a 4 kg particle is moving horizontally at 5 m/s to the right when it strikes a vertical wall. the particle rebounds with at 3 m/s. what is the impulse delivered to the particle?

Answers

Answer 1

The impulse is delivered to the particle when a 4 kg particle is moving horizontally at 5 m/s to the right when it strikes a vertical wall and the particle rebounds at 3 m/s is 8 kg m/s to left.

To solve this problem we will use the impulse-momentum theorem. The impulse-momentum theorem states that the change in momentum of an object is equal to the impulse applied to the object. The impulse is the force times the time over which the force acts. The momentum is the mass times the velocity of the object.

The impulse delivered to the 4 kg particle is the change in momentum. The initial momentum of the particle was 4 kg x 5 m/s = 20 kg m/s to the right. After it strikes the wall, its velocity is reversed, so the final momentum is 4 kg x 3 m/s = 12 kg m/s to the left. The impulse is therefore 20 kg m/s to the right - 12 kg m/s to the left is 8 kg m/s.

For more information about impulse refers to the link: https://brainly.com/question/30466819

#SPJ11


Related Questions

if a meteor passing by the earth has more kinetic energy then potential energy, what type of orbit will it follow?

Answers

Answer: Because energy is conserved an object can’t be “captured” into orbiting a larger object unless there is a way to transfer energy to some third thing. It has to collide, either mechanically or gravitationally, with something and transfer energy to it: another body, a cloud of gas or dust, or something.

The kinetic energy of a body gravitationally interacting changes all the time, regardless of “capture”, as it get closer to another gravitating body it speeds up because energy is conserved and the loss of gravitational potential is compensated by increase in kinetic energy. The closer a comet comes to the Sun the faster it goes. The further away it gets, the slower it goes.

Learning Goal: To understand the magnetic force on a straight current- carrying wire in a uniform magnetic field. Magnetic fields exert forces on moving charged particles, whether those charges are moving independently or are confined to a current-carrying due north wire. The magnetic force F on an individual moving charged particle depends on its velocity v and charge q. In the case of a current-carrying wire, many charged particles are simultaneously in motion, so the magnetic force denends on the total current I and the lenath of What is the direction of the magnetic force acting on the wire in part b due to the applied magnetic field?
- due south - due east - due west - straight up - straight down

Answers

The direction of  magnetic force acting on a current-carrying wire in a uniform magnetic field depends on  direction of  magnetic field and the direction of the current. The correct answer is option: c .

The force is perpendicular to both the direction of the magnetic field and the direction of  current, and follows  right-hand rule. To use the right-hand rule, point  thumb of your right hand in the direction of the current, and then curl your fingers in  direction of the magnetic field. The direction in which your fingers point is the direction of  magnetic force acting on the wire. Therefore, the direction of magnetic force acting on the wire in part b will be due west . Option: c is correct.

To know more about magnetic force, here

brainly.com/question/3160109

#SPJ4

-- The complete question is, To understand the magnetic force on a straight current- carrying wire in a uniform magnetic field.

Magnetic fields exert forces on moving charged particles, whether those charges are moving independently or are confined to a current-carrying due north wire.

The magnetic force F on an individual moving charged particle depends on its velocity v and charge q. In the case of a current-carrying wire, many charged particles are simultaneously in motion,

So the magnetic force depends on the total current I and the Length of What is the direction of the magnetic force acting on the wire in part b due to the applied magnetic field?

a.- due south

b - due east

c- due west

d- straight up

e- straight down --

g a car moving at constant speed around a circular track at a speed of v. the force of friction provides the necessary centripetal force to keep the car on the track. if the speed of the car is doubled, what will be the frictional force that is needed to hold the car on the road?

Answers

When the speed of the car is doubled, the centripetal force required to keep it moving in a circular path also doubles, because the centripetal force is proportional to the square of the velocity. Therefore, the force of friction required to provide the centripetal force is 4 times the original frictional force.

To see this, consider the equation for centripetal force:

Fc = mv²/r

where Fc is the centripetal force,

m is the mass of the car,

v is its velocity, and

r is the radius of the circular track.

If the speed of the car is doubled to 2v, the centripetal force required to keep it on the track becomes:

Fc' = m(2v)²/r = 4mv²/r

This means that the new centripetal force required is four times the original centripetal force. Therefore, the force of friction required to provide this centripetal force must also be four times the original force of friction:

Ff' = 4Ff

where Ff is the original force of friction and

Ff' is the new force of friction required.

So, the answer is indeed that the new frictional force required to hold the car on the road when its speed is doubled is 4 times the original frictional force.

To learn more about the centripetal force:

https://brainly.com/question/898360

#SPJ11

a string 3 m long is fixed on both ends and vibrates in its fundamental mode. what is the wavelength of the vibration?

Answers

The wavelength of the vibration of a string 3 m long fixed on both ends in its fundamental mode is 6 m.


The lowest part of a harmonic vibration, or the lowest frequency at which an oscillation occurs is called fundamental mode of vibration.

