1. Explain the difference between experiencing disfluencies during a stressful speaking
situation (e.g., a classroom presentation) and stuttering.
2. How is incidence different from prevalence, and why is that difference important in the
case of stuttering?
3. Distinguish between core behaviors and secondary behaviors of stuttering,
4. Why is it important to consider emotions and attitudes in relation to stuttering?
5. What should a speech-language pathologist consider when evaluating a child who is
culturally and linguistically diverse?
6. When preparing for a stuttering assessment, what should a speech-language patholo-
gist include?
7.
Compare
therapy.
and contrast stuttering modification versus fluency shaping approaches to

Answers

Answer 1

Answer:

1. Disfluencies are differences in speaking based on different conditions. They come from stress, nervousness, fatigue, etc. Stuttering is when the person knows what they want to say but cannot find the correct flow of speech to say it.

2. Incidence is the proportions as to when a person develops a condition at a certain time. Prevalence is the proportions as to when the person has a condition in a certain time period. the prevalence of stuttering was around .72% while the incidence was 5 to 8% in children.

3. Core behaviors of stuttering are when the speech itself is being affected like the repetition of certain names and syllables. Secondary behaviors are the movements in the body that can be observed.

4.


Related Questions

When the valve between the right atrium and right
ventricle has an abnormal narrowing, this is known as

Answers

Pulmonary valve stenosis is a narrowing of the valve located between the lower right heart chamber (right ventricle) and the lung arteries (pulmonary arteries).

What antibiotics could cause discoloration of teeth in young children

Answers

Answer:

Amoxicillin

Explanation:

it is a common culprit of tooth discoloration. A single dose could cause a child's teeth to turn orange or yellow.

Tetracycline antibiotics
Other Questions
when an allocation of resources maximizes total surplus, the result is said to be efficient. Which is NOT considered an organism?fungivirusbacteriaGerman Sheppard which body system is responsible for producing the hormone adrenaline? According to which virtue do you need to secure information by limiting computer access to authorized personnel only? 1) What was the Yazoo Land Act? 2) Why did the Act become a Scandal? 3) Why were the legislators in the picture burning the law after it had already been repealed? 4) What did that message send to the public? which continent is not located in the eastern hemisphere?A)frica B) AsiaC)South American D) Europe Whats 20/10 simplified?? Cu 1. Trong dao ng iu ho, pht biu no sau y l khng ng ?A.C sau mt khong thi gian T (chu k) th vt li tr v v tr ban u.B.C sau mt khong thi gian T th vn tc ca vt li tr v gi tr ban u.C.C sau mt khong thi gian T th gia tc ca vt li tr v gi tr ban u.C sau mt khong thi gian T th bin ca vt li tr v gi tr ban u which republicans voted to hold bannon in contempt why did the colonists at plymouth believe that representative government would be the best way to protect their religious freedomAUGHHWJE I SWEAR IM GOING TO FAIL SOCIAL STUDIES ITS ONLY THE FIRST QUARTER TOO An airplane flies with a velocity of 750. kilometersper hour, 30.0 south of east. What is themagnitude of the eastward component of theplane's velocity?A. 866 km/hB. 650. km/hD. 375 km/hC. 433 km/h Need help please i have been having trouble May someone help? Will give brainliest and 100 points. Just answer with the letter? NO LINKS PLEASE Based on their composition and structure, list CH3COCH3CH3COCH3, CH3CH(CH3)CH3CH3CH(CH3)CH3, and CH3COOHCH3COOH in order of decreasing intermolecular forces. What factors are causing Indias population to increase while many other nations are below replacement levels? Which answer choice is it?A 3dB 4pC 4dD 4f 5. I do not care to talk to you although/ Your speech evokes a thousand sympathies Which type of figurative language is being used and how do you know6. The sun was shining on the sea, / Shining with all his might: Which type of figurative language is being used and how do you know what river was used as the center activity during slavery solution needed step by step M