emit radiation.

Now, let's move on to solving the problem. We know that the half-life of the substance is 3.20 hours, which means that after 3.20 hours, half of the original sample will have decayed or emitted radiation. We also know that currently, 34.4 g of the substance is present.

Using this information, we can set up the following equation:

34.4 g = a0 (1/2)^(8.00/3.20)

Here, a0 represents the initial mass of the substance, before any decay occurred. We are trying to solve for a0.

Let's break down the equation. The term (1/2)^(8.00/3.20) represents the fraction of the original sample that remains after 8.00 hours, based on the half-life. We can simplify this fraction to (1/2)^2.5, which is approximately 0.176.

Plugging in the numbers and solving for a0, we get:

a0 = 34.4 g / 0.176
a0 = 195 g (rounded to three significant figures)

Learn more about radiation here:

brainly.com/question/1497235

#SPJ11

The area of chemistry known as stoichiometry is focused on the proportions of reactants and products in chemical processes.

Thus, Whole numbers (coefficients) are used to represent the quantities (often in moles) of both the reactants and products in any balanced chemical reaction.

One mole of oxygen combines with two moles of hydrogen, for instance, to create two moles of water when oxygen and hydrogen combine to form that substance.

Additionally, stoichiometry can be used to determine values like the percentage yield and the number of products that can be made from a given quantity of reactants. The calculation of the number of items that can be produced given specific information will be covered in upcoming topics.

Thus, The area of chemistry known as stoichiometry is focused on the proportions of reactants and products in chemical processes.

Learn more about stoichiometry, refer to the link:

https://brainly.com/question/19484482

#SPJ1

When you land, the volume of the pillow will decrease to 1.125 L due to the increase in atmospheric pressure. Inflating the pillow before takeoff has both advantages and disadvantages, and should be done with caution to avoid damaging the pillow or taking up too much space in your luggage.

What is Volume?

Volume is the amount of space occupied by an object, substance, or region of space. It is a physical quantity that describes the three-dimensional size of an object or the amount of space it takes up.

[tex]P_1[/tex][tex]V_1[/tex]= [tex]P_2[/tex][tex]V_2[/tex]

where[tex]P_1[/tex] is the initial pressure (0.75 atm), [tex]V_1[/tex] is the initial volume (1.5 L), [tex]P_2[/tex]is the final pressure (1 atm), and [tex]V_2[/tex] is the final volume (unknown). Solving for [tex]V_2[/tex], we get:

[tex]V_2[/tex] = ([tex]P_1[/tex][tex]V_1[/tex])/[tex]P_2[/tex]= (0.75 atm)(1.5 L)/(1 atm) = 1.125 L

Therefore, the volume of the pillow when you land will be 1.125 L.

Blowing up your travel pillow before the plane takes off has the advantage of providing a comfortable pillow to use during the flight without having to worry about inflating it at a high altitude.

To know more about Volume, visit;

https://brainly.com/question/14197390

#SPJ4

Based on the titration curve provided, the equivalence point is reached at around 25 mL of NaOH solution, which means that 25 mL of NaOH solution is required to completely react with the 20.0 mL of 0.125 M monoprotic acid solution.

At the equivalence point, moles of acid = moles of base.

Moles of acid in the sample = (20.0 mL) x (0.125 mol/L) = 2.50 x 10^-3 moles

Therefore, the number of moles of NaOH needed to reach the equivalence point is also 2.50 x 10^-3 moles.

From the titration curve, we can see that the concentration of NaOH is 0.100 M.

Moles of NaOH = (25.0 mL) x (0.100 mol/L) = 2.50 x 10^-3 moles

Since the number of moles of NaOH needed to reach the equivalence point is the same as the number of moles of acid in the sample, the molar concentration of NaOH can be calculated as follows:

Molarity of NaOH = moles of NaOH / volume of NaOH solution used

Molarity of NaOH = (2.50 x 10^-3 moles) / (25.0 mL) = 0.100 M

Therefore, the molar concentration of NaOH(aq) is 0.100 M.