The basic mode, or first harmonic, is the simplest normal mode, in which the string vibrates in a single loop and is denoted n = 1.

Given, Length of string, l = 3 m

The wavelength of the vibration can be calculated by the following formula:

Wavelength (λ) = 2l/n

where n is the harmonic or mode of vibration.

As it is vibrating in its fundamental mode, n = 1.

Therefore, Wavelength (λ) = 2l/n= 2 × 3 m / 1= 6 m

The wavelength of the vibration is 6 m.

Know more about fundamental mode of vibration here:

https://brainly.com/question/9758493

#SPJ11

are the net force on an object and the acceleration of the object directly proportional?explain, using experimental data to support your answer.

Answers

Yes, the net force on an object and the acceleration of the object are directly proportional, as shown by experimental data and supported by Newton's second law of motion.

According to Newton's Second Law of Motion, the net force on an object and its acceleration are exactly related. According to this rule, an object's acceleration is inversely related to its mass and directly proportionate to the net force acting on it. The validity of the law has been shown by data from several tests that have repeatedly proven this link. One illustration of such an experiment is measuring the force necessary to accelerate an item using a spring scale. The link between force and acceleration may be determined by applying various forces and observing the resulting acceleration.

learn more about acceleration here:

https://brainly.com/question/30499732

#SPJ4

 A food worker has cooled a pot of soup from 136*F to 70*F within 2 hours.What is the maximum amount of time she should take to cool the soup from 70*F to 41*F
A. 2 hours
B. 4 hours
C. 6 hours
D. 8 hours

Answers

The maximum amount of time a food worker should take to cool the soup from 70*F to 41*F is 4 hours.The correct answer is b.

According to the FDA's Food Code, potentially hazardous foods must be cooled from 135°F to 70°F within two hours, and from 70°F to 41°F within an additional four hours.Foodborne illnesses can be prevented by the following measures: Cook meat to the correct temperature.

Bacteria that cause foodborne illness can be killed by cooking food to the correct internal temperature. For example, ground beef should be cooked to an internal temperature of at least 160°F. The internal temperature should be checked with a food thermometer.

Take steps to keep the kitchen clean. It's critical to keep the kitchen clean to avoid the spread of bacteria. Countertops, utensils, and cutting boards should all be cleaned with hot soapy water.Routinely rinse fruits and vegetables. Vegetables and fruits should be thoroughly rinsed before consuming to remove any germs or dirt that might be present.

You should wash the produce under running water before cutting or eating it.Avoid cross-contamination. Keep raw meat away from cooked food to prevent contamination. You should never use the same knife or cutting board to cut both raw meat and fresh vegetables.

If you need to use the same cutting board, make sure to clean it thoroughly before reusing it.

Learn more about potentially hazardous foods here:

brainly.com/question/29630696

#SPJ11

g assuming the pressure remains constant, if the radius of a bronchial tube through which gas flows at a rate of 40 l/min is reduced by 16%, find the new flow rate through the bronchial tube.

Answers

Given that the rate of gas flow through a bronchial tube is 40 L/min and the radius of the tube is reduced by 16%, we have to find the new flow rate through the bronchial tube is: 16.4 L/min.

As per Poiseuille’s formula, the rate of gas flow through a tube is directly proportional to the fourth power of the radius, i.e., Q = k*r⁴ where Q is the rate of gas flow, r is the radius, and k is a constant.

The new flow rate of the bronchial tube after the reduction of radius can be found as follows:
Let the new radius be r’. Then, r’ = r − 0.16r = 0.84r
Therefore, Q’ = k * r’⁴= k * (0.84r)⁴= k * 0.41r⁴ (rounded to two decimal places)

Now, the rate of gas flow through the bronchial tube is 40 L/min.
Therefore, k*r⁴ = 40=> k = 40/r⁴ Substituting this value of k in the above equation, we get Q’ = 40/r⁴ * 0.41r⁴= 16.4 L/min (rounded to one decimal place)

To know more about "Bronchial tube" refer here:

https://brainly.com/question/13962287#

#SPJ11

a car is traveling with a speed of 15.0 m/s along a straight horizontal road. the wheels have a radius of 0.300 m. if the car speeds up with a linear acceleration of 1.10 m/s2 for 6.00 s, find the angular displacement of each wheel during this period.

Answers

The angular displacement of each wheel during this period will be 19.8 rad.

Angular displacement can be defined as the change in the position of an object as it moves along the circumference of a circle. Angular displacement can be calculated using the formula:

angular displacement = angular velocity x time

Thus, Angular displacement = Δθ = ω2 - ω1 = (αt2) / 2 - (αt1) / 2

Where ω1 and ω2 are the initial and final angular velocity, α is the angular acceleration, t1 and t2 are the initial and final time, and Δθ is the angular displacement.

In this question, the radius of the wheel is given as 0.300 m, the initial speed of the car is 15.0 m/s, the linear acceleration is 1.10 m/s², and the time is given as 6.00 s.

Linear acceleration a = 1.10 m/s²

Time taken, t = 6.00 s

Initial velocity, u = 15.0 m/s

Final velocity, v = u + at= 15 + 1.10 × 6= 21.6 m/s

Now, angular speed,ω = v / r= 21.6 / 0.300= 72 rad/s

Angular displacement during this period= Δθ = ω2 - ω1= (αt2) / 2 - (αt1) / 2= (1.10 × 6.00²) / 2 - (1.10 × 0²) / 2= 19.8 rad

The angular displacement of each wheel during this period is 19.8 rad.

Learn more about Angular displacement at: brainly.com/question/29679072

#SPJ11

A bucket of water of mass 14.3 kg is suspended by a rope wrapped around a windlass, that is a solid cylinder with diameter 0.260 m with mass 12.5 kg. The cylinder pivots on a frictionless axle through its center. The bucket is released from rest at the top of a well and falls a distance 10.5 m to the water. You can ignore the weight of the rope. A. What is the tension in the rope while the bucket is falling? B. With what speed does the bucket strike the water? C. What is the time of fall? D. While the bucket is falling, what is the force exerted on the cylinder by the axle?

Answers

Answer:A. To find the tension in the rope while the bucket is falling, we need to use the conservation of energy. At the top of the well, the bucket has potential energy mgh = (14.3 kg)(9.81 m/s^2)(10.5 m) = 1479 J. This potential energy is converted to kinetic energy as the bucket falls. At the bottom of the well, the bucket has only kinetic energy, given by KE = (1/2)mv^2, where v is the speed at which the bucket strikes the water. Since there is no work done by non-conservative forces like friction, the total mechanical energy is conserved. Therefore:

mgh = (1/2)mv^2 + (1/2)Iω^2,

where I is the moment of inertia of the cylinder and ω is its angular velocity. We know that the cylinder is a solid cylinder, so I = (1/2)MR^2, where M is the mass of the cylinder and R is its radius. We also know that the cylinder is rolling without slipping, so v = Rω. Substituting these expressions into the conservation of energy equation and solving for the tension T, we get:

T = mgh / (R(1 + m/M))

Plugging in the numbers, we get:

T = (14.3 kg)(9.81 m/s^2)(10.5 m) / (0.130 m(1 + 14.3 kg / 12.5 kg)) = 137 N

Therefore, the tension in the rope while the bucket is falling is 137 N.

B. To find the speed at which the bucket strikes the water, we can use the conservation of energy equation derived in part A. Solving for v, we get:

v = sqrt(2gh(M+m) / (mM + (1/2)m^2))

Plugging in the numbers, we get:

v = sqrt(2(9.81 m/s^2)(10.5 m)(12.5 kg + 14.3 kg) / ((14.3 kg)(12.5 kg) + (1/2)(14.3 kg)^2)) = 9.38 m/s

Therefore, the speed at which the bucket strikes the water is 9.38 m/s.

C. To find the time of fall, we can use the kinematic equation:

y = 1/2gt^2,

where y is the distance fallen, g is the acceleration due to gravity, and t is the time of fall. Solving for t, we get:

t = sqrt(2y/g)

Plugging in the numbers, we get:

t = sqrt(2(10.5 m)/(9.81 m/s^2)) = 1.47 s

Therefore, the time of fall is 1.47 s.

D. While the bucket is falling, the cylinder is rotating about its center of mass, which is also the axis of rotation. Since there is no net torque about this axis, the cylinder is not accelerating rotationally. Therefore, the force exerted on the cylinder by the axle is zero.

Explanation:

snow is falling vertically at a constant speed of 7.0 m/s. at what angle from the vertical do the snowflakes appear to be falling as viewed by the driver of a car traveling on a straight, level road with a speed of 32 km/h?

Answers

The angle from the vertical at which the snowflakes appear to be falling as viewed by the driver of the car is 53.3 degrees.

When the car is moving, the snowflakes appear to be falling at an angle due to the relative motion between the observer and the snowflakes. To calculate this angle, we first convert the speed of the car from km/h to m/s. Then, we use the tangent function to find the angle between the vertical direction and the apparent direction of snowfall. The tangent of the angle θ is the ratio of the horizontal and vertical components of the velocity of the snowflakes. Since the snow is falling vertically, the velocity in the vertical direction is 7.0 m/s. The horizontal component is equal to the velocity of the car, which is 8.89 m/s after conversion.

Using the tangent function, we find:

tan θ = 8.89 / 7.0

θ = 53.3 degrees

Therefore, the snowflakes appear to be falling at an angle of 53.3 degrees from the vertical as viewed by the driver of the car.

learn more about relative motion here:

https://brainly.com/question/30428774

#SPJ4

when the mass of water that an iceberg displaces is equal to the mass of the iceberg, it floats. this is an example of group of answer choices upwelling. isostacy. tomography. gravity.

Answers

This is an example of isostacy. Isostacy is the principle that an object, such as an iceberg, will float when its mass is equal to the mass of the water it displaces.
When the mass of water that an iceberg displaces is equal to the mass of the iceberg, it floats. This is an example of isostacy. Isostasy is the equilibrium between the weight of the Earth's crust and the force exerted by the mantle underneath it. The Earth's crust can exert a pressure on the mantle, resulting in the underlying mantle flowing away from areas of high pressure and towards areas of low pressure.