Learn more about Titration here:- brainly.com/question/186765

#SPJ11

The mean air pressure at sea level is 1013.2 millibars. The correct option is A 1013.2 millibars.

The pressure within Earth's atmosphere is referred to as atmospheric pressure or barometric pressure (after the barometer). The definition of the standard atmosphere (symbol: atm) is 101,325 Pa (1,013.25 hPa), or 1013.25 millibars, 760 mm Hg, 29.9212 inches Hg, or 14.696 psi.

The Earth's mean sea-level atmospheric pressure is roughly equivalent to one atm, or one atmosphere, and is measured in the atm unit. The planet's gravitational pull on the gases above its surface produces atmospheric pressure, which depends on the planet's mass, the radius of its surface, the quantity, composition, and vertical distribution of the gases in the atmosphere. Hence, The mean air pressure at sea level is 1013.2 millibars. The correct option is A 1013.2 millibars.

To know more about air pressure click here:

https://brainly.com/question/15189000

#SPJ11

In a chemical reaction, bonds in the reactants are broken and new bonds are formed in the products. The energy required to break a bond is known as bond energy. The energy released when new bonds are formed is also bond energy.

In order to determine the true statement about bond energies in a reaction, we need to compare the energy required to break the bonds in the reactants to the energy released when new bonds are formed in the products. If the energy absorbed as the bonds in the reactants are broken is greater than the energy released as the bonds in the product are formed, then the reaction is endothermic, meaning it requires energy input to occur. Conversely, if the energy released as the bonds in the reactants are broken is greater than the energy absorbed as the bonds in the product are formed, then the reaction is exothermic, meaning it releases energy.

Based on this, we can conclude that the true statement about bond energies in a reaction is that the energy released as the bonds in the reactants are broken is greater than the energy absorbed as the bonds in the product are formed. This means that the reaction is exothermic and releases energy.

To know more about bond energy

https://brainly.com/question/14867588

#SPJ11

The following is true for pure oxygen gas, O2(g) at 25°C is the correct answer is: E) S° > 0

This is true for pure oxygen gas, O2(g), at 25°C because the entropy (S°) of any substance in its standard state (in this case, gaseous oxygen) at 25°C is always greater than zero. Entropy is a measure of the degree of randomness or disorder in a system, and since gases have more randomness compared to solids and liquids, their entropy is positive.

Pure oxygen or oxygen-enriched air is used in many industrial applications. Because it is present in air it is tempting to take oxygen for granted.

Learn more about entropy here: brainly.com/question/13146879

#SPJ11

The pH of the given solution is 10.34. Morphine (C17H19O3N) and morphine hydrochloride (C17H20O3NCl) can be considered as a weak base and its conjugate acid, respectively. The dissociation of morphine in water is as follows: C17H19O3N + H2O ⇌ C17H19O3NH+ + OH-

The equilibrium constant expression for the above reaction is: Kb = [C17H19O3NH+][OH-]/[C17H19O3N]. Morphine hydrochloride will dissociate in water to form morphine and H+ ions: C17H20O3NCl → C17H19O3N + H+ + Cl-.

To calculate the pH of the given solution, we can consider the dissociation of morphine only and calculate the concentration of hydroxide ions. Then, we can use the relationship:

pH + pOH = 14

First, we need to calculate the concentration of hydroxide ions:

Kb = [C17H19O3NH+][OH-]/[C17H19O3N]

1.6 x 10^-6 = x^2 / (0.488 - x)

Since the concentration of OH- is very small compared to the initial concentration of morphine, we can assume that x is negligible compared to 0.488. Therefore:

1.6 x 10^-6 = x^2 / 0.488

x = √(1.6 x 10^-6 x 0.488) = 2.20 x 10^-4 M

Now, we can use the relationship pH + pOH = 14 to calculate the pH of the solution:

pOH = -log[OH-] = -log(2.20 x 10^-4) = 3.66

pH = 14 - pOH = 14 - 3.66 = 10.34

Therefore, the pH of the given solution is 10.34.