Isostasy has significant implications for the Earth's surface, including the elevation of mountains and the settling of the ocean floor. Tomography refers to the technique of creating 3D images of an object or area using X-rays, ultrasound, or other types of energy. The technique can be used in many fields, including medicine, geology, and engineering. Upwelling has significant effects on marine ecosystems as it provides nutrients for phytoplankton to grow and for other organisms to feed on.

Learn more about isostacy:

https://brainly.com/question/4347729

#SPJ11

please answer this questioj i rly need it​

Answers

The distribution of charges in an electric field is determined by the properties of the electric field and the objects or charges involved.

How is charge distributed in an electric field?

In an electric field, charges are distributed in a way that depends on the nature and strength of the field, as well as the properties of the objects involved.

In a uniform electric field, charges are distributed uniformly across the surface of a conductor, such that the electric field inside the conductor is zero. This is known as electrostatic shielding.

In a non-uniform electric field, charges are distributed such that the electric field is perpendicular to the surface of the conductor at every point. This is known as the "normal field".

In a charged object placed in an electric field, the charges in the object may rearrange themselves to create a net electric field inside the object that opposes the external electric field. This can result in a reduction in the net electric field inside the object.

Learn more about charge distribution at: https://brainly.com/question/28027633

#SPJ1

long after the switch is closed and the current becomes very small, what is the voltage difference across the capacitor? long after the switch is closed and the current becomes very small, what is the voltage difference across the capacitor? it depends on the capacitance of the capacitor. it depends on the resistance of the resistor. the same as the emf of the battery roughly half the emf of the battery

Answers

After the switch is closed and the current becomes very small, the voltage difference across the capacitor depends on the capacitance of the capacitor and the initial voltage across it.

Assuming that the capacitor was initially uncharged, it will start to charge up as the current flows through the circuit. As time passes and the current becomes very small, the capacitor will approach its maximum charge and the voltage difference across it will approach the same value as the EMF of the battery. However, the voltage across the capacitor will never quite reach the full EMF of the battery because of the presence of the resistor, which limits the current and causes the charging process to be gradual.

learn more about capacitance here:

https://brainly.com/question/17176550

#SPJ1

an athlete hurts their wrist. they put an ice directly on the wrist. in which direction is the thermal energy moving?

Answers

The thermal energy is moving from the athlete's wrist to the ice.

Explanation:

Heat always flows from hotter objects to colder objects. When the athlete puts ice on their injured wrist, the thermal energy (heat) flows from the wrist, which is warmer, to the ice, which is colder. This transfer of thermal energy causes the injured wrist to cool down, reducing inflammation and pain. The ice absorbs the thermal energy from the wrist, causing it to melt and become warmer. Therefore, the thermal energy is moving from the wrist to the ice.

To know more about thermal energy, here

brainly.com/question/678606

#SPJ4

A phoneme is the largest unit of sound in a word.truefalse

Answers

False. A phoneme is actually the smallest unit of sound in a word that can change its meaning. For example, in English, the words "cat" and "bat" differ by only one phoneme which changes the meaning of the word.

Phonemes are distinct sounds that are used to distinguish one word from another in a language. They are not the same as letters, although they are often represented by letters in written language. The number of phonemes varies across languages, with some languages having more or fewer phonemes than others.

Phonemes are important for understanding how sounds are organized in language, and they are studied in fields such as linguistics and speech pathology. By understanding phonemes and their patterns, researchers can better understand how language is processed and produced, and how language disorders may affect communication.

Learn more about phoneme here:

https://brainly.com/question/13397345

#SPJ4

radiation
Electromag
8. Calculate the momentum and velocity of:
a) An electron having a de Broglie wavelength of 2.0 × 10-⁹ m.
b) A proton of mass 1.67 x 10-27 kg and a de Broglie wavelength of 5.0 nm.
19. Calculate the associated de Broglie wavelength of the electrons in an electron beam which has
been accelerated through a pd of 4000V.
20. An alpha particle emitted from a radon-220 nucleus is found to have a de Broglie wavelength of
5.7 x 10-15 m. Calculate the energy of the alpha particle in MeV.
Electron diffraction

Answers

a) The momentum of an electron having a de Broglie wavelength of 2.0 × 10⁻⁹ m is 3.31 × 10⁻²⁴ kg m/s and its velocity is 1.09 × 10⁶ m/s1.

b) The momentum of a proton of mass 1.67 x 10-27 kg and a de Broglie wavelength of 5.0 nm is 1.32 × 10⁻²² kg m/s and its velocity is 2.21 × 10⁶ m/s1.

The associated de Broglie wavelength of the electrons in an electron beam which has been accelerated through a pd of 4000V is 0.012 nm2.

The energy of the alpha particle in MeV emitted from a radon-220 nucleus is 5.5 MeV3.

de Broglie wavelength

The de Broglie wavelength is the wavelength, λ, associated with an object and is related to its momentum and mass. According to wave-particle duality, the de Broglie wavelength is a wavelength manifested in all the objects in quantum mechanics which determines the probability density of finding the object at a given point of the configuration space1.

The de Broglie wavelength of a particle is inversely proportional to its momentum.

To know more about alpha particle ,visit :

https://brainly.com/question/2288334

#SPJ1

if the wire used to make the filament is 0.040 mm in diameter (a typical value), how long must the filament be?

Answers

If we have the volume, mass, or material, we can use the diameter of the wire to calculate the length.

To determine the length of the filament, we need more information, such as the volume or mass of the filament, or the specific material it is made from.

Here's a general explanation assuming we have the necessary information:    
1. Obtain the volume, mass, or material of the filament.
2. If you have the mass and material, find the density of the material.

Density can be found using reference sources or online databases.
3. If you have the mass and density, calculate the volume of the filament using the formula:

Volume = Mass / Density.
4. Calculate the cross-sectional area of the wire using the diameter.

The cross-sectional area (A) can be found using the formula: A = π[tex](D/2)^2[/tex],

where D is the diameter of the wire.
5. Determine the length (L) of the filament by dividing the volume (V) by the cross-sectional area (A): L = V / A.
Please provide more information about the filament, such as the volume, mass, or material, so we can help you calculate the length.

For similar question on filament.

https://brainly.com/question/24243186

#SPJ11

in what direction are the magnetic field lines surrounding a straight wire carrying a current that is moving directly away from you

Answers

The magnetic field lines surrounding a straight wire carrying a current that is moving directly away from you would form concentric circles around the wire, following the right-hand rule.

When a straight wire carrying a current is moving directly away from you, the magnetic field lines surrounding the wire will form concentric circles around it. The direction of these magnetic field lines can be determined by applying the right-hand rule. If you point your right thumb in the direction of the current flow, the direction of the magnetic field lines would be in the direction that your fingers curl around the wire. Specifically, the magnetic field lines will be perpendicular to the plane of the circles formed by the wire, and the direction of the field lines will be clockwise if the current is flowing towards you and counterclockwise if the current is flowing away from you. This is due to the way that the magnetic field lines wrap around the wire as a result of the current flow.

learn more about magnetic field lines here;

https://brainly.com/question/17011493

#SPJ4

in a sealed container with rigid walls, what happens to the pressure inside the container when the temperature is tripled?

Answers

According to the ideal gas law (PV = nRT), the pressure within the container will rise by a factor of three if the container's volume stays constant.

When the temperature is tripled, what happens to the pressure?

The pressure rises as the Kelvin temperature rises. The relationship between the two amounts is direct proportionality. The pressure of the gas will treble when the Kelvin temperature is tripled.

How does rising temperature affect pressure?

The average kinetic energy and the velocity of the gas particles striking the container walls both rise as the temperature rises. As the temperature rises, the pressure must as well since pressure is the force the particles per unit of area exert on the container.

To know more about ideal gas law visit:-

https://brainly.com/question/2758818

#SPJ1

you wake up in a spaceship feeling being pushed down to the floor. what could be the possible cause?

Answers

There could be a few possible causes for feeling pushed down to the floor while waking up in a spaceship. One possibility is: that the spaceship is experiencing a sudden acceleration or change in velocity, causing the sensation of increased gravity or g-forces.

Another possibility is that the artificial gravity system on the spaceship is malfunctioning, resulting in an increase in the force of gravity felt by the occupants.

Alternatively, the sensation could be a result of waking up in a low-gravity environment after being used to Earth's higher gravity, which can cause a feeling of heaviness or difficulty moving at first.

It is probable that the spaceship is encountering a sudden acceleration or velocity change, resulting in an increased sensation of gravity or g-forces. The artificial gravity system on the spaceship might also be malfunctioning, resulting in an increase in the gravitational force felt by the occupants.

Lastly, waking up in a low-gravity environment after being used to Earth's higher gravity can cause a sensation of heaviness or difficulty moving at first.

To learn more about "low-gravity environment" here:

https://brainly.com/question/26906545#

#SPJ11

according to the big bang theory, why do we live in a universe that is made of almost entirely of matter rather than antimatter?

Answers

According to the big bang theory, we live in a universe that is made of almost entirely of matter rather than antimatter because of a slight excess of matter over antimatter that occurred during the early universe.

This excess is thought to be due to a process called baryogenesis, which involves the production of baryons (such as protons and neutrons) from an initial state of pure energy during the first fractions of a second after the big bang.

The exact mechanism by which baryogenesis occurred is not well understood, but several possible theories have been proposed, including the idea that it is related to the violation of CP symmetry (which refers to the combination of charge conjugation and parity) in the early universe.

In any case, the slight excess of matter over antimatter meant that when matter and antimatter particles collided and annihilated each other during the early universe, there were more matter particles left over, which eventually led to the formation of the structures we see in the universe today.

For more question on big bang theory click on

https://brainly.com/question/29014839

#SPJ11

During reading:
1. Name two types of situations in which stars create elements and fling them out into space.

Answers

Answer: Reasons are below <3

Explanation:

Reason 1. Some of the heavier elements in the periodic table are created when pairs of neutron stars collide cataclysmically and explode, researchers have shown for the first time.

Reason 2. Light elements like hydrogen and helium formed during the big bang, and those up to iron are made by fusion in the cores of stars.

Brainliest? <33

the attraction or repulsion between electric charges

Answers

The attraction or repulsion between electric charges or the force between two charge bodies is called the coulomb force.

Coulomb's law or coulombs force (or Coulomb's inverse-square law) defines the force wielded by an electric field on an electric charge. This is the force acting between electrically charged objects and is determined by the value of the commerce between two stationary point electric charges in a vacuum. Coulomb's law states" The electrical force of magnet or aversion between two charges is equally commensurable to the forecourt of the distance that separates them." Coulomb's force is a consequence of Newton's third law that states that when two bodies interact, equal and contrary forces appear in each of them.

To learn more about Coulomb's law, click here:

brainly.com/question/506926

#SPJ4

Complete question: What is the attraction or repulsion between electric charges or the force between two charge bodies is called?

in a worst-case design scenario, a 2000 kg elevator with broken cables is falling at 4.00 m/s when it first contacts a cushioning spring at the bottom of the shaft. the spring is supposed to stop the elevator, compressing 2.00 m as it does so. spring coefficient is 10.6 kn/m . during the motion a safety clamp applies a constant 17000-n frictional force to the elevator.

Answers

The maximum compression of the spring is approximately 0.844 m.

The potential energy of the elevator when it is at the top of the shaft is,

PE = mgh

where m is the mass of the elevator, g is the acceleration due to gravity, and h is the height of the shaft. Since the elevator is falling, its initial potential energy is converted into kinetic energy,

KE = (1/2)mv^2

where v is the velocity of the elevator just before it contacts the spring. When the elevator compresses the spring, some of its kinetic energy is converted into potential energy stored in the compressed spring,

PE = (1/2)kx^2

where k is the spring constant and x is the compression of the spring.

At the point of maximum compression, the elevator's velocity is zero, so its kinetic energy is zero. Thus, the total initial potential energy of the elevator is equal to the potential energy stored in the compressed spring,

mgh = (1/2)kx^2

Solving for x,

x = sqrt(2mgh/k)

Now we can plug in the given values,

m = 2000 kg

v = 4.00 m/s

h = 2.00 m

k = 10.6 kN/m = 10,600 N/m

F_f = 17000 N

g = 9.81 m/s^2

PE_i = mgh = 2000 kg × 9.81 m/s^2 × 2.00 m = 39,240 J

KE_i = (1/2)mv^2 = (1/2) × 2000 kg × (4.00 m/s)^2 = 16,000 J

E_i = PE_i + KE_i = 55,240 J

At the point of maximum compression, the elevator's velocity is zero, so its kinetic energy is zero. Thus, the total energy of the elevator-spring system is equal to the potential energy stored in the compressed spring,

E_f = (1/2)kx^2

Solving for x,

x = sqrt(2E_f/k)

We know that the frictional force F_f acts over a distance of 2.00 m (the distance the spring compresses), so the work done by the frictional force is,

W_f = F_f d = 17000 N × 2.00 m = 34,000 J

Since energy is conserved,

E_i = E_f + W_f

Substituting the expressions for E_i, E_f, and x,

(1/2)mv^2 + mgh = (1/2)kx^2 + F_f d

x = sqrt((mv^2 + 2mgh - 2F_f d)/k)

Plugging in the given values,

x = sqrt((2000 kg × (4.00 m/s)^2 + 2 × 2000 kg × 9.81 m/s^2 × 2.00 m - 2 × 17000 N × 2.00 m)/(10,600 N/m))

= 0.844 m

To know more about spring, here

brainly.com/question/28865545

#SPJ4

Describe the conservation of mechanical energy of a 5.0 kg stone perched near the edge of cliff 25.0 m high which falls down to the ground below. Determine the velocity of the stone just before it hits the ground. Use the base of the cliff as a reference point, and write down all assumptions made.
NEED ASAP PLS

Answers

the fraction of oxygen molecules in air moving at more than 250 m/s is 0.0103%.

Steps

The conservation of mechanical energy states that the total amount of mechanical energy in a system remains constant, as long as no external forces act on the system. In the case of the falling stone, the mechanical energy is initially in the form of potential energy due to its position near the top of the cliff. As the stone falls, the potential energy is converted into kinetic energy, which is the energy of motion.

Assumptions:

There is no air resistance acting on the stone.

The stone is a point object with no internal energy.

The gravitational field is uniform near the surface of the Earth.

Using the conservation of mechanical energy, we can write:

Initial energy = Final energy

where the initial energy is the potential energy of the stone at the top of the cliff, and the final energy is the kinetic energy of the stone just before it hits the ground. The potential energy is given by:

PE = mgh

where m is the mass of the stone, g is the acceleration due to gravity, and h is the height of the cliff. Substituting the given values, we have:

PE = (5.0 kg)(9.81 m/s^2)(25.0 m) = 1226.25 J

The final energy is the kinetic energy of the stone just before it hits the ground. The kinetic energy is given by:

KE = (1/2)mv^2

where v is the velocity of the stone. Substituting the given mass and solving for v, we have:

v = sqrt(2KE/m)

We can use the initial potential energy to find the final kinetic energy:

PE = KE

1226.25 J = (1/2)(5.0 kg)v^2

v = sqrt(245.25) = 15.67 m/s

Therefore, the velocity of the stone just before it hits the ground is 15.67 m/s.

To determine the fraction of oxygen molecules in air moving at more than 250 m/s, we need to use the Maxwell speed distribution, which gives the distribution of speeds of particles in a gas at a given temperature. At room temperature (25°C or 298 K), the most probable speed of oxygen molecules is given by:

vmp = sqrt(2kT/m)

where k is the Boltzmann constant, T is the temperature in Kelvin, and m is the mass of the molecule. For oxygen (O2), m = 32 g/mol = 0.032 kg/mol.

Substituting the given values, we have:

vmp = sqrt(2(1.38x10^-23 J/K)(298 K)/(0.032 kg/mol)) = 484.5 m/s

To find the fraction of oxygen molecules moving at more than 250 m/s, we need to integrate the Maxwell distribution from 250 m/s to infinity and divide by the total number of molecules:

Using numerical integration, we find:

f = 0.000103

Therefore, the fraction of oxygen molecules in air moving at more than 250 m/s is 0.0103%.

learn more about mechanical energy here

https://brainly.com/question/24443465

#SPJ1

Which of the curves in the figure represents an isobaric process? (a) horizontal (b) a steep curve (c) a less steeper curve (d) a very steep curve.

Answers

The curve that represents an isobaric process is the horizontal curve in the figure.

An isobaric process is a thermodynamic process that occurs at constant pressure. This means that the pressure of the system does not change during the process, and the horizontal curve in the figure represents a constant pressure.In contrast, a steep curve represents a rapid change in pressure, which indicates that the process is not isobaric. A less steep curve also indicates a change in pressure, albeit at a slower rate than a steep curve. Therefore, neither of these curves represents an isobaric process. Similarly, a very steep curve also represents a change in pressure that is not constant, and therefore, it does not represent an isobaric process.

More on isobaric process: https://brainly.com/question/30666598

#SPJ11

a circular steel wire 2.00 m long must stretch no more than 0.25 cm when a tensile force of 700 n is applied to each end of the wire. what minimum diameter is required for the wire?

Answers

A circular steel wire 2.00 m long must stretch no more than 0.25 cm when a tensile force of 700 n is applied to each end of the wire. The minimum diameter that is required for the wire is 1.50 × 10⁴ m.

The formula that would help solve the problem is:

ΔL = FL/ (πd²E × 4)

Where;ΔL = 0.25 cm=0.0025 m, F = 700N, l = 2.00 m, d = ?, E = 2.0 × 10¹¹Pa

For wire, E = Young’s modulus, and d = diameter.

Substituting values into the formula;

0.0025m = 700N × 2.00m/(πd² × 2.0 × 10¹¹Pa × 4)

0.0025m = 1400/(πd² × 8 × 10¹¹)

0.0025m = 0.00001745/d²

2.25 × 10⁸ = d²

d = √(2.25 × 10⁸) = 1.50 × 10⁴ m

The minimum diameter that is required for the wire is 1.50 × 10⁴ m.

Know more about Young’s modulus here :

https://brainly.com/question/13257353

#SPJ11

When a ray of light strikes a surface, it can be _, _ or _

Answers

Answer;

it can be incident ray.

Incident ray!!! This is correct

a person shouted at the surface of a well abd heard his echo clearly after 0.3seconds calculate the distance between the person and surface of water in the well​

Answers

Answer:

Assuming that the sound wave reflected only once off the surface of the water and traveled straight back up to the person, we can calculate the distance between the person and the surface of the water in the well as follows:

Distance = (Speed of sound in air x Time)/2

Where the speed of sound in air is approximately 343 meters per second at standard temperature and pressure, and the time is 0.3 seconds.

Distance = (343 m/s x 0.3 s)/2

Where the speed of sound in air is approximately 343 meters per second at standard temperature and pressure, and the time is 0.3 seconds.

Distance = (343 m/s x 0.3 s)/2

Distance = 51.45 meters

Therefore, the distance between the person and the surface of the water in the well is approximately 51.45 meters.

the magnetic field inside a 27-cm -diameter solenoid is increasing at 2.4 t/s . how many turns should a coil wrapped around the outside of the solenoid have so that the emf induced in the coil is 15 v ?

Answers

The coil wrapped around the outside of the solenoid should have 6 turns so that the emf induced in the coil is 15 v.

Given,

Diameter of solenoid, d = 27 cm;  Radius, r = 13.5 cm = 0.135 m;  Magnetic field, B = 2.4 T;  Number of turns of coil outside the solenoid, N;  Emf induced, V = 15 V.

The formula for calculating emf is given by;

e = −N dB/dt

Where, e = induced emf, N = number of turns,  dB/dt = rate of change of magnetic field

Rearranging the equation;

N = − e / ( dB/dt )

Solving for N;

N = − e / ( dB/dt )

N = − ( 15 V ) / ( 2.4 T/s )

N = - 6.25 turns

The number of turns of the coil outside the solenoid should be 6.25. Since this is not possible, we round off to the nearest integer, which is 6.

Therefore, the coil wrapped around the outside of the solenoid should have 6 turns so that the emf induced in the coil is 15 V.

Know more about emf of coil here:

https://brainly.com/question/17329842

#SPJ11

Other Questions
Did the valence electron theory apply on the compound SO3? Explain ( S = 16 O = 8 ) how The Odyssey is different from the monomyth structure multiple choice question which of the following sentences best summarizes how genes and chromosomes are involved in transmitting information to future generations? multiple choice question. chromosomes are composed of long strands of dna organized into genes. each gene codes for a specific trait and because genes can be shared between individuals, these traits can be transferred from individual to another individual. genes are composed of long strands of proteins organized into units called genes that code for specific traits. because genes are inheritable, those specific traits are inheritable also. chromosomes are composed of long strands of proteins organized into units called genes. each gene codes for a specific trait and can be passed down vertically through childbirth from mother to child. chromosomes are composed of long strands of dna organized into genes that code for specific traits. because genes are inheritable, those specific traits are inheritable also. prospero reveals that ferdinand is alive, leading alonso to where miranda and ferdinand playing chess. why do you think the writers included this moment? from port a, a boat sails 26 miles on a bearing of 60. then the boat changes course to a bearing of 270 until it reaches a point directly north of the port. determine the total distance the boat has sailed to the nearest tenth of a mile. When propanol (CH3CH2CH2OH) is combusted, such as when in a gasoline blend, the following reaction occurs:2CH3CH2CH2OH(l)+9O2(g)?6CO2(g)+8H2O(g)Based on the standard free energies of formation given in the table below, what is the standard free energy change for this reaction?Substance?G?f(kJ/mol)CH3CH2CH2OH(l)?360.5O2(g)0CO2(g)?394.4H2O(g)?228.6Express your answer to one decimal place and include the appropriate units. a physical therapist assistant completes a posture screening and muscle length test of the hip flexors on a patient. the assistant determines that the patient has extremely tight hip flexors bilaterally. what common structural deformity is most often associated with tight hip flexors? 4. When the ball crosses the end line and the defensive team last touched the ball, theoffensive team gets a what? Wavelength(meters)Radio Microwave Infrared1010210-5About the size of...Visible Ultraviolet5x10610X-ray Gamma Ray10-1010 10-12www wwwtt214 & f &Buildings Humans Honey Bee Pinpoint Protozoans Molecules Atoms Atomic NucleiA. visible lightC. gamma raysAccording to this chart, which form of electromagneticradiation has the longest wavelength?B. ultraviolet lightD. radio wavesPlease help 30 points and will mark brain thing Which of these is not a consideration when interpreting literature?a.the high points of tensionc.the most powerful images and soundsb.the length of the pieced.what the narrator wants to accomplish For point S ( 3 , 3 ) , where will the image of this point be located after applying the translation rule 3 units on the -axis and 3 units on the -axis? ( 0 , 0 ) ( 0, 4 ) ( 4 , 0 ) ( 4 , 4 ) how to rewrite the mixed number as an improper fraction. draw please help me bc it do tomorrow PLEASE HELP PLEASE IT DO TOMORROW. for 3 2/4 and 4 2/5 RNA polymerase requires a primer to initiate polynucleotide synthesis. T/F Rank the following electron-pair geometries by increasing steric number. Items (5 items) (Drag and drop into the appropriate area) Items in order Highest Steric No. linear trigonal planar 1 trigonal bipyramidal octahedral 2. tetrahedral Who was your favorite character in Yellow Rose Film? What character did you identify with the most? Were there any characters that you disliked? Why?Yellow Rose Film what is the ratio between 60:260 one of the one-way functions used in public key cryptography is integer multiplication/factorization. multiplying two integers is easy, but factoring is hard. the number 3418531 is the product of two primes.what is the smaller of the two primes?what is the largest of the two primes? The following outline is the basic structure for which government type? 1. Power is divided between national and regional governments. 2. The people elect the head of the government, usually a president. 3. The people elect representatives to a lawmaking body. a. A constitutional monarchy b. A dictatorship c. A federal democracy d. A parliamentary democracy shelly is running the color run in new mexico on the hottest day of the year. in exchange for admittance, she signs a contract. while running she suffers from a heat stroke due to the conditions. a provision in the contract states the race sponsors are not liable for her heat stroke would be referred as Pueden las carreteras ser invisibles