For more questions like pH visit the link below:

https://brainly.com/question/17011255

#SPJ11

In the case of trans-9-(2-Phenylethenyl)-anthracene, one might expect to see peaks in the IR spectrum corresponding to the aromatic ring and the C=C double bond.

A double bond is a type of chemical bond in which two atoms share two pairs of electrons. It is formed when two atoms, typically carbon or oxygen, are bonded to each other and share four electrons in a covalent bond. The double bond is represented in chemical formulas as a double line between the atoms.

In a double bond, the shared electrons are held more tightly between the atoms than in a single bond, making the double bond stronger and shorter than a single bond. This increased bond strength and shorter bond length can have important implications for the chemical and physical properties of the compound. Molecules with double bonds are often more reactive than those with single bonds, as the shared electrons in the double bond are more available for chemical reactions.

To learn more about double bond visit here:

brainly.com/question/31535069

#SPJ4

The monomer of polyvinyl chloride (PVC) differs from the monomer of polyethylene (PE) in their chemical structures and properties. since the monomer of PVC is vinyl chloride and the monomer of PE is ethylene.

The monomer of polyvinyl chloride (PVC) differs from the monomer of polyethylene (PE) in its chemical structure. PVC is derived from the monomer vinyl chloride, which has a structure consisting of a vinyl group (CH2=CH-) attached to a chloride atom. PE, on the other hand, is derived from the monomer ethylene, which has a structure consisting of two carbon atoms with a double bond between them (CH2=CH2).  

The main difference is the presence of a chlorine atom (Cl) in the vinyl chloride monomer, while the ethylene monomer only consists of carbon and hydrogen atoms. This difference in structure leads to variations in the properties and applications of the resulting polymers, PVC and PE. PVC is often used in construction materials, pipes, and electrical cables, while PE is commonly used in packaging materials, plastic bags, and containers.

To know more about PVC:

https://brainly.com/question/30704544

#SPJ11

3.6 %(w/v) solutions of glucose (C₆H₁₂O₆) is isotonic with a 0.1 m nacl solution from the following .

Option C is correct.

                  NaCl Na⁺ + Cl⁻  = 2 particles

mol of 0.1 M NaCl = 0.1 x 2 = 0.2 Osmol NaCl

Glucose does not dissociate to particles so 0.2

                            Mol glucose = 0.2 M glucose

0.2 M glucose = 0.2 mol glucose/1 L solution

                            = 0.02 mol/100 mL

1 mol glucose (C₆H₁₂O₆) = 6 x 12 g + 12 x 1 g + 6 x 16 g

                                 = 180 g glucose

0.02 mol glucose x 180 g glucose = 3.6 g glucose 3.6 g glucose/100 mL solution

1 mol glucose  = 3.6 %(w/v) glucose solution.

Isotonic solutions are those that have the same concentration of water and solutes as the cytoplasm of the cell. Since there is no net gain or loss of water in an isotonic solution, cells placed there will not swell or shrink. Isotonic is a term used to portray arrangements and science and, once in a while, muscles in human science.

When a solution crosses a semipermeable membrane with the same concentration of solutes as another solution, it is said to be isotonic in chemistry. The utilization of isotonic in human life structures is utilized all the more once in a blue moon

Incomplete question :

Which of the following solutions of glucose (C6H12O6) is isotonic with a 0.1 M NaCl solution?

A. 0.15%(w/v)

B. 0.55%(w/v)

C. 3.6 %(w/v)

D. 5.4%(w/v)

Learn more about isotonic solutions ;

brainly.com/question/29218607

#SPJ4

Therefore, the rate law for the reaction is concentration rate= k[NO2], and the rate constant is 0.21 M's^-1.

Using the method of initial rates, we can calculate the rate and rate constant of the given reaction. The initial rates of the reaction are given in the table:

[NO2] (M) [CO] (M) Initial Rate (M/s)

0.10 0.10 0.0021

0.20 0.10 0.0082

0.20 0.20 0.0083

0.40 0.10 0.033

We can see that the initial rate depends on the concentration of NO2, and is independent of the concentration of CO. This suggests that the reaction is first order with respect to NO2 and zero order with respect to CO. Therefore, the rate law for the reaction is:

rate = k[NO2][CO]^0 = k[NO2]

To find the rate constant, we can use any of the experiments in the table. Let's use the first experiment, where [NO2] = 0.10 M and the initial rate is 0.0021 M/s. Substituting these values into the rate law, we get:

0.0021 M/s = k (0.10 M)

Solving for k, we get:

k = 0.0021 M/s / 0.10 M

k = 0.021 s^-1 or 0.21 M's^-1

To know more about concentration,

https://brainly.com/question/29276511

#SPJ11

It would require 29.25 joules of heat energy to raise the temperature of 15 grams of lead from 22°C to 37°C.

The specific heat capacity of a substance is the amount of heat energy required to raise the temperature of one gram of the substance by one degree Celsius (or Kelvin). In this case, the specific heat capacity of lead is given as 0.13 J/g*K, which means that 0.13 joules of heat energy are required to raise the temperature of one gram of lead by one degree Celsius.

To calculate the heat energy required to raise the temperature of 15 grams of lead from 22°C to 37°C, we can use the following formula:

Q = m * c * ΔT

where Q is the heat energy required, m is the mass of the substance, c is the specific heat capacity of the substance, and ΔT is the change in temperature.

Substituting the given values, we get:

Q = 15 g * 0.13 J/g*K * (37°C - 22°C)

Q = 15 g * 0.13 J/g*K * 15°C

Q = 29.25 J

To learn more about heat energy

https://brainly.com/question/29210982

#SPJ4

To calculate the half-life of the radioactive substance, we can use the following formula. Therefore, the half-life of this substance is 66.4 minutes.

N = N₀(1/2)^(t/t½)
Where:
N₀ = initial count (400 counts)
N = count after time t (100 counts)
t = time elapsed (33.2 minutes)
t½ = half-life
Substituting the given values in the formula, we get:
100 = 400(1/2)^(33.2/t½)
Simplifying this equation, we get:
(1/2)^(33.2/t½) = 1/4
Taking the logarithm of both sides, we get:
(33.2/t½)log(1/2) = log(1/4)
Solving for t½, we get:
t½ = (33.2/log(2)) x log(4) = 66.4 minutes
Therefore, the half-life of this substance is 66.4 minutes.

You are using a Geiger counter to measure the activity of a radioactive substance over the course of several minutes. You've observed that the reading of 400 counts has diminished to 100 counts after 33.2 minutes, and you want to determine the half-life of this substance.
To find the half-life, we can use the formula:
N = N0 * (1/2)^(t/T)
Where:
N = final count (100 counts)
N0 = initial count (400 counts)
t = time elapsed (33.2 minutes)
T = half-life
Rearranging the formula for T, we get:
T = t * (log(1/2) / log(N/N0))
Now, plug in the values:
T = 33.2 * (log(1/2) / log(100/400))
T = 33.2 * (log(1/2) / log(1/4))
T ≈ 33.2 * 2
T ≈ 66.4 minutes
The half-life of this radioactive substance is approximately 66.4 minutes.

Visit here to learn more about radioactive substance:

brainly.com/question/1160651

#SPJ11

The equilibrium constant for this reaction is 0.096.

The equilibrium constant (Kc) for the following reaction is given by the ratio of the concentration of products to the concentration of reactants at equilibrium, with each concentration raised to the power of its coefficient in the balanced chemical equation:

a + b ⇌ c

Kc = [c]/([a][b])

At the beginning, the concentrations of a and b are 0.0420 M, and the concentration of c is 0 M. At equilibrium, the concentration of a is 0.0124 M. We can assume that the concentration of b at equilibrium is also 0.0124 M, since the stoichiometry of the reaction tells us that the ratio of a to b is 1:1.

Therefore, we can plug these values into the equilibrium constant expression:

Kc = [c]/([a][b]) = 0.0124^2 / (0.0420)(0.0420) = 0.096

So, the equilibrium constant for this reaction is 0.096.

For more such questions on equilibrium constant

https://brainly.com/question/3159758

#SPJ11

The mass of the Zn electrode decreases as the cell operates because the Zn ions are falling into the solution.

The galvanic cell consists of two pieces of metal, one is zinc and the other is copper. These pieces are immersed in a solution containing a dissolved salt of the corresponding metal. The mixing of these two solutions is prevented by separating them with a porous barrier. But the ions are allowed to diffuse through the barrier.

When the cell operates, the Zn electrode loses its mass. Therefore, when we connect zinc and copper by a metallic conductor, the zinc electrode gets oxidized in the cell and increases the concentration of [tex]Zn^{+2}[/tex] ions in the solution. These ions flow through the external circuit from the left cell into the right electrode where they could be delivered to the [tex]Cu^{+2}[/tex] ions.

[tex]Zn(s) - > Zn^{2+ } + 2e^{-}[/tex]

Therefore, the mass of the zinc electrode decreases as the cell operates because it is now an anode after being oxidized to [tex]Zn^{2+}[/tex] ions that are falling into the solution.

To learn more about Zn electrodes;

https://brainly.com/question/29676588

#SPJ4

The pKa of Jung's weak acid is approximately 3.28.


1. At the 1/4 equivalence point, the ratio of the weak acid ([HA]) to its conjugate base ([A-]) is 3:1.
2. The Henderson-Hasselbalch equation can be used to determine the pKa: pH = pKa + log([A-]/[HA]).
3. Given the pH of 2.28 and the 3:1 ratio, we can plug in the values into the equation: 2.28 = pKa + log(1/3).
4. Solving for pKa, we first calculate the log(1/3), which is approximately -0.48.
5. Next, we subtract -0.48 from 2.28: pKa = 2.28 - (-0.48).
6. Finally, we find that the pKa of the weak acid is approximately 3.28.

learn more about weak acid

https://brainly.com/question/24018697

#SPJ11

Here is the higher energy chair conformation of cis-1,3-dimethylcyclohexane:

     CH3           H

      |             |

H--C--C--C--C--C--C--C--H

      |             |

     CH3           H

In this conformation, the two methyl groups are in an axial position, which is less stable than the equatorial position. The hydrogen atoms on the same side of the ring as the methyl groups are also in axial positions, which contributes to the higher energy of this chair conformation.

A higher energy chair conformation is a specific arrangement of substituents on a cyclohexane ring that is less stable than the lowest energy or most stable chair conformation. In the higher energy chair conformation, one or more substituents are located in axial positions rather than equatorial positions, leading to destabilizing interactions with other groups or atoms in the molecule. This can result in an increase in potential energy, making the conformation less stable and more reactive than the most stable chair conformation.

To know more about higher energy chair conformation, please click on:

https://brainly.com/question/31727032

#SPJ11

Sea level is rising can be excluded from the list of environmental impacts of mining. Option D is correct.

Sea level rise is not directly related to mining activities. It is a consequence of various factors such as climate change, thermal expansion of seawater, melting of glaciers and ice sheets, and other environmental processes. Sea level rise is a global phenomenon that affects coastal areas and is caused by multiple factors, including human activities beyond mining.

However, mining activities can indirectly contribute to climate change through the release of greenhouse gases, deforestation, and other associated activities. It's important to note that mining can have a range of environmental impacts, including habitat destruction, air and water pollution, soil erosion, and more, which should be carefully managed and mitigated to minimize negative effects on the environment.

Hence, D. is the correct option.

To know more about Sea level here

https://brainly.com/question/2113249

#SPJ1

--The given question is incomplete, the complete question is

"Which can be excluded from the list of environmental impacts of mining? A) habitats are destroyed B) harmful gases are released C) water is polluted D) sea level is rising."--

There is more available soluble oxygen in the cold tank than in the warmer tank hence more fish can survive in the cold tank.

The kinetic energy of the solvent molecules increases together with the temperature of a solution. As a consequence, the distance between solvent molecules increases, decreasing the number of places where gas molecules can dissolve.

In other words, the solubility of the gas drops as temperature rises because the solvent molecules are less able to cling to the gas molecules.

Learn more about solubility:https://brainly.com/question/29661360

#SPJ